IL43647A - Production of n-chloroformyl-carbonic acid amides and certain such novel amides - Google Patents
Production of n-chloroformyl-carbonic acid amides and certain such novel amidesInfo
- Publication number
- IL43647A IL43647A IL43647A IL4364773A IL43647A IL 43647 A IL43647 A IL 43647A IL 43647 A IL43647 A IL 43647A IL 4364773 A IL4364773 A IL 4364773A IL 43647 A IL43647 A IL 43647A
- Authority
- IL
- Israel
- Prior art keywords
- carbon atoms
- radical
- alkyl
- phenyl
- chloroformyl
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 150000001408 amides Chemical class 0.000 title description 3
- 238000000034 method Methods 0.000 claims description 30
- -1 aromatic radical Chemical class 0.000 claims description 29
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 14
- 150000003254 radicals Chemical class 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 239000000470 constituent Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000005864 Sulphur Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000004702 methyl esters Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 6
- 125000001624 naphthyl group Chemical group 0.000 claims 5
- 125000003342 alkenyl group Chemical group 0.000 claims 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 3
- HIKMLKJXXYSSSX-UHFFFAOYSA-N carbonochloridoylcarbamic acid Chemical compound OC(=O)NC(Cl)=O HIKMLKJXXYSSSX-UHFFFAOYSA-N 0.000 claims 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 2
- 125000005724 cycloalkenylene group Chemical group 0.000 claims 2
- GAWCRULEMQFHTI-UHFFFAOYSA-N 4-chlorophenylisocyanic acid Natural products OC(=O)NC1=CC=C(Cl)C=C1 GAWCRULEMQFHTI-UHFFFAOYSA-N 0.000 claims 1
- QSAZNFKHPKECDU-UHFFFAOYSA-N C(N)(=O)Cl.C(O)(O)=O Chemical compound C(N)(=O)Cl.C(O)(O)=O QSAZNFKHPKECDU-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 125000004450 alkenylene group Chemical group 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims 1
- 125000005110 aryl thio group Chemical group 0.000 claims 1
- 125000004104 aryloxy group Chemical group 0.000 claims 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical group CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 claims 1
- BUCFBDOGGUMCDT-UHFFFAOYSA-N carbonochloridoyl(phenyl)carbamic acid Chemical compound OC(=O)N(C(Cl)=O)C1=CC=CC=C1 BUCFBDOGGUMCDT-UHFFFAOYSA-N 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 150000008282 halocarbons Chemical class 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- STRLTPKWHYQXAU-UHFFFAOYSA-N methyl n-carbonochloridoyl-n-ethenylcarbamate Chemical compound COC(=O)N(C=C)C(Cl)=O STRLTPKWHYQXAU-UHFFFAOYSA-N 0.000 claims 1
- 125000004957 naphthylene group Chemical group 0.000 claims 1
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 claims 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims 1
- 150000003573 thiols Chemical class 0.000 claims 1
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 1
- ONNDGYXYNGPSJT-UHFFFAOYSA-N 2,2-diethyl-1,4-dioxane Chemical compound CCC1(CC)COCCO1 ONNDGYXYNGPSJT-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- RYTLGWCJESCDMY-UHFFFAOYSA-N carbamimidoyl chloride Chemical compound NC(Cl)=N RYTLGWCJESCDMY-UHFFFAOYSA-N 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/58—Y being a hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2257344A DE2257344C2 (de) | 1972-11-22 | 1972-11-22 | Verfahren zur Herstellung von N-Chlorformyl-kohlensäureamiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL43647A0 IL43647A0 (en) | 1974-03-14 |
| IL43647A true IL43647A (en) | 1977-03-31 |
Family
ID=5862475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL43647A IL43647A (en) | 1972-11-22 | 1973-11-19 | Production of n-chloroformyl-carbonic acid amides and certain such novel amides |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3950367A (it) |
| JP (4) | JPS5750779B2 (it) |
| BE (1) | BE807595A (it) |
| BR (1) | BR7309124D0 (it) |
| CH (1) | CH605695A5 (it) |
| DE (1) | DE2257344C2 (it) |
| DK (1) | DK142078C (it) |
| FR (1) | FR2207910B1 (it) |
| GB (1) | GB1415428A (it) |
| IE (1) | IE38531B1 (it) |
| IL (1) | IL43647A (it) |
| IT (1) | IT1001811B (it) |
| LU (1) | LU68837A1 (it) |
| NL (1) | NL7315837A (it) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3106724A1 (de) | 1981-02-24 | 1982-09-09 | Bayer Ag, 5090 Leverkusen | "verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4 (1h, 3h)-dionen" |
| DE3414881A1 (de) * | 1984-04-19 | 1985-10-24 | Bayer Ag, 5090 Leverkusen | Allophanat-derivate |
| JPS6421484U (it) * | 1987-07-28 | 1989-02-02 | ||
| JP3882195B2 (ja) * | 1994-04-20 | 2007-02-14 | イー・アイ・デユポン・ドウ・ヌムール・アンド・カンパニー | 関節ポリシダルオキサジアジンの製造 |
| CN101007763B (zh) | 1994-04-20 | 2012-10-10 | 纳幕尔杜邦公司 | 用于制备噁二嗪的中间体 |
| WO2000043377A1 (en) * | 1999-01-25 | 2000-07-27 | E. I. Du Pont De Nemours And Company | Herbicidal oxadiazolidines |
| US6737383B1 (en) | 1999-01-25 | 2004-05-18 | The Regents Of The University Of California | Herbicidal oxadiazolidines |
| US20040063581A1 (en) * | 2001-06-29 | 2004-04-01 | The Regents Of The University Of California | Herbicidal oxadiazolidines |
| WO2014190200A1 (en) | 2013-05-22 | 2014-11-27 | Carefusion 303, Inc. | Medication workflow management |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2028280A1 (it) * | 1969-01-14 | 1970-10-09 | Basf Ag | |
| US3671499A (en) * | 1970-07-09 | 1972-06-20 | Union Carbide Corp | Lactam polymerization with allophanoyl halide initiators |
| DE2042497C3 (de) * | 1970-08-27 | 1980-01-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von N-(l-Alkenyl)-carbamoyrverbindungen |
| DE2054660C3 (de) * | 1970-11-06 | 1980-08-21 | Basf Ag, 6700 Ludwigshafen | N-Methyl-N- a -methoxyvinylcarbamidsäurechlorid sowie ein Verfahren zur Herstellung von N-( 1-Alken-IyI)carbamidsäurechloriden |
| DE2115096A1 (de) * | 1971-03-29 | 1972-10-05 | Basf Ag | Substituierte Chlorcarbonylharnstoffe |
-
1972
- 1972-11-22 DE DE2257344A patent/DE2257344C2/de not_active Expired
-
1973
- 1973-11-16 US US05/416,569 patent/US3950367A/en not_active Expired - Lifetime
- 1973-11-16 IT IT31445/73A patent/IT1001811B/it active
- 1973-11-19 IL IL43647A patent/IL43647A/en unknown
- 1973-11-19 NL NL7315837A patent/NL7315837A/xx not_active Application Discontinuation
- 1973-11-20 CH CH1628073A patent/CH605695A5/xx not_active IP Right Cessation
- 1973-11-20 LU LU68837A patent/LU68837A1/xx unknown
- 1973-11-21 BR BR9124/73A patent/BR7309124D0/pt unknown
- 1973-11-21 BE BE137986A patent/BE807595A/xx not_active IP Right Cessation
- 1973-11-21 GB GB5403273A patent/GB1415428A/en not_active Expired
- 1973-11-21 DK DK628973A patent/DK142078C/da active
- 1973-11-21 IE IE2108/73A patent/IE38531B1/xx unknown
- 1973-11-22 JP JP48130849A patent/JPS5750779B2/ja not_active Expired
- 1973-11-22 FR FR7341602A patent/FR2207910B1/fr not_active Expired
-
1981
- 1981-11-25 JP JP56187922A patent/JPS596296B2/ja not_active Expired
- 1981-11-25 JP JP56187920A patent/JPS594422B2/ja not_active Expired
- 1981-11-25 JP JP56187921A patent/JPS5917106B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL43647A0 (en) | 1974-03-14 |
| JPS57114562A (en) | 1982-07-16 |
| CH605695A5 (it) | 1978-10-13 |
| DE2257344A1 (de) | 1974-05-30 |
| DE2257344C2 (de) | 1982-04-22 |
| DK142078C (da) | 1981-01-19 |
| IE38531L (en) | 1974-05-22 |
| NL7315837A (it) | 1974-05-27 |
| US3950367A (en) | 1976-04-13 |
| BR7309124D0 (pt) | 1974-08-29 |
| JPS5917106B2 (ja) | 1984-04-19 |
| JPS4981321A (it) | 1974-08-06 |
| LU68837A1 (it) | 1974-01-28 |
| JPS57118548A (en) | 1982-07-23 |
| IE38531B1 (en) | 1978-03-29 |
| JPS594422B2 (ja) | 1984-01-30 |
| BE807595A (fr) | 1974-05-21 |
| FR2207910A1 (it) | 1974-06-21 |
| GB1415428A (en) | 1975-11-26 |
| JPS5750779B2 (it) | 1982-10-28 |
| JPS596296B2 (ja) | 1984-02-10 |
| IT1001811B (it) | 1976-04-30 |
| FR2207910B1 (it) | 1977-08-12 |
| JPS57118550A (en) | 1982-07-23 |
| DK142078B (da) | 1980-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5023346A (en) | Process for the production of cyclic carbonic acid esters | |
| ES8601110A1 (es) | Procedimiento para preparar isocianatos de terc-aralquilo | |
| IL43647A (en) | Production of n-chloroformyl-carbonic acid amides and certain such novel amides | |
| US3162644A (en) | Nu-alkyl-2-benzoxazolyl urea compounds | |
| US3627813A (en) | A process of preparing carbamates | |
| US4096334A (en) | Process for the manufacture of carbodiimides | |
| Sakai et al. | A new type of iminocarbonylaton of diols, mercaptoalkanol, and dithiol via their dibutylstannyl derivatives. | |
| US2959611A (en) | Fluoroalkyl chlorocarbonates and carbamates | |
| US3477933A (en) | Process for preparing n-monosubstituted carbamic acid esters | |
| US3404171A (en) | Preparation of alkyl isothiocyanates | |
| US3100790A (en) | Isocyanoaryl esters of phosphonic, phosphinic, thiophosphonic, and thiophosphinic acids | |
| White et al. | Synthesis of 1, 3-dialkyldiazetidinediones from N, N'-dialkylaminocarbonylcarbamic chlorides (2, 4-dialkylallophanoyl chlorides) | |
| US3468934A (en) | Acyloxyalkylamine hydrochlorides | |
| US3154561A (en) | Organic sulfide derivatives of decaborane | |
| US3794620A (en) | Preparation of aromatic carbonyl hydroxamoyl chlorides | |
| US3544583A (en) | Cycloaliphatic mono (nitrile sulfites) | |
| US3370078A (en) | Process for preparing isocyanates | |
| GB1069308A (en) | A process for producing trithiones | |
| US3404170A (en) | Preparation of isocyanates | |
| US3423449A (en) | Process for preparing aliphatic polyisocyanates | |
| US4001318A (en) | Preparation of n-chloroformyl-carbamic acid amides and esters | |
| US4661626A (en) | Process for the production of 2-isocyanato-2,3-dehydrocarboxylic acid esters | |
| US2898363A (en) | Isocyanato-mustard oils | |
| US3449396A (en) | Preparation of n-(2-chloroalkyl)sulfinylamines | |
| US4455260A (en) | Preparation of alk-1-enyl isocyanates |