AU463550B2 - Nitrofurylpyrimidine derivatives - Google Patents
Nitrofurylpyrimidine derivativesInfo
- Publication number
- AU463550B2 AU463550B2 AU39769/72A AU3976972A AU463550B2 AU 463550 B2 AU463550 B2 AU 463550B2 AU 39769/72 A AU39769/72 A AU 39769/72A AU 3976972 A AU3976972 A AU 3976972A AU 463550 B2 AU463550 B2 AU 463550B2
- Authority
- AU
- Australia
- Prior art keywords
- nitrofurylpyrimidine
- derivatives
- nitrofurylpyrimidine derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LAIZBXNIUKWPOC-UHFFFAOYSA-N 2-(furan-2-yl)-4-nitropyrimidine Chemical class [N+](=O)([O-])C1=NC(=NC=C1)C=1OC=CC1 LAIZBXNIUKWPOC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2113529A DE2113529C3 (en) | 1971-03-17 | 1971-03-17 | 2- (5-Nitro-2-furyl) -5- (2-alkylaminoethoxy) pyrimidine compounds |
| DEDE821135 | 1971-03-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3976972A AU3976972A (en) | 1973-09-13 |
| AU463550B2 true AU463550B2 (en) | 1975-07-14 |
Family
ID=5802207
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU39769/72A Expired AU463550B2 (en) | 1971-03-17 | 1972-03-08 | Nitrofurylpyrimidine derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3846428A (en) |
| AT (1) | AT312589B (en) |
| AU (1) | AU463550B2 (en) |
| BE (1) | BE780879A (en) |
| CA (1) | CA945557A (en) |
| CH (1) | CH575943A5 (en) |
| DD (1) | DD96950A5 (en) |
| DE (1) | DE2113529C3 (en) |
| DK (1) | DK126999B (en) |
| ES (1) | ES400560A1 (en) |
| FR (1) | FR2130327B1 (en) |
| GB (1) | GB1391933A (en) |
| HU (1) | HU163178B (en) |
| IL (1) | IL38962A (en) |
| NL (1) | NL7203650A (en) |
| PL (1) | PL83278B1 (en) |
| SU (1) | SU458130A3 (en) |
| ZA (1) | ZA721689B (en) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1937629C3 (en) * | 1969-07-19 | 1979-07-26 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Nitrofuryl-aminoalkoxy-pyriinidines |
-
1971
- 1971-03-17 DE DE2113529A patent/DE2113529C3/en not_active Expired
-
1972
- 1972-02-29 DK DK93172AA patent/DK126999B/en unknown
- 1972-03-02 SU SU1754975A patent/SU458130A3/en active
- 1972-03-08 ES ES400560A patent/ES400560A1/en not_active Expired
- 1972-03-08 AU AU39769/72A patent/AU463550B2/en not_active Expired
- 1972-03-12 IL IL38962A patent/IL38962A/en unknown
- 1972-03-13 GB GB1152872A patent/GB1391933A/en not_active Expired
- 1972-03-13 ZA ZA721689A patent/ZA721689B/en unknown
- 1972-03-15 PL PL1972154083A patent/PL83278B1/pl unknown
- 1972-03-15 DD DD161547A patent/DD96950A5/xx unknown
- 1972-03-16 US US00235426A patent/US3846428A/en not_active Expired - Lifetime
- 1972-03-16 FR FR7209187A patent/FR2130327B1/fr not_active Expired
- 1972-03-16 CH CH385372A patent/CH575943A5/xx not_active IP Right Cessation
- 1972-03-16 HU HUSC379A patent/HU163178B/hu unknown
- 1972-03-17 BE BE780879A patent/BE780879A/en unknown
- 1972-03-17 AT AT230072A patent/AT312589B/en not_active IP Right Cessation
- 1972-03-17 CA CA137,369A patent/CA945557A/en not_active Expired
- 1972-03-17 NL NL7203650A patent/NL7203650A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU3976972A (en) | 1973-09-13 |
| DE2113529B2 (en) | 1979-08-02 |
| DD96950A5 (en) | 1973-04-12 |
| IL38962A (en) | 1975-10-15 |
| PL83278B1 (en) | 1975-12-31 |
| FR2130327A1 (en) | 1972-11-03 |
| BE780879A (en) | 1972-09-18 |
| GB1391933A (en) | 1975-04-23 |
| NL7203650A (en) | 1972-09-19 |
| ES400560A1 (en) | 1975-02-01 |
| DE2113529C3 (en) | 1980-04-30 |
| AT312589B (en) | 1974-01-10 |
| IL38962A0 (en) | 1972-05-30 |
| CH575943A5 (en) | 1976-05-31 |
| FR2130327B1 (en) | 1975-04-25 |
| SU458130A3 (en) | 1975-01-25 |
| DE2113529A1 (en) | 1972-12-14 |
| US3846428A (en) | 1974-11-05 |
| ZA721689B (en) | 1972-12-27 |
| HU163178B (en) | 1973-06-28 |
| CA945557A (en) | 1974-04-16 |
| DK126999B (en) | 1973-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU468250B2 (en) | 3-nitropyrazole derivatives | |
| AU462723B2 (en) | 2-nitro-5-imidazolyaldehyde derivatives | |
| AU461957B2 (en) | Lumilysergol derivatives | |
| CA1017335A (en) | Triazolyl-ethenyl-phenylene derivatives | |
| AU463679B2 (en) | Dibenzocycloheptadioxolan derivatives | |
| AU470552B2 (en) | Aminocephalosporin derivatives | |
| AU472069B2 (en) | Dibenzoxirenazepine derivatives | |
| CA867769A (en) | Fluoracylamino-trichloromethyl-methane derivatives | |
| CA873890A (en) | 5-nitrofuran derivatives | |
| CA874996A (en) | Diaryloxalamide derivatives | |
| CA871723A (en) | Pyridyl-2-imidazolone derivatives | |
| CA869544A (en) | Thieno-benzothiazine derivatives | |
| CA868361A (en) | Thieno-benzothiazine derivatives | |
| CA872254A (en) | Indenopyridine derivatives | |
| CA866804A (en) | Spiro-azatetramethylene derivatives | |
| CA863950A (en) | Thienobenzothiazephine derivatives | |
| CA863356A (en) | Indenopyridine derivatives | |
| CA862773A (en) | N-phenylsuccinimide derivatives | |
| CA862754A (en) | Benzothiazepin-4-one derivatives | |
| CA872805A (en) | 3-aryloxyalkylpiperidine derivatives | |
| CA871716A (en) | Norscopolamine derivatives | |
| CA872252A (en) | 4-substituted-benzocyclohepta-imidazole derivatives | |
| AU479054B2 (en) | Triazole-ethenyl-phenylene derivatives | |
| AU475768B2 (en) | Ergolene derivatives | |
| AU475691B2 (en) | 7-amino-indazole derivatives |