IL201285A - Stirnyl derivative compounds and preparations containing them - Google Patents
Stirnyl derivative compounds and preparations containing themInfo
- Publication number
- IL201285A IL201285A IL201285A IL20128509A IL201285A IL 201285 A IL201285 A IL 201285A IL 201285 A IL201285 A IL 201285A IL 20128509 A IL20128509 A IL 20128509A IL 201285 A IL201285 A IL 201285A
- Authority
- IL
- Israel
- Prior art keywords
- phenyl
- propan
- alkyl
- amine
- compound
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 71
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 title description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 419
- 229910052739 hydrogen Inorganic materials 0.000 claims description 385
- 150000001875 compounds Chemical class 0.000 claims description 381
- 239000001257 hydrogen Substances 0.000 claims description 379
- 150000002431 hydrogen Chemical class 0.000 claims description 202
- -1 (3- -(2-(2-methoxyethoxy)styryl)phenyl)-propan- l-amine Chemical compound 0.000 claims description 154
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 154
- 229910052736 halogen Inorganic materials 0.000 claims description 128
- 150000002367 halogens Chemical class 0.000 claims description 127
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 122
- 125000003118 aryl group Chemical group 0.000 claims description 75
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 64
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 62
- 150000003839 salts Chemical class 0.000 claims description 51
- 125000003342 alkenyl group Chemical group 0.000 claims description 39
- 125000000304 alkynyl group Chemical group 0.000 claims description 32
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 29
- 239000012453 solvate Substances 0.000 claims description 26
- 150000001204 N-oxides Chemical class 0.000 claims description 17
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 claims description 8
- USAUHTGTPLTQJD-BQYQJAHWSA-N 1-amino-3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-2-one Chemical compound NCC(=O)CC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 USAUHTGTPLTQJD-BQYQJAHWSA-N 0.000 claims description 3
- LCADTYPEALEUAO-ZHACJKMWSA-N 2-methyl-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound NCC(C)CC1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 LCADTYPEALEUAO-ZHACJKMWSA-N 0.000 claims description 3
- RDQLTOZPSLWFBC-VAWYXSNFSA-N 3-[2-methyl-5-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=C(C)C(CCCN)=C1 RDQLTOZPSLWFBC-VAWYXSNFSA-N 0.000 claims description 3
- QLLVSACPOAJGDL-MDZDMXLPSA-N 3-[3-[(e)-2-(2,4,6-trimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC(C)=CC(C)=C1\C=C\C1=CC=CC(CCCN)=C1 QLLVSACPOAJGDL-MDZDMXLPSA-N 0.000 claims description 3
- COHVBBAMZSZFSV-ZHACJKMWSA-N 3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]butan-1-amine Chemical compound NCCC(C)C1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 COHVBBAMZSZFSV-ZHACJKMWSA-N 0.000 claims description 3
- SQPRVQOLIZOHKE-VAWYXSNFSA-N 3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(CCCN)=C1 SQPRVQOLIZOHKE-VAWYXSNFSA-N 0.000 claims description 3
- OFLQNOFHNYJMRM-MDZDMXLPSA-N 3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 OFLQNOFHNYJMRM-MDZDMXLPSA-N 0.000 claims description 3
- CPLRGWJFPLETLO-VAWYXSNFSA-N 3-[3-[(e)-2-(2,6-dimethoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound COC1=CC=CC(OC)=C1\C=C\C1=CC=CC(CCCN)=C1 CPLRGWJFPLETLO-VAWYXSNFSA-N 0.000 claims description 3
- FZHPUUJYIQGCKM-OUKQBFOZSA-N 3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCCN)=C1C FZHPUUJYIQGCKM-OUKQBFOZSA-N 0.000 claims description 3
- HELNQALGIJBZCO-MDZDMXLPSA-N 3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]-4-fluorophenyl]propan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC(CCCN)=CC=C1F HELNQALGIJBZCO-MDZDMXLPSA-N 0.000 claims description 3
- ACKOXNPHOJJOLZ-VAWYXSNFSA-N 3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCCN)=C1 ACKOXNPHOJJOLZ-VAWYXSNFSA-N 0.000 claims description 3
- YXGPTZZXMXJZIL-BUHFOSPRSA-N 3-[3-[(e)-2-(2-butoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CCCCOC1=CC=CC=C1\C=C\C1=CC=CC(CCCN)=C1 YXGPTZZXMXJZIL-BUHFOSPRSA-N 0.000 claims description 3
- QQEMPACAPZMRMY-OUKQBFOZSA-N 3-[3-[(e)-2-(2-ethoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CCOC1=CC=CC=C1\C=C\C1=CC=CC(CCCN)=C1 QQEMPACAPZMRMY-OUKQBFOZSA-N 0.000 claims description 3
- LHIMPNFCTKYLTL-VAWYXSNFSA-N 3-[3-[(e)-2-(2-methylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=CC=C1\C=C\C1=CC=CC(CCCN)=C1 LHIMPNFCTKYLTL-VAWYXSNFSA-N 0.000 claims description 3
- VBOJEAGVIKVJIN-FOCLMDBBSA-N 3-[3-[(e)-2-(2-phenylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2)C=2C=CC=CC=2)=C1 VBOJEAGVIKVJIN-FOCLMDBBSA-N 0.000 claims description 3
- UITGYMASHPKVQS-MDZDMXLPSA-N 3-[3-[(e)-2-(3-chlorophenyl)ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C=2C=C(Cl)C=CC=2)=C1 UITGYMASHPKVQS-MDZDMXLPSA-N 0.000 claims description 3
- GGWNYPAAOSIVSI-ZHACJKMWSA-N 3-[3-[(e)-2-(3-methoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound COC1=CC=CC(\C=C\C=2C=C(CCCN)C=CC=2)=C1 GGWNYPAAOSIVSI-ZHACJKMWSA-N 0.000 claims description 3
- CYHDTIBJYIKSQN-BQYQJAHWSA-N 3-[3-[(e)-2-(4-methoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound C1=CC(OC)=CC=C1\C=C\C1=CC=CC(CCCN)=C1 CYHDTIBJYIKSQN-BQYQJAHWSA-N 0.000 claims description 3
- NGNAJYMEOALPDA-MDZDMXLPSA-N 3-[3-[(e)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2C(F)(F)F)C(F)(F)F)=C1 NGNAJYMEOALPDA-MDZDMXLPSA-N 0.000 claims description 3
- FZHPUUJYIQGCKM-SEYXRHQNSA-N 3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C/C1=CC=CC(CCCN)=C1C FZHPUUJYIQGCKM-SEYXRHQNSA-N 0.000 claims description 3
- ACKOXNPHOJJOLZ-QXMHVHEDSA-N 3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C/C1=CC=CC(CCCN)=C1 ACKOXNPHOJJOLZ-QXMHVHEDSA-N 0.000 claims description 3
- LHIMPNFCTKYLTL-QXMHVHEDSA-N 3-[3-[(z)-2-(2-methylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=CC=C1\C=C/C1=CC=CC(CCCN)=C1 LHIMPNFCTKYLTL-QXMHVHEDSA-N 0.000 claims description 3
- AILVLYLDTGIMED-VQHVLOKHSA-N 3-[5-[(e)-2-(2,6-dichlorophenyl)ethenyl]-2-methoxyphenyl]propan-1-amine Chemical compound C1=C(CCCN)C(OC)=CC=C1\C=C\C1=C(Cl)C=CC=C1Cl AILVLYLDTGIMED-VQHVLOKHSA-N 0.000 claims description 3
- MVNYXEAZKVOLLN-MDZDMXLPSA-N 3-amino-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-ol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(O)CCN)=C1 MVNYXEAZKVOLLN-MDZDMXLPSA-N 0.000 claims description 3
- JNCYMQSTWYVZCF-BQYQJAHWSA-N 3-amino-1-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-1-ol Chemical compound NCCC(O)C1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 JNCYMQSTWYVZCF-BQYQJAHWSA-N 0.000 claims description 3
- IXEDDGWFONXBHR-BQYQJAHWSA-N 3-amino-1-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-1-one Chemical compound NCCC(=O)C1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 IXEDDGWFONXBHR-BQYQJAHWSA-N 0.000 claims description 3
- SCVHVGHEAYRPBI-CMDGGOBGSA-N 3-amino-1-[3-[(e)-2-(2-chloro-6-methylphenyl)ethenyl]phenyl]propan-1-ol Chemical compound CC1=CC=CC(Cl)=C1\C=C\C1=CC=CC(C(O)CCN)=C1 SCVHVGHEAYRPBI-CMDGGOBGSA-N 0.000 claims description 3
- FALVZABGRYNOON-VAWYXSNFSA-N 3-amino-2,2-dimethyl-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-ol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(O)C(C)(C)CN)=C1 FALVZABGRYNOON-VAWYXSNFSA-N 0.000 claims description 3
- FXKCGXJBFRUOSM-ZHACJKMWSA-N 3-amino-2-methyl-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-ol Chemical compound NCC(C)C(O)C1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 FXKCGXJBFRUOSM-ZHACJKMWSA-N 0.000 claims description 3
- FBSOLVONTKXSJE-MDZDMXLPSA-N 3-fluoro-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(F)CCN)=C1 FBSOLVONTKXSJE-MDZDMXLPSA-N 0.000 claims description 3
- SMMRJLXBUXPNJB-VAWYXSNFSA-N 3-[3-[(e)-2-(1-methoxynaphthalen-2-yl)ethenyl]phenyl]propan-1-amine Chemical compound C1=CC2=CC=CC=C2C(OC)=C1\C=C\C1=CC=CC(CCCN)=C1 SMMRJLXBUXPNJB-VAWYXSNFSA-N 0.000 claims description 2
- CICOWLFEHIFHJR-BQYQJAHWSA-N 3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]-2,2-difluoropropan-1-amine Chemical compound NCC(F)(F)CC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 CICOWLFEHIFHJR-BQYQJAHWSA-N 0.000 claims description 2
- QCFDVSIWQVALQQ-CSKARUKUSA-N 3-[5-[(e)-2-(2-chloro-6-methylsulfanylphenyl)ethenyl]-2-methoxyphenyl]propan-1-amine Chemical compound C1=C(CCCN)C(OC)=CC=C1\C=C\C1=C(Cl)C=CC=C1SC QCFDVSIWQVALQQ-CSKARUKUSA-N 0.000 claims description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims 2
- AFPOYXZCXANJPI-UHFFFAOYSA-N 1-[3-(2-naphthalen-1-ylethenyl)phenyl]propan-1-amine Chemical compound C1(=CC=CC2=CC=CC=C12)C=CC=1C=C(C=CC=1)C(CC)N AFPOYXZCXANJPI-UHFFFAOYSA-N 0.000 claims 1
- LCMQWEWNZQFNHQ-UHFFFAOYSA-N 1-[3-[2-(3-methoxynaphthalen-2-yl)ethenyl]phenyl]propan-1-amine Chemical compound COC=1C(=CC2=CC=CC=C2C=1)C=CC=1C=C(C=CC=1)C(CC)N LCMQWEWNZQFNHQ-UHFFFAOYSA-N 0.000 claims 1
- HNPWYERMGSZQFN-ZHACJKMWSA-N 3-[3-[(e)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=C(C)C(\C=C\C=2C=C(CCCN)C=CC=2)=C1 HNPWYERMGSZQFN-ZHACJKMWSA-N 0.000 claims 1
- ZLHZFVLOPXOLJY-CMDGGOBGSA-N 3-[3-[(e)-2-(3,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC(C)=CC(\C=C\C=2C=C(CCCN)C=CC=2)=C1 ZLHZFVLOPXOLJY-CMDGGOBGSA-N 0.000 claims 1
- PJUJZHNFELIJSY-ZHACJKMWSA-N 3-[3-[(e)-2-[2-(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2)C(F)(F)F)=C1 PJUJZHNFELIJSY-ZHACJKMWSA-N 0.000 claims 1
- XPVSROPKQGCQNT-QXMHVHEDSA-N 3-[3-[(z)-2-(2,3-dimethylphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CC1=CC=CC(\C=C/C=2C=C(CCCN)C=CC=2)=C1C XPVSROPKQGCQNT-QXMHVHEDSA-N 0.000 claims 1
- HXDSGNKROBBAPR-UHFFFAOYSA-N C(CC)OC1=C(C=CC=2C=C(C=CC2)C(CC)N)C=CC=C1 Chemical compound C(CC)OC1=C(C=CC=2C=C(C=CC2)C(CC)N)C=CC=C1 HXDSGNKROBBAPR-UHFFFAOYSA-N 0.000 claims 1
- TZOUJNLVUFSQKT-UHFFFAOYSA-N ClC1=CC=C(C=CC=2C=C(C=CC2)C(CC)N)C=C1 Chemical compound ClC1=CC=C(C=CC=2C=C(C=CC2)C(CC)N)C=C1 TZOUJNLVUFSQKT-UHFFFAOYSA-N 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims 1
- 210000004027 cell Anatomy 0.000 description 206
- 238000000034 method Methods 0.000 description 191
- 230000002207 retinal effect Effects 0.000 description 155
- 235000020945 retinal Nutrition 0.000 description 151
- 125000004452 carbocyclyl group Chemical group 0.000 description 145
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 97
- 210000001525 retina Anatomy 0.000 description 88
- 239000011604 retinal Substances 0.000 description 86
- 125000005843 halogen group Chemical group 0.000 description 81
- NCYCYZXNIZJOKI-UHFFFAOYSA-N vitamin A aldehyde Natural products O=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-UHFFFAOYSA-N 0.000 description 72
- 125000000623 heterocyclic group Chemical group 0.000 description 70
- 229930002945 all-trans-retinaldehyde Natural products 0.000 description 69
- 210000000880 retinal rod photoreceptor cell Anatomy 0.000 description 68
- 210000003583 retinal pigment epithelium Anatomy 0.000 description 60
- 230000002401 inhibitory effect Effects 0.000 description 59
- 210000002569 neuron Anatomy 0.000 description 58
- NCYCYZXNIZJOKI-IOUUIBBYSA-N 11-cis-retinal Chemical compound O=C/C=C(\C)/C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-IOUUIBBYSA-N 0.000 description 57
- 210000001508 eye Anatomy 0.000 description 57
- 201000010099 disease Diseases 0.000 description 56
- 125000004043 oxo group Chemical group O=* 0.000 description 53
- 208000017442 Retinal disease Diseases 0.000 description 52
- 102000004330 Rhodopsin Human genes 0.000 description 51
- 108090000820 Rhodopsin Proteins 0.000 description 51
- 208000002780 macular degeneration Diseases 0.000 description 48
- 229910052727 yttrium Inorganic materials 0.000 description 44
- 230000004300 dark adaptation Effects 0.000 description 42
- 125000001072 heteroaryl group Chemical group 0.000 description 42
- 229910052721 tungsten Inorganic materials 0.000 description 42
- 208000035475 disorder Diseases 0.000 description 41
- 230000000007 visual effect Effects 0.000 description 40
- 229910052757 nitrogen Inorganic materials 0.000 description 39
- 108090000769 Isomerases Proteins 0.000 description 37
- 102000004195 Isomerases Human genes 0.000 description 37
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 36
- 125000004433 nitrogen atom Chemical group N* 0.000 description 34
- 239000000049 pigment Substances 0.000 description 34
- 238000004113 cell culture Methods 0.000 description 33
- 230000000694 effects Effects 0.000 description 32
- 210000000608 photoreceptor cell Anatomy 0.000 description 31
- 239000000651 prodrug Substances 0.000 description 31
- 229940002612 prodrug Drugs 0.000 description 31
- 125000002947 alkylene group Chemical group 0.000 description 30
- 230000008929 regeneration Effects 0.000 description 30
- 238000011069 regeneration method Methods 0.000 description 30
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 11-cis-Retinol Chemical compound OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 29
- 230000015572 biosynthetic process Effects 0.000 description 29
- 239000008194 pharmaceutical composition Substances 0.000 description 29
- 206010064930 age-related macular degeneration Diseases 0.000 description 28
- 239000000284 extract Substances 0.000 description 28
- 150000004492 retinoid derivatives Chemical class 0.000 description 27
- FPIPGXGPPPQFEQ-HPNHMNAASA-N 11-cis-retinol Natural products OCC=C(C)C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-HPNHMNAASA-N 0.000 description 25
- 238000004519 manufacturing process Methods 0.000 description 25
- 150000003254 radicals Chemical class 0.000 description 25
- 230000004083 survival effect Effects 0.000 description 25
- 239000003795 chemical substances by application Substances 0.000 description 24
- 108091008695 photoreceptors Proteins 0.000 description 24
- 230000003405 preventing effect Effects 0.000 description 24
- 230000001603 reducing effect Effects 0.000 description 24
- 125000001841 imino group Chemical group [H]N=* 0.000 description 23
- 238000000338 in vitro Methods 0.000 description 23
- 206010021143 Hypoxia Diseases 0.000 description 22
- 230000007850 degeneration Effects 0.000 description 22
- 230000007954 hypoxia Effects 0.000 description 22
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 22
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 22
- 208000003098 Ganglion Cysts Diseases 0.000 description 21
- 208000005400 Synovial Cyst Diseases 0.000 description 21
- 238000006489 isomerase reaction Methods 0.000 description 21
- 150000001336 alkenes Chemical class 0.000 description 20
- 229910052799 carbon Inorganic materials 0.000 description 20
- 208000028867 ischemia Diseases 0.000 description 19
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 18
- 229910052760 oxygen Inorganic materials 0.000 description 18
- 239000001301 oxygen Chemical group 0.000 description 18
- 238000011282 treatment Methods 0.000 description 18
- 238000009825 accumulation Methods 0.000 description 17
- 206010029113 Neovascularisation Diseases 0.000 description 16
- 125000004450 alkenylene group Chemical group 0.000 description 16
- 210000000411 amacrine cell Anatomy 0.000 description 16
- 230000001965 increasing effect Effects 0.000 description 16
- 238000006317 isomerization reaction Methods 0.000 description 16
- 210000004498 neuroglial cell Anatomy 0.000 description 16
- 101000729271 Homo sapiens Retinoid isomerohydrolase Proteins 0.000 description 15
- 102100031176 Retinoid isomerohydrolase Human genes 0.000 description 15
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000000126 substance Substances 0.000 description 15
- 208000024827 Alzheimer disease Diseases 0.000 description 14
- 102100033356 Lecithin retinol acyltransferase Human genes 0.000 description 14
- 241001465754 Metazoa Species 0.000 description 14
- 206010057430 Retinal injury Diseases 0.000 description 14
- 102100028001 Retinaldehyde-binding protein 1 Human genes 0.000 description 14
- 101710101931 Retinaldehyde-binding protein 1 Proteins 0.000 description 14
- 239000003153 chemical reaction reagent Substances 0.000 description 14
- 230000007423 decrease Effects 0.000 description 14
- 239000003937 drug carrier Substances 0.000 description 14
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 14
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 14
- 108010084957 lecithin-retinol acyltransferase Proteins 0.000 description 14
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 14
- 230000009467 reduction Effects 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 14
- 125000001424 substituent group Chemical group 0.000 description 14
- 230000006378 damage Effects 0.000 description 13
- 210000002287 horizontal cell Anatomy 0.000 description 13
- 239000000543 intermediate Substances 0.000 description 13
- 208000010412 Glaucoma Diseases 0.000 description 12
- 102000010175 Opsin Human genes 0.000 description 12
- 108050001704 Opsin Proteins 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 12
- 238000010171 animal model Methods 0.000 description 12
- 210000004556 brain Anatomy 0.000 description 12
- 230000003247 decreasing effect Effects 0.000 description 12
- 230000002829 reductive effect Effects 0.000 description 12
- 210000001519 tissue Anatomy 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 125000000753 cycloalkyl group Chemical group 0.000 description 11
- 206010012601 diabetes mellitus Diseases 0.000 description 11
- 230000004438 eyesight Effects 0.000 description 11
- 230000006870 function Effects 0.000 description 11
- 230000005764 inhibitory process Effects 0.000 description 11
- 230000002503 metabolic effect Effects 0.000 description 11
- 230000004770 neurodegeneration Effects 0.000 description 11
- 230000008569 process Effects 0.000 description 11
- 230000035899 viability Effects 0.000 description 11
- 208000035719 Maculopathy Diseases 0.000 description 10
- 201000007737 Retinal degeneration Diseases 0.000 description 10
- 125000004122 cyclic group Chemical group 0.000 description 10
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 229960003471 retinol Drugs 0.000 description 10
- 239000011607 retinol Substances 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- 244000201986 Cassia tora Species 0.000 description 9
- 206010012689 Diabetic retinopathy Diseases 0.000 description 9
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 9
- 208000027073 Stargardt disease Diseases 0.000 description 9
- 230000008901 benefit Effects 0.000 description 9
- 150000001721 carbon Chemical group 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000001727 in vivo Methods 0.000 description 9
- 208000014674 injury Diseases 0.000 description 9
- NCAIGTHBQTXTLR-UHFFFAOYSA-N phentermine hydrochloride Chemical compound [Cl-].CC(C)([NH3+])CC1=CC=CC=C1 NCAIGTHBQTXTLR-UHFFFAOYSA-N 0.000 description 9
- 210000001116 retinal neuron Anatomy 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- 206010038933 Retinopathy of prematurity Diseases 0.000 description 8
- 208000027418 Wounds and injury Diseases 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 230000003833 cell viability Effects 0.000 description 8
- 125000004093 cyano group Chemical group *C#N 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- 239000002243 precursor Substances 0.000 description 8
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 8
- 230000004258 retinal degeneration Effects 0.000 description 8
- 210000001210 retinal vessel Anatomy 0.000 description 8
- 201000004569 Blindness Diseases 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 208000022758 Sorsby fundus dystrophy Diseases 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 230000002708 enhancing effect Effects 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 125000001153 fluoro group Chemical group F* 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 108010005264 metarhodopsins Proteins 0.000 description 7
- 208000015122 neurodegenerative disease Diseases 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 230000010410 reperfusion Effects 0.000 description 7
- 239000000790 retinal pigment Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 208000018737 Parkinson disease Diseases 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 206010038848 Retinal detachment Diseases 0.000 description 6
- 208000007014 Retinitis pigmentosa Diseases 0.000 description 6
- 230000002411 adverse Effects 0.000 description 6
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 150000002430 hydrocarbons Chemical group 0.000 description 6
- 208000017532 inherited retinal dystrophy Diseases 0.000 description 6
- 210000001153 interneuron Anatomy 0.000 description 6
- 230000004410 intraocular pressure Effects 0.000 description 6
- 210000004379 membrane Anatomy 0.000 description 6
- 239000012528 membrane Substances 0.000 description 6
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 6
- 230000000750 progressive effect Effects 0.000 description 6
- 210000000844 retinal pigment epithelial cell Anatomy 0.000 description 6
- 125000000946 retinyl group Chemical group [H]C([*])([H])/C([H])=C(C([H])([H])[H])/C([H])=C([H])/C([H])=C(C([H])([H])[H])/C([H])=C([H])/C1=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])C1(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 125000003107 substituted aryl group Chemical group 0.000 description 6
- 208000024891 symptom Diseases 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- 125000000464 thioxo group Chemical group S=* 0.000 description 6
- NCYCYZXNIZJOKI-HPNHMNAASA-N 11Z-retinal Natural products CC(=C/C=O)C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-HPNHMNAASA-N 0.000 description 5
- 208000030507 AIDS Diseases 0.000 description 5
- 101000801643 Homo sapiens Retinal-specific phospholipid-transporting ATPase ABCA4 Proteins 0.000 description 5
- 206010061323 Optic neuropathy Diseases 0.000 description 5
- 208000002158 Proliferative Vitreoretinopathy Diseases 0.000 description 5
- 208000032430 Retinal dystrophy Diseases 0.000 description 5
- NCYCYZXNIZJOKI-OVSJKPMPSA-N Retinaldehyde Chemical compound O=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C NCYCYZXNIZJOKI-OVSJKPMPSA-N 0.000 description 5
- 206010038934 Retinopathy proliferative Diseases 0.000 description 5
- 206010046851 Uveitis Diseases 0.000 description 5
- 208000036142 Viral infection Diseases 0.000 description 5
- 238000003556 assay Methods 0.000 description 5
- 210000003050 axon Anatomy 0.000 description 5
- 125000005884 carbocyclylalkyl group Chemical group 0.000 description 5
- 210000003986 cell retinal photoreceptor Anatomy 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 5
- 208000037765 diseases and disorders Diseases 0.000 description 5
- 230000002255 enzymatic effect Effects 0.000 description 5
- 230000002008 hemorrhagic effect Effects 0.000 description 5
- 208000014188 hereditary optic neuropathy Diseases 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 230000002757 inflammatory effect Effects 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 201000006417 multiple sclerosis Diseases 0.000 description 5
- 208000021971 neovascular inflammatory vitreoretinopathy Diseases 0.000 description 5
- 208000020911 optic nerve disease Diseases 0.000 description 5
- 125000004193 piperazinyl group Chemical group 0.000 description 5
- 125000003386 piperidinyl group Chemical group 0.000 description 5
- 230000006785 proliferative vitreoretinopathy Effects 0.000 description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 5
- 230000004264 retinal detachment Effects 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- 230000009385 viral infection Effects 0.000 description 5
- MVNYXEAZKVOLLN-JBVUFVISSA-N (1r)-3-amino-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-ol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC([C@H](O)CCN)=C1 MVNYXEAZKVOLLN-JBVUFVISSA-N 0.000 description 4
- JMZLSKWRWCNXSD-BXCLKCLZSA-N (e)-2-fluoro-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-en-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(\C=C(\F)CN)=C1 JMZLSKWRWCNXSD-BXCLKCLZSA-N 0.000 description 4
- OQKSTWHBLYTRLR-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]ethanamine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCN)=C1 OQKSTWHBLYTRLR-MDZDMXLPSA-N 0.000 description 4
- GDKGYVQAUIRZBX-VAWYXSNFSA-N 3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]prop-2-yn-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C#CCN)=C1 GDKGYVQAUIRZBX-VAWYXSNFSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- 208000032578 Inherited retinal disease Diseases 0.000 description 4
- 206010025421 Macule Diseases 0.000 description 4
- WPWFMRDPTDEJJA-FAXVYDRBSA-N N-retinylidene-N-retinylethanolamine Chemical group C=1C(\C=C\C=C(/C)\C=C\C=2C(CCCC=2C)(C)C)=CC=[N+](CCO)C=1\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C WPWFMRDPTDEJJA-FAXVYDRBSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 206010038923 Retinopathy Diseases 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- 150000001502 aryl halides Chemical class 0.000 description 4
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical class O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 239000012472 biological sample Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- GKMQWTVAAMITHR-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O.CCC(C)O GKMQWTVAAMITHR-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 210000005056 cell body Anatomy 0.000 description 4
- 230000001413 cellular effect Effects 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 230000003111 delayed effect Effects 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 201000006321 fundus dystrophy Diseases 0.000 description 4
- 229960002989 glutamic acid Drugs 0.000 description 4
- 230000000977 initiatory effect Effects 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 230000007774 longterm Effects 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 238000006213 oxygenation reaction Methods 0.000 description 4
- 230000002093 peripheral effect Effects 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 230000016732 phototransduction Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000003726 retinal derivatives Chemical class 0.000 description 4
- 229910052717 sulfur Chemical group 0.000 description 4
- 239000011593 sulfur Chemical group 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 231100000331 toxic Toxicity 0.000 description 4
- 230000002588 toxic effect Effects 0.000 description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 3
- 208000036443 AIPL1-related retinopathy Diseases 0.000 description 3
- 102100026663 All-trans-retinol dehydrogenase [NAD(+)] ADH7 Human genes 0.000 description 3
- 241000283690 Bos taurus Species 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 201000003533 Leber congenital amaurosis Diseases 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 208000007135 Retinal Neovascularization Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 3
- 150000001345 alkine derivatives Chemical class 0.000 description 3
- 125000004419 alkynylene group Chemical group 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 230000006907 apoptotic process Effects 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 125000005605 benzo group Chemical group 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000005779 cell damage Effects 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 201000006754 cone-rod dystrophy Diseases 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000001514 detection method Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 230000002132 lysosomal effect Effects 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 238000010172 mouse model Methods 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- 208000001491 myopia Diseases 0.000 description 3
- 230000004379 myopia Effects 0.000 description 3
- 239000002858 neurotransmitter agent Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 230000036284 oxygen consumption Effects 0.000 description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 3
- 238000007699 photoisomerization reaction Methods 0.000 description 3
- 208000032253 retinal ischemia Diseases 0.000 description 3
- 108010035291 retinol dehydrogenase Proteins 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 239000003053 toxin Substances 0.000 description 3
- 231100000765 toxin Toxicity 0.000 description 3
- 108700012359 toxins Proteins 0.000 description 3
- 230000004393 visual impairment Effects 0.000 description 3
- JNCYMQSTWYVZCF-IWAYRVGRSA-N (1r)-3-amino-1-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-1-ol Chemical compound NCC[C@@H](O)C1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 JNCYMQSTWYVZCF-IWAYRVGRSA-N 0.000 description 2
- JNCYMQSTWYVZCF-OZSKJFCKSA-N (1s)-3-amino-1-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-1-ol Chemical compound NCC[C@H](O)C1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 JNCYMQSTWYVZCF-OZSKJFCKSA-N 0.000 description 2
- GFQWMSQANCSPPQ-HSBSLETESA-N (2r)-1-amino-3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-2-ol Chemical compound NC[C@H](O)CC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 GFQWMSQANCSPPQ-HSBSLETESA-N 0.000 description 2
- GFQWMSQANCSPPQ-NPQIQWPPSA-N (2s)-1-amino-3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]propan-2-ol Chemical compound NC[C@@H](O)CC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 GFQWMSQANCSPPQ-NPQIQWPPSA-N 0.000 description 2
- ADNOXSJYZLHHRZ-KIRNREEKSA-N (3Z)-3-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]-3-hydrazinylidenepropan-1-amine Chemical compound Cc1cccc(C)c1C=Cc1cccc(C(\CCN)=N/N)c1 ADNOXSJYZLHHRZ-KIRNREEKSA-N 0.000 description 2
- AFAKLPFUAPIXGQ-MBDWYYTESA-N (E)-3-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]prop-2-en-1-amine Chemical compound Cc1cccc(C)c1C=Cc1cccc(\C=C\CN)c1 AFAKLPFUAPIXGQ-MBDWYYTESA-N 0.000 description 2
- CMIVHTLFBIUJTH-MGAHFUHESA-N (NZ)-N-[3-amino-1-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]propylidene]hydroxylamine Chemical compound NCC/C(=N/O)/C1=CC(=CC=C1)C=CC1=C(C=CC=C1C)C CMIVHTLFBIUJTH-MGAHFUHESA-N 0.000 description 2
- NSDOMDWSAGWWBL-ZRDIBKRKSA-N (e)-1-[3-(3-aminopropyl)phenyl]-3-ethylhex-1-en-3-ol Chemical compound CCCC(O)(CC)\C=C\C1=CC=CC(CCCN)=C1 NSDOMDWSAGWWBL-ZRDIBKRKSA-N 0.000 description 2
- WZAMHIIJKHBBSF-ZHACJKMWSA-N (e)-1-[3-(3-aminopropyl)phenyl]-3-ethylpent-1-en-3-ol Chemical compound CCC(O)(CC)\C=C\C1=CC=CC(CCCN)=C1 WZAMHIIJKHBBSF-ZHACJKMWSA-N 0.000 description 2
- VLSXCDGACFQSQF-PKNBQFBNSA-N (e)-1-[3-(3-aminopropyl)phenyl]-3-methylhex-1-en-3-ol Chemical compound CCCC(C)(O)\C=C\C1=CC=CC(CCCN)=C1 VLSXCDGACFQSQF-PKNBQFBNSA-N 0.000 description 2
- HEHHAZWIYHQNJM-MDZDMXLPSA-N (e)-1-[3-(3-aminopropyl)phenyl]hex-1-en-3-ol Chemical compound CCCC(O)\C=C\C1=CC=CC(CCCN)=C1 HEHHAZWIYHQNJM-MDZDMXLPSA-N 0.000 description 2
- XQNSRHAJJXWIKR-XVNBXDOJSA-N (e)-3-[3-(3-aminopropyl)phenyl]prop-2-en-1-ol Chemical compound NCCCC1=CC=CC(\C=C\CO)=C1 XQNSRHAJJXWIKR-XVNBXDOJSA-N 0.000 description 2
- QQKHNSWZQLKIDO-CMDGGOBGSA-N (e)-4-[3-(3-aminopropyl)phenyl]-2-methylbut-3-en-2-ol Chemical compound CC(C)(O)\C=C\C1=CC=CC(CCCN)=C1 QQKHNSWZQLKIDO-CMDGGOBGSA-N 0.000 description 2
- CUVAQHRQKYFPLN-KSAPZYQLSA-N (nz)-n-[3-amino-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylidene]hydroxylamine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(\CCN)=N/O)=C1 CUVAQHRQKYFPLN-KSAPZYQLSA-N 0.000 description 2
- JIPZPRKDXATEBL-JLHYYAGUSA-N 1-[(e)-2-[3-(3-aminopropyl)phenyl]ethenyl]cycloheptan-1-ol Chemical compound NCCCC1=CC=CC(\C=C\C2(O)CCCCCC2)=C1 JIPZPRKDXATEBL-JLHYYAGUSA-N 0.000 description 2
- YEJVSXDBMHCSAA-FMIVXFBMSA-N 1-[(e)-2-[3-(3-aminopropyl)phenyl]ethenyl]cyclohexan-1-ol Chemical compound NCCCC1=CC=CC(\C=C\C2(O)CCCCC2)=C1 YEJVSXDBMHCSAA-FMIVXFBMSA-N 0.000 description 2
- TWLYBERRJWMSJT-DHZHZOJOSA-N 1-[(e)-2-[3-(3-aminopropyl)phenyl]ethenyl]cyclopentan-1-ol Chemical compound NCCCC1=CC=CC(\C=C\C2(O)CCCC2)=C1 TWLYBERRJWMSJT-DHZHZOJOSA-N 0.000 description 2
- GZUHDMIETMZNIN-MDZDMXLPSA-N 1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propane-1,3-diamine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(N)CCN)=C1 GZUHDMIETMZNIN-MDZDMXLPSA-N 0.000 description 2
- NKTKTXUXCAITBD-VAWYXSNFSA-N 1-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-n,n-dimethylmethanamine Chemical compound CN(C)CC1=CC=CC(\C=C\C=2C(=CC=CC=2C)C)=C1 NKTKTXUXCAITBD-VAWYXSNFSA-N 0.000 description 2
- ZHRBINGNIDPHQF-BUHFOSPRSA-N 1-[3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propyl]pyrrolidine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCCN2CCCC2)=C1 ZHRBINGNIDPHQF-BUHFOSPRSA-N 0.000 description 2
- LWJFQTAZQWZGON-PFONDFGASA-N 1-[3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propyl]piperidine Chemical compound CC1=CC=CC(C)=C1\C=C/C1=CC=CC(CCCN2CCCCC2)=C1 LWJFQTAZQWZGON-PFONDFGASA-N 0.000 description 2
- ZHRBINGNIDPHQF-YPKPFQOOSA-N 1-[3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propyl]pyrrolidine Chemical compound CC1=CC=CC(C)=C1\C=C/C1=CC=CC(CCCN2CCCC2)=C1 ZHRBINGNIDPHQF-YPKPFQOOSA-N 0.000 description 2
- PQALEEGHDDHZMT-MDZDMXLPSA-N 1-amino-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-2-ol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(CC(O)CN)=C1 PQALEEGHDDHZMT-MDZDMXLPSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- KSDLTQDAZDWFKK-ZHACJKMWSA-N 2-[(e)-2-[3-(3-aminopropyl)phenyl]ethenyl]phenol Chemical compound NCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2)O)=C1 KSDLTQDAZDWFKK-ZHACJKMWSA-N 0.000 description 2
- DRHCFRQFKCNMCN-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenoxy]ethanamine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(OCCN)=C1 DRHCFRQFKCNMCN-MDZDMXLPSA-N 0.000 description 2
- GOBTZDDLKTZYBH-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]ethanamine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(CCN)=C1 GOBTZDDLKTZYBH-MDZDMXLPSA-N 0.000 description 2
- JXMWFGDSUMHILQ-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]sulfanylethanamine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(SCCN)=C1 JXMWFGDSUMHILQ-MDZDMXLPSA-N 0.000 description 2
- CDVGWPIVOINQCB-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]sulfinylethanamine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(S(=O)CCN)=C1 CDVGWPIVOINQCB-MDZDMXLPSA-N 0.000 description 2
- ONRQGKXNZHJUFA-MDZDMXLPSA-N 2-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]sulfonylethanamine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(S(=O)(=O)CCN)=C1 ONRQGKXNZHJUFA-MDZDMXLPSA-N 0.000 description 2
- AETORJPTIHURGC-VAWYXSNFSA-N 2-[3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propylamino]ethanol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(CCCNCCO)=C1 AETORJPTIHURGC-VAWYXSNFSA-N 0.000 description 2
- QSYKFFVERNGYGE-MDZDMXLPSA-N 2-[[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]methylamino]ethanol Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CNCCO)=C1 QSYKFFVERNGYGE-MDZDMXLPSA-N 0.000 description 2
- FXWOEVCVWRWPQP-MDZDMXLPSA-N 2-amino-1-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]ethanol Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(C(O)CN)=C1 FXWOEVCVWRWPQP-MDZDMXLPSA-N 0.000 description 2
- FPTVZUBIWQGPBX-MDZDMXLPSA-N 2-amino-n-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]acetamide Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(NC(=O)CN)=C1 FPTVZUBIWQGPBX-MDZDMXLPSA-N 0.000 description 2
- FZMULJKCXUYTRU-MDZDMXLPSA-N 2-amino-n-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]acetamide Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(NC(=O)CN)=C1 FZMULJKCXUYTRU-MDZDMXLPSA-N 0.000 description 2
- SHXWCVYOXRDMCX-UHFFFAOYSA-N 3,4-methylenedioxymethamphetamine Chemical compound CNC(C)CC1=CC=C2OCOC2=C1 SHXWCVYOXRDMCX-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- JWLLQTVCCCMPPU-BUHFOSPRSA-N 3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCC1=CC=CC(\C=C\C=2C(=CC=CC=2C)C)=C1 JWLLQTVCCCMPPU-BUHFOSPRSA-N 0.000 description 2
- ZAIOJCJMZKCELI-OUKQBFOZSA-N 3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-n-methylpropan-1-amine Chemical compound CNCCCC1=CC=CC(\C=C\C=2C(=CC=CC=2C)C)=C1 ZAIOJCJMZKCELI-OUKQBFOZSA-N 0.000 description 2
- ORCWBXAPGMTKGI-OUKQBFOZSA-N 3-[3-[(e)-2-cycloheptylethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C2CCCCCC2)=C1 ORCWBXAPGMTKGI-OUKQBFOZSA-N 0.000 description 2
- FTTGXOXGHQOGFL-VAWYXSNFSA-N 3-[3-[(e)-2-cyclohexylethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C2CCCCC2)=C1 FTTGXOXGHQOGFL-VAWYXSNFSA-N 0.000 description 2
- USEKNVKYSIYZOO-ZHACJKMWSA-N 3-[3-[(e)-2-cyclopentylethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C\C2CCCC2)=C1 USEKNVKYSIYZOO-ZHACJKMWSA-N 0.000 description 2
- AZSQWTFLGQISGL-XBXARRHUSA-N 3-[3-[(e)-3-methoxyprop-1-enyl]phenyl]propan-1-amine Chemical compound COC\C=C\C1=CC=CC(CCCN)=C1 AZSQWTFLGQISGL-XBXARRHUSA-N 0.000 description 2
- YVZJGLCOOBNTSC-RMKNXTFCSA-N 3-[3-[(e)-hept-1-enyl]phenyl]propan-1-amine Chemical compound CCCCC\C=C\C1=CC=CC(CCCN)=C1 YVZJGLCOOBNTSC-RMKNXTFCSA-N 0.000 description 2
- WZLGJPFVKKGSPB-GZTJUZNOSA-N 3-[3-[(e)-non-4-en-5-yl]phenyl]propan-1-amine Chemical compound CCCC\C(=C/CCC)C1=CC=CC(CCCN)=C1 WZLGJPFVKKGSPB-GZTJUZNOSA-N 0.000 description 2
- HAQXUGGJYHMFOB-QPJJXVBHSA-N 3-[3-[(e)-pent-1-enyl]phenyl]propan-1-amine Chemical compound CCC\C=C\C1=CC=CC(CCCN)=C1 HAQXUGGJYHMFOB-QPJJXVBHSA-N 0.000 description 2
- JWLLQTVCCCMPPU-YPKPFQOOSA-N 3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCC1=CC=CC(\C=C/C=2C(=CC=CC=2C)C)=C1 JWLLQTVCCCMPPU-YPKPFQOOSA-N 0.000 description 2
- ZAIOJCJMZKCELI-SEYXRHQNSA-N 3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]-n-methylpropan-1-amine Chemical compound CNCCCC1=CC=CC(\C=C/C=2C(=CC=CC=2C)C)=C1 ZAIOJCJMZKCELI-SEYXRHQNSA-N 0.000 description 2
- ZDQHOHLUNXUQHK-SEYXRHQNSA-N 3-[3-[(z)-2-(2-propoxyphenyl)ethenyl]phenyl]propan-1-amine Chemical compound CCCOC1=CC=CC=C1\C=C/C1=CC=CC(CCCN)=C1 ZDQHOHLUNXUQHK-SEYXRHQNSA-N 0.000 description 2
- LGLOMWKWZRFVPM-QXMHVHEDSA-N 3-[3-[(z)-2-(3-methoxynaphthalen-2-yl)ethenyl]phenyl]propan-1-amine Chemical compound COC1=CC2=CC=CC=C2C=C1\C=C/C1=CC=CC(CCCN)=C1 LGLOMWKWZRFVPM-QXMHVHEDSA-N 0.000 description 2
- JCRJEGIYIWJLQS-SREVYHEPSA-N 3-[3-[(z)-2-(4-chlorophenyl)ethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C/C=2C=CC(Cl)=CC=2)=C1 JCRJEGIYIWJLQS-SREVYHEPSA-N 0.000 description 2
- ZEVVCNAXJAQWFP-QXMHVHEDSA-N 3-[3-[(z)-2-[2-(2-methoxyethoxy)phenyl]ethenyl]phenyl]propan-1-amine Chemical compound COCCOC1=CC=CC=C1\C=C/C1=CC=CC(CCCN)=C1 ZEVVCNAXJAQWFP-QXMHVHEDSA-N 0.000 description 2
- NXDBEZGJSOCPAL-YPKPFQOOSA-N 3-[3-[(z)-2-naphthalen-1-ylethenyl]phenyl]propan-1-amine Chemical compound NCCCC1=CC=CC(\C=C/C=2C3=CC=CC=C3C=CC=2)=C1 NXDBEZGJSOCPAL-YPKPFQOOSA-N 0.000 description 2
- RXVRCNUGGRIQOS-UHFFFAOYSA-N 3-[3-[2-(2,6-dimethylphenyl)ethenyl]phenyl]-3-hydroxypropanimidamide Chemical compound CC1=CC=CC(C)=C1C=CC1=CC=CC(C(O)CC(N)=N)=C1 RXVRCNUGGRIQOS-UHFFFAOYSA-N 0.000 description 2
- BUUMFQMGBUREOX-MDZDMXLPSA-N 3-amino-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-one Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(=O)CCN)=C1 BUUMFQMGBUREOX-MDZDMXLPSA-N 0.000 description 2
- RBRQNNZLCPSMMQ-VAWYXSNFSA-N 3-amino-2,2-dimethyl-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-one Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(=O)C(C)(C)CN)=C1 RBRQNNZLCPSMMQ-VAWYXSNFSA-N 0.000 description 2
- MPBBVYAEAAQSRC-MDZDMXLPSA-N 3-amino-2-fluoro-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-one Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(=O)C(F)CN)=C1 MPBBVYAEAAQSRC-MDZDMXLPSA-N 0.000 description 2
- OGYCIYIBRQOPIT-ZHACJKMWSA-N 3-amino-2-methyl-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-one Chemical compound NCC(C)C(=O)C1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 OGYCIYIBRQOPIT-ZHACJKMWSA-N 0.000 description 2
- UUOVDTILMFEMMT-UHFFFAOYSA-N 3-hydroxy-3-[3-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propanimidamide Chemical compound CC1(C)CCCC(C)=C1C=CC1=CC=CC(C(O)CC(N)=N)=C1 UUOVDTILMFEMMT-UHFFFAOYSA-N 0.000 description 2
- SWELBYUDHIFUBI-ZHACJKMWSA-N 3-methoxy-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound NCCC(OC)C1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 SWELBYUDHIFUBI-ZHACJKMWSA-N 0.000 description 2
- FEYOSYWCENBTJX-VAWYXSNFSA-N 3-methoxy-n-methyl-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound CNCCC(OC)C1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 FEYOSYWCENBTJX-VAWYXSNFSA-N 0.000 description 2
- UHFQKWZTHVORII-MDZDMXLPSA-N 4,4,4-trifluoro-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]butan-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(CCN)C(F)(F)F)=C1 UHFQKWZTHVORII-MDZDMXLPSA-N 0.000 description 2
- HGAFCTJJXJRDBW-DHZHZOJOSA-N 4-[(e)-2-[3-(2-aminoethoxy)phenyl]ethenyl]heptan-4-ol Chemical compound CCCC(O)(CCC)\C=C\C1=CC=CC(OCCN)=C1 HGAFCTJJXJRDBW-DHZHZOJOSA-N 0.000 description 2
- YKDDVFPUWDDOOM-JLHYYAGUSA-N 4-[(e)-2-[3-(3-aminopropyl)phenyl]ethenyl]heptan-4-ol Chemical compound CCCC(O)(CCC)\C=C\C1=CC=CC(CCCN)=C1 YKDDVFPUWDDOOM-JLHYYAGUSA-N 0.000 description 2
- OIOADURUGJUHOS-OUKQBFOZSA-N 4-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]butan-2-amine Chemical compound CC(N)CCC1=CC=CC(\C=C\C=2C(CCCC=2C)(C)C)=C1 OIOADURUGJUHOS-OUKQBFOZSA-N 0.000 description 2
- HIDRUQLHXXDKSO-OUKQBFOZSA-N 4-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]butan-1-amine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCCCN)=C1 HIDRUQLHXXDKSO-OUKQBFOZSA-N 0.000 description 2
- IWPIWJMSAYHJPN-VAWYXSNFSA-N 4-[3-[3-[(e)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propyl]morpholine Chemical compound CC1=CC=CC(C)=C1\C=C\C1=CC=CC(CCCN2CCOCC2)=C1 IWPIWJMSAYHJPN-VAWYXSNFSA-N 0.000 description 2
- IWPIWJMSAYHJPN-QXMHVHEDSA-N 4-[3-[3-[(z)-2-(2,6-dimethylphenyl)ethenyl]phenyl]propyl]morpholine Chemical compound CC1=CC=CC(C)=C1\C=C/C1=CC=CC(CCCN2CCOCC2)=C1 IWPIWJMSAYHJPN-QXMHVHEDSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 108010083590 Apoproteins Proteins 0.000 description 2
- 102000006410 Apoproteins Human genes 0.000 description 2
- 102000010565 Apoptosis Regulatory Proteins Human genes 0.000 description 2
- 108010063104 Apoptosis Regulatory Proteins Proteins 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 108091005462 Cation channels Proteins 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- 108020004414 DNA Proteins 0.000 description 2
- 206010012289 Dementia Diseases 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 206010061818 Disease progression Diseases 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 208000012902 Nervous system disease Diseases 0.000 description 2
- 208000025966 Neurological disease Diseases 0.000 description 2
- 208000001140 Night Blindness Diseases 0.000 description 2
- 208000008589 Obesity Diseases 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- ASNFTDCKZKHJSW-REOHCLBHSA-N Quisqualic acid Chemical compound OC(=O)[C@@H](N)CN1OC(=O)NC1=O ASNFTDCKZKHJSW-REOHCLBHSA-N 0.000 description 2
- 102100033617 Retinal-specific phospholipid-transporting ATPase ABCA4 Human genes 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000278713 Theora Species 0.000 description 2
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 2
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 2
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 2
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 2
- 208000000208 Wet Macular Degeneration Diseases 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- KIQMYNGEZASHGH-MDZDMXLPSA-N [3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]methanamine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(CN)=C1 KIQMYNGEZASHGH-MDZDMXLPSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 210000001742 aqueous humor Anatomy 0.000 description 2
- 229940009098 aspartate Drugs 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 230000030833 cell death Effects 0.000 description 2
- 208000037887 cell injury Diseases 0.000 description 2
- 201000005667 central retinal vein occlusion Diseases 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 210000003161 choroid Anatomy 0.000 description 2
- 235000019504 cigarettes Nutrition 0.000 description 2
- 210000004240 ciliary body Anatomy 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 230000001010 compromised effect Effects 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 210000001787 dendrite Anatomy 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 238000003745 diagnosis Methods 0.000 description 2
- 230000005750 disease progression Effects 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 230000008029 eradication Effects 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 229940093499 ethyl acetate Drugs 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 238000012606 in vitro cell culture Methods 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- SHGAZHPCJJPHSC-XFYACQKRSA-N isotretinoin Chemical compound OC(=O)/C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-XFYACQKRSA-N 0.000 description 2
- 229960005280 isotretinoin Drugs 0.000 description 2
- 230000004301 light adaptation Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 230000003340 mental effect Effects 0.000 description 2
- 210000003470 mitochondria Anatomy 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 210000003061 neural cell Anatomy 0.000 description 2
- 230000016273 neuron death Effects 0.000 description 2
- 235000020824 obesity Nutrition 0.000 description 2
- 210000001328 optic nerve Anatomy 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical class [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 230000008506 pathogenesis Effects 0.000 description 2
- 230000007170 pathology Effects 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 210000000063 presynaptic terminal Anatomy 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 210000001176 projection neuron Anatomy 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 230000000979 retarding effect Effects 0.000 description 2
- 230000004233 retinal vasculature Effects 0.000 description 2
- 208000004644 retinal vein occlusion Diseases 0.000 description 2
- 235000020944 retinol Nutrition 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 210000000130 stem cell Anatomy 0.000 description 2
- 230000035882 stress Effects 0.000 description 2
- 210000004895 subcellular structure Anatomy 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- YAPQBXQYLJRXSA-UHFFFAOYSA-N theobromine Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000011269 treatment regimen Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 235000019155 vitamin A Nutrition 0.000 description 2
- 239000011719 vitamin A Substances 0.000 description 2
- 229940045997 vitamin a Drugs 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- YFYNOWXBIBKGHB-FBCQKBJTSA-N (1s,3r)-1-aminocyclopentane-1,3-dicarboxylic acid Chemical compound OC(=O)[C@]1(N)CC[C@@H](C(O)=O)C1 YFYNOWXBIBKGHB-FBCQKBJTSA-N 0.000 description 1
- KYLUAQBYONVMCP-UHFFFAOYSA-N (2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P KYLUAQBYONVMCP-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- ILYSIVSSNXQZQG-OVSJKPMPSA-N (2e,4e,6e,8e)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine Chemical compound NC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C ILYSIVSSNXQZQG-OVSJKPMPSA-N 0.000 description 1
- IRJCBFDCFXCWGO-BYPYZUCNSA-N (2s)-2-amino-2-(3-oxo-1,2-oxazol-5-yl)acetic acid Chemical compound OC(=O)[C@@H](N)C1=CC(=O)NO1 IRJCBFDCFXCWGO-BYPYZUCNSA-N 0.000 description 1
- MYUPODARKKQONN-NPQIQWPPSA-N (2s)-3-[3-[(e)-2-(2,6-dichlorophenyl)ethenyl]phenyl]-2-fluoropropan-1-amine Chemical compound NC[C@@H](F)CC1=CC=CC(\C=C\C=2C(=CC=CC=2Cl)Cl)=C1 MYUPODARKKQONN-NPQIQWPPSA-N 0.000 description 1
- ZAPIUEIQSYXBEM-UOBXZYDMSA-N (3z)-3-hydrazinylidene-3-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]propan-1-amine Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(\CCN)=N/N)=C1 ZAPIUEIQSYXBEM-UOBXZYDMSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N 1,1'-Carbonyldiimidazole Substances C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 125000005987 1-oxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- RBXQXOPQBYVQIS-MDZDMXLPSA-N 2-amino-1-[3-[(e)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]phenyl]ethanol Chemical compound CC1(C)CCCC(C)=C1\C=C\C1=CC=CC(C(O)CN)=C1 RBXQXOPQBYVQIS-MDZDMXLPSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ZOOGRGPOEVQQDX-UUOKFMHZSA-N 3',5'-cyclic GMP Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=C(NC2=O)N)=C2N=C1 ZOOGRGPOEVQQDX-UUOKFMHZSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 102000043966 ABC-type transporter activity proteins Human genes 0.000 description 1
- 108010006533 ATP-Binding Cassette Transporters Proteins 0.000 description 1
- 208000021959 Abnormal metabolism Diseases 0.000 description 1
- 102100026882 Alpha-synuclein Human genes 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102000013455 Amyloid beta-Peptides Human genes 0.000 description 1
- 108010090849 Amyloid beta-Peptides Proteins 0.000 description 1
- 235000002198 Annona diversifolia Nutrition 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 208000031104 Arterial Occlusive disease Diseases 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 208000000412 Avitaminosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 208000014644 Brain disease Diseases 0.000 description 1
- 101100240519 Caenorhabditis elegans nhr-13 gene Proteins 0.000 description 1
- 108010028326 Calbindin 2 Proteins 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- 102100021849 Calretinin Human genes 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- 108091006146 Channels Proteins 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 206010010356 Congenital anomaly Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FMGYKKMPNATWHP-UHFFFAOYSA-N Cyperquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=CC=C1 FMGYKKMPNATWHP-UHFFFAOYSA-N 0.000 description 1
- 102000000634 Cytochrome c oxidase subunit IV Human genes 0.000 description 1
- 108090000365 Cytochrome-c oxidases Proteins 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- ASNFTDCKZKHJSW-UHFFFAOYSA-N DL-Quisqualic acid Natural products OC(=O)C(N)CN1OC(=O)NC1=O ASNFTDCKZKHJSW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 208000030453 Drug-Related Side Effects and Adverse reaction Diseases 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 108010057573 Flavoproteins Proteins 0.000 description 1
- 102000003983 Flavoproteins Human genes 0.000 description 1
- 208000036357 GUCY2D-related recessive retinopathy Diseases 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 208000008069 Geographic Atrophy Diseases 0.000 description 1
- JZNWSCPGTDBMEW-UHFFFAOYSA-N Glycerophosphorylethanolamin Natural products NCCOP(O)(=O)OCC(O)CO JZNWSCPGTDBMEW-UHFFFAOYSA-N 0.000 description 1
- 101100043639 Glycine max ACPD gene Proteins 0.000 description 1
- 241000282575 Gorilla Species 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 238000007341 Heck reaction Methods 0.000 description 1
- 206010019899 Hereditary retinal dystrophy Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010021135 Hypovitaminosis Diseases 0.000 description 1
- IRJCBFDCFXCWGO-UHFFFAOYSA-N Ibotenic acid Natural products OC(=O)C(N)C1=CC(=O)NO1 IRJCBFDCFXCWGO-UHFFFAOYSA-N 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 229940118465 Isomerase inhibitor Drugs 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- 239000004201 L-cysteine Substances 0.000 description 1
- 235000013878 L-cysteine Nutrition 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- 241000282838 Lama Species 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 208000001344 Macular Edema Diseases 0.000 description 1
- 206010025415 Macular oedema Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- 108010006519 Molecular Chaperones Proteins 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 206010067013 Normal tension glaucoma Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000282579 Pan Species 0.000 description 1
- 241000287127 Passeridae Species 0.000 description 1
- 241000282405 Pongo abelii Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- 241000283080 Proboscidea <mammal> Species 0.000 description 1
- 102000003923 Protein Kinase C Human genes 0.000 description 1
- 108090000315 Protein Kinase C Proteins 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 208000019155 Radiation injury Diseases 0.000 description 1
- 206010038926 Retinopathy hypertensive Diseases 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 101001010097 Shigella phage SfV Bactoprenol-linked glucose translocase Proteins 0.000 description 1
- 241000700584 Simplexvirus Species 0.000 description 1
- 238000003477 Sonogashira cross-coupling reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 102000019197 Superoxide Dismutase Human genes 0.000 description 1
- 108010012715 Superoxide dismutase Proteins 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 241000282458 Ursus sp. Species 0.000 description 1
- 206010058990 Venous occlusion Diseases 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 208000010011 Vitamin A Deficiency Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000000475 acetylene derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 210000003766 afferent neuron Anatomy 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000019194 all-trans-retinaldehyde Nutrition 0.000 description 1
- 239000011751 all-trans-retinaldehyde Substances 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- VLSMHEGGTFMBBZ-UHFFFAOYSA-N alpha-Kainic acid Natural products CC(=C)C1CNC(C(O)=O)C1CC(O)=O VLSMHEGGTFMBBZ-UHFFFAOYSA-N 0.000 description 1
- 108090000185 alpha-Synuclein Proteins 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 208000021328 arterial occlusion Diseases 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- YEESUBCSWGVPCE-UHFFFAOYSA-N azanylidyneoxidanium iron(2+) pentacyanide Chemical compound [Fe++].[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.N#[O+] YEESUBCSWGVPCE-UHFFFAOYSA-N 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005870 benzindolyl group Chemical group 0.000 description 1
- 125000005873 benzo[d]thiazolyl group Chemical group 0.000 description 1
- 125000000928 benzodioxinyl group Chemical group O1C(=COC2=C1C=CC=C2)* 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000005878 benzonaphthofuranyl group Chemical group 0.000 description 1
- 125000005872 benzooxazolyl group Chemical group 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 230000000035 biogenic effect Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 230000003925 brain function Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 210000001775 bruch membrane Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- ILAJWURWJKXJPW-UHFFFAOYSA-N butanedioic acid;octanedioic acid Chemical class OC(=O)CCC(O)=O.OC(=O)CCCCCCC(O)=O ILAJWURWJKXJPW-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 102000014823 calbindin Human genes 0.000 description 1
- 108060001061 calbindin Proteins 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 108091092356 cellular DNA Proteins 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 210000004081 cilia Anatomy 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000004456 color vision Effects 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000005507 decahydroisoquinolyl group Chemical group 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000003412 degenerative effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000013118 diabetic mouse model Methods 0.000 description 1
- 125000005509 dibenzothiophenyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 210000002451 diencephalon Anatomy 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-N dimethyl(phenyl)phosphine Chemical compound CP(C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-N 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 150000004141 diterpene derivatives Chemical group 0.000 description 1
- 125000005883 dithianyl group Chemical group 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 208000011325 dry age related macular degeneration Diseases 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- 238000007336 electrophilic substitution reaction Methods 0.000 description 1
- 239000002158 endotoxin Substances 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000928 excitatory amino acid agonist Substances 0.000 description 1
- 210000001723 extracellular space Anatomy 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000005714 functional activity Effects 0.000 description 1
- 125000003844 furanonyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 208000014216 genetic macular dystrophy Diseases 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 229940049906 glutamate Drugs 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 208000035474 group of disease Diseases 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000002706 hydrostatic effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 201000001948 hypertensive retinopathy Diseases 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000006882 induction of apoptosis Effects 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 210000000554 iris Anatomy 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 239000003394 isomerase inhibitor Substances 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 230000000366 juvenile effect Effects 0.000 description 1
- VLSMHEGGTFMBBZ-OOZYFLPDSA-N kainic acid Chemical compound CC(=C)[C@H]1CN[C@H](C(O)=O)[C@H]1CC(O)=O VLSMHEGGTFMBBZ-OOZYFLPDSA-N 0.000 description 1
- 229950006874 kainic acid Drugs 0.000 description 1
- 150000002561 ketenes Chemical class 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229920006008 lipopolysaccharide Polymers 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 208000018769 loss of vision Diseases 0.000 description 1
- 231100000864 loss of vision Toxicity 0.000 description 1
- 201000002978 low tension glaucoma Diseases 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 210000003712 lysosome Anatomy 0.000 description 1
- 230000001868 lysosomic effect Effects 0.000 description 1
- 230000002080 lysosomotropic effect Effects 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 201000010230 macular retinal edema Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000002595 magnetic resonance imaging Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 230000006371 metabolic abnormality Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000037323 metabolic rate Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 229960001252 methamphetamine Drugs 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 210000004088 microvessel Anatomy 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000004973 motor coordination Effects 0.000 description 1
- 210000002161 motor neuron Anatomy 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 210000000663 muscle cell Anatomy 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- NOUUUQMKVOUUNR-UHFFFAOYSA-N n,n'-diphenylethane-1,2-diamine Chemical compound C=1C=CC=CC=1NCCNC1=CC=CC=C1 NOUUUQMKVOUUNR-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 210000000461 neuroepithelial cell Anatomy 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 229960002460 nitroprusside Drugs 0.000 description 1
- 231100001221 nontumorigenic Toxicity 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 125000005060 octahydroindolyl group Chemical group N1(CCC2CCCCC12)* 0.000 description 1
- 125000005061 octahydroisoindolyl group Chemical group C1(NCC2CCCCC12)* 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 231100000590 oncogenic Toxicity 0.000 description 1
- 230000002246 oncogenic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000003534 oscillatory effect Effects 0.000 description 1
- 210000004205 output neuron Anatomy 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000004792 oxidative damage Effects 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- DIVDFFZHCJEHGG-UHFFFAOYSA-N oxidopamine Chemical compound NCCC1=CC(O)=C(O)C=C1O DIVDFFZHCJEHGG-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 238000002496 oximetry Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000242 pagocytic effect Effects 0.000 description 1
- UVBXZOISXNZBLY-UHFFFAOYSA-L palladium(2+);triphenylphosphane;diacetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UVBXZOISXNZBLY-UHFFFAOYSA-L 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000008447 perception Effects 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- PHEDXBVPIONUQT-RGYGYFBISA-N phorbol 13-acetate 12-myristate Chemical compound C([C@]1(O)C(=O)C(C)=C[C@H]1[C@@]1(O)[C@H](C)[C@H]2OC(=O)CCCCCCCCCCCCC)C(CO)=C[C@H]1[C@H]1[C@]2(OC(C)=O)C1(C)C PHEDXBVPIONUQT-RGYGYFBISA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000008104 phosphatidylethanolamines Chemical class 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000001443 photoexcitation Effects 0.000 description 1
- 231100000760 phototoxic Toxicity 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 150000004291 polyenes Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 230000001242 postsynaptic effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 238000004393 prognosis Methods 0.000 description 1
- 230000007425 progressive decline Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000006410 propenylene group Chemical group 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 238000011552 rat model Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 210000003370 receptor cell Anatomy 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 208000014733 refractive error Diseases 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004243 retinal function Effects 0.000 description 1
- 108010021975 retinal isomerase Proteins 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 210000004358 rod cell outer segment Anatomy 0.000 description 1
- 229940080817 rotenone Drugs 0.000 description 1
- JUVIOZPCNVVQFO-UHFFFAOYSA-N rotenone Natural products O1C2=C3CC(C(C)=C)OC3=CC=C2C(=O)C2C1COC1=C2C=C(OC)C(OC)=C1 JUVIOZPCNVVQFO-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 231100000241 scar Toxicity 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical class OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 210000002955 secretory cell Anatomy 0.000 description 1
- 230000009758 senescence Effects 0.000 description 1
- 210000001044 sensory neuron Anatomy 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000007958 sleep Effects 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 210000002301 subretinal fluid Anatomy 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229940032362 superoxide dismutase Drugs 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 210000001138 tear Anatomy 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229960004559 theobromine Drugs 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000011285 therapeutic regimen Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- 230000008736 traumatic injury Effects 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- CMSYDJVRTHCWFP-UHFFFAOYSA-N triphenylphosphane;hydrobromide Chemical compound Br.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 CMSYDJVRTHCWFP-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-O triphenylphosphanium Chemical compound C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-O 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005455 trithianyl group Chemical group 0.000 description 1
- 239000002550 vasoactive agent Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
- 208000030401 vitamin deficiency disease Diseases 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
- A61K31/137—Arylalkylamines, e.g. amphetamine, epinephrine, salbutamol, ephedrine or methadone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/145—Amines having sulfur, e.g. thiurams (>N—C(S)—S—C(S)—N< and >N—C(S)—S—S—C(S)—N<), Sulfinylamines (—N=SO), Sulfonylamines (—N=SO2)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/165—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide
- A61K31/167—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide having the nitrogen of a carboxamide group directly attached to the aromatic ring, e.g. lidocaine, paracetamol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4453—Non condensed piperidines, e.g. piperocaine only substituted in position 1, e.g. propipocaine, diperodon
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/10—Ophthalmic agents for accommodation disorders, e.g. myopia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/27—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring having amino groups linked to the six-membered aromatic ring by saturated carbon chains
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/28—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring having amino groups linked to the six-membered aromatic ring by unsaturated carbon chains
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/29—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/08—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic with only one hydroxy group and one amino group bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/22—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated
- C07C215/28—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
- C07C215/30—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings containing hydroxy groups and carbon atoms of six-membered aromatic rings bound to the same carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/42—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having amino groups or hydroxy groups bound to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/46—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/08—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom
- C07C217/10—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/16—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring not being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/48—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/62—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms linked by carbon chains having at least three carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/64—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms
- C07C217/66—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms with singly-bound oxygen atoms and six-membered aromatic rings bound to the same carbon atom of the carbon chain
- C07C217/72—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by singly-bound oxygen atoms with singly-bound oxygen atoms and six-membered aromatic rings bound to the same carbon atom of the carbon chain linked by carbon chains having at least three carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/04—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being saturated
- C07C225/06—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being saturated and acyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
- C07C225/18—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings the carbon skeleton containing also rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C233/04—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C233/05—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/28—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/33—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to a carbon atom of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
- C07D295/03—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring with the ring nitrogen atoms directly attached to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/14—All rings being cycloaliphatic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/14—All rings being cycloaliphatic
- C07C2602/16—All rings being cycloaliphatic the ring system containing five carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Emergency Medicine (AREA)
- Pain & Pain Management (AREA)
- Ophthalmology & Optometry (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US91324107P | 2007-04-20 | 2007-04-20 | |
| US93700207P | 2007-06-22 | 2007-06-22 | |
| PCT/US2008/061073 WO2008131368A2 (en) | 2007-04-20 | 2008-04-21 | Styrenyl derivative compounds for treating ophthalmic diseases and disorders |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL201285A0 IL201285A0 (en) | 2010-05-31 |
| IL201285A true IL201285A (en) | 2014-11-30 |
Family
ID=39876187
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL201285A IL201285A (en) | 2007-04-20 | 2009-10-01 | Stirnyl derivative compounds and preparations containing them |
Country Status (16)
| Country | Link |
|---|---|
| US (7) | US20090170841A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP2076124A4 (cg-RX-API-DMAC7.html) |
| JP (1) | JP5371953B2 (cg-RX-API-DMAC7.html) |
| KR (2) | KR20120137513A (cg-RX-API-DMAC7.html) |
| CN (1) | CN101686665B (cg-RX-API-DMAC7.html) |
| AU (1) | AU2008242626B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BRPI0810063A2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2681850C (cg-RX-API-DMAC7.html) |
| CO (1) | CO6251201A2 (cg-RX-API-DMAC7.html) |
| EC (1) | ECSP099695A (cg-RX-API-DMAC7.html) |
| IL (1) | IL201285A (cg-RX-API-DMAC7.html) |
| MX (1) | MX2009011360A (cg-RX-API-DMAC7.html) |
| MY (1) | MY161818A (cg-RX-API-DMAC7.html) |
| RU (1) | RU2494089C2 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2008131368A2 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA200907313B (cg-RX-API-DMAC7.html) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2681850C (en) * | 2007-04-20 | 2013-07-23 | Acucela Inc. | Styrenyl derivative compounds for treating ophthalmic diseases and disorders |
| MY156662A (en) | 2007-11-01 | 2016-03-15 | Acucela Inc | Amine derivative compounds for treating ophthalmic diseases and disorders |
| JP5773877B2 (ja) | 2008-10-22 | 2015-09-02 | アキュセラ インコーポレイテッド | 眼の疾患及び障害を治療する化合物 |
| WO2012150208A1 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Verwendung von substituierten benzylalkoholestern der cyclopropancarbonsäure zur bekämpfung von insektizid-resistenten insekten |
| WO2013082000A1 (en) * | 2011-11-30 | 2013-06-06 | Bikam Pharmaceuticals, Inc. | Opsin-binding ligands, compositions and methods of use |
| EP2804605A4 (en) | 2012-01-20 | 2015-07-08 | Acucela Inc | SUBSTITUTED HETEROCYCLIC COMPOUNDS FOR THE TREATMENT OF DISEASES |
| TW201406707A (zh) | 2012-05-04 | 2014-02-16 | Acucela Inc | 用以治療糖尿病性視網膜病變及其他眼部疾病之方法 |
| EP2867225B1 (en) * | 2012-06-28 | 2017-08-09 | Novartis AG | Pyrrolidine derivatives and their use as complement pathway modulators |
| CN104379579B (zh) * | 2012-06-28 | 2017-03-08 | 诺华股份有限公司 | 吡咯烷衍生物及其作为补体途径调节剂的用途 |
| MX2014015738A (es) * | 2012-06-28 | 2015-08-06 | Novartis Ag | Derivados de pirrolidina y su uso como moduladores de la senda del complemento. |
| ES2644700T3 (es) * | 2012-06-28 | 2017-11-30 | Novartis Ag | Derivados de pirrolidina y su uso como moduladores de la ruta del complemento |
| RU2515502C1 (ru) * | 2012-12-21 | 2014-05-10 | федеральное государственное автономное образовательное учреждение высшего профессионального образования "Московский физико-технический институт (государственный университет) | Поверхностно-активный фотосенсибилизатор, представляющий собой бромид 2-{ 4-[(е)-2-(4-этоксифенил)винил]фенокси} -n, n, n-триметилэтаманамина (с-таб) |
| US11286233B2 (en) | 2017-05-09 | 2022-03-29 | Ambient Photonics, Inc. | Stilbene derivatives for the treatment of CNS and other disorders |
| WO2019103989A1 (en) * | 2017-11-22 | 2019-05-31 | Temple University-Of The Commonwealth System Of Higher Education | Novel functionalized n,n-dialkylamino phenyl ethers and their method of use |
| CN110938003B (zh) * | 2018-09-25 | 2022-11-22 | 新发药业有限公司 | 一种芬戈莫德盐酸盐的制备方法 |
| CN112920081B (zh) * | 2021-02-06 | 2023-01-31 | 许昌学院 | 一种选择性识别次氯酸的荧光探针及其制备方法和应用 |
| WO2024196850A1 (en) * | 2023-03-17 | 2024-09-26 | University Of Southern California | Development of highly fluorogenic styrene probes for visualizing rna in live cells |
Family Cites Families (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB815211A (en) | 1957-08-13 | 1959-06-17 | Bayer Ag | Basic ethers |
| US2566360A (en) * | 1948-08-30 | 1951-09-04 | Schering Corp | Aminoalkyl ethers of pyridyl alkylene aryl compounds |
| CH368181A (de) * | 1956-11-13 | 1963-03-31 | Geigy Ag J R | Verfahren zur Herstellung von N-Aminoalkylderivaten von Azepinen |
| US3095449A (en) * | 1957-08-06 | 1963-06-25 | Bayer Ag | 1-(gamma-dimethylaminopropoxy)-2-alkoxy alkenylbenzenes |
| NL255316A (cg-RX-API-DMAC7.html) | 1959-08-28 | |||
| US3746768A (en) * | 1970-10-02 | 1973-07-17 | Scm Corp | Substituted phenyl ethers and thioethers as insect repellents |
| GB1433595A (en) * | 1972-07-06 | 1976-04-28 | Ici Ltd | Alkanolamine derivatives |
| DE2547524A1 (de) * | 1975-10-23 | 1977-04-28 | Bayer Ag | Disubstituierte phenolaether des 3-amino-2-hydroxypropans, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4569354A (en) | 1982-03-22 | 1986-02-11 | Boston University | Method and apparatus for measuring natural retinal fluorescence |
| FR2558158B1 (fr) * | 1984-01-13 | 1986-05-16 | Roussel Uclaf | Derives de l'indole ethenyl phenol, leurs sels, procede de preparation, application a titre de medicaments, compositions les renfermant et intermediaires |
| US4861897A (en) * | 1987-06-22 | 1989-08-29 | Ortho Pharmaceutical Corporation | 2-Aryloxyalkylaminobenzoxazoles and 2-aryloxyalkylaminobenzothiazoles |
| US5217999A (en) * | 1987-12-24 | 1993-06-08 | Yissum Research Development Company Of The Hebrew University Of Jerusalem | Styryl compounds which inhibit EGF receptor protein tyrosine kinase |
| US5141959A (en) * | 1990-09-21 | 1992-08-25 | Bristol-Myers Squibb Company | Isoprenoid phospholipase a2 inhibitors and preparations comprising same |
| TW334418B (en) * | 1995-03-07 | 1998-06-21 | Ajinomoto Kk | Stilbene derivatives and pharmaceutical compositions |
| JP3163391B2 (ja) * | 1995-03-07 | 2001-05-08 | 味の素株式会社 | スチルベン誘導体及びそれを含有する制癌剤 |
| US5641750A (en) | 1995-11-29 | 1997-06-24 | Amgen Inc. | Methods for treating photoreceptors using glial cell line-derived neurotrophic factor (GDNF) protein product |
| US6090624A (en) * | 1996-04-19 | 2000-07-18 | Brown University Research Foundation | Immortalized retinal cell lines and their applications |
| FR2747690B1 (fr) * | 1996-04-19 | 1998-06-12 | Neurotech Sa | Lignees immortalisees de cellules retiniennes et leurs applications au traitement de differents troubles primaires ou secondaires ophtalmologiques ou neurologiques |
| US6878544B2 (en) | 1996-04-19 | 2005-04-12 | Neurotech Sa | Retinal cell lines with extended life-span and their applications |
| NZ334148A (en) * | 1996-08-12 | 2001-12-21 | Celgene Corp | 3-Substituted phenyl-ethyl or ethenyl derivatives terminated with a nitrile, alkane, carboxyl or carbamoyl group useful to reduce cytokine levels |
| AUPO235996A0 (en) | 1996-09-16 | 1996-10-10 | Garvan Institute Of Medical Research | Method of cell culture |
| CA2216439A1 (en) * | 1996-09-25 | 1998-03-25 | Derek Van Der Kooy | Pharmaceuticals containing retinal stem cells |
| US6713300B1 (en) * | 1997-02-27 | 2004-03-30 | University Of Utah Research Foundation | Nucleic acid and amino acid sequences for ATP-binding cassette transporter and methods of screening for agents that modify ATP-binding cassette transporter |
| WO1999029279A2 (en) | 1997-12-05 | 1999-06-17 | The Board Of Trustees Of The Leland Stanford Junior University | Long-term survival and regeneration of central nervous system neurons |
| JP2003524391A (ja) | 1999-01-05 | 2003-08-19 | アバンテイス・フアルマ・エス・アー | アストロサイト、その製造およびその使用 |
| AU6391000A (en) | 1999-07-28 | 2001-02-19 | Genentech Inc. | Method of preventing the injury or death of retinal cells and treating ocular diseases |
| EP1107003A1 (en) | 1999-12-09 | 2001-06-13 | Trophos | Methods for screening compounds active on neurons |
| US6406840B1 (en) * | 1999-12-17 | 2002-06-18 | Biomosaic Systems, Inc. | Cell arrays and the uses thereof |
| AU2001251083A1 (en) * | 2000-03-31 | 2001-10-15 | Ortho-Mcneil Pharmaceutical, Inc. | Method for using 2-aryloxyalkylaminobenzoxazoles and 2-aryloxyalkylaminobenzothiazoles as h3 antagonists |
| DE10021246A1 (de) | 2000-04-25 | 2001-10-31 | Schering Ag | Substituierte Benzoesäureamide und deren Verwendung als Arzneimittel |
| WO2001083714A2 (en) | 2000-05-02 | 2001-11-08 | Central Institute For The Deaf | Composition and methods for treating photoreceptor degeneration |
| US20020009713A1 (en) | 2000-05-11 | 2002-01-24 | Miller Freda D. | Methods for identifying modulators of neuronal growth |
| EP1351912A2 (en) * | 2000-12-21 | 2003-10-15 | Cancer Research Ventures Limited | Substituted stilbenes, their reactions and anticancer activity |
| US20030032078A1 (en) * | 2001-01-23 | 2003-02-13 | Board Of Regents, The University Of Texas System | Methods and compositions for the treatment of macular and retinal degenerations |
| DE10141018A1 (de) | 2001-08-22 | 2003-03-13 | Eth Zuerich Eidgenoessische Te | Verwendung von negativ geladenen Phospholipiden, sowie Zusammensetzungen umfassend Phospholipide zur Behandlung des Auges |
| EP1438281A4 (en) * | 2001-10-26 | 2006-04-26 | Oxigene Inc | FUNCTIONALIZED STILBENE DERIVATIVES USEFUL AS IMPROVED VASCULAR TARGETING AGENTS |
| AU2002319899A1 (en) * | 2002-06-25 | 2004-01-06 | Raju Gokaraju Ganga | Novel resveratrol analogs |
| AU2003249227A1 (en) * | 2002-07-12 | 2004-02-02 | University Of Washington | Methods and systems for extended in vitro culture of neuronal cells |
| CN1717234A (zh) * | 2002-12-06 | 2006-01-04 | 爱尔康公司 | 用于治疗眼紊乱和疾病的超氧化物岐化酶模拟物 |
| WO2004056806A1 (en) * | 2002-12-19 | 2004-07-08 | Pfizer Inc. | 2-(1h-indazol-6-ylamino)-benzamide compounds as protein kinases inhibitors useful for the treatment of ophtalmic diseases |
| JP3793759B2 (ja) | 2003-03-07 | 2006-07-05 | 憲敬 谷水 | 有孔パネル構体及びその製造方法 |
| US7399776B2 (en) * | 2003-04-02 | 2008-07-15 | Taigen Biotechnology | Polyamine compounds for treating chemokine receptor mediated diseases |
| US20050074497A1 (en) * | 2003-04-09 | 2005-04-07 | Schultz Clyde L. | Hydrogels used to deliver medicaments to the eye for the treatment of posterior segment diseases |
| WO2004101505A1 (en) * | 2003-05-14 | 2004-11-25 | Novo Nordisk A/S | Novel compounds for treatment of obesity |
| CA2534123A1 (en) | 2003-07-30 | 2005-02-10 | Acucela, Inc. | Extended primary retinal cell culture and stress models, and methods of use |
| WO2005025498A2 (en) * | 2003-09-08 | 2005-03-24 | Corus Pharma | Substituted acetanilides and benzamides for the treatment of asthma and pulmonary inflammation |
| TW200529812A (en) | 2003-12-26 | 2005-09-16 | Chugai Pharmaceutical Co Ltd | Benzamide derivatives |
| US7706863B2 (en) | 2004-01-21 | 2010-04-27 | University Of Washington | Methods for assessing a physiological state of a mammalian retina |
| US20080176952A1 (en) * | 2004-02-17 | 2008-07-24 | Rando Robert R | Management of Ophthalmologic Disorders, Including Macular Degeneration |
| JP2007525496A (ja) * | 2004-02-17 | 2007-09-06 | プレジデント・アンド・フェロウズ・オブ・ハーバード・カレッジ | 黄班変性症を含む眼科疾患の管理 |
| US7566808B2 (en) * | 2004-02-17 | 2009-07-28 | President And Fellows Of Harvard College | Management of ophthalmologic disorders, including macular degeneration |
| NZ587006A (en) * | 2004-06-18 | 2011-12-22 | Univ Washington | 11-cis-Retinal derivatives and methods for the use thereof for the treatment of visual disorders |
| DE102004034957A1 (de) * | 2004-07-16 | 2006-02-02 | Carl Zeiss Jena Gmbh | Anordnung zur mikroskopischen Beobachtung und/oder Detektion und Verwendung |
| CA2584845C (en) * | 2004-12-08 | 2009-02-17 | Sirion Therapeutics, Inc. | Methods, assays and compositions for treating retinol-related diseases |
| WO2006091761A1 (en) * | 2005-02-24 | 2006-08-31 | University Of Washington | Methods for treatment of retinal degenerative disease |
| US8098907B2 (en) | 2005-07-01 | 2012-01-17 | Siemens Corporation | Method and system for local adaptive detection of microaneurysms in digital fundus images |
| JP2009524684A (ja) | 2006-01-26 | 2009-07-02 | アキュセラ, インコーポレイテッド | 眼疾患および障害の治療のための組成物および方法 |
| CN100398624C (zh) | 2006-03-24 | 2008-07-02 | 大连理工大学 | 高分子配位接枝的碱土铝酸盐长余辉发光材料及制备方法 |
| CA2681850C (en) | 2007-04-20 | 2013-07-23 | Acucela Inc. | Styrenyl derivative compounds for treating ophthalmic diseases and disorders |
-
2008
- 2008-04-21 CA CA2681850A patent/CA2681850C/en not_active Expired - Fee Related
- 2008-04-21 CN CN200880021041.1A patent/CN101686665B/zh not_active Expired - Fee Related
- 2008-04-21 EP EP08746483A patent/EP2076124A4/en not_active Withdrawn
- 2008-04-21 MY MYPI20094213A patent/MY161818A/en unknown
- 2008-04-21 JP JP2010504313A patent/JP5371953B2/ja not_active Expired - Fee Related
- 2008-04-21 KR KR1020127030994A patent/KR20120137513A/ko not_active Withdrawn
- 2008-04-21 MX MX2009011360A patent/MX2009011360A/es active IP Right Grant
- 2008-04-21 BR BRPI0810063-2A2A patent/BRPI0810063A2/pt not_active IP Right Cessation
- 2008-04-21 RU RU2009136911/04A patent/RU2494089C2/ru not_active IP Right Cessation
- 2008-04-21 KR KR1020097024142A patent/KR101368248B1/ko not_active Expired - Fee Related
- 2008-04-21 AU AU2008242626A patent/AU2008242626B2/en not_active Ceased
- 2008-04-21 WO PCT/US2008/061073 patent/WO2008131368A2/en not_active Ceased
- 2008-04-21 US US12/107,040 patent/US20090170841A1/en not_active Abandoned
-
2009
- 2009-10-01 IL IL201285A patent/IL201285A/en not_active IP Right Cessation
- 2009-10-16 EC EC2009009695A patent/ECSP099695A/es unknown
- 2009-10-19 ZA ZA2009/07313A patent/ZA200907313B/en unknown
- 2009-10-20 CO CO09117150A patent/CO6251201A2/es not_active Application Discontinuation
-
2012
- 2012-01-27 US US13/360,285 patent/US8420863B2/en not_active Expired - Fee Related
-
2013
- 2013-03-07 US US13/789,259 patent/US8653142B2/en not_active Expired - Fee Related
-
2015
- 2015-02-25 US US14/631,711 patent/US10201545B2/en active Active
- 2015-02-25 US US14/630,897 patent/US9421210B2/en not_active Expired - Fee Related
- 2015-02-25 US US14/630,889 patent/US9314467B2/en not_active Expired - Fee Related
-
2016
- 2016-03-16 US US15/072,250 patent/US20160193160A1/en not_active Abandoned
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8420863B2 (en) | Styrenyl derivative compounds for treating ophthalmic diseases and disorders | |
| US9464033B2 (en) | Alkynyl phenyl derivative compounds for treating ophthalmic diseases and disorders | |
| US9193669B2 (en) | Compounds for treating ophthalmic diseases and disorders | |
| AU2012204132B2 (en) | Styrenyl derivative compounds for treating ophthalmic diseases and disorders | |
| AU2016201178A1 (en) | Styrenyl derivative compounds for treating ophthalmic diseases and disorders |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| MM9K | Patent not in force due to non-payment of renewal fees |