IE35283B1 - Substituted benzylimidazolidinones and a process for the manufacture thereof - Google Patents
Substituted benzylimidazolidinones and a process for the manufacture thereofInfo
- Publication number
- IE35283B1 IE35283B1 IE213/71A IE21371A IE35283B1 IE 35283 B1 IE35283 B1 IE 35283B1 IE 213/71 A IE213/71 A IE 213/71A IE 21371 A IE21371 A IE 21371A IE 35283 B1 IE35283 B1 IE 35283B1
- Authority
- IE
- Ireland
- Prior art keywords
- compounds
- compound
- prepared
- reacting
- give
- Prior art date
Links
- IXNSPEIJKZNYLL-UHFFFAOYSA-N 1-benzylimidazolidin-2-one Chemical class O=C1NCCN1CC1=CC=CC=C1 IXNSPEIJKZNYLL-UHFFFAOYSA-N 0.000 title abstract 2
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 abstract 2
- -1 ethoxy, isopropoxy Chemical group 0.000 abstract 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- CSSRHTDXZIBTMI-UHFFFAOYSA-N 3-butoxy-4-methoxybenzaldehyde Chemical compound CCCCOC1=CC(C=O)=CC=C1OC CSSRHTDXZIBTMI-UHFFFAOYSA-N 0.000 abstract 1
- 101000653791 Bos taurus Protein S100-A12 Proteins 0.000 abstract 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 abstract 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 abstract 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 abstract 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 abstract 1
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract 1
- 230000001476 alcoholic effect Effects 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 229940100198 alkylating agent Drugs 0.000 abstract 1
- 239000002168 alkylating agent Substances 0.000 abstract 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 abstract 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 abstract 1
- 229940125692 cardiovascular agent Drugs 0.000 abstract 1
- 239000002327 cardiovascular agent Substances 0.000 abstract 1
- 239000000969 carrier Substances 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- DXTVYXOAQBXYAU-UHFFFAOYSA-N chloro ethyl carbonate Chemical compound CCOC(=O)OCl DXTVYXOAQBXYAU-UHFFFAOYSA-N 0.000 abstract 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 abstract 1
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanilline Natural products COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 238000007363 ring formation reaction Methods 0.000 abstract 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1376970A | 1970-02-24 | 1970-02-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35283L IE35283L (en) | 1971-08-24 |
| IE35283B1 true IE35283B1 (en) | 1976-01-07 |
Family
ID=21761656
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE213/71A IE35283B1 (en) | 1970-02-24 | 1971-02-22 | Substituted benzylimidazolidinones and a process for the manufacture thereof |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3636039A (enExample) |
| JP (1) | JPS5421338B1 (enExample) |
| BE (1) | BE763298A (enExample) |
| BR (1) | BR7101125D0 (enExample) |
| CA (1) | CA967163A (enExample) |
| CH (2) | CH567482A5 (enExample) |
| DE (1) | DE2108438C2 (enExample) |
| DK (2) | DK134601B (enExample) |
| FI (1) | FI54919C (enExample) |
| FR (1) | FR2081537B1 (enExample) |
| GB (1) | GB1292768A (enExample) |
| IE (1) | IE35283B1 (enExample) |
| IL (1) | IL36237A (enExample) |
| NL (1) | NL171446C (enExample) |
| NO (1) | NO130680C (enExample) |
| SE (1) | SE369190B (enExample) |
| YU (1) | YU34407B (enExample) |
| ZA (1) | ZA711077B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3932452A (en) * | 1975-02-07 | 1976-01-13 | Morton-Norwich Products, Inc. | 1-Arylmethyl-2-imidazolidinones |
| US3966758A (en) * | 1975-06-16 | 1976-06-29 | Morton-Norwich Products, Inc. | Anti-inflammatory 1-(substituted benzyl)-2-imidazolidinones |
| US4063022A (en) * | 1976-11-22 | 1977-12-13 | Morton-Norwich Products, Inc. | Antisecretory 2-imidazolidinones |
| HU179019B (en) * | 1978-11-01 | 1982-08-28 | Gyogyszekutato Intezet | Process for preparing 4-//3,4-dialkoxy-phenyl/-alkyl/- 2imidazolidinone derivatives |
| CA1188616A (en) * | 1981-06-11 | 1985-06-11 | Hoffmann-La Roche Limited | Pharmaceutical preparations |
| US5459145A (en) * | 1988-01-19 | 1995-10-17 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| WO1987006576A1 (en) * | 1986-04-29 | 1987-11-05 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| US5395935A (en) * | 1992-05-08 | 1995-03-07 | Pfizer Inc. | Endo-bicyclo[2.2.1]heptan-2-ol and derived pharmaceutical agents |
| GB9312853D0 (en) * | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5922751A (en) | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| AU4527996A (en) * | 1994-12-13 | 1996-07-03 | Euro-Celtique S.A. | Trisubstituted thioxanthines |
| DE69531506T2 (de) * | 1994-12-13 | 2004-06-24 | Euroceltique S.A. | Arylthioxanthine |
| US6025361A (en) * | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| US6166041A (en) * | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| US6075016A (en) * | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| US5864037A (en) * | 1996-06-06 | 1999-01-26 | Euro-Celtique, S.A. | Methods for the synthesis of chemical compounds having PDE-IV inhibitory activity |
| US5744473A (en) * | 1996-09-16 | 1998-04-28 | Euro-Celtique, S.A. | PDE IV inhibitors: "bis-compounds" |
| CA2402384A1 (en) * | 2000-03-16 | 2001-09-20 | Inflazyme Pharmaceuticals Ltd. | Benzylated pde4 inhibitors |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| AU2008261102B2 (en) | 2007-06-04 | 2013-11-28 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| EP3239170B1 (en) | 2008-06-04 | 2019-03-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| WO2010009319A2 (en) | 2008-07-16 | 2010-01-21 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| CA3100941C (en) | 2011-03-01 | 2024-03-05 | Synergy Pharmaceuticals Inc. | Process of preparing guanylate cyclase c agonists |
| WO2014131024A2 (en) | 2013-02-25 | 2014-08-28 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| EP2970384A1 (en) | 2013-03-15 | 2016-01-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| WO2014151200A2 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| HRP20240805T1 (hr) | 2013-06-05 | 2024-09-27 | Bausch Health Ireland Limited | Ultra-pročišćeni agonisti guanilat-ciklaze c, postupak njihove pripreme i uporabe |
| CN114404588A (zh) | 2013-08-09 | 2022-04-29 | 阿德利克斯公司 | 用于抑制磷酸盐转运的化合物和方法 |
| CN114340631A (zh) | 2019-05-21 | 2022-04-12 | 阿德利克斯股份有限公司 | 用于降低患者的血清磷酸盐的组合 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH518285A (de) * | 1968-05-01 | 1972-01-31 | Hoffmann La Roche | Verfahren zur Herstellung von neuen substituierten Benzylimidazolidinonen |
-
1970
- 1970-02-24 US US13769A patent/US3636039A/en not_active Expired - Lifetime
-
1971
- 1971-02-18 CH CH239371A patent/CH567482A5/xx not_active IP Right Cessation
- 1971-02-18 CH CH149474A patent/CH567483A5/xx not_active IP Right Cessation
- 1971-02-19 ZA ZA711077A patent/ZA711077B/xx unknown
- 1971-02-19 BR BR1125/71A patent/BR7101125D0/pt unknown
- 1971-02-19 IL IL36237A patent/IL36237A/en unknown
- 1971-02-22 NL NLAANVRAGE7102324,A patent/NL171446C/xx not_active IP Right Cessation
- 1971-02-22 DE DE2108438A patent/DE2108438C2/de not_active Expired
- 1971-02-22 FI FI501/71A patent/FI54919C/fi active
- 1971-02-22 IE IE213/71A patent/IE35283B1/xx unknown
- 1971-02-23 NO NO654/71A patent/NO130680C/no unknown
- 1971-02-23 YU YU439/71A patent/YU34407B/xx unknown
- 1971-02-23 BE BE763298A patent/BE763298A/xx not_active IP Right Cessation
- 1971-02-24 SE SE02361/71A patent/SE369190B/xx unknown
- 1971-02-24 DK DK83171AA patent/DK134601B/da not_active IP Right Cessation
- 1971-02-24 CA CA106,142A patent/CA967163A/en not_active Expired
- 1971-02-24 FR FR7106262A patent/FR2081537B1/fr not_active Expired
- 1971-02-24 JP JP923471A patent/JPS5421338B1/ja active Pending
- 1971-04-19 GB GB22437/71A patent/GB1292768A/en not_active Expired
-
1975
- 1975-12-15 DK DK570075A patent/DK570075A/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI54919C (fi) | 1979-04-10 |
| YU43971A (en) | 1978-12-31 |
| BE763298A (fr) | 1971-08-23 |
| CH567483A5 (enExample) | 1975-10-15 |
| JPS5421338B1 (enExample) | 1979-07-30 |
| NO130680B (enExample) | 1974-10-14 |
| YU34407B (en) | 1979-07-10 |
| IL36237A (en) | 1974-11-29 |
| BR7101125D0 (pt) | 1973-04-26 |
| SE369190B (enExample) | 1974-08-12 |
| FR2081537B1 (enExample) | 1974-08-23 |
| DE2108438A1 (de) | 1971-09-09 |
| DE2108438C2 (de) | 1987-02-05 |
| NO130680C (enExample) | 1975-01-22 |
| DK134601B (da) | 1976-12-06 |
| CH567482A5 (enExample) | 1975-10-15 |
| ZA711077B (en) | 1971-10-27 |
| FR2081537A1 (enExample) | 1971-12-03 |
| IE35283L (en) | 1971-08-24 |
| US3636039A (en) | 1972-01-18 |
| CA967163A (en) | 1975-05-06 |
| DK134601C (enExample) | 1977-05-16 |
| IL36237A0 (en) | 1971-04-28 |
| GB1292768A (en) | 1972-10-11 |
| DK570075A (da) | 1975-12-15 |
| NL171446C (nl) | 1983-04-05 |
| NL7102324A (enExample) | 1971-08-26 |
| FI54919B (fi) | 1978-12-29 |
| NL171446B (nl) | 1982-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE35283B1 (en) | Substituted benzylimidazolidinones and a process for the manufacture thereof | |
| SE7503517L (enExample) | ||
| GB1376096A (en) | 1-3,4-methylenedioxy-phenyl-4,4-dimethyl-1-pentene derivatives | |
| IE36797L (en) | 1,5-benzodiazepin-2-one derivatives. | |
| GB1261693A (en) | Benzomorphans | |
| GB1337280A (en) | 5-phenyl-isoxazole-3-carboxylic acids and their derivatives | |
| GB1389621A (en) | Salts of 3-hydroxy-2-hydroxy-methyl-propanesulphonic acid-1 and a process for their preparation | |
| GB1294720A (en) | Aryl butanol derivatives, compositions containing them, and processes for preparing aryl ketone derivatives from them | |
| GB1320032A (en) | Imidazole derivatives | |
| GB1433270A (en) | Benzopyrano-2,3-c-pyrazolecarboxylic acids their preparation and compositions containing them | |
| IE32859B1 (en) | Penicilloic acid derivatives and process for the manufacture thereof | |
| GB1410275A (en) | Phenoxycarboxylic acid derivatives their preparation and compositions containing them | |
| IE35223B1 (en) | Bis-basic ethers of 2,6- and 2,7-dihydroxyanthraquinones | |
| GB1428933A (en) | 5-phenyl-sulphinyl-2-benzimidazolyl-carbamic acid esters and process for their manufacture | |
| GB1310382A (en) | Process for the preparation of glucofuranosides | |
| GB1325142A (en) | Phenazine derivatives | |
| GB1333524A (en) | Penicilloic acid derivatives | |
| GB1395235A (en) | 2-phenyl-1-pyrrolidinocycloalkanes | |
| GB1472257A (en) | Derivative of 4-hydroxy-5-azacoumarin | |
| GB1437149A (en) | Spiro-compounds and a process for their preparation | |
| GB1167386A (en) | Novel Derivatives of Cyclohexane | |
| IE40226L (en) | 5-AMINOMETHYL-m-DIOXANES. | |
| IE40088B1 (en) | Substituted quinazolone compounds and pharmaceutical uses thereof | |
| GB1472937A (en) | Benzyl alcohol derivatives | |
| GB1150614A (en) | Pyrylium Compounds |