IE34620B1 - New penicillanic acid derivatives - Google Patents
New penicillanic acid derivativesInfo
- Publication number
- IE34620B1 IE34620B1 IE1359/70A IE135970A IE34620B1 IE 34620 B1 IE34620 B1 IE 34620B1 IE 1359/70 A IE1359/70 A IE 1359/70A IE 135970 A IE135970 A IE 135970A IE 34620 B1 IE34620 B1 IE 34620B1
- Authority
- IE
- Ireland
- Prior art keywords
- alkyl
- heterocyclic
- penicillanic acid
- residue
- acid derivatives
- Prior art date
Links
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 3
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 2
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 abstract 1
- -1 O-alkyl Chemical group 0.000 abstract 1
- 125000005042 acyloxymethyl group Chemical group 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 125000003435 aroyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 231100000053 low toxicity Toxicity 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
| GB5520969 | 1969-11-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34620L IE34620L (en) | 1971-05-11 |
| IE34620B1 true IE34620B1 (en) | 1975-06-25 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1359/70A IE34620B1 (en) | 1969-11-11 | 1970-10-22 | New penicillanic acid derivatives |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (enFirst) |
| AT (1) | AT301026B (enFirst) |
| BE (1) | BE758782A (enFirst) |
| BG (1) | BG18619A3 (enFirst) |
| CH (2) | CH559752A5 (enFirst) |
| CS (1) | CS166020B2 (enFirst) |
| DE (1) | DE2055531C3 (enFirst) |
| DK (1) | DK135127B (enFirst) |
| ES (1) | ES385437A1 (enFirst) |
| FI (1) | FI54601C (enFirst) |
| FR (1) | FR2073338A1 (enFirst) |
| HU (1) | HU162440B (enFirst) |
| IE (1) | IE34620B1 (enFirst) |
| IL (1) | IL35490A (enFirst) |
| IT (1) | IT1044209B (enFirst) |
| LU (1) | LU62031A1 (enFirst) |
| NL (1) | NL168227C (enFirst) |
| NO (1) | NO137826C (enFirst) |
| PL (1) | PL90581B1 (enFirst) |
| RO (2) | RO56878A (enFirst) |
| SE (1) | SE397355B (enFirst) |
| SU (1) | SU406362A3 (enFirst) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (enFirst) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (ru) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Способ получени производных 6- -амидинопенициллановой кислоты |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (de) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
0
- BE BE758782D patent/BE758782A/xx not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/xx unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/xx unknown
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 AT AT995970A patent/AT301026B/de not_active IP Right Cessation
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/da not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 FR FR7040428A patent/FR2073338A1/fr active Granted
- 1970-11-10 IT IT70739/70A patent/IT1044209B/it active
- 1970-11-10 SE SE7015181A patent/SE397355B/xx unknown
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 NO NO4290/70A patent/NO137826C/no unknown
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/xx not_active IP Right Cessation
- 1970-11-10 PL PL1970144350A patent/PL90581B1/pl unknown
- 1970-11-11 DE DE2055531A patent/DE2055531C3/de not_active Expired
- 1970-11-11 FI FI3032/70A patent/FI54601C/fi active
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
- 1970-11-11 ES ES385437A patent/ES385437A1/es not_active Expired
- 1970-11-11 BG BG016025A patent/BG18619A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE34620L (en) | 1971-05-11 |
| DK135127C (enFirst) | 1977-08-15 |
| FR2073338B1 (enFirst) | 1974-02-15 |
| LU62031A1 (enFirst) | 1971-05-10 |
| DE2055531B2 (de) | 1980-01-10 |
| IT1044209B (it) | 1980-03-20 |
| DE2055531A1 (de) | 1971-05-27 |
| CS166020B2 (enFirst) | 1976-01-29 |
| NL7016435A (enFirst) | 1971-05-13 |
| SE397355B (sv) | 1977-10-31 |
| RO60563A (enFirst) | 1977-01-15 |
| ES385437A1 (es) | 1973-11-01 |
| FR2073338A1 (en) | 1971-10-01 |
| BE758782A (fr) | 1971-05-10 |
| NL168227C (nl) | 1982-03-16 |
| CH559752A5 (enFirst) | 1975-03-14 |
| JPS518955B1 (enFirst) | 1976-03-22 |
| SU406362A3 (enFirst) | 1973-11-05 |
| IL35490A0 (en) | 1970-12-24 |
| BG18619A3 (bg) | 1975-02-25 |
| DE2055531C3 (de) | 1982-02-25 |
| NO137826C (no) | 1982-02-16 |
| FI54601C (fi) | 1979-01-10 |
| IL35490A (en) | 1974-11-29 |
| NO137826B (no) | 1978-01-23 |
| HU162440B (enFirst) | 1973-02-28 |
| NL168227B (nl) | 1981-10-16 |
| AT301026B (de) | 1972-08-25 |
| PL90581B1 (en) | 1977-01-31 |
| FI54601B (fi) | 1978-09-29 |
| RO56878A (enFirst) | 1975-02-15 |
| DK135127B (da) | 1977-03-07 |
| CH559753A5 (enFirst) | 1975-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE34620B1 (en) | New penicillanic acid derivatives | |
| GB1347455A (en) | Sulphonamido and carboxamido phenyl quinazolinones | |
| GB1366062A (en) | 1-acyl-3-amino-sulphonyl-2-imino-benzimidazolines process for their production and their use as fungicides | |
| GB1422266A (en) | Diazepine derivatives and processes for their production | |
| GB1136933A (en) | Process for the production of tetra---substituted anthraquinone derivatives | |
| GB1381210A (en) | Azomethines of 4-amino-5-h-1,2,4-triazin-5-ones process for their production and their use as herbicides | |
| GB1351799A (en) | Azo compounds process for their manufacture and their use | |
| IE41347B1 (en) | Production of benzenesulphonamides | |
| GB1471962A (en) | Dihydropyridine amines | |
| ES394346A1 (es) | Procedimiento para la preparacion de nuevas 2-alquiltio-4,6 -diamino - s - triacinas de actividad herbicida. | |
| GB1138745A (en) | Penicillins | |
| GB1504707A (en) | 1-aryl-2-oxo-2,4,5,6,7,7a-hexahydroindoles | |
| GB1315630A (en) | Penicillins | |
| GB1383408A (en) | Substituted isoindolines processes for their manufacture and preparations containing them | |
| GB1119761A (en) | Process for the manufacture of azo dyestuffs | |
| GB1362795A (en) | Process for the preparation of amides | |
| GB1299887A (en) | New penicillin derivatives | |
| GB1336138A (en) | Process for the production of pyrimidine derivatives | |
| ES392823A1 (es) | Procedimiento para preparar derivados de penicilina. | |
| GB1205519A (en) | Novel 1,2-dihydro-benztriazine derivatives and process for preparing the same | |
| GB1244016A (en) | Method for preparing penicillins | |
| GB1236165A (en) | Fluoroacetylaminotrichloromethylmethyl-thiocarbamic acid esters and ureas | |
| GB1451980A (en) | Thiourea derivatives of vitamin a acid | |
| GB1479948A (en) | Azo dyes process for their manufacture and their use | |
| GB1239488A (enFirst) |