IL35490A0 - New penicillanic acid derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
New penicillanic acid derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL35490A0 IL35490A0 IL35490A IL3549070A IL35490A0 IL 35490 A0 IL35490 A0 IL 35490A0 IL 35490 A IL35490 A IL 35490A IL 3549070 A IL3549070 A IL 3549070A IL 35490 A0 IL35490 A0 IL 35490A0
- Authority
- IL
- Israel
- Prior art keywords
- preparation
- pharmaceutical compositions
- compositions containing
- acid derivatives
- penicillanic acid
- Prior art date
Links
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
| GB5520969 | 1969-11-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL35490A0 true IL35490A0 (en) | 1970-12-24 |
| IL35490A IL35490A (en) | 1974-11-29 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35490A IL35490A (en) | 1969-11-11 | 1970-10-20 | 6-amidino-penicillanic acid derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (en) |
| AT (1) | AT301026B (en) |
| BE (1) | BE758782A (en) |
| BG (1) | BG18619A3 (en) |
| CH (2) | CH559752A5 (en) |
| CS (1) | CS166020B2 (en) |
| DE (1) | DE2055531C3 (en) |
| DK (1) | DK135127B (en) |
| ES (1) | ES385437A1 (en) |
| FI (1) | FI54601C (en) |
| FR (1) | FR2073338A1 (en) |
| HU (1) | HU162440B (en) |
| IE (1) | IE34620B1 (en) |
| IL (1) | IL35490A (en) |
| IT (1) | IT1044209B (en) |
| LU (1) | LU62031A1 (en) |
| NL (1) | NL168227C (en) |
| NO (1) | NO137826C (en) |
| PL (1) | PL90581B1 (en) |
| RO (2) | RO56878A (en) |
| SE (1) | SE397355B (en) |
| SU (1) | SU406362A3 (en) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (en) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (en) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Method of preparing derivatives of 6- -amidino penicillanic acid |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (en) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Pesticides |
-
0
- BE BE758782D patent/BE758782A/en not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/en unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/en unknown
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 AT AT995970A patent/AT301026B/en not_active IP Right Cessation
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/en not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 FR FR7040428A patent/FR2073338A1/en active Granted
- 1970-11-10 IT IT70739/70A patent/IT1044209B/en active
- 1970-11-10 SE SE7015181A patent/SE397355B/en unknown
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 NO NO4290/70A patent/NO137826C/en unknown
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/en not_active IP Right Cessation
- 1970-11-10 PL PL1970144350A patent/PL90581B1/en unknown
- 1970-11-11 DE DE2055531A patent/DE2055531C3/en not_active Expired
- 1970-11-11 FI FI3032/70A patent/FI54601C/en active
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
- 1970-11-11 ES ES385437A patent/ES385437A1/en not_active Expired
- 1970-11-11 BG BG016025A patent/BG18619A3/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE34620L (en) | 1971-05-11 |
| DK135127C (en) | 1977-08-15 |
| FR2073338B1 (en) | 1974-02-15 |
| LU62031A1 (en) | 1971-05-10 |
| DE2055531B2 (en) | 1980-01-10 |
| IT1044209B (en) | 1980-03-20 |
| DE2055531A1 (en) | 1971-05-27 |
| CS166020B2 (en) | 1976-01-29 |
| NL7016435A (en) | 1971-05-13 |
| SE397355B (en) | 1977-10-31 |
| RO60563A (en) | 1977-01-15 |
| ES385437A1 (en) | 1973-11-01 |
| FR2073338A1 (en) | 1971-10-01 |
| BE758782A (en) | 1971-05-10 |
| NL168227C (en) | 1982-03-16 |
| CH559752A5 (en) | 1975-03-14 |
| JPS518955B1 (en) | 1976-03-22 |
| SU406362A3 (en) | 1973-11-05 |
| BG18619A3 (en) | 1975-02-25 |
| DE2055531C3 (en) | 1982-02-25 |
| NO137826C (en) | 1982-02-16 |
| FI54601C (en) | 1979-01-10 |
| IE34620B1 (en) | 1975-06-25 |
| IL35490A (en) | 1974-11-29 |
| NO137826B (en) | 1978-01-23 |
| HU162440B (en) | 1973-02-28 |
| NL168227B (en) | 1981-10-16 |
| AT301026B (en) | 1972-08-25 |
| PL90581B1 (en) | 1977-01-31 |
| FI54601B (en) | 1978-09-29 |
| RO56878A (en) | 1975-02-15 |
| DK135127B (en) | 1977-03-07 |
| CH559753A5 (en) | 1975-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL35781A0 (en) | New derivatives of aminopropiophenone,their preparation and pharmaceutical compositions containing them | |
| IL35668A (en) | Xanthone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35400A (en) | Furoyl and thenoylphenoxy acetic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33526A0 (en) | New sulphamyl-benzoic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33500A0 (en) | Thiazolyl-benzoic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL33846A0 (en) | Derivatives of 1-thiachromone and 4-thionchromone,their preparation and pharmaceutical compositions containing them | |
| IL33925A0 (en) | Acetyl-guanidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34195A0 (en) | Thiocarbamic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34279A0 (en) | New sulfamyl-anthranilic acids,their preparation and pharmaceutical compositions containing them | |
| IL35717A0 (en) | Quinoxaline-2-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34173A0 (en) | Imidazolidinone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35504A0 (en) | New derivatives of hexahydrobenzindole,their production and pharmaceutical compositions containing them | |
| IL35490A0 (en) | New penicillanic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34328A (en) | Isoquinoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35779A (en) | 4-amino-quinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34947A0 (en) | Pyridobenzodiazepin-6-one derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35211A0 (en) | 4-aryl-4-hydroxy-piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL38467A0 (en) | 6-aminopenicillanic acid derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL35204A0 (en) | Derivatives of 4-amino-2-methylpyrimidine,their preparation and pharmaceutical compositions containing them | |
| IL35087A0 (en) | Imidazolidinone derivatives,their production and pharmaceutical compositions containing them | |
| IL34468A0 (en) | Acid addition salts of indenopyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL34158A0 (en) | Adamantylcarboxamido-phenylacetic acid and its derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35227A0 (en) | P-aminoalkyl-benzenesulphonamide derivatives,their production and pharmaceutical compositions containing them | |
| IL35221A0 (en) | P-aminoalkyl-benzenesulphonamide derivatives,their production and pharmaceutical compositions containing them | |
| IL33947A0 (en) | D-2-(6-substituted-2-naphthyl)propanals,their preparation and pharmaceutical compositions containing them |