IL38962A - 2-(5-nitro-2-furyl)-5-beta-aminoethoxy pyrimidine derivatives - Google Patents
2-(5-nitro-2-furyl)-5-beta-aminoethoxy pyrimidine derivativesInfo
- Publication number
- IL38962A IL38962A IL38962A IL3896272A IL38962A IL 38962 A IL38962 A IL 38962A IL 38962 A IL38962 A IL 38962A IL 3896272 A IL3896272 A IL 3896272A IL 38962 A IL38962 A IL 38962A
- Authority
- IL
- Israel
- Prior art keywords
- aminoethoxy
- furyl
- nitro
- beta
- pyrimidine derivatives
- Prior art date
Links
- JALZUZBDKJIKPH-UHFFFAOYSA-N 2-[2-(5-nitrofuran-2-yl)pyrimidin-5-yl]oxyethanamine Chemical class N1=CC(OCCN)=CN=C1C1=CC=C([N+]([O-])=O)O1 JALZUZBDKJIKPH-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2113529A DE2113529C3 (de) | 1971-03-17 | 1971-03-17 | 2-(5-Nitro-2-furyl)-5-(2-alkylaminoäthoxy)-pyrimidin-Verbindungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL38962A0 IL38962A0 (en) | 1972-05-30 |
| IL38962A true IL38962A (en) | 1975-10-15 |
Family
ID=5802207
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL38962A IL38962A (en) | 1971-03-17 | 1972-03-12 | 2-(5-nitro-2-furyl)-5-beta-aminoethoxy pyrimidine derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3846428A (enExample) |
| AT (1) | AT312589B (enExample) |
| AU (1) | AU463550B2 (enExample) |
| BE (1) | BE780879A (enExample) |
| CA (1) | CA945557A (enExample) |
| CH (1) | CH575943A5 (enExample) |
| DD (1) | DD96950A5 (enExample) |
| DE (1) | DE2113529C3 (enExample) |
| DK (1) | DK126999B (enExample) |
| ES (1) | ES400560A1 (enExample) |
| FR (1) | FR2130327B1 (enExample) |
| GB (1) | GB1391933A (enExample) |
| HU (1) | HU163178B (enExample) |
| IL (1) | IL38962A (enExample) |
| NL (1) | NL7203650A (enExample) |
| PL (1) | PL83278B1 (enExample) |
| SU (1) | SU458130A3 (enExample) |
| ZA (1) | ZA721689B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1937629C3 (de) * | 1969-07-19 | 1979-07-26 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Nitrofuryl-aminoalkoxy-pyriinidine |
-
1971
- 1971-03-17 DE DE2113529A patent/DE2113529C3/de not_active Expired
-
1972
- 1972-02-29 DK DK93172AA patent/DK126999B/da unknown
- 1972-03-02 SU SU1754975A patent/SU458130A3/ru active
- 1972-03-08 AU AU39769/72A patent/AU463550B2/en not_active Expired
- 1972-03-08 ES ES400560A patent/ES400560A1/es not_active Expired
- 1972-03-12 IL IL38962A patent/IL38962A/xx unknown
- 1972-03-13 GB GB1152872A patent/GB1391933A/en not_active Expired
- 1972-03-13 ZA ZA721689A patent/ZA721689B/xx unknown
- 1972-03-15 PL PL1972154083A patent/PL83278B1/pl unknown
- 1972-03-15 DD DD161547A patent/DD96950A5/xx unknown
- 1972-03-16 US US00235426A patent/US3846428A/en not_active Expired - Lifetime
- 1972-03-16 HU HUSC379A patent/HU163178B/hu unknown
- 1972-03-16 FR FR7209187A patent/FR2130327B1/fr not_active Expired
- 1972-03-16 CH CH385372A patent/CH575943A5/xx not_active IP Right Cessation
- 1972-03-17 BE BE780879A patent/BE780879A/xx unknown
- 1972-03-17 CA CA137,369A patent/CA945557A/en not_active Expired
- 1972-03-17 NL NL7203650A patent/NL7203650A/xx unknown
- 1972-03-17 AT AT230072A patent/AT312589B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1391933A (en) | 1975-04-23 |
| ES400560A1 (es) | 1975-02-01 |
| AU3976972A (en) | 1973-09-13 |
| CH575943A5 (enExample) | 1976-05-31 |
| DE2113529A1 (de) | 1972-12-14 |
| US3846428A (en) | 1974-11-05 |
| BE780879A (fr) | 1972-09-18 |
| PL83278B1 (enExample) | 1975-12-31 |
| HU163178B (enExample) | 1973-06-28 |
| FR2130327B1 (enExample) | 1975-04-25 |
| IL38962A0 (en) | 1972-05-30 |
| SU458130A3 (ru) | 1975-01-25 |
| DE2113529C3 (de) | 1980-04-30 |
| NL7203650A (enExample) | 1972-09-19 |
| FR2130327A1 (enExample) | 1972-11-03 |
| CA945557A (en) | 1974-04-16 |
| AT312589B (de) | 1974-01-10 |
| AU463550B2 (en) | 1975-07-14 |
| DK126999B (da) | 1973-09-10 |
| ZA721689B (en) | 1972-12-27 |
| DD96950A5 (enExample) | 1973-04-12 |
| DE2113529B2 (de) | 1979-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA727532B (en) | Heterocyclic compounds | |
| AU7420774A (en) | Heterocyclic compounds | |
| ZA726667B (en) | Heterocyclic compounds | |
| AU466496B2 (en) | Pyrimidine derivatives | |
| IL37749A0 (en) | Heterocyclic compounds | |
| MY7500263A (en) | Heterocyclic compounds | |
| CA983920A (en) | Heterocyclic compounds | |
| IE35376B1 (en) | Pyrimidine derivatives | |
| ZA718536B (en) | Heterocyclic compounds | |
| ZA715698B (en) | Heterocyclic compounds | |
| ZA72165B (en) | Substituted m-trifluormethylphenylurea derivatives | |
| ZA715697B (en) | Heterocyclic compounds | |
| ZA708344B (en) | Heterocyclic compounds | |
| ZA726099B (en) | Isopropylamino pyrimidine derivatives | |
| CA977343A (en) | Heterocyclic compounds | |
| IL38962A (en) | 2-(5-nitro-2-furyl)-5-beta-aminoethoxy pyrimidine derivatives | |
| ZA723919B (en) | New heterocyclic compounds | |
| AU4493472A (en) | 2-nitroamino-6-hydroxy-4-methyl pyrimidines | |
| ZA715081B (en) | Heterocyclic compounds | |
| ZA714692B (en) | Heterocyclic compounds | |
| AU4455572A (en) | Quinazolinone derivatives | |
| IE36154L (en) | Nitrofuran derivatives | |
| PH11448A (en) | Nitrofuran derivatives | |
| CA859164A (en) | 4-(hydroxyanilino)-2-(5-nitro-2-furyl)-quinazolines | |
| CA862115A (en) | Pyrimidine derivatives |