IE41484B1 - Water-soluble benzene azo pyrazolone reactive monoazo dyestuffs processes for their preparation and use - Google Patents
Water-soluble benzene azo pyrazolone reactive monoazo dyestuffs processes for their preparation and useInfo
- Publication number
- IE41484B1 IE41484B1 IE1426/75A IE142675A IE41484B1 IE 41484 B1 IE41484 B1 IE 41484B1 IE 1426/75 A IE1426/75 A IE 1426/75A IE 142675 A IE142675 A IE 142675A IE 41484 B1 IE41484 B1 IE 41484B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- formula
- group
- acid
- parts
- Prior art date
Links
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims abstract description 10
- -1 benzene azo pyrazolone Chemical compound 0.000 title claims description 41
- 238000000034 method Methods 0.000 title claims description 32
- 238000002360 preparation method Methods 0.000 title description 4
- 238000004043 dyeing Methods 0.000 claims abstract description 22
- 238000006243 chemical reaction Methods 0.000 claims abstract description 20
- 238000007639 printing Methods 0.000 claims abstract description 12
- 239000002657 fibrous material Substances 0.000 claims abstract description 10
- 230000008878 coupling Effects 0.000 claims abstract description 9
- 238000010168 coupling process Methods 0.000 claims abstract description 9
- 238000005859 coupling reaction Methods 0.000 claims abstract description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims abstract description 9
- 239000004952 Polyamide Substances 0.000 claims abstract description 5
- 239000004744 fabric Substances 0.000 claims abstract description 5
- 229920002647 polyamide Polymers 0.000 claims abstract description 5
- 229920002635 polyurethane Polymers 0.000 claims abstract description 5
- 239000004814 polyurethane Substances 0.000 claims abstract description 5
- 210000002268 wool Anatomy 0.000 claims abstract description 5
- 239000001913 cellulose Substances 0.000 claims abstract description 3
- 229920002678 cellulose Polymers 0.000 claims abstract description 3
- 239000010985 leather Substances 0.000 claims abstract description 3
- 229920002554 vinyl polymer Polymers 0.000 claims abstract description 3
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 42
- 239000002253 acid Substances 0.000 claims description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 9
- 239000001117 sulphuric acid Substances 0.000 claims description 9
- 235000011149 sulphuric acid Nutrition 0.000 claims description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005265 dialkylamine group Chemical group 0.000 claims description 4
- 150000002484 inorganic compounds Chemical class 0.000 claims description 4
- 229910010272 inorganic material Inorganic materials 0.000 claims description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 4
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 4
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000008049 diazo compounds Chemical class 0.000 claims description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 238000005886 esterification reaction Methods 0.000 claims description 2
- 235000011007 phosphoric acid Nutrition 0.000 claims description 2
- 229940005657 pyrophosphoric acid Drugs 0.000 claims description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000004627 regenerated cellulose Substances 0.000 claims 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 abstract description 5
- 239000000835 fiber Substances 0.000 abstract description 4
- 229920000742 Cotton Polymers 0.000 abstract description 2
- 229920000297 Rayon Polymers 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- CIZVQWNPBGYCGK-UHFFFAOYSA-N benzenediazonium Chemical group N#[N+]C1=CC=CC=C1 CIZVQWNPBGYCGK-UHFFFAOYSA-N 0.000 abstract 1
- 238000006193 diazotization reaction Methods 0.000 abstract 1
- 238000010561 standard procedure Methods 0.000 abstract 1
- 239000000975 dye Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000243 solution Substances 0.000 description 20
- 235000002639 sodium chloride Nutrition 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 150000001989 diazonium salts Chemical class 0.000 description 6
- 239000000843 powder Substances 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000003801 milling Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- GSUHCMJUVKKVFG-UHFFFAOYSA-N 5-amino-2,4-dimethoxybenzenesulfonic acid Chemical compound COC1=CC(OC)=C(S(O)(=O)=O)C=C1N GSUHCMJUVKKVFG-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001175 calcium sulphate Substances 0.000 description 2
- 235000011132 calcium sulphate Nutrition 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000005562 fading Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229940083761 high-ceiling diuretics pyrazolone derivative Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- HQBJSEKQNRSDAZ-UHFFFAOYSA-N 2,6-dimethoxyaniline Chemical compound COC1=CC=CC(OC)=C1N HQBJSEKQNRSDAZ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- YNLZKJXZEZFHDO-UHFFFAOYSA-M potassium;2,2,2-trichloroacetate Chemical compound [K+].[O-]C(=O)C(Cl)(Cl)Cl YNLZKJXZEZFHDO-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- COEZWFYORILMOM-UHFFFAOYSA-M sodium 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate Chemical compound [Na+].OC1=CC(O)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 COEZWFYORILMOM-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical group C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 125000005853 β-dimethylaminoethyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
- C09B62/51—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2431343A DE2431343C2 (de) | 1974-06-29 | 1974-06-29 | Goldgelbe, wasserlösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41484L IE41484L (en) | 1975-12-29 |
| IE41484B1 true IE41484B1 (en) | 1980-01-16 |
Family
ID=5919306
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1426/75A IE41484B1 (en) | 1974-06-29 | 1975-06-27 | Water-soluble benzene azo pyrazolone reactive monoazo dyestuffs processes for their preparation and use |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4014865A (OSRAM) |
| JP (1) | JPS5848589B2 (OSRAM) |
| BE (1) | BE830853A (OSRAM) |
| BR (1) | BR7504078A (OSRAM) |
| CA (1) | CA1052778A (OSRAM) |
| CH (1) | CH578602A5 (OSRAM) |
| CS (1) | CS183808B2 (OSRAM) |
| DE (1) | DE2431343C2 (OSRAM) |
| DK (1) | DK146161C (OSRAM) |
| FR (1) | FR2276356A1 (OSRAM) |
| GB (1) | GB1502149A (OSRAM) |
| IE (1) | IE41484B1 (OSRAM) |
| IN (1) | IN143365B (OSRAM) |
| IT (1) | IT1039524B (OSRAM) |
| LU (1) | LU72840A1 (OSRAM) |
| NL (1) | NL7507528A (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5285229A (en) * | 1976-01-01 | 1977-07-15 | Hoechst Ag | Novel waterrsolube monoazo compounds |
| JPS5637379A (en) * | 1979-09-04 | 1981-04-11 | Sumitomo Chemical Co | Dyeing of cellulosic fiber |
| DE3009177A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von schwefelsaeurehalbester-verbindungen |
| DE3019960A1 (de) * | 1980-05-24 | 1981-12-03 | Hoechst Ag, 6000 Frankfurt | Verfahren zum faerben und bedrucken von hydroxy- und/oder carbonamidgruppen enthaltenden fasermaterialien |
| US4886726A (en) * | 1987-11-25 | 1989-12-12 | E. I. Du Pont De Nemours And Company | Glycerides as charge directors for liquid electrostatic developers |
| CN103275516B (zh) * | 2013-06-06 | 2016-05-11 | 恒升化工(启东)有限公司 | 一种含活性基团的酸性黄色染料的生产方法 |
| CN111041864A (zh) * | 2019-12-30 | 2020-04-21 | 淄博大染坊丝绸集团有限公司 | 一种真丝面料的仿提花印花工艺 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1150163B (de) * | 1960-02-13 | 1963-06-12 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen gelben Monoazofarbstoffen |
| DE1795086C3 (de) * | 1968-08-07 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Cellulosefasern, Wolle, Seide, Polyamidfasern und Leder |
| US3655642A (en) * | 1968-08-24 | 1972-04-11 | Hoechst Ag | Water-soluble monoazo dyestuffs containing a naphthalene diazo component |
| DE2009421C3 (de) * | 1970-02-28 | 1979-09-27 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamid-, Polyurethan- und/oder nativen oder regenerierten Cellulosefasermaterialien |
| DE2048842C3 (de) * | 1970-10-05 | 1980-10-02 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Monoazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamid-, Polyurethanoder Cellulosefasern |
-
1974
- 1974-06-29 DE DE2431343A patent/DE2431343C2/de not_active Expired
-
1975
- 1975-06-18 IN IN1208/CAL/75A patent/IN143365B/en unknown
- 1975-06-24 NL NL7507528A patent/NL7507528A/xx not_active Application Discontinuation
- 1975-06-25 CH CH828775A patent/CH578602A5/xx not_active IP Right Cessation
- 1975-06-26 GB GB27143/75A patent/GB1502149A/en not_active Expired
- 1975-06-26 CS CS7500004550A patent/CS183808B2/cs unknown
- 1975-06-26 US US05/590,576 patent/US4014865A/en not_active Expired - Lifetime
- 1975-06-26 LU LU72840A patent/LU72840A1/xx unknown
- 1975-06-27 JP JP50079465A patent/JPS5848589B2/ja not_active Expired
- 1975-06-27 IE IE1426/75A patent/IE41484B1/en unknown
- 1975-06-27 DK DK293875A patent/DK146161C/da not_active IP Right Cessation
- 1975-06-27 CA CA230,422A patent/CA1052778A/en not_active Expired
- 1975-06-27 BR BR5229/75A patent/BR7504078A/pt unknown
- 1975-06-27 IT IT24905/75A patent/IT1039524B/it active
- 1975-06-30 FR FR7520446A patent/FR2276356A1/fr active Granted
- 1975-06-30 BE BE157862A patent/BE830853A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1039524B (it) | 1979-12-10 |
| CS183808B2 (en) | 1978-07-31 |
| GB1502149A (en) | 1978-02-22 |
| DE2431343C2 (de) | 1982-02-11 |
| IN143365B (OSRAM) | 1977-11-12 |
| CA1052778A (en) | 1979-04-17 |
| DK293875A (da) | 1975-12-30 |
| US4014865A (en) | 1977-03-29 |
| JPS5848589B2 (ja) | 1983-10-29 |
| FR2276356B1 (OSRAM) | 1978-09-22 |
| DK146161C (da) | 1983-12-05 |
| FR2276356A1 (fr) | 1976-01-23 |
| IE41484L (en) | 1975-12-29 |
| CH578602A5 (OSRAM) | 1976-08-13 |
| NL7507528A (nl) | 1975-12-31 |
| BE830853A (fr) | 1975-12-30 |
| BR7504078A (pt) | 1976-06-29 |
| DE2431343A1 (de) | 1976-01-15 |
| DK146161B (da) | 1983-07-11 |
| LU72840A1 (OSRAM) | 1977-03-07 |
| JPS5119028A (en) | 1976-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0022575B2 (en) | Reactive monoazo dyes, a process for their production and their use for dyeing cellulosic fibers and cellulosic textiles | |
| EP0021105A1 (en) | Reactive dyes, process for their preparation and their use for dyeing cellulose fibers | |
| EP0035171B1 (en) | Monochlorotriazinyl compounds, a process for their preparation and a process for dyeing cellulose fibers | |
| US4336190A (en) | Copper complex formazan compounds, process for their manufacture and their use as dyestuffs | |
| US4014865A (en) | Golden-yellow fiber-reactive water-soluble monoazo dyestuffs | |
| EP0073267B1 (en) | Copper phthalocyanine blue reactive dyes, process for their production, and their use for dyeing cellulosic fibers | |
| EP1230304B1 (en) | Azo dyestuffs | |
| EP0169457B1 (de) | Wasserlösliche Pyridon-Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0182366B1 (en) | Fiber-reactive pyridone monoazo compounds | |
| US4889923A (en) | AZO compounds containing cyano and vinyl-sulfone groups, a process for their preparation and their use as dyestuffs | |
| US3925351A (en) | Water-soluble reactive monoazodyestuffs | |
| US5093483A (en) | Water-soluble azo compounds having a 6-carboxy-2-naphthal as coupling components, suitable as dyestuffs | |
| KR890001784B1 (ko) | 모노 아조화합물의 제조방법 | |
| US4035351A (en) | Water-soluble monoazo dyestuff containing a phenylene diazo component | |
| EP0343262B1 (en) | Fibre-reactive azo dyes, process for their preparation and their use for dyeing hydroxy- and/or carboxamide groups containing fibre-material | |
| CA1264737A (en) | Water-soluble monoazo compounds, process for their preparation and their use as dyestuffs | |
| US3471469A (en) | Water-soluble monoazo-pyrazolone dyestuffs | |
| JPS59115360A (ja) | ジスアゾ化合物およびそれを用いる繊維の染色法 | |
| KR890002348B1 (ko) | 수-용성 모노아조 화합물의 제조방법 | |
| US4029644A (en) | Water-soluble, fiber-reactive monoazo dyestuffs | |
| IE912319A1 (en) | Disazo compounds, preparation thereof and use thereof as dyes | |
| US4372892A (en) | Process for the preparation of 1-aminobenzene-5-β-sulfatoethylsulfone-2,4-disulfonic acid, the 5-vinylsulfone compound and the alkali salts thereof | |
| DE3517755A1 (de) | Wasserloesliche mono- und disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| US3040023A (en) | Monoazo-dyestuffs | |
| US3102886A (en) | New water soluble dyestuffs of the pyrene-quinone and pyrene-quinone-carbazole series capable of being chemically fixed on fibers |