IL61376A - Trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine derivatives and pharmaceutical compositions containing them - Google Patents
Trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine derivatives and pharmaceutical compositions containing themInfo
- Publication number
- IL61376A IL61376A IL61376A IL6137680A IL61376A IL 61376 A IL61376 A IL 61376A IL 61376 A IL61376 A IL 61376A IL 6137680 A IL6137680 A IL 6137680A IL 61376 A IL61376 A IL 61376A
- Authority
- IL
- Israel
- Prior art keywords
- tetrahydro
- trans
- phenyl
- pharmaceutical compositions
- compositions containing
- Prior art date
Links
- IWNWWVPLTTUPBQ-XJKSGUPXSA-N (1r,4s)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Chemical class C1([C@@H]2CC[C@H](C3=CC=CC=C32)N)=CC=CC=C1 IWNWWVPLTTUPBQ-XJKSGUPXSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
- C07C209/16—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups with formation of amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/21—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/30—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system formed by two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/687—Unsaturated compounds containing a keto groups being part of a ring containing halogen
- C07C49/697—Unsaturated compounds containing a keto groups being part of a ring containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
- C07C49/755—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups a keto group being part of a condensed ring system with two or three rings, at least one ring being a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
- C07C57/60—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings having unsaturation outside the rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9023779A | 1979-11-01 | 1979-11-01 | |
| US06/184,447 US4556676A (en) | 1979-11-01 | 1980-09-05 | Antidepressant derivatives of trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL61376A0 IL61376A0 (en) | 1980-12-31 |
| IL61376A true IL61376A (en) | 1983-10-31 |
Family
ID=26782055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL61376A IL61376A (en) | 1979-11-01 | 1980-10-30 | Trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine derivatives and pharmaceutical compositions containing them |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4556676A (no) |
| EP (1) | EP0028901B1 (no) |
| KR (1) | KR840002021B1 (no) |
| AR (2) | AR225196A1 (no) |
| AT (1) | ATE2667T1 (no) |
| AU (1) | AU517842B2 (no) |
| CA (1) | CA1130816A (no) |
| DE (1) | DE3062226D1 (no) |
| DK (1) | DK149308C (no) |
| ES (2) | ES8201948A1 (no) |
| FI (1) | FI68807C (no) |
| GR (1) | GR70782B (no) |
| IE (1) | IE50396B1 (no) |
| IL (1) | IL61376A (no) |
| NO (1) | NO149102C (no) |
| PH (1) | PH15468A (no) |
| PT (1) | PT72005B (no) |
| YU (2) | YU41744B (no) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8004002L (sv) * | 1980-05-29 | 1981-11-30 | Arvidsson Folke Lars Erik | Terapeutiskt anvendbara tetralinderivat |
| US4866208A (en) * | 1981-12-21 | 1989-09-12 | The Dow Chemical Company | Meta-phenylene diamine derivatives |
| US4839104A (en) * | 1987-06-11 | 1989-06-13 | Pfizer, Inc. | Process for preparing sertraline intermediates |
| US4777288A (en) * | 1987-06-11 | 1988-10-11 | Pfizer Inc. | Process for preparing a 4,4-diphenylbutanoic acid derivative |
| FR2623802B1 (fr) * | 1987-11-26 | 1990-05-04 | Lucien Laboratoires | Derives d'amino-4 trifluoromethyl-1 tetralines. leur preparation et leur application en therapeutique |
| FR2642065B1 (fr) * | 1989-01-24 | 1991-05-24 | Lipha | Derives d'acides benzocycloalcenyl dihydroxy alcanoiques, procede de preparation et medicaments les contenant |
| FR2665443B1 (fr) * | 1990-08-03 | 1992-11-06 | Lucien Laboratoires | Derives d'amino-4-methyl-1-tetralines, leur preparation et leur application en therapeutique. |
| US5082970A (en) * | 1991-03-06 | 1992-01-21 | Pfizer Inc. | Process for recycling amine isomer |
| GB9114948D0 (en) * | 1991-07-11 | 1991-08-28 | Pfizer Ltd | Process for preparing sertraline intermediates |
| US5196607A (en) * | 1992-02-14 | 1993-03-23 | Pfizer Inc. | Process for preparing ketone enantiomer |
| US5248699A (en) * | 1992-08-13 | 1993-09-28 | Pfizer Inc. | Sertraline polymorph |
| US5466880A (en) * | 1992-09-15 | 1995-11-14 | Pfizer Inc. | Process for preparing ketone enantiomer |
| WO1994022495A1 (en) * | 1993-03-31 | 1994-10-13 | The Trustees Of The University Of Pennsylvania | Dopamine d-3 and serotonin (5-ht1a) receptor ligands and imaging agents |
| EP0724552B1 (en) * | 1993-11-30 | 1997-10-29 | Pfizer Inc. | Process for preparing a chiral tetralone |
| US6410794B1 (en) | 1994-12-16 | 2002-06-25 | Uop Llc | Process for preparation of pharmaceutically desired chiral tetralone from tetralones |
| US6455736B1 (en) | 1994-12-16 | 2002-09-24 | Uop Llc | Process for preparation of pharmaceutically desired sertraline and sertraline analogs |
| HU222341B1 (hu) * | 1996-12-18 | 2003-06-28 | Richter Gedeon Vegyészeti Gyár Rt. | Eljárás sertralin előállítására és az eljárásban alkalmazott intermedier |
| IN182588B (no) | 1998-05-12 | 1999-05-08 | Sun Pharmaceutical Ind Ltd | |
| IN187170B (no) | 2000-01-04 | 2002-02-23 | Sun Pharmaceutical Ind Ltd | |
| DE10006411C2 (de) * | 2000-02-14 | 2002-03-07 | Huf Huelsbeck & Fuerst Gmbh | Elektronischer Zündanlaßschalter für Kraftfahrzeuge und Reserveschlüssel zur Betätigung desselben |
| DE10041478A1 (de) | 2000-08-24 | 2002-03-14 | Sanol Arznei Schwarz Gmbh | Neue pharmazeutische Zusammensetzung |
| US6482440B2 (en) | 2000-09-21 | 2002-11-19 | Phase 2 Discovery, Inc. | Long acting antidepressant microparticles |
| US6723878B2 (en) | 2001-06-15 | 2004-04-20 | Orion Corporation Fermion | Method for preparing sertraline |
| US8134029B2 (en) | 2002-09-16 | 2012-03-13 | Sunovion Pharmaceuticals Inc. | Treatment of CNS disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine |
| JP4610336B2 (ja) * | 2002-09-16 | 2011-01-12 | セプラコール インク． | トランス４−（３，４−ジクロロフェニル）−１，２，３，４−テトラヒドロ−１−ナフタレンアミン及びそのホルムアミドによる中枢神経系障害の治療 |
| EP1545485A2 (en) * | 2002-09-16 | 2005-06-29 | Sepracor Inc. | Treatment of cns disorders with trans-4- (3,4-dichlorophenyl)-1,2,3,4-tetrahydro-n-methyl-1-napthalenamine |
| DE10334188B4 (de) * | 2003-07-26 | 2007-07-05 | Schwarz Pharma Ag | Verwendung von Rotigotin zur Behandlung von Depressionen |
| DE10334187A1 (de) * | 2003-07-26 | 2005-03-03 | Schwarz Pharma Ag | Substituierte 2-Aminotetraline zur Behandlung von Depressionen |
| US20060014838A1 (en) * | 2004-07-14 | 2006-01-19 | Sudhakar Valluri | Process for converting trans-sertraline to cis-sertraline |
| US20080293726A1 (en) | 2005-07-06 | 2008-11-27 | Sepracor Inc. | Combinations of Eszopiclone and Trans 4-(3,4-Dichlorophenyl)-1,2,3,4-Tetrahydro-N-Methyl-1-Napthalenamine or Trans 4-(3,4-Dichlorophenyl)-1,2,3,4-Tetrahydro-1-Napthalenamine, and Methods of Treatment of Menopause and Mood, Anxiety, and Cognitive Disorders |
| CN103588659A (zh) | 2006-03-31 | 2014-02-19 | 赛诺维信制药公司 | 手性酰胺和胺的制备 |
| EP2043745A2 (en) * | 2006-05-31 | 2009-04-08 | SEPRACOR Inc | Treatment of pain disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine and its formamide |
| WO2007146796A2 (en) * | 2006-06-13 | 2007-12-21 | Ramot At Tel-Aviv University Ltd. | Antiproliferative compounds, compositions and methods of use |
| EP1987815A1 (en) * | 2007-05-04 | 2008-11-05 | Schwarz Pharma Ag | Oronasopharyngeally deliverable pharmaceutical compositions of dopamine agonists for the prevention and/or treatment of restless limb disorders |
| US20100081713A1 (en) * | 2008-03-19 | 2010-04-01 | CombinatoRx, (Singapore) Pte. Ltd. | Compositions and methods for treating viral infections |
| KR20170005088A (ko) * | 2014-05-13 | 2017-01-11 | 선오비온 파마슈티컬스 인코포레이티드 | Adhd의 치료를 위한 방법 및 다소트랄린의 투약량 |
| WO2015175514A1 (en) * | 2014-05-13 | 2015-11-19 | Sunovion Pharmaceuticals Inc. | Methods and compositions of dasotraline for treatment of adhd |
| WO2016046669A2 (en) * | 2014-09-27 | 2016-03-31 | Mohan M Alapati | Compositions and methods for the treatment of depression and neurological diseases |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB793853A (en) * | 1954-09-15 | 1958-04-23 | Schering Ag | Manufacture of new 3-amino-indanes |
| DE1098511B (de) * | 1959-11-21 | 1961-02-02 | Schering Ag | Verfahren zur Abtrennung von analgetisch wirksamen d-1-Phenyl-3-dimethylaminoindan |
| US3704323A (en) * | 1969-12-23 | 1972-11-28 | Squibb & Sons Inc | Indane derivatives |
| GB1420472A (en) * | 1972-09-27 | 1976-01-07 | Pfizer | Aminophenyltetralin compounds |
| US4029731A (en) * | 1974-11-06 | 1977-06-14 | Pfizer Inc. | Aminophenyltetralin compounds |
| US4045488A (en) * | 1974-11-06 | 1977-08-30 | Pfizer Inc. | Aminophenyltetralin compounds |
-
1980
- 1980-09-05 US US06/184,447 patent/US4556676A/en not_active Expired - Lifetime
- 1980-10-28 AT AT80303810T patent/ATE2667T1/de not_active IP Right Cessation
- 1980-10-28 EP EP80303810A patent/EP0028901B1/en not_active Expired
- 1980-10-28 DE DE8080303810T patent/DE3062226D1/de not_active Expired
- 1980-10-29 PH PH24786A patent/PH15468A/en unknown
- 1980-10-30 GR GR63248A patent/GR70782B/el unknown
- 1980-10-30 YU YU2774/80A patent/YU41744B/xx unknown
- 1980-10-30 CA CA363,571A patent/CA1130816A/en not_active Expired
- 1980-10-30 FI FI803399A patent/FI68807C/fi not_active IP Right Cessation
- 1980-10-30 IL IL61376A patent/IL61376A/xx unknown
- 1980-10-30 AR AR283061A patent/AR225196A1/es active
- 1980-10-31 ES ES496441A patent/ES8201948A1/es not_active Expired
- 1980-10-31 IE IE2260/80A patent/IE50396B1/en not_active IP Right Cessation
- 1980-10-31 DK DK462480A patent/DK149308C/da not_active IP Right Cessation
- 1980-10-31 KR KR1019800004175A patent/KR840002021B1/ko active
- 1980-10-31 NO NO803259A patent/NO149102C/no unknown
- 1980-10-31 PT PT72005A patent/PT72005B/pt unknown
- 1980-10-31 AU AU63898/80A patent/AU517842B2/en not_active Expired
-
1981
- 1981-10-06 AR AR286998A patent/AR229106A1/es active
- 1981-11-05 ES ES506893A patent/ES8207120A1/es not_active Expired
-
1983
- 1983-01-07 YU YU33/83A patent/YU42066B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES496441A0 (es) | 1982-01-16 |
| IE802260L (en) | 1981-05-01 |
| US4556676A (en) | 1985-12-03 |
| CA1130816A (en) | 1982-08-31 |
| YU41744B (en) | 1987-12-31 |
| EP0028901A1 (en) | 1981-05-20 |
| AR229106A1 (es) | 1983-06-15 |
| AR225196A1 (es) | 1982-02-26 |
| ES8201948A1 (es) | 1982-01-16 |
| NO149102C (no) | 1984-02-15 |
| FI68807B (fi) | 1985-07-31 |
| EP0028901B1 (en) | 1983-03-02 |
| AU517842B2 (en) | 1981-08-27 |
| DK462480A (da) | 1981-05-02 |
| NO803259L (no) | 1981-05-04 |
| PH15468A (en) | 1983-01-24 |
| GR70782B (no) | 1983-03-23 |
| KR830004201A (ko) | 1983-07-06 |
| PT72005B (en) | 1981-08-31 |
| KR840002021B1 (ko) | 1984-11-05 |
| IE50396B1 (en) | 1986-04-16 |
| ATE2667T1 (de) | 1983-03-15 |
| IL61376A0 (en) | 1980-12-31 |
| NO149102B (no) | 1983-11-07 |
| DK149308C (da) | 1986-12-08 |
| ES506893A0 (es) | 1982-09-01 |
| PT72005A (en) | 1980-11-01 |
| ES8207120A1 (es) | 1982-09-01 |
| YU42066B (en) | 1988-04-30 |
| DK149308B (da) | 1986-04-28 |
| YU3383A (en) | 1983-09-30 |
| FI803399L (fi) | 1981-05-02 |
| AU6389880A (en) | 1981-05-07 |
| FI68807C (fi) | 1985-11-11 |
| YU277480A (en) | 1983-09-30 |
| DE3062226D1 (en) | 1983-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL61376A0 (en) | Trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine derivatives and pharmaceutical compositions containing them | |
| IL57020A (en) | Carbazolyl-(4)-oxypropanolamine derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same | |
| PH16519A (en) | 1,2,3,4-tetrahydro-2-amino-5-oxy-naphthalene derivatives and their pharmaceutical compositions | |
| IL56206A0 (en) | New 1,2-benzothiazine-1,1-doxide derivatives, their preparation and pharmaceutical compositions containing them | |
| IL58123A0 (en) | 4,5-diaryl-2-nitroimidazoles their preparation and pharmaceutical compositions containing them | |
| IL60201A0 (en) | 1,2,4-triazine derivatives,their preparation and pharmaceutical compositions containing them | |
| NZ190299A (en) | 1,2,4-trizole -3,5- diamines and pharmaceutical compositions | |
| NZ190745A (en) | Mercapto-substituted -2,3,4,5-tetrahydro-1h-3-benzazepines and pharmaceutical compositions | |
| PH15886A (en) | 3-aminopropoxy derivatives,pharmaceutical compositions containing them and their use | |
| DE3064582D1 (en) | 5,6,7-trinor-4,8-inter-m-phenylene pgi2 derivatives and pharmaceutical compositions containing them | |
| IL56076A (en) | 2 alpha-cyano-4 alpha,5 alpha-epoxyandrostanes,their preparation and pharmaceutical compositions containing them | |
| GB2046259B (en) | Amino-alcohol derivatives and pharmaceutical compositions containing them | |
| DE3069074D1 (en) | 6-alpha-9-alpha-difluoro-16-beta-methyl-prednisolone-17,21 diesters and pharmaceutical compositions containing them | |
| IL51309A0 (en) | New 1,2-benzisothiazolin-3-ones,their preparation and pharmaceutical compositions containing them | |
| IL58526A (en) | 24,24-difluoro-1alpha,25-dihydroxycholecalciferol and pharmaceutical compositions containing it | |
| IL49422A0 (en) | 1-(3,3,3-triarylpropyl)-4-phenyl-4-piperidinemethanols,their preparation and pharmaceutical compositions containing them | |
| DE3067564D1 (en) | 1,2,4-triazole derivatives, processes for the preparation thereof and pharmaceutical compositions containing them | |
| IL52717A (en) | Derivatives of2-phenylamino-imidazoline-(2),their preparation and pharmaceutical compositions containing them | |
| IL56808A0 (en) | 1-oxo-1h-pyrimido(6,1)benztheazole derivatives,process forthe preparation thereof and pharmaceutical compositions containing the same | |
| IL61603A0 (en) | 2,3-indoledione derivatives their manufacture and pharmalceutical compositions containing them | |
| IL60376A0 (en) | 3-methyleneazetidine derivatives and pharmaceutical compositions containing them | |
| IL54358A (en) | 1-substituted-3-amino-6,7-dialkoxy-1h-1,2,4-benzothiadiazine-1-oxides,their preparation and pharmaceutical compositions containing them | |
| IL56856A0 (en) | 4,5-diaryl-pyrrole derivatives,ther preparation and pharmaceutical compositions containing them | |
| NZ185539A (en) | Cis-4a-aryl-2-substituted-2,3,4,4a,5,6,7,7a-octa hydro-1h-2-pyrindines and pharmaceutical compositions | |
| NZ184185A (en) | 3,5,5-trimethylhexanoyl-ferrocene and pharmaceutical compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| KB | Patent renewed |