IL26742A - Manufacture of heterocyclic compounds containing vinylidene bridges - Google Patents
Manufacture of heterocyclic compounds containing vinylidene bridgesInfo
- Publication number
- IL26742A IL26742A IL26742A IL2674266A IL26742A IL 26742 A IL26742 A IL 26742A IL 26742 A IL26742 A IL 26742A IL 2674266 A IL2674266 A IL 2674266A IL 26742 A IL26742 A IL 26742A
- Authority
- IL
- Israel
- Prior art keywords
- ring
- compound
- formula
- atoms
- denotes
- Prior art date
Links
- 150000002391 heterocyclic compounds Chemical class 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 39
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 125000004122 cyclic group Chemical group 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 125000004429 atom Chemical group 0.000 claims description 14
- 239000003513 alkali Substances 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000002262 Schiff base Substances 0.000 claims description 9
- 150000004753 Schiff bases Chemical class 0.000 claims description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 125000006413 ring segment Chemical group 0.000 claims description 8
- -1 diphenylyl Chemical group 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 230000009469 supplementation Effects 0.000 claims description 4
- 239000005864 Sulphur Substances 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 3
- 239000004305 biphenyl Substances 0.000 claims description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000006267 biphenyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 5
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims 4
- 229910052783 alkali metal Inorganic materials 0.000 claims 3
- 150000001340 alkali metals Chemical class 0.000 claims 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 2
- 150000001721 carbon Chemical group 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 229910052700 potassium Inorganic materials 0.000 claims 2
- 239000011591 potassium Substances 0.000 claims 2
- 239000007858 starting material Substances 0.000 claims 2
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 claims 1
- 150000003868 ammonium compounds Chemical class 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 125000005331 diazinyl group Chemical group N1=NC(=CC=C1)* 0.000 claims 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 125000002971 oxazolyl group Chemical group 0.000 claims 1
- 150000003112 potassium compounds Chemical class 0.000 claims 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 claims 1
- 150000003230 pyrimidines Chemical class 0.000 claims 1
- 125000005504 styryl group Chemical group 0.000 claims 1
- 125000003944 tolyl group Chemical group 0.000 claims 1
- 150000003918 triazines Chemical class 0.000 claims 1
- 125000001425 triazolyl group Chemical group 0.000 claims 1
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000005282 brightening Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000007717 exclusion Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- UVEWQKMPXAHFST-UHFFFAOYSA-N n,1-diphenylmethanimine Chemical compound C=1C=CC=CC=1C=NC1=CC=CC=C1 UVEWQKMPXAHFST-UHFFFAOYSA-N 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229950011008 tetrachloroethylene Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical group CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical group 0.000 description 1
- 238000012505 colouration Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000004867 thiadiazoles Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/18—Benzimidazoles; Hydrogenated benzimidazoles with aryl radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/42—Benzopyrazines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
- C07D249/20—Benzotriazoles with aryl radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/22—Naphthotriazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/22—Naphthotriazoles
- C07D249/24—Naphthotriazoles with stilbene radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/24—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to three ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D263/57—Aryl or substituted aryl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
- C07D271/107—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles with two aryl or substituted aryl radicals attached in positions 2 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
- C07D277/66—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2 with aromatic rings or ring systems directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1490265A CH484918A (de) | 1965-10-28 | 1965-10-28 | Verfahren zur Herstellung heterocyclischer, Aethylendoppelbindungen enthaltender Verbindungen |
| CH964966A CH517101A (de) | 1965-10-28 | 1966-07-04 | Verfahren zur Herstellung heterocyclischer, Äthylendoppelbindungen enthaltender Verbindungen |
| US6796770A | 1970-08-28 | 1970-08-28 | |
| US00295405A US3849163A (en) | 1965-10-28 | 1972-10-05 | Process for the optical brightening of organic materials |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26742A true IL26742A (en) | 1972-12-29 |
Family
ID=27429238
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26742A IL26742A (en) | 1965-10-28 | 1966-10-24 | Manufacture of heterocyclic compounds containing vinylidene bridges |
| IL40375A IL40375A (en) | 1965-10-28 | 1966-10-24 | 1-phenyl(or naphthyl)-2-(benzoxazol-6-yl)-ethylene derivatives |
| IL40374A IL40374A (en) | 1965-10-28 | 1966-10-24 | 1-(heterocyclylphenyl)-2-phenyl(or naphthyl)-ethylene derivatives |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL40375A IL40375A (en) | 1965-10-28 | 1966-10-24 | 1-phenyl(or naphthyl)-2-(benzoxazol-6-yl)-ethylene derivatives |
| IL40374A IL40374A (en) | 1965-10-28 | 1966-10-24 | 1-(heterocyclylphenyl)-2-phenyl(or naphthyl)-ethylene derivatives |
Country Status (13)
| Country | Link |
|---|---|
| US (6) | US3725395A (OSRAM) |
| BE (1) | BE688963A (OSRAM) |
| BR (1) | BR6684095D0 (OSRAM) |
| CH (2) | CH484918A (OSRAM) |
| CS (1) | CS154567B2 (OSRAM) |
| DE (4) | DE1670394C3 (OSRAM) |
| FI (1) | FI50336C (OSRAM) |
| FR (1) | FR1499546A (OSRAM) |
| GB (1) | GB1131484A (OSRAM) |
| IL (3) | IL26742A (OSRAM) |
| NL (4) | NL6615215A (OSRAM) |
| NO (2) | NO126018B (OSRAM) |
| SE (4) | SE329992B (OSRAM) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3880841A (en) * | 1971-03-18 | 1975-04-29 | Sandoz Ltd | Triazolyl ethenyl phenylene derivatives |
| US3849155A (en) * | 1971-06-18 | 1974-11-19 | Ciba Geigy Ag | Brightening of polyacrylonitrile wet tow |
| IT966203B (it) * | 1971-10-07 | 1974-02-11 | Sbiancanti alchilbenzossazolilstil benici | |
| CH554911A (de) * | 1971-12-30 | 1974-10-15 | Ciba Geigy Ag | Verwendung ausserhalb der textilindustrie von neuen 4,4'divinyldiphenyl-verbindungen als optische aufhellmittel fuer organische materialien. |
| CH567054A5 (OSRAM) * | 1972-03-08 | 1975-09-30 | Ciba Geigy Ag | |
| US3926963A (en) * | 1973-04-20 | 1975-12-16 | Ciba Geigy Ag | New benzoxazolylstilbenes as optical brighteners |
| US3912697A (en) * | 1973-04-27 | 1975-10-14 | Eastman Kodak Co | Light-sensitive polymers |
| US3993645A (en) * | 1973-05-29 | 1976-11-23 | Sterling Drug Inc. | Stilbene optical brighteners and compositions brightened therewith |
| GB1431589A (en) * | 1973-07-13 | 1976-04-07 | Smith Kline French Lab | Ureas, thioureas and guanidines n,n-disubstituted by heterocyclo- alkylene and/or heterocycloalkylenethioalkylene groups |
| US4215125A (en) * | 1973-07-13 | 1980-07-29 | Smith Kline & French Laboratories Limited | Pyridyl ureas, thioureas and guanidines |
| US4217301A (en) | 1973-11-19 | 1980-08-12 | Ciba-Geigy Corporation | Cyano-substituted stilbene compounds |
| US4008224A (en) | 1973-11-19 | 1977-02-15 | Ciba-Geigy Corporation | Process for the manufacture of cyano-substituted stilbene compounds |
| US4097515A (en) | 1973-11-19 | 1978-06-27 | Ciba-Geigy Corporation | Process for the manufacture of cyano-substituted stilbene compounds |
| CH579173B5 (OSRAM) * | 1974-06-06 | 1976-08-31 | Hoechst Ag | |
| DE2525683A1 (de) * | 1974-06-12 | 1976-01-02 | Ciba Geigy Ag | Sulfogruppenhaltige heterocyclen |
| DE2525682A1 (de) * | 1974-06-12 | 1976-01-02 | Ciba Geigy Ag | Herstellung von sulfogruppenhaltigen stilbenverbindungen |
| US3951654A (en) * | 1974-06-20 | 1976-04-20 | Xerox Corporation | Method for enhancement in the rate and efficiency of photodischarge of electrostatographic imaging members comprising phthalocyanine |
| CH597225A5 (OSRAM) * | 1974-08-14 | 1978-03-31 | Ciba Geigy Ag | |
| CH598307A5 (OSRAM) * | 1974-08-14 | 1978-04-28 | Ciba Geigy Ag | |
| CH598309A5 (OSRAM) * | 1974-08-14 | 1978-04-28 | Ciba Geigy Ag | |
| US4172045A (en) * | 1974-09-09 | 1979-10-23 | Ciba-Geigy Corporation | Process for the manufacture of 2-stilbenyl-1,2,3-triazoles which contain carboxyl groups, novel 2-stilbenyl-1,2,3-triazoles which contain carboxyl groups and the use thereof as fluorescent brighteners |
| DE2525610C2 (de) * | 1975-06-09 | 1985-04-11 | Henkel KGaA, 4000 Düsseldorf | Kationische Avivagemittel mit verbesserter Kaltwasserlöslichkeit |
| DE2724408A1 (de) * | 1976-06-02 | 1977-12-15 | Ciba Geigy Ag | V-triazole |
| LU76467A1 (OSRAM) * | 1976-12-23 | 1978-07-10 | ||
| DE2712686C2 (de) * | 1977-03-23 | 1986-09-04 | Bayer Ag, 5090 Leverkusen | 4-Triazinyl-4'-benzoxazolyl- bzw. 4'-phenyl-stilben-derivate |
| LU77024A1 (OSRAM) * | 1977-03-25 | 1978-11-03 | ||
| DE2730644A1 (de) * | 1977-07-07 | 1979-01-25 | Bayer Ag | Fluoreszenz-farbstoffe |
| LU78484A1 (de) * | 1977-11-10 | 1979-06-13 | Ciba Geigy Ag | Verfahren zur herstellung von benzoxazolyl-phenyl-stilbenen |
| LU78483A1 (de) * | 1977-11-10 | 1979-06-13 | Ciba Geigy Ag | Verfahren zur herstellung von benzoxazolyl-phenylstilbenen |
| DE2833470A1 (de) * | 1978-07-29 | 1980-02-07 | Hoechst Ag | 1,3,4-oxadiazolon(2)-verbindungen und verfahren zu deren herstellung |
| US4297234A (en) * | 1979-05-17 | 1981-10-27 | Ciba-Geigy Corporation | Benzoxazolyl-stilbenes |
| US4381101A (en) * | 1981-02-23 | 1983-04-26 | Halliburton Company | Draft gear removal apparatus |
| FR2539509B1 (fr) * | 1983-01-13 | 1986-08-22 | Sandoz Sa | Procede pour le marquage des peaux ayant subi un tannage mineral |
| US4500533A (en) * | 1983-06-22 | 1985-02-19 | Eli Lilly And Company | 2,4,5-Triaryl pyrimidines and a method of treating pain, fever, thrombosis, inflammation and arthritis |
| DE3337024A1 (de) * | 1983-10-12 | 1985-04-25 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliche, trichlormethylgruppen aufweisende verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltendes lichtempfindliches gemisch |
| DE3706880A1 (de) * | 1987-03-04 | 1988-09-15 | Hoechst Ag | 4-chloroxazol-derivate, verfahren zu ihrer herstellung und ihre verwendung |
| US5216157A (en) * | 1988-03-08 | 1993-06-01 | Egis Gyogyszergyar | 1,4,Dihydro-pyridine intermediates |
| JP2832028B2 (ja) * | 1989-04-20 | 1998-12-02 | キヤノン株式会社 | 化合物およびこれを含む液晶組成物およびこれを使用した液晶素子 |
| WO2001010854A1 (en) * | 1999-08-09 | 2001-02-15 | Ciba Specialty Chemicals Holding Inc. | Benzothiazole compounds and their use as optical brighteners |
| US20070275960A1 (en) * | 2006-01-25 | 2007-11-29 | Synta Pharmaceuticals Corp. | Phenyl and pyridyl compounds for inflammation and immune-related uses |
| US8367680B2 (en) | 2008-03-28 | 2013-02-05 | Wisconsin Alumni Research Foundation | Antibacterial small molecules and methods for their synthesis |
| AU2009295701B2 (en) | 2008-09-23 | 2014-07-24 | Wista Laboratories Ltd. | Ligands for aggregated tau molecules |
| CN108286186B (zh) * | 2018-01-09 | 2020-05-26 | 上海雅运新材料有限公司 | 一种新型低温氧漂催化剂及其制备方法和应用 |
| WO2020199191A1 (zh) * | 2019-04-04 | 2020-10-08 | 复旦大学 | 长余辉发光材料 |
| CN111635523A (zh) * | 2020-06-03 | 2020-09-08 | 河北科技大学 | 以三聚喹唑啉为结点的二维共价有机框架材料及其制备方法和应 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL265443A (OSRAM) * | 1960-06-02 | |||
| GB944265A (en) * | 1961-03-31 | 1963-12-11 | Gen Aniline & Film Corp | Naphthotriazole brightening agents |
| FR1345260A (fr) * | 1961-12-04 | 1963-12-06 | Ici Ltd | Nouvelles polycyclo-triazines substituées, production et applications |
| BE669951A (OSRAM) * | 1964-09-23 | 1900-01-01 | ||
| FR1479071A (OSRAM) * | 1965-05-10 | 1967-07-19 | ||
| CH477469A (de) * | 1965-12-02 | 1969-08-31 | Ciba Geigy | Verfahren zur Herstellung heterocyclischer Stilbenverbindungen |
-
1965
- 1965-10-28 CH CH1490265A patent/CH484918A/de not_active IP Right Cessation
-
1966
- 1966-07-04 CH CH964966A patent/CH517101A/de not_active IP Right Cessation
- 1966-10-21 DE DE1670394A patent/DE1670394C3/de not_active Expired
- 1966-10-21 DE DE19661594833 patent/DE1594833B2/de active Granted
- 1966-10-21 DE DE19661594834 patent/DE1594834B1/de not_active Ceased
- 1966-10-21 DE DE19661594832 patent/DE1594832B1/de active Pending
- 1966-10-24 IL IL26742A patent/IL26742A/en unknown
- 1966-10-24 IL IL40375A patent/IL40375A/en unknown
- 1966-10-24 IL IL40374A patent/IL40374A/en unknown
- 1966-10-25 FR FR81533A patent/FR1499546A/fr not_active Expired
- 1966-10-27 NL NL6615215A patent/NL6615215A/xx unknown
- 1966-10-27 BR BR184095/66A patent/BR6684095D0/pt unknown
- 1966-10-27 SE SE14758/66A patent/SE329992B/xx unknown
- 1966-10-27 NL NL6615211A patent/NL6615211A/xx unknown
- 1966-10-27 SE SE14760/66A patent/SE347746B/xx unknown
- 1966-10-27 NO NO165375A patent/NO126018B/no unknown
- 1966-10-27 GB GB48262/66A patent/GB1131484A/en not_active Expired
- 1966-10-27 NL NL6615213A patent/NL6615213A/xx unknown
- 1966-10-27 NO NO165376A patent/NO121832B/no unknown
- 1966-10-27 CS CS684966A patent/CS154567B2/cs unknown
- 1966-10-27 FI FI662839A patent/FI50336C/fi active
- 1966-10-27 NL NL6615214A patent/NL6615214A/xx unknown
- 1966-10-27 SE SE14759/66A patent/SE334856B/xx unknown
- 1966-10-27 BE BE688963D patent/BE688963A/xx unknown
- 1966-10-27 SE SE14757/66A patent/SE340436B/xx unknown
-
1970
- 1970-08-28 US US00068012A patent/US3725395A/en not_active Expired - Lifetime
- 1970-08-28 US US00068013A patent/US3711472A/en not_active Expired - Lifetime
- 1970-08-28 US US00068014A patent/US3781278A/en not_active Expired - Lifetime
- 1970-08-28 US US00067967A patent/US3758462A/en not_active Expired - Lifetime
-
1971
- 1971-05-11 US US00142388A patent/US3732221A/en not_active Expired - Lifetime
-
1972
- 1972-10-05 US US00295405A patent/US3849163A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL26742A (en) | Manufacture of heterocyclic compounds containing vinylidene bridges | |
| US3476747A (en) | Manufacture of 1,2-bis(aryl)ethylenes | |
| ES8201201A1 (es) | Procedimiento para la preparacion de materiales organicos aclarados opticamente. | |
| US4380514A (en) | Preparation of optical brighteners | |
| US5886183A (en) | Naphthalenelactamimide fluorescence dyes | |
| US4521605A (en) | Carbazole compounds and process for preparing the same | |
| US3351591A (en) | 4-azolyl-4'-oxdiazolyl-stilbenes | |
| US4104468A (en) | 1,3,4-Oxadiazolyl-(2)-vinyl stilbene optical brighteners | |
| US4061860A (en) | Stilbene compounds | |
| GB2203433A (en) | Novel aldehydes | |
| Tyutin et al. | Synthesis of esters of 3, 3-dicyano-2-(trifluoromethyl) acrylic acid and their reactions with arylamines | |
| US3860584A (en) | 4,4{40 -Bis-{8 benzoxazolyl-(2){9 -stilbenes | |
| US4417014A (en) | Phthaloperinone dyes and the use thereof for more dyeing plastics | |
| US3609160A (en) | P,p{40 -bis(benzoxazolyl) tolan derivatives | |
| US3940410A (en) | Bis-benzonazoledicarbonitriles | |
| EP1265876A1 (en) | Preparation of mixtures of benzoxazolyl-stilbene compounds | |
| CH470410A (de) | Verfahren zur Herstellung von Benzoxazolderivaten und Verwendung derselben | |
| Sudborough | C.—Additive compounds of trinitrobenzene | |
| US4013713A (en) | Diarylvinyl-dihydrophenanthrene compounds | |
| US2657228A (en) | Sulfonic acid aryl esters of polyarylethylene derivatives and a process of making same | |
| US3546217A (en) | Novel symmetrical heterocyclicly substituted stilbenes and process therefor | |
| US3679669A (en) | Phenyl-1,3,4-oxdiazole compounds | |
| US4210451A (en) | Regenerated cellulose flameproofed with organophosphorylamides | |
| US3761470A (en) | 2-(4 - staylphenyl) - 2h-1,2,3-triazole brighteners intermediates therefor and compositions containing the same | |
| US3808256A (en) | Styryl dyes |