IE41477B1 - Sulfonylcarbamoyl derivatives - Google Patents
Sulfonylcarbamoyl derivativesInfo
- Publication number
- IE41477B1 IE41477B1 IE1312/75A IE131275A IE41477B1 IE 41477 B1 IE41477 B1 IE 41477B1 IE 1312/75 A IE1312/75 A IE 1312/75A IE 131275 A IE131275 A IE 131275A IE 41477 B1 IE41477 B1 IE 41477B1
- Authority
- IE
- Ireland
- Prior art keywords
- toluenesulfonylcarbamoyl
- cyclohexanedione
- group
- phenyl
- compound
- Prior art date
Links
- -1 Sulfonylcarbamoyl Chemical class 0.000 title claims description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 65
- 238000000034 method Methods 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000008280 blood Substances 0.000 claims description 17
- 210000004369 blood Anatomy 0.000 claims description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical compound O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 150000001447 alkali salts Chemical class 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 6
- 230000001105 regulatory effect Effects 0.000 claims description 6
- 241000124008 Mammalia Species 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 230000037396 body weight Effects 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000000376 reactant Substances 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- LKFBIHAJCFDIIN-UHFFFAOYSA-N spiro[5.5]undecane-2,4-dione Chemical compound C1C(=O)CC(=O)CC11CCCCC1 LKFBIHAJCFDIIN-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 230000033228 biological regulation Effects 0.000 claims description 2
- OILAIQUEIWYQPH-UHFFFAOYSA-N cyclohexane-1,2-dione Chemical compound O=C1CCCCC1=O OILAIQUEIWYQPH-UHFFFAOYSA-N 0.000 claims description 2
- UQNDMNHJULEGKX-UHFFFAOYSA-N n-(benzenesulfonyl)-2,6-dioxo-4-propan-2-ylcyclohexane-1-carboxamide Chemical compound O=C1CC(C(C)C)CC(=O)C1C(=O)NS(=O)(=O)C1=CC=CC=C1 UQNDMNHJULEGKX-UHFFFAOYSA-N 0.000 claims description 2
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 238000001556 precipitation Methods 0.000 claims 1
- 238000004458 analytical method Methods 0.000 description 20
- 239000000460 chlorine Substances 0.000 description 6
- 230000002218 hypoglycaemic effect Effects 0.000 description 5
- 230000003345 hyperglycaemic effect Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- VLJQDHDVZJXNQL-UHFFFAOYSA-N 4-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N=C=O)C=C1 VLJQDHDVZJXNQL-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- SDEMJWNRMQWCQI-UHFFFAOYSA-N 5-butan-2-ylcyclohexane-1,3-dione Chemical compound CCC(C)C1CC(=O)CC(=O)C1 SDEMJWNRMQWCQI-UHFFFAOYSA-N 0.000 description 2
- ARHIIRZQTUSYIX-UHFFFAOYSA-N 5-pentan-3-ylcyclohexane-1,3-dione Chemical compound CCC(CC)C1CC(=O)CC(=O)C1 ARHIIRZQTUSYIX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000003472 antidiabetic agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229960005371 tolbutamide Drugs 0.000 description 2
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- DUKZQEYDAFUJMK-UHFFFAOYSA-N 5-propan-2-ylcyclohexane-1,3-dione Chemical compound CC(C)C1CC(=O)CC(=O)C1 DUKZQEYDAFUJMK-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical compound CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000000864 hyperglycemic agent Substances 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/18—Sulfonamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/53—X and Y not being nitrogen atoms, e.g. N-sulfonylcarbamic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/51—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US478497A US3917692A (en) | 1974-06-12 | 1974-06-12 | Arylsulfonylcarbamoyl-1,3-dicarbonylalicyclic |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41477L IE41477L (en) | 1975-12-12 |
| IE41477B1 true IE41477B1 (en) | 1980-01-16 |
Family
ID=23900189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1312/75A IE41477B1 (en) | 1974-06-12 | 1975-06-11 | Sulfonylcarbamoyl derivatives |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3917692A (enFirst) |
| JP (1) | JPS5829785B2 (enFirst) |
| AU (1) | AU8129175A (enFirst) |
| BE (1) | BE829953A (enFirst) |
| CA (1) | CA1051924A (enFirst) |
| CH (1) | CH596158A5 (enFirst) |
| DE (1) | DE2526195A1 (enFirst) |
| DK (1) | DK261775A (enFirst) |
| FR (1) | FR2274288A1 (enFirst) |
| GB (1) | GB1454737A (enFirst) |
| IE (1) | IE41477B1 (enFirst) |
| LU (1) | LU72697A1 (enFirst) |
| NL (1) | NL7506830A (enFirst) |
| SE (1) | SE7506707L (enFirst) |
| YU (1) | YU40265B (enFirst) |
| ZA (1) | ZA753689B (enFirst) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54156826A (en) * | 1978-05-23 | 1979-12-11 | Sumitomo Electric Ind Ltd | Metod of making glass fiber for light transmission |
| US4347380A (en) * | 1979-04-20 | 1982-08-31 | Stauffer Chemical Company | N-Acylsulfonamide herbicidal antidotes |
| US5135941A (en) * | 1989-12-18 | 1992-08-04 | G. D. Searle & Co. | LTB4 synthesis inhibitors |
| AR037097A1 (es) | 2001-10-05 | 2004-10-20 | Novartis Ag | Compuestos acilsulfonamidas, composiciones farmaceuticas y el uso de dichos compuestos para la preparacion de un medicamento |
| WO2004113091A1 (ja) * | 2003-06-24 | 2004-12-29 | Idemitsu Kosan Co., Ltd. | 感熱記録体及びベンゼンスルホンアミド系誘導体 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3298917A (en) * | 1964-09-15 | 1967-01-17 | Merck & Co Inc | Antidiabetic nu-acylaliphaticsulfonamides |
| CH475250A (de) * | 1966-08-25 | 1969-07-15 | Geigy Ag J R | Verfahren zur Herstellung von neuen N'-substituierten N-Arylsulfonylharnstoffen |
-
1974
- 1974-06-12 US US478497A patent/US3917692A/en not_active Expired - Lifetime
-
1975
- 1975-05-16 AU AU81291/75A patent/AU8129175A/en not_active Expired
- 1975-05-26 CA CA227,783A patent/CA1051924A/en not_active Expired
- 1975-06-06 BE BE157097A patent/BE829953A/xx unknown
- 1975-06-06 GB GB2445575A patent/GB1454737A/en not_active Expired
- 1975-06-09 NL NL7506830A patent/NL7506830A/xx unknown
- 1975-06-09 ZA ZA00753689A patent/ZA753689B/xx unknown
- 1975-06-10 DK DK261775A patent/DK261775A/da unknown
- 1975-06-10 LU LU72697A patent/LU72697A1/xx unknown
- 1975-06-11 SE SE7506707A patent/SE7506707L/xx unknown
- 1975-06-11 JP JP50069778A patent/JPS5829785B2/ja not_active Expired
- 1975-06-11 IE IE1312/75A patent/IE41477B1/en unknown
- 1975-06-11 CH CH756575A patent/CH596158A5/xx not_active IP Right Cessation
- 1975-06-11 FR FR7518300A patent/FR2274288A1/fr active Granted
- 1975-06-12 DE DE19752526195 patent/DE2526195A1/de active Pending
- 1975-06-12 YU YU1515/75A patent/YU40265B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5829785B2 (ja) | 1983-06-24 |
| FR2274288A1 (fr) | 1976-01-09 |
| GB1454737A (en) | 1976-11-03 |
| ZA753689B (en) | 1976-05-26 |
| AU8129175A (en) | 1976-11-25 |
| IE41477L (en) | 1975-12-12 |
| YU151575A (en) | 1982-06-30 |
| YU40265B (en) | 1985-12-31 |
| SE7506707L (sv) | 1975-12-15 |
| US3917692A (en) | 1975-11-04 |
| LU72697A1 (enFirst) | 1976-04-13 |
| CH596158A5 (enFirst) | 1978-02-28 |
| DK261775A (da) | 1975-12-13 |
| NL7506830A (nl) | 1975-12-16 |
| BE829953A (fr) | 1975-12-08 |
| CA1051924A (en) | 1979-04-03 |
| FR2274288B1 (enFirst) | 1978-11-10 |
| DE2526195A1 (de) | 1976-01-02 |
| JPS5111734A (enFirst) | 1976-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU942597A3 (ru) | Способ получени спирооксазолидиндионов | |
| JP2617546B2 (ja) | 3‐〔4(1‐置換‐4‐ピペラジニル)ブチル〕‐4‐チアゾリジノンおよびその製法 | |
| US4342771A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| SE437375B (sv) | Sett att framstella nya hogervridande isomerer av asymmetrisk spirohydantoin | |
| EP0804193A1 (en) | Thiazolidine derivatives for the treatment of psoriasis | |
| CS199690B2 (cs) | Způsob výroby spiro-hydantoinových derivátů | |
| GB2083810A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| US4617312A (en) | Aldose reductase inhibiting 5-(2-alkoxyphenyl) thiazolidinediones | |
| IE41477B1 (en) | Sulfonylcarbamoyl derivatives | |
| EP0097453B1 (en) | Alicyclic substituted oxazolidine-2,4-diones having hypoglycemic activity | |
| US4226875A (en) | Novel spiro-oxazolidinediones | |
| US4093741A (en) | Process for reducing blood sugar concentration in a mammal | |
| US3998879A (en) | Arylsulfonylcarbamoyl-1,3-dicarbonylacyclic compounds | |
| WO1989002890A1 (fr) | Composes de thiohydantoine | |
| US4689336A (en) | Hypoglycemic 5-substituted oxazolidine 2,4-diones | |
| EP0117035B1 (en) | Aldose reductase inhibiting 5-(2-alkoxyphenyl)thiazolidinediones | |
| EP0008259A1 (fr) | Nouveaux dérivés de la pipéridylbenzimidazolinone, leurs procédés de préparation et les compositions pharmaceutiques les renfermant | |
| US5236941A (en) | 5-(2-hydroxy-1-arylethylidene)- and 5-(2-oxo-1-arylethylidene)-2,4-thiazolidinediones and derivatives thereof | |
| JP3154298B2 (ja) | 製薬上活性の3―アリール及び3―ヘテロアリール―2―フルオロ―1―オレフィン類 | |
| US3562256A (en) | 1,3-dialkyl-5-(substituted arylsulfonyl)-tetrahydro-1,3,5-triazine-4-thiones | |
| KR860001508B1 (ko) | 5-(2-알콕시-3-치환된 페닐) 히단토인의 제조방법 | |
| JPH0118076B2 (enFirst) | ||
| US3772378A (en) | 7-oxo-benzocycloheptene acetic acids | |
| US5068465A (en) | Pharmaceutically active 3-aryl-2-fluoro-1-olefins | |
| KR850000384B1 (ko) | 5-치환된 옥사졸리딘-2, 4-디온의 제조방법 |