IE57306B1 - Preparation of 3-(amino or substituted amino)-4-(substituted amino)-1,2,5,-thiadiazoles - Google Patents
Preparation of 3-(amino or substituted amino)-4-(substituted amino)-1,2,5,-thiadiazolesInfo
- Publication number
- IE57306B1 IE57306B1 IE651/84A IE65184A IE57306B1 IE 57306 B1 IE57306 B1 IE 57306B1 IE 651/84 A IE651/84 A IE 651/84A IE 65184 A IE65184 A IE 65184A IE 57306 B1 IE57306 B1 IE 57306B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- compound
- alkyl
- amino
- thiadiazole
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 35
- 150000001875 compounds Chemical class 0.000 claims abstract description 101
- 239000012453 solvate Substances 0.000 claims abstract description 30
- 150000003839 salts Chemical class 0.000 claims abstract description 27
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 22
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 22
- RDJGIQPSSNMJPF-UHFFFAOYSA-N ethanediimidamide Chemical class NC(=N)C(N)=N RDJGIQPSSNMJPF-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000004677 hydrates Chemical class 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 80
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 48
- -1 methylenedioxy Chemical group 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 125000006308 propyl amino group Chemical group 0.000 claims description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 27
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 239000003960 organic solvent Substances 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 8
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 8
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- QYIWBOWEQBEAGP-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1SN1C(=O)C2=CC=CC=C2C1=O QYIWBOWEQBEAGP-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 5
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- DRGIXHISBNDJEL-UHFFFAOYSA-N 3-n-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCC2)=C1 DRGIXHISBNDJEL-UHFFFAOYSA-N 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 3
- 125000005943 1,2,3,6-tetrahydropyridyl group Chemical group 0.000 claims description 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- LBNPMRUENVBXOR-UHFFFAOYSA-N 2-n'-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]ethanediimidamide Chemical compound C1=NC(OCCCNC(=N)C(=N)N)=CC(CN2CCCCC2)=C1 LBNPMRUENVBXOR-UHFFFAOYSA-N 0.000 claims 1
- 229940125904 compound 1 Drugs 0.000 claims 1
- 101150009274 nhr-1 gene Proteins 0.000 claims 1
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract description 3
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 abstract 1
- 239000003699 antiulcer agent Substances 0.000 abstract 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 40
- 239000000047 product Substances 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 26
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 26
- 239000000243 solution Substances 0.000 description 22
- 239000000203 mixture Substances 0.000 description 18
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 17
- 229960001340 histamine Drugs 0.000 description 13
- UDGKZGLPXCRRAM-UHFFFAOYSA-N 1,2,5-thiadiazole Chemical compound C=1C=NSN=1 UDGKZGLPXCRRAM-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 10
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZZGPYPVNEPAJHG-UHFFFAOYSA-N 1,2,5-thiadiazole 1-oxide Chemical compound O=S1N=CC=N1 ZZGPYPVNEPAJHG-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 210000002837 heart atrium Anatomy 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 7
- 229960001380 cimetidine Drugs 0.000 description 7
- 230000002496 gastric effect Effects 0.000 description 7
- 230000028327 secretion Effects 0.000 description 7
- 241000700199 Cavia porcellus Species 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 5
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 231100000673 dose–response relationship Toxicity 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- KXOFUUASPAGCPE-UHFFFAOYSA-N ethanediimidamide trihydrochloride Chemical compound Cl.Cl.Cl.C(C(N)=N)(N)=N KXOFUUASPAGCPE-UHFFFAOYSA-N 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 229940044551 receptor antagonist Drugs 0.000 description 4
- 239000002464 receptor antagonist Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- DUPAVAVETJQPOR-UHFFFAOYSA-N 1-oxo-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 DUPAVAVETJQPOR-UHFFFAOYSA-N 0.000 description 3
- MIUWQWMRZOEFEX-UHFFFAOYSA-N 3-n-benzyl-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C=1C=CC(CN2CCCCC2)=CC=1OCCCNC1=NSN=C1NCC1=CC=CC=C1 MIUWQWMRZOEFEX-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- GCPNDUGDDPCEAY-UHFFFAOYSA-N 2-n'-[2-[[5-[(dimethylamino)methyl]thiophen-3-yl]methylsulfanyl]ethyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.CN(C)CC1=CC(CSCCNC(=N)C(N)=N)=CS1 GCPNDUGDDPCEAY-UHFFFAOYSA-N 0.000 description 2
- JRHOBGUKGKDYFU-UHFFFAOYSA-N 3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 JRHOBGUKGKDYFU-UHFFFAOYSA-N 0.000 description 2
- FIGKQXOGRKFRGS-UHFFFAOYSA-N 3-n-[3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=N1 FIGKQXOGRKFRGS-UHFFFAOYSA-N 0.000 description 2
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 2
- 206010065713 Gastric Fistula Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 230000001746 atrial effect Effects 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000010009 beating Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 238000002513 implantation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 150000003464 sulfur compounds Chemical class 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000002627 tracheal intubation Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- YOTIBQOCCYWJMZ-UHFFFAOYSA-N 1,2,5-thiadiazole 1,1-dioxide Chemical compound O=S1(=O)N=CC=N1 YOTIBQOCCYWJMZ-UHFFFAOYSA-N 0.000 description 1
- SOQFZXMZMHODLD-UHFFFAOYSA-N 1,2,5-thiadiazolidine Chemical compound C1CNSN1 SOQFZXMZMHODLD-UHFFFAOYSA-N 0.000 description 1
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 1
- DSHMLZMUXJZPGA-UHFFFAOYSA-N 1-(1,2,4-triazol-1-ylsulfanyl)-1,2,4-triazole Chemical compound C1=NC=NN1SN1C=NC=N1 DSHMLZMUXJZPGA-UHFFFAOYSA-N 0.000 description 1
- YVBWBXBLUUCYER-UHFFFAOYSA-N 1-(2,5-dioxopyrrolidin-1-yl)sulfanylpyrrolidine-2,5-dione Chemical compound O=C1CCC(=O)N1SN1C(=O)CCC1=O YVBWBXBLUUCYER-UHFFFAOYSA-N 0.000 description 1
- XSJGCCZBIPAMPM-UHFFFAOYSA-N 1-(benzimidazol-1-ylsulfanyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1SN1C2=CC=CC=C2N=C1 XSJGCCZBIPAMPM-UHFFFAOYSA-N 0.000 description 1
- NFPDNSMAFDHAHK-UHFFFAOYSA-N 1-(benzotriazol-1-ylsulfanyl)benzotriazole Chemical compound N1=NC2=CC=CC=C2N1SN1C2=CC=CC=C2N=N1 NFPDNSMAFDHAHK-UHFFFAOYSA-N 0.000 description 1
- PWWIWFJRQSXNDA-UHFFFAOYSA-N 1-imidazol-1-ylsulfanylimidazole Chemical compound C1=CN=CN1SN1C=CN=C1 PWWIWFJRQSXNDA-UHFFFAOYSA-N 0.000 description 1
- AHJMOFANVWLNNR-UHFFFAOYSA-N 1-oxo-3-n-[2-[[4-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCSCC1=CC(CN2CCCCC2)=CC=N1 AHJMOFANVWLNNR-UHFFFAOYSA-N 0.000 description 1
- XFJHNGFEVKBQCA-UHFFFAOYSA-N 1-oxo-3-n-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCC2)=C1 XFJHNGFEVKBQCA-UHFFFAOYSA-N 0.000 description 1
- VOEMYPMXKXCFCF-UHFFFAOYSA-N 1-oxo-3-n-[3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=N1 VOEMYPMXKXCFCF-UHFFFAOYSA-N 0.000 description 1
- NMNIHVKUIGROBN-UHFFFAOYSA-N 1-oxo-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-4-prop-2-ynyl-1,2,5-thiadiazol-3-amine Chemical compound O=S1N=C(CC#C)C(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 NMNIHVKUIGROBN-UHFFFAOYSA-N 0.000 description 1
- SLCZNGZFOVAAED-UHFFFAOYSA-N 2-aminoethanimidamide;dihydrobromide Chemical compound Br.Br.NCC(N)=N SLCZNGZFOVAAED-UHFFFAOYSA-N 0.000 description 1
- LSZMVESSGLHDJE-UHFFFAOYSA-N 2-bromo-4-methylpyridine Chemical compound CC1=CC=NC(Br)=C1 LSZMVESSGLHDJE-UHFFFAOYSA-N 0.000 description 1
- WTAURALGPQDIDB-UHFFFAOYSA-N 2-chloro-6-methylpyridine Chemical compound CC1=C[C]=CC(Cl)=N1 WTAURALGPQDIDB-UHFFFAOYSA-N 0.000 description 1
- ZJISWUHWDYNKFX-UHFFFAOYSA-N 2-n'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCCC2)=C1 ZJISWUHWDYNKFX-UHFFFAOYSA-N 0.000 description 1
- KULYHDQCRCSIHF-UHFFFAOYSA-N 2-n'-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCC2)=C1 KULYHDQCRCSIHF-UHFFFAOYSA-N 0.000 description 1
- GXUPWFDCTMTLFJ-UHFFFAOYSA-N 2-n'-benzyl-1-n'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.C=1C=CC=CC=1CN=C(N)C(N)=NCCCOC(C=1)=CC=CC=1CN1CCCCC1 GXUPWFDCTMTLFJ-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- QAFXMKWXHAGIMR-UHFFFAOYSA-N 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)sulfanyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound O=C1C(C)(C)NC(=O)N1SN1C(=O)C(C)(C)NC1=O QAFXMKWXHAGIMR-UHFFFAOYSA-N 0.000 description 1
- AVFWSRPBBZUMQK-UHFFFAOYSA-N 3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN1CCCC1 AVFWSRPBBZUMQK-UHFFFAOYSA-N 0.000 description 1
- AAEOEVRPMYKMKS-UHFFFAOYSA-N 3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound C1=NC(OCCCN)=CC(CN2CCCCC2)=C1 AAEOEVRPMYKMKS-UHFFFAOYSA-N 0.000 description 1
- WEKYWIBCHONDBC-UHFFFAOYSA-N 3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCCC2)=N1 WEKYWIBCHONDBC-UHFFFAOYSA-N 0.000 description 1
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 1
- WRNHJGPNEUJTDB-UHFFFAOYSA-N 3-n-[(6-methylpyridin-3-yl)methyl]-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C1=NC(C)=CC=C1CNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 WRNHJGPNEUJTDB-UHFFFAOYSA-N 0.000 description 1
- GKOTVAAPBWUUDR-UHFFFAOYSA-N 3-n-[2-[[4-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CC(CN2CCCCC2)=CC=N1 GKOTVAAPBWUUDR-UHFFFAOYSA-N 0.000 description 1
- GSKUHCYANQAPDQ-UHFFFAOYSA-N 3-n-[2-[[5-[(dimethylamino)methyl]-4-methylthiophen-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1=C(CN(C)C)SC(CSCCNC=2C(=NSN=2)N)=C1 GSKUHCYANQAPDQ-UHFFFAOYSA-N 0.000 description 1
- BAIOIUXJZQHHST-UHFFFAOYSA-N 3-n-[2-[[5-[(dimethylamino)methyl]thiophen-3-yl]methylsulfanyl]ethyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound S1C(CN(C)C)=CC(CSCCNC=2C(=NS(=O)N=2)N)=C1 BAIOIUXJZQHHST-UHFFFAOYSA-N 0.000 description 1
- RHPQYKPBHCAVNL-UHFFFAOYSA-N 3-n-[2-[[6-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CC=CC(CN2CCCCC2)=N1 RHPQYKPBHCAVNL-UHFFFAOYSA-N 0.000 description 1
- BIHKIFICPIILPI-UHFFFAOYSA-N 3-n-[3-[3-(diethylaminomethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CCN(CC)CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 BIHKIFICPIILPI-UHFFFAOYSA-N 0.000 description 1
- SSTYCGCTOJCTIB-UHFFFAOYSA-N 3-n-[3-[3-[(2-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1CCCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 SSTYCGCTOJCTIB-UHFFFAOYSA-N 0.000 description 1
- SSGNTSIJJRKNEV-UHFFFAOYSA-N 3-n-[3-[3-[(3-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C1C(C)CCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 SSGNTSIJJRKNEV-UHFFFAOYSA-N 0.000 description 1
- CQTYNLYKUZFXOC-UHFFFAOYSA-N 3-n-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 CQTYNLYKUZFXOC-UHFFFAOYSA-N 0.000 description 1
- QFIBCDPEQSLPBP-UHFFFAOYSA-N 3-n-[3-[3-[(dimethylamino)methyl]phenyl]sulfanylpropyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(SCCCNC=2C(=NS(=O)N=2)N)=C1 QFIBCDPEQSLPBP-UHFFFAOYSA-N 0.000 description 1
- FTQNYNLEKXCHPJ-UHFFFAOYSA-N 3-n-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC(CN2CCCCC2)=CC=N1 FTQNYNLEKXCHPJ-UHFFFAOYSA-N 0.000 description 1
- NOUYKLMMPLVAEB-UHFFFAOYSA-N 3-n-[3-[6-[(dimethylamino)methyl]pyridin-2-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=N1 NOUYKLMMPLVAEB-UHFFFAOYSA-N 0.000 description 1
- DGCCBFCPKIIWKR-UHFFFAOYSA-N 4-n-methyl-1-oxo-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CNC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 DGCCBFCPKIIWKR-UHFFFAOYSA-N 0.000 description 1
- XGRRSCZJFCJRGY-UHFFFAOYSA-N 4-n-methyl-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 XGRRSCZJFCJRGY-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101100233050 Caenorhabditis elegans ima-1 gene Proteins 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010016717 Fistula Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 1
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 1
- 239000007836 KH2PO4 Substances 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001260 acyclic compounds Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RIMGDBZXWSGBQN-UHFFFAOYSA-N burimamide Chemical compound CNC(=S)NCCCCC1=CN=C[N]1 RIMGDBZXWSGBQN-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000881 depressing effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 230000003890 fistula Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- WRUGWIBCXHJTDG-UHFFFAOYSA-L magnesium sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Mg+2].[O-]S([O-])(=O)=O WRUGWIBCXHJTDG-UHFFFAOYSA-L 0.000 description 1
- 238000013289 male long evans rat Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- GGHDAUPFEBTORZ-UHFFFAOYSA-N propane-1,1-diamine Chemical class CCC(N)N GGHDAUPFEBTORZ-UHFFFAOYSA-N 0.000 description 1
- 239000012521 purified sample Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000006215 rectal suppository Substances 0.000 description 1
- 229940100618 rectal suppository Drugs 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- RKBCYCFRFCNLTO-UHFFFAOYSA-N triisopropylamine Chemical compound CC(C)N(C(C)C)C(C)C RKBCYCFRFCNLTO-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/10—1,2,5-Thiadiazoles; Hydrogenated 1,2,5-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/475,985 US4440933A (en) | 1983-03-16 | 1983-03-16 | Process for preparing 1,2,5-thiadiazoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE840651L IE840651L (en) | 1984-09-16 |
| IE57306B1 true IE57306B1 (en) | 1992-07-15 |
Family
ID=23890020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE651/84A IE57306B1 (en) | 1983-03-16 | 1984-03-15 | Preparation of 3-(amino or substituted amino)-4-(substituted amino)-1,2,5,-thiadiazoles |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4440933A (Direct) |
| KR (1) | KR860002036B1 (Direct) |
| CA (1) | CA1207763A (Direct) |
| CS (1) | CS241072B2 (Direct) |
| DD (1) | DD218364A5 (Direct) |
| DK (1) | DK155984A (Direct) |
| ES (1) | ES530590A0 (Direct) |
| FI (1) | FI79848C (Direct) |
| GR (1) | GR81826B (Direct) |
| HU (1) | HU198925B (Direct) |
| IE (1) | IE57306B1 (Direct) |
| LU (1) | LU85254A1 (Direct) |
| NO (1) | NO158136C (Direct) |
| YU (1) | YU45597B (Direct) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4588826A (en) * | 1982-03-29 | 1986-05-13 | Bristol-Myers Company | Ethanediimidamide intermediates |
| US4595758A (en) * | 1982-03-29 | 1986-06-17 | Bristol-Myers Company | Ethanediimidamide intermediates |
| US4600779A (en) * | 1982-03-29 | 1986-07-15 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4578471A (en) * | 1982-03-29 | 1986-03-25 | Bristol-Myers Company | Substituted amino alkyl pyridyl ethanediimidamides |
| AU2222083A (en) * | 1982-12-14 | 1984-06-21 | Smith Kline & French Laboratories Limited | Pyridine derivatives |
| US4644006A (en) * | 1984-06-22 | 1987-02-17 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4692531A (en) * | 1984-06-22 | 1987-09-08 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| CA1275097A (en) * | 1984-10-02 | 1990-10-09 | Fujio Nohara | Pyridyloxy derivatives |
| DE3513184A1 (de) * | 1985-04-12 | 1986-10-16 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 1,3,4-thiadiazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US5248673A (en) * | 1992-12-23 | 1993-09-28 | Bristol-Myers Squibb Co. | Bisamidine derivatives as thrombin inhibitors |
| US5618816A (en) * | 1995-03-02 | 1997-04-08 | Bristol-Myers Squibb Company | Antimigraine 1,2,5-thiadiazole derivatives of indolylalkyl-pyridnyl and pyrimidinylpiperazines |
| TW200517114A (en) | 2003-10-15 | 2005-06-01 | Combinatorx Inc | Methods and reagents for the treatment of immunoinflammatory disorders |
| EP2218442A1 (en) | 2005-11-09 | 2010-08-18 | CombinatoRx, Inc. | Methods, compositions, and kits for the treatment of ophthalmic disorders |
| WO2010021681A2 (en) * | 2008-08-18 | 2010-02-25 | Combinatorx (Singapore) Pte. Ltd. | Compositions and methods for treatment of viral diseases |
| US20110130711A1 (en) * | 2009-11-19 | 2011-06-02 | Follica, Inc. | Hair growth treatment |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL189197C (nl) * | 1979-09-04 | 1993-02-01 | Bristol Myers Squibb Co | 3,4-digesubstitueerde-1,2,5-thiadiazool-1-oxiden en 1,1-dioxiden, bereiding daarvan alsmede farmaceutische preparaten. |
| DE3175201D1 (en) * | 1980-04-30 | 1986-10-02 | Merck & Co Inc | Aminothiadiazoles as gastric secretion inhibitors |
| US4394508A (en) * | 1980-06-07 | 1983-07-19 | Bristol-Myers Company | Chemical compounds |
| US4380639A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Substituted 1,2,5-thiadiazole derivatives |
| US4380638A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Chemical compounds |
-
1983
- 1983-03-16 US US06/475,985 patent/US4440933A/en not_active Expired - Fee Related
-
1984
- 1984-03-12 NO NO840929A patent/NO158136C/no unknown
- 1984-03-13 FI FI841009A patent/FI79848C/fi not_active IP Right Cessation
- 1984-03-14 DK DK155984A patent/DK155984A/da not_active Application Discontinuation
- 1984-03-14 ES ES530590A patent/ES530590A0/es active Granted
- 1984-03-15 IE IE651/84A patent/IE57306B1/en not_active IP Right Cessation
- 1984-03-15 GR GR74113A patent/GR81826B/el unknown
- 1984-03-15 CA CA000449644A patent/CA1207763A/en not_active Expired
- 1984-03-15 LU LU85254A patent/LU85254A1/de unknown
- 1984-03-15 HU HU841026A patent/HU198925B/hu not_active IP Right Cessation
- 1984-03-15 CS CS841859A patent/CS241072B2/cs unknown
- 1984-03-16 KR KR1019840001362A patent/KR860002036B1/ko not_active Expired
- 1984-03-16 YU YU46984A patent/YU45597B/sh unknown
- 1984-03-16 DD DD84260980A patent/DD218364A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| YU45597B (sh) | 1992-07-20 |
| ES8602721A1 (es) | 1985-12-01 |
| HU198925B (en) | 1989-12-28 |
| CS241072B2 (en) | 1986-03-13 |
| LU85254A1 (de) | 1984-11-14 |
| GR81826B (Direct) | 1984-12-12 |
| KR840008005A (ko) | 1984-12-12 |
| CA1207763A (en) | 1986-07-15 |
| ES530590A0 (es) | 1985-12-01 |
| IE840651L (en) | 1984-09-16 |
| FI79848B (fi) | 1989-11-30 |
| FI841009L (fi) | 1984-09-17 |
| CS185984A2 (en) | 1985-06-13 |
| FI79848C (fi) | 1990-03-12 |
| NO158136B (no) | 1988-04-11 |
| DK155984D0 (da) | 1984-03-14 |
| NO840929L (no) | 1984-09-17 |
| KR860002036B1 (ko) | 1986-11-17 |
| DD218364A5 (de) | 1985-02-06 |
| FI841009A0 (fi) | 1984-03-13 |
| NO158136C (no) | 1988-07-20 |
| US4440933A (en) | 1984-04-03 |
| YU46984A (en) | 1986-10-31 |
| DK155984A (da) | 1984-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI76795C (fi) | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara 3,4-disubstituerade 1,2,5-tiadiazol-1-oxider och -1,1-dioxider samt nya mellanprodukter. | |
| IE57306B1 (en) | Preparation of 3-(amino or substituted amino)-4-(substituted amino)-1,2,5,-thiadiazoles | |
| IE53274B1 (en) | Chemical compounds derived from cyclobutene | |
| US4528375A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4528378A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4600779A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4528377A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4692531A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| US4588826A (en) | Ethanediimidamide intermediates | |
| NZ203726A (en) | 3,4,diamino-1,2,5,thiadiazole derivatives and pharmaceutical compositions | |
| US4395553A (en) | Chemical compounds | |
| US4578471A (en) | Substituted amino alkyl pyridyl ethanediimidamides | |
| US4595758A (en) | Ethanediimidamide intermediates | |
| US4517366A (en) | Intermediates for preparing 3,4-diamino-1,2,5-thiadiazoles | |
| CA1253144A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine h.sub.2-receptor antagonist activity | |
| US4644006A (en) | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity | |
| KR880002530B1 (ko) | 치환된 에탄디이미드 아미드 및 그의 제조방법 | |
| GB2038798A (en) | (Hydroxymethyl imidazolyl) methylthioethyl guanidine derivatives | |
| CY1448A (en) | Chemical intermediates derived from cyclobutene | |
| EP0673925A1 (en) | Acetamide derivative | |
| NO880872L (no) | Fremgangsmaate til fremstilling av en kjemisk forbindelse. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |