IL23556A - 2-Sulfonamido pyrimidines are converted instead of 5 - Google Patents
2-Sulfonamido pyrimidines are converted instead of 5Info
- Publication number
- IL23556A IL23556A IL23556A IL2355665A IL23556A IL 23556 A IL23556 A IL 23556A IL 23556 A IL23556 A IL 23556A IL 2355665 A IL2355665 A IL 2355665A IL 23556 A IL23556 A IL 23556A
- Authority
- IL
- Israel
- Prior art keywords
- process according
- pyrimidine
- benzene
- general
- general formula
- Prior art date
Links
- 150000003230 pyrimidines Chemical class 0.000 title claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 62
- 238000000034 method Methods 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 16
- -1 dicarbonyl compound Chemical class 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 150000003456 sulfonamides Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 239000012286 potassium permanganate Substances 0.000 claims description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims 4
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000008065 acid anhydrides Chemical class 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- 150000001728 carbonyl compounds Chemical class 0.000 claims 1
- 125000004185 ester group Chemical group 0.000 claims 1
- 150000002357 guanidines Chemical class 0.000 claims 1
- 150000002366 halogen compounds Chemical class 0.000 claims 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 230000002829 reductive effect Effects 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- 239000011701 zinc Substances 0.000 claims 1
- 229910052725 zinc Inorganic materials 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 239000000243 solution Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- BRSRNTJGTDYRFT-UHFFFAOYSA-N 2-(benzenesulfonyl)guanidine Chemical class NC(N)=NS(=O)(=O)C1=CC=CC=C1 BRSRNTJGTDYRFT-UHFFFAOYSA-N 0.000 description 3
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical class NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 150000005695 2-halopyrimidines Chemical class 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- OIEZCWFCXVSIGQ-UHFFFAOYSA-N 1,1-diethoxy-4-methylpentane Chemical compound CCOC(OCC)CCC(C)C OIEZCWFCXVSIGQ-UHFFFAOYSA-N 0.000 description 1
- 150000008319 1H-pyrimidin-2-ones Chemical class 0.000 description 1
- FYERTDTXGGOMGT-UHFFFAOYSA-N 2,2-diethoxyethylbenzene Chemical compound CCOC(OCC)CC1=CC=CC=C1 FYERTDTXGGOMGT-UHFFFAOYSA-N 0.000 description 1
- BWEMBJVKRNPUQY-UHFFFAOYSA-N 2-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=NC=CC=N1 BWEMBJVKRNPUQY-UHFFFAOYSA-N 0.000 description 1
- KNATWQKKAILTOM-UHFFFAOYSA-N 2-butoxypyrimidine Chemical compound CCCCOC1=NC=CC=N1 KNATWQKKAILTOM-UHFFFAOYSA-N 0.000 description 1
- VQEHSBSZLWUDML-UHFFFAOYSA-N 2-chloro-5-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=CN=C(Cl)N=C1 VQEHSBSZLWUDML-UHFFFAOYSA-N 0.000 description 1
- YJDDXMSIMBMMGY-UHFFFAOYSA-N 2-cyclohexylpyrimidine Chemical compound C1CCCCC1C1=NC=CC=N1 YJDDXMSIMBMMGY-UHFFFAOYSA-N 0.000 description 1
- RZNHSEZOLFEFGB-UHFFFAOYSA-N 2-methoxybenzoyl chloride Chemical compound COC1=CC=CC=C1C(Cl)=O RZNHSEZOLFEFGB-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- ZTRBLDGFVYAFEK-UHFFFAOYSA-N 5-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=CN=CN=C1 ZTRBLDGFVYAFEK-UHFFFAOYSA-N 0.000 description 1
- JCKHSOMIXYGMOX-UHFFFAOYSA-N 5-propoxypyrimidin-2-amine Chemical compound CCCOC1=CN=C(N)N=C1 JCKHSOMIXYGMOX-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- JITICTFBBGXLFC-UHFFFAOYSA-N n-[2-(4-sulfamoylphenyl)ethyl]benzamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)C1=CC=CC=C1 JITICTFBBGXLFC-UHFFFAOYSA-N 0.000 description 1
- HLBLNLYCFFWMFF-UHFFFAOYSA-N n-pyrimidin-2-ylbenzenesulfonamide Chemical class C=1C=CC=CC=1S(=O)(=O)NC1=NC=CC=N1 HLBLNLYCFFWMFF-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000003109 potassium Chemical class 0.000 description 1
- WKSAUQYGYAYLPV-UHFFFAOYSA-N pyrimethamine Chemical compound CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 WKSAUQYGYAYLPV-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heat-Pump Type And Storage Water Heaters (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0076848 | 1964-05-20 | ||
| DEB84050A DE1254153B (de) | 1964-05-20 | 1965-10-09 | Verfahren zur Herstellung von neuen 2-Benzolsulfonamido-pyrimidinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL23556A true IL23556A (en) | 1968-12-26 |
Family
ID=25967088
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL23556A IL23556A (en) | 1964-05-20 | 1965-05-17 | 2-Sulfonamido pyrimidines are converted instead of 5 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3377351A (enFirst) |
| BE (1) | BE664178A (enFirst) |
| BR (1) | BR6569749D0 (enFirst) |
| CH (2) | CH471796A (enFirst) |
| DE (2) | DE1445531C3 (enFirst) |
| DK (1) | DK112318B (enFirst) |
| FI (2) | FI43878C (enFirst) |
| FR (3) | FR1464602A (enFirst) |
| GB (2) | GB1034300A (enFirst) |
| IL (1) | IL23556A (enFirst) |
| NL (3) | NL6506379A (enFirst) |
| NO (1) | NO116415B (enFirst) |
| SE (4) | SE317383B (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670168C3 (de) * | 1966-11-29 | 1975-04-10 | Boehringer Mannheim Gmbh, 6800 Mannheim | 2-Benzolsulfonamido-4-methyl-5alkyl-pyrimidine und Verfahren zu ihrer Herstellung |
| DE1695855C3 (de) * | 1967-12-30 | 1979-07-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-(5-Isobutyl-2-pyrimidinyl)-sulfonamidophenylessigsäure-(2-methoxy-5chloranilid) und dessen Salze mit physiologisch verträglichen Basen |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| DE1101428B (de) * | 1959-07-08 | 1961-03-09 | Schering Ag | Verfahren zur Herstellung langwirkender Aminobenzolsulfonsaeure-amidderivate |
| US3275635A (en) * | 1960-10-18 | 1966-09-27 | Schering Ag | Certain 2-benzenesulfonamide-5-alkyl (or alkoxy) pyrimidine compounds |
-
0
- NL NL129627D patent/NL129627C/xx active
-
1964
- 1964-05-20 DE DE1445531A patent/DE1445531C3/de not_active Expired
-
1965
- 1965-05-17 IL IL23556A patent/IL23556A/en unknown
- 1965-05-18 CH CH695765A patent/CH471796A/de not_active IP Right Cessation
- 1965-05-18 FI FI651195A patent/FI43878C/fi active
- 1965-05-19 NO NO158120A patent/NO116415B/no unknown
- 1965-05-19 SE SE6532/65A patent/SE317383B/xx unknown
- 1965-05-19 FR FR17592A patent/FR1464602A/fr not_active Expired
- 1965-05-19 BE BE664178D patent/BE664178A/xx unknown
- 1965-05-19 BR BR169749/65A patent/BR6569749D0/pt unknown
- 1965-05-19 GB GB21194/65A patent/GB1034300A/en not_active Expired
- 1965-05-19 NL NL6506379A patent/NL6506379A/xx unknown
- 1965-08-19 FR FR28820A patent/FR4724M/fr not_active Expired
- 1965-10-09 DE DEB84050A patent/DE1254153B/de active Pending
-
1966
- 1966-08-22 DK DK429366AA patent/DK112318B/da unknown
- 1966-09-23 US US581445A patent/US3377351A/en not_active Expired - Lifetime
- 1966-10-06 FR FR78998A patent/FR91332E/fr not_active Expired
- 1966-10-06 FI FI662625A patent/FI46963C/fi active
- 1966-10-06 CH CH1442166A patent/CH490389A/de unknown
- 1966-10-07 NL NL666614126A patent/NL146810B/xx unknown
- 1966-10-07 GB GB44908/66A patent/GB1092500A/en not_active Expired
-
1967
- 1967-06-19 SE SE08616/67A patent/SE325891B/xx unknown
- 1967-06-19 SE SE08617/67A patent/SE325892B/xx unknown
- 1967-06-19 SE SE08615/67A patent/SE325890B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE325892B (enFirst) | 1970-07-13 |
| CH471796A (de) | 1969-04-30 |
| SE325890B (enFirst) | 1970-07-13 |
| NL129627C (enFirst) | |
| FI46963C (fi) | 1973-08-10 |
| SE325891B (enFirst) | 1970-07-13 |
| DE1445531A1 (de) | 1969-03-20 |
| NL146810B (nl) | 1975-08-15 |
| GB1034300A (en) | 1966-06-29 |
| DE1445531B2 (de) | 1973-02-15 |
| FR4724M (enFirst) | 1967-01-02 |
| NL6614126A (enFirst) | 1967-04-10 |
| BR6569749D0 (pt) | 1973-08-02 |
| DK112318B (da) | 1968-12-02 |
| FI43878C (fi) | 1971-07-12 |
| FI43878B (enFirst) | 1971-03-31 |
| DE1254153B (de) | 1967-11-16 |
| CH490389A (de) | 1970-05-15 |
| DE1445531C3 (de) | 1973-10-31 |
| NL6506379A (enFirst) | 1965-11-22 |
| FR1464602A (fr) | 1967-01-06 |
| SE317383B (enFirst) | 1969-11-17 |
| NO116415B (enFirst) | 1969-03-24 |
| FR91332E (fr) | 1968-05-24 |
| BE664178A (enFirst) | 1965-11-19 |
| GB1092500A (en) | 1967-11-29 |
| FI46963B (enFirst) | 1973-05-02 |
| US3377351A (en) | 1968-04-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0212617A1 (en) | Process for producing 4-biphenylylacetic acid | |
| HU198905B (en) | Process for production of derivatives of 4-/alkyl-sulphonil/-3-hydroxi-2-chlor bensoic acid | |
| NO152817B (no) | Fremgangsmaate og innretning for haandtering av vaeskeporsjoner | |
| NO117180B (enFirst) | ||
| JPS6354714B2 (enFirst) | ||
| JPH05208978A (ja) | 1,2−ジヒドロ−3H−ピロロ〔1,2−α〕ピロール−1−カルボン酸エステルの5位のアロイル化方法 | |
| JPH0368026B2 (enFirst) | ||
| IL23556A (en) | 2-Sulfonamido pyrimidines are converted instead of 5 | |
| US2680740A (en) | Production of | |
| US6891041B2 (en) | Method for producing 4-(heteroaryl-methyl)-halogen-1(2H)-phthalazinones | |
| Elderfield et al. | Synthesis of 2-Phenyl-4-chloroquinolines1 | |
| US3519592A (en) | Indole compounds | |
| US2796417A (en) | Quinazolone compounds and methods of making the same | |
| JP2000327603A (ja) | プロピオン酸誘導体の製造方法 | |
| CN110003119A (zh) | 一种5-甲基-5-苯基巴比妥酸的制备方法 | |
| SU502607A3 (ru) | Способ получени лактамов | |
| US3277092A (en) | 5, 6-substituted dihydro-5-fluoropyrimidines | |
| US3277093A (en) | (optionally-2-substituted) 4-halophenyl-5, 7-diketo-6-alkylthiazolo[4, 5-d]pyrimidines | |
| Kleinspehn et al. | A Proof of Structure for 2-Bromo-3-methyl-4-carbethoxypyrrole1 | |
| NO137093B (no) | Fremgangsm}te til fremstilling av 2,4-diamino-5-benzylpyrimidiner | |
| JPS6147837B2 (enFirst) | ||
| NO141137B (no) | Apparat for avlesning av en plateformet opptegningsbaerer | |
| US2698846A (en) | Heterocyclic compounds | |
| JPS6245867B2 (enFirst) | ||
| US2651638A (en) | Derivatives of i |