HUT60728A - Benzimidazole derivatives, herbicidal compositions comprising such compounds and process for producing such compounds - Google Patents
Benzimidazole derivatives, herbicidal compositions comprising such compounds and process for producing such compounds Download PDFInfo
- Publication number
- HUT60728A HUT60728A HU9201235A HU9201235A HUT60728A HU T60728 A HUT60728 A HU T60728A HU 9201235 A HU9201235 A HU 9201235A HU 9201235 A HU9201235 A HU 9201235A HU T60728 A HUT60728 A HU T60728A
- Authority
- HU
- Hungary
- Prior art keywords
- dimethylsulfamoyl
- carboxylic acid
- formula
- methylpyridine
- benzimidazol
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 147
- 239000000203 mixture Substances 0.000 title claims description 66
- 230000002363 herbicidal effect Effects 0.000 title claims description 31
- 238000000034 method Methods 0.000 title claims description 21
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 title claims description 8
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 title claims description 6
- 230000008569 process Effects 0.000 title claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 79
- 241000196324 Embryophyta Species 0.000 claims description 61
- 125000004432 carbon atom Chemical group C* 0.000 claims description 48
- -1 methoxy, ethoxy, n-propoxy Chemical group 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 238000002360 preparation method Methods 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 21
- 239000004480 active ingredient Substances 0.000 claims description 20
- 239000003085 diluting agent Substances 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 239000004094 surface-active agent Substances 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 14
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 13
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 13
- 238000009472 formulation Methods 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 239000007788 liquid Substances 0.000 claims description 13
- 239000001301 oxygen Substances 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 150000001556 benzimidazoles Chemical class 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- 239000011591 potassium Chemical group 0.000 claims description 7
- 229910052700 potassium Chemical group 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 239000000843 powder Substances 0.000 claims description 6
- 239000004563 wettable powder Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- JJWLVOIRVHMVIS-UHFFFAOYSA-O isopropylaminium Chemical group CC(C)[NH3+] JJWLVOIRVHMVIS-UHFFFAOYSA-O 0.000 claims description 5
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 5
- DJXNJVFEFSWHLY-UHFFFAOYSA-M quinoline-3-carboxylate Chemical compound C1=CC=CC2=CC(C(=O)[O-])=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-M 0.000 claims description 5
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 claims description 5
- 239000004550 soluble concentrate Substances 0.000 claims description 5
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000012141 concentrate Substances 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 239000004546 suspension concentrate Substances 0.000 claims description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 2
- SILNNFMWIMZVEQ-UHFFFAOYSA-N 1,3-dihydrobenzimidazol-2-one Chemical compound C1=CC=C2NC(O)=NC2=C1 SILNNFMWIMZVEQ-UHFFFAOYSA-N 0.000 claims description 2
- XQFMUGDFOSEYOY-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4,5-dimethylbenzimidazol-2-yl]-6-methylpyridine-3-carboxylic acid Chemical compound N=1C2=C(C)C(C)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(O)=O XQFMUGDFOSEYOY-UHFFFAOYSA-N 0.000 claims description 2
- RLICNNSWFUACJQ-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4,5-dimethylbenzimidazol-2-yl]quinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C=3N(C4=CC=C(C)C(C)=C4N=3)S(=O)(=O)N(C)C)=NC2=C1 RLICNNSWFUACJQ-UHFFFAOYSA-N 0.000 claims description 2
- FKVLWSZNBIWRJM-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-methylbenzimidazol-2-yl]-5-methylpyridine-3-carboxylate;propan-2-ylazanium Chemical compound CC(C)[NH3+].N=1C2=C(C)C=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C([O-])=O FKVLWSZNBIWRJM-UHFFFAOYSA-N 0.000 claims description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 238000012272 crop production Methods 0.000 claims description 2
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- LIOXJJWQGJRAEZ-UHFFFAOYSA-M potassium;2-[1-(dimethylsulfamoyl)-4-methylbenzimidazol-2-yl]-5-methylpyridine-3-carboxylate Chemical compound [K+].N=1C2=C(C)C=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C([O-])=O LIOXJJWQGJRAEZ-UHFFFAOYSA-M 0.000 claims description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims 1
- NLHAEQLDYFXEKG-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-ethoxybenzimidazol-2-yl]quinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C=3N(C=4C=CC=C(C=4N=3)OCC)S(=O)(=O)N(C)C)=NC2=C1 NLHAEQLDYFXEKG-UHFFFAOYSA-N 0.000 claims 1
- STLCWGSTXILUJE-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-methoxybenzimidazol-2-yl]quinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C=3N(C=4C=CC=C(C=4N=3)OC)S(=O)(=O)N(C)C)=NC2=C1 STLCWGSTXILUJE-UHFFFAOYSA-N 0.000 claims 1
- UAQCIVBMHLEOIX-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-methylbenzimidazol-2-yl]quinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C=3N(C4=CC=CC(C)=C4N=3)S(=O)(=O)N(C)C)=NC2=C1 UAQCIVBMHLEOIX-UHFFFAOYSA-N 0.000 claims 1
- QLCLAXJIYIFPMC-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-propoxybenzimidazol-2-yl]-6-methylpyridine-3-carboxylic acid Chemical compound N=1C=2C(OCCC)=CC=CC=2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(O)=O QLCLAXJIYIFPMC-UHFFFAOYSA-N 0.000 claims 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 1
- 239000012050 conventional carrier Substances 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 239000007789 gas Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- XYBBAJSDPUAFJC-UHFFFAOYSA-M potassium;2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-5-methylpyridine-3-carboxylate Chemical compound [K+].N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C([O-])=O XYBBAJSDPUAFJC-UHFFFAOYSA-M 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- 239000002904 solvent Substances 0.000 description 35
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000007787 solid Substances 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 19
- 238000009835 boiling Methods 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 230000009467 reduction Effects 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000002689 soil Substances 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000000969 carrier Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 244000038559 crop plants Species 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- QKZQJBBZKDVVFI-UHFFFAOYSA-N 4-fluoro-2,1,3-benzoxadiazole Chemical compound FC1=CC=CC2=NON=C12 QKZQJBBZKDVVFI-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229940125904 compound 1 Drugs 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- YTGWKOHORKGMHD-UHFFFAOYSA-N n-(2,3-dinitrophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O YTGWKOHORKGMHD-UHFFFAOYSA-N 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 150000003573 thiols Chemical class 0.000 description 5
- AWBOSXFRPFZLOP-UHFFFAOYSA-N 2,1,3-benzoxadiazole Chemical class C1=CC=CC2=NON=C21 AWBOSXFRPFZLOP-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- 235000010469 Glycine max Nutrition 0.000 description 4
- 241000209504 Poaceae Species 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- WGDRAVMHLDKGGA-UHFFFAOYSA-N prop-2-en-1-imine Chemical class [CH2]C=C[NH] WGDRAVMHLDKGGA-UHFFFAOYSA-N 0.000 description 4
- 239000003586 protic polar solvent Substances 0.000 description 4
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 3
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical class NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 3
- BFLWXPJTAKXXKT-UHFFFAOYSA-N 3-methoxybenzene-1,2-diamine Chemical compound COC1=CC=CC(N)=C1N BFLWXPJTAKXXKT-UHFFFAOYSA-N 0.000 description 3
- 240000006995 Abutilon theophrasti Species 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 235000008427 Brassica arvensis Nutrition 0.000 description 3
- 244000024671 Brassica kaber Species 0.000 description 3
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 244000285774 Cyperus esculentus Species 0.000 description 3
- 235000005853 Cyperus esculentus Nutrition 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 241000207890 Ipomoea purpurea Species 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 240000003461 Setaria viridis Species 0.000 description 3
- 235000002248 Setaria viridis Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 244000067505 Xanthium strumarium Species 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical class NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BHSSXQLSMUDQIV-UHFFFAOYSA-N 1-(4-methyl-2-nitrophenyl)pyrrole-2,5-dione Chemical compound [O-][N+](=O)C1=CC(C)=CC=C1N1C(=O)C=CC1=O BHSSXQLSMUDQIV-UHFFFAOYSA-N 0.000 description 2
- 150000003923 2,5-pyrrolediones Chemical class 0.000 description 2
- XKIPMLRYMMVZPD-UHFFFAOYSA-N 2-[1-(dimethylsulfamoyl)-4-methoxybenzimidazol-2-yl]-6-methylpyridine-3-carboxylic acid Chemical compound N=1C=2C(OC)=CC=CC=2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(O)=O XKIPMLRYMMVZPD-UHFFFAOYSA-N 0.000 description 2
- NDKWDGCTUOOAPF-UHFFFAOYSA-N 2-methoxy-6-nitroaniline Chemical compound COC1=CC=CC([N+]([O-])=O)=C1N NDKWDGCTUOOAPF-UHFFFAOYSA-N 0.000 description 2
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 2
- YGGUPCZXQURTMJ-UHFFFAOYSA-N 3-ethyl-6-(4-methyl-2-nitrophenyl)-1,4-dihydropyrrolo[3,4-b]pyridine-5,7-dione Chemical compound CC1=CC(=C(C=C1)N1C(=O)C=2NC=C(CC2C1=O)CC)[N+](=O)[O-] YGGUPCZXQURTMJ-UHFFFAOYSA-N 0.000 description 2
- FZRNMFVEXPERKP-UHFFFAOYSA-N 3-ethyl-6-(4-methyl-2-nitrophenyl)pyrrolo[3,4-b]pyridine-5,7-dione Chemical compound O=C1C2=CC(CC)=CN=C2C(=O)N1C1=CC=C(C)C=C1[N+]([O-])=O FZRNMFVEXPERKP-UHFFFAOYSA-N 0.000 description 2
- NFEHEXRTJPZJPV-UHFFFAOYSA-N 6-(2-amino-4-methylphenyl)-3-ethylpyrrolo[3,4-b]pyridine-5,7-dione Chemical compound O=C1C2=CC(CC)=CN=C2C(=O)N1C1=CC=C(C)C=C1N NFEHEXRTJPZJPV-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 241001148683 Zostera marina Species 0.000 description 2
- 150000008061 acetanilides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 150000005182 dinitrobenzenes Chemical class 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000003973 irrigation Methods 0.000 description 2
- 230000002262 irrigation Effects 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- PPNNQNWJSVTFRO-UHFFFAOYSA-N methyl 2-(4-methoxy-1h-benzimidazol-2-yl)-6-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(C)N=C1C1=NC2=C(OC)C=CC=C2N1 PPNNQNWJSVTFRO-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 125000005936 piperidyl group Chemical group 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 244000062645 predators Species 0.000 description 2
- 150000007660 quinolones Chemical class 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- JJDNBBLXPYVGPN-UHFFFAOYSA-N 1,3-dihydro-2,1,3-benzoxadiazole Chemical class C1=CC=C2NONC2=C1 JJDNBBLXPYVGPN-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 1
- ZHWGRLDBELYMCJ-UHFFFAOYSA-N 1-(4-methoxy-2-nitrophenyl)pyrrole-2,5-dione Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1N1C(=O)C=CC1=O ZHWGRLDBELYMCJ-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- XMQGSECMOPTNEA-UHFFFAOYSA-N 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-5-methylpyridine-3-carboxylate;propan-2-ylazanium Chemical compound CC(C)[NH3+].N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C([O-])=O XMQGSECMOPTNEA-UHFFFAOYSA-N 0.000 description 1
- XULVHQXHFBNGSC-UHFFFAOYSA-N 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-6-methylpyridine-3-carboxylate;propan-2-ylazanium Chemical compound CC(C)[NH3+].N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C([O-])=O XULVHQXHFBNGSC-UHFFFAOYSA-N 0.000 description 1
- PTJHAIRDKTVMMT-UHFFFAOYSA-N 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-6-methylpyridine-3-carboxylic acid Chemical compound N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(O)=O PTJHAIRDKTVMMT-UHFFFAOYSA-N 0.000 description 1
- SYYARCUEINIFDO-UHFFFAOYSA-N 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]quinoline-3-carboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C=3N(C4=CC=C(Cl)C=C4N=3)S(=O)(=O)N(C)C)=NC2=C1 SYYARCUEINIFDO-UHFFFAOYSA-N 0.000 description 1
- KUCWUAFNGCMZDB-UHFFFAOYSA-N 2-amino-3-nitrophenol Chemical compound NC1=C(O)C=CC=C1[N+]([O-])=O KUCWUAFNGCMZDB-UHFFFAOYSA-N 0.000 description 1
- ZBFSZPQMEGQIES-UHFFFAOYSA-N 2-ethoxyethyl 5-ethyl-2-(6-methoxy-1h-benzimidazol-2-yl)pyridine-3-carboxylate Chemical compound CCOCCOC(=O)C1=CC(CC)=CN=C1C1=NC2=CC=C(OC)C=C2N1 ZBFSZPQMEGQIES-UHFFFAOYSA-N 0.000 description 1
- YJNIIKUNIMEMHE-UHFFFAOYSA-N 2-ethoxyethyl 5-ethyl-2-(6-methyl-1h-benzimidazol-2-yl)pyridine-3-carboxylate Chemical compound CCOCCOC(=O)C1=CC(CC)=CN=C1C1=NC2=CC=C(C)C=C2N1 YJNIIKUNIMEMHE-UHFFFAOYSA-N 0.000 description 1
- WEZPWDALYRIHIP-UHFFFAOYSA-N 2-methylfuro[3,4-b]pyridine-5,7-dione Chemical compound CC1=CC=C2C(=O)OC(=O)C2=N1 WEZPWDALYRIHIP-UHFFFAOYSA-N 0.000 description 1
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 1
- SEUOXNQCSYDBKF-UHFFFAOYSA-N 2-phenylmethoxy-1h-benzimidazole Chemical class N=1C2=CC=CC=C2NC=1OCC1=CC=CC=C1 SEUOXNQCSYDBKF-UHFFFAOYSA-N 0.000 description 1
- BLCZXLGRKKRKJJ-UHFFFAOYSA-N 3-amino-2-nitrophenol Chemical compound NC1=CC=CC(O)=C1[N+]([O-])=O BLCZXLGRKKRKJJ-UHFFFAOYSA-N 0.000 description 1
- ZCNILONSFBQKEA-UHFFFAOYSA-N 3-ethyl-6-(4-methoxy-2-nitrophenyl)-1,4-dihydropyrrolo[3,4-b]pyridine-5,7-dione Chemical compound COC1=CC(=C(C=C1)N1C(=O)C=2NC=C(CC2C1=O)CC)[N+](=O)[O-] ZCNILONSFBQKEA-UHFFFAOYSA-N 0.000 description 1
- ALXTUICOKUSFLJ-UHFFFAOYSA-N 3-ethyl-6-(4-methoxy-2-nitrophenyl)pyrrolo[3,4-b]pyridine-5,7-dione Chemical compound O=C1C2=CC(CC)=CN=C2C(=O)N1C1=CC=C(OC)C=C1[N+]([O-])=O ALXTUICOKUSFLJ-UHFFFAOYSA-N 0.000 description 1
- GWJMXHZRZKRWSU-UHFFFAOYSA-N 6-(2-amino-4-methoxyphenyl)-3-ethylpyrrolo[3,4-b]pyridine-5,7-dione Chemical compound O=C1C2=CC(CC)=CN=C2C(=O)N1C1=CC=C(OC)C=C1N GWJMXHZRZKRWSU-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000010662 Bidens pilosa Nutrition 0.000 description 1
- 244000104272 Bidens pilosa Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- NZQFYSNTSHICDS-UHFFFAOYSA-N C1=CC=C2N3C(=O)C4=CC=CN=C4C3=NC2=C1 Chemical class C1=CC=C2N3C(=O)C4=CC=CN=C4C3=NC2=C1 NZQFYSNTSHICDS-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005494 Chlorotoluron Substances 0.000 description 1
- 229940126639 Compound 33 Drugs 0.000 description 1
- 239000005946 Cypermethrin Substances 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 235000001950 Elaeis guineensis Nutrition 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 206010019909 Hernia Diseases 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- YJLYANLCNIKXMG-UHFFFAOYSA-N N-Methyldioctylamine Chemical compound CCCCCCCCN(C)CCCCCCCC YJLYANLCNIKXMG-UHFFFAOYSA-N 0.000 description 1
- 239000005586 Nicosulfuron Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 240000000359 Triticum dicoccon Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- CIRZURUTJRNCKH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Mn+6] Chemical compound [O-2].[O-2].[O-2].[Mn+6] CIRZURUTJRNCKH-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002152 aqueous-organic solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-BFGUONQLSA-N benzene-1,2-diamine Chemical class [15NH2]C1=CC=CC=C1[15NH2] GEYOCULIXLDCMW-BFGUONQLSA-N 0.000 description 1
- RGRZVYPWYSPSSH-UHFFFAOYSA-N benzimidazol-4-one Chemical class O=C1C=CC=C2N=CN=C12 RGRZVYPWYSPSSH-UHFFFAOYSA-N 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940125844 compound 46 Drugs 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- UVJHQYIOXKWHFD-UHFFFAOYSA-N cyclohexa-1,4-diene Chemical compound C1C=CCC=C1 UVJHQYIOXKWHFD-UHFFFAOYSA-N 0.000 description 1
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 1
- 229960005424 cypermethrin Drugs 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004925 dihydropyridyl group Chemical class N1(CC=CC=C1)* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007590 electrostatic spraying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- ISXSFOPKZQZDAO-UHFFFAOYSA-N formaldehyde;sodium Chemical compound [Na].O=C ISXSFOPKZQZDAO-UHFFFAOYSA-N 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- NLVZUORLSQCGFQ-UHFFFAOYSA-N furo[3,4-b]quinoline-1,3-dione Chemical compound C1=CC=C2C=C3C(=O)OC(=O)C3=NC2=C1 NLVZUORLSQCGFQ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000000852 hydrogen donor Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- PPNAOCWZXJOHFK-UHFFFAOYSA-N manganese(2+);oxygen(2-) Chemical compound [O-2].[Mn+2] PPNAOCWZXJOHFK-UHFFFAOYSA-N 0.000 description 1
- VASIZKWUTCETSD-UHFFFAOYSA-N manganese(II) oxide Inorganic materials [Mn]=O VASIZKWUTCETSD-UHFFFAOYSA-N 0.000 description 1
- 229910000473 manganese(VI) oxide Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- SZELXOVHWHJPKY-UHFFFAOYSA-N methyl 2-(4-methoxy-1h-benzimidazol-2-yl)quinoline-3-carboxylate Chemical compound C1=CC=C2NC(C3=NC4=CC=CC=C4C=C3C(=O)OC)=NC2=C1OC SZELXOVHWHJPKY-UHFFFAOYSA-N 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- NPEGICQXVSZABE-UHFFFAOYSA-N methyl 2-[1-(dimethylsulfamoyl)-4-methoxybenzimidazol-2-yl]-6-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(C)N=C1C1=NC2=C(OC)C=CC=C2N1S(=O)(=O)N(C)C NPEGICQXVSZABE-UHFFFAOYSA-N 0.000 description 1
- YEAIVJWCYPJUNX-UHFFFAOYSA-N methyl 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-6-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(C)N=C1C1=NC2=CC(Cl)=CC=C2N1S(=O)(=O)N(C)C YEAIVJWCYPJUNX-UHFFFAOYSA-N 0.000 description 1
- 239000011859 microparticle Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- IXXWOILUPFRGDZ-UHFFFAOYSA-N n-methyl-n-(2-methylidenebutylideneamino)methanamine Chemical compound CCC(=C)C=NN(C)C IXXWOILUPFRGDZ-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- IOMMMLWIABWRKL-WUTDNEBXSA-N nazartinib Chemical compound C1N(C(=O)/C=C/CN(C)C)CCCC[C@H]1N1C2=C(Cl)C=CC=C2N=C1NC(=O)C1=CC=NC(C)=C1 IOMMMLWIABWRKL-WUTDNEBXSA-N 0.000 description 1
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000013618 particulate matter Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- SEUSRXNVULUWNE-UHFFFAOYSA-N prop-2-ynyl 2-[1-(dimethylsulfamoyl)-4-ethoxybenzimidazol-2-yl]-6-methylpyridine-3-carboxylate Chemical compound N=1C=2C(OCC)=CC=CC=2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(=O)OCC#C SEUSRXNVULUWNE-UHFFFAOYSA-N 0.000 description 1
- KYJGKMSZUKIBQV-UHFFFAOYSA-N prop-2-ynyl 2-[1-(dimethylsulfamoyl)-4-methylbenzimidazol-2-yl]-5-methylpyridine-3-carboxylate Chemical compound N=1C2=C(C)C=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C(=O)OCC#C KYJGKMSZUKIBQV-UHFFFAOYSA-N 0.000 description 1
- MABTWQLNAJGORM-UHFFFAOYSA-N prop-2-ynyl 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-5-methylpyridine-3-carboxylate Chemical compound N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC=C(C)C=C1C(=O)OCC#C MABTWQLNAJGORM-UHFFFAOYSA-N 0.000 description 1
- HBZJEHUAHQMJRC-UHFFFAOYSA-N prop-2-ynyl 2-[5-chloro-1-(dimethylsulfamoyl)benzimidazol-2-yl]-6-methylpyridine-3-carboxylate Chemical compound N=1C2=CC(Cl)=CC=C2N(S(=O)(=O)N(C)C)C=1C1=NC(C)=CC=C1C(=O)OCC#C HBZJEHUAHQMJRC-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- WQQPDTLGLVLNOH-UHFFFAOYSA-M sodium;4-hydroxy-4-oxo-3-sulfobutanoate Chemical class [Na+].OC(=O)CC(C([O-])=O)S(O)(=O)=O WQQPDTLGLVLNOH-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919107742A GB9107742D0 (en) | 1991-04-11 | 1991-04-11 | New compositions of matter |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU9201235D0 HU9201235D0 (en) | 1992-07-28 |
| HUT60728A true HUT60728A (en) | 1992-10-28 |
Family
ID=10693110
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9201235A HUT60728A (en) | 1991-04-11 | 1992-04-10 | Benzimidazole derivatives, herbicidal compositions comprising such compounds and process for producing such compounds |
Country Status (20)
| Country | Link |
|---|---|
| EP (1) | EP0508800A1 (OSRAM) |
| JP (1) | JPH05112557A (OSRAM) |
| KR (1) | KR920019773A (OSRAM) |
| CN (1) | CN1067653A (OSRAM) |
| AU (1) | AU646552B2 (OSRAM) |
| BR (1) | BR9201460A (OSRAM) |
| CA (1) | CA2065198A1 (OSRAM) |
| CS (1) | CS110592A3 (OSRAM) |
| FI (1) | FI921614A7 (OSRAM) |
| GB (1) | GB9107742D0 (OSRAM) |
| HU (1) | HUT60728A (OSRAM) |
| IE (1) | IE921154A1 (OSRAM) |
| IL (1) | IL101549A0 (OSRAM) |
| MA (1) | MA22498A1 (OSRAM) |
| MX (1) | MX9201653A (OSRAM) |
| OA (1) | OA09575A (OSRAM) |
| PL (1) | PL294186A1 (OSRAM) |
| TR (1) | TR26643A (OSRAM) |
| TW (1) | TW213908B (OSRAM) |
| YU (1) | YU37792A (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9108369D0 (en) * | 1991-04-18 | 1991-06-05 | Rhone Poulenc Agriculture | Compositions of matter |
| DE4323916A1 (de) * | 1993-07-16 | 1995-01-19 | Basf Ag | Substituierte 2-Phenylpyridine |
| AU5881394A (en) * | 1994-01-08 | 1995-08-01 | Rhone-Poulenc Agriculture Limited | Benzimidazolyl quinoline-3-carboxylate derivatives, intermediates thereto, and their use as herbicides |
| PT1313734E (pt) | 2000-09-01 | 2010-02-09 | Novartis Vaccines & Diagnostic | Derivados aza heterocíclicos e sua utilização terapêutica |
| DE60132937T2 (de) | 2000-09-11 | 2009-02-12 | Novartis Vaccines and Diagnostics, Inc., Emeryville | Verfahren zur Herstellung von Benzimidazol-2-yl -Chinolinonderivaten |
| US7825132B2 (en) | 2002-08-23 | 2010-11-02 | Novartis Vaccines And Diagnostics, Inc. | Inhibition of FGFR3 and treatment of multiple myeloma |
| AU2003288899B2 (en) | 2002-08-23 | 2009-09-03 | Novartis Vaccines And Diagnostics, Inc. | Benzimidazole quinolinones and uses thereof |
| AU2003290699B2 (en) | 2002-11-13 | 2009-08-27 | Novartis Vaccines And Diagnostics, Inc. | Methods of treating cancer and related methods |
| RU2377988C2 (ru) | 2004-02-20 | 2010-01-10 | Новартис Вэксинес Энд Дайэгностикс, Инк. | Модуляция воспалительных и метастатических процессов |
| WO2006124413A2 (en) | 2005-05-13 | 2006-11-23 | Novartis Ag | Methods for treating drug resistant cancer |
| ES2376347T3 (es) | 2005-05-17 | 2012-03-13 | Novartis Ag | Métodos para sintetizar compuestos heteroc�?clicos. |
| KR101368519B1 (ko) | 2005-05-23 | 2014-02-27 | 노파르티스 아게 | 결정형 및 기타 형태의 4-아미노-5-플루오로-3-[6-(4-메틸피페라진-1-일)-1h-벤즈이미다졸-2-일]-1h-퀴놀린-2-온 락트산염 |
| TWI545119B (zh) * | 2011-08-04 | 2016-08-11 | 住友化學股份有限公司 | 稠合雜環化合物及其在病蟲害防制上之用途 |
| CA2896453C (en) | 2012-12-27 | 2021-06-08 | Masaki Takahashi | Fused oxazole compounds and use thereof for pest control |
| TWI621616B (zh) * | 2013-01-31 | 2018-04-21 | 住友化學股份有限公司 | 有害生物防治組成物及有害生物之防治方法 |
| RU2015138924A (ru) * | 2013-02-13 | 2017-03-20 | Сумитомо Кемикал Компани, Лимитед | Композиция для борьбы с вредителями и ее применение |
| US20230357210A1 (en) * | 2020-10-29 | 2023-11-09 | Nihon Nohyaku Co., Ltd. | Nitrogen-containing condensed heterocyclic compound having an oxime group, agricultural or horticultural herbicide comprising the compound, and method for using the compound or the herbicide |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1805548A1 (de) * | 1968-10-26 | 1970-10-08 | Agfa Gevaert Ag | Benzimidazol-Derivate und ihre photographische Verwendung |
| ES2052769T3 (es) * | 1987-07-01 | 1994-07-16 | Ciba Geigy Ag | Procedimiento para la obtencion de imidazolonas sustituidas con actividad herbicida. |
| FR2653432A1 (fr) * | 1989-10-20 | 1991-04-26 | Rhone Poulenc Agrochimie | Herbicides derives de 2-azolyl nicotinate. |
| GB9108369D0 (en) * | 1991-04-18 | 1991-06-05 | Rhone Poulenc Agriculture | Compositions of matter |
-
1991
- 1991-04-11 GB GB919107742A patent/GB9107742D0/en active Pending
-
1992
- 1992-04-06 CA CA002065198A patent/CA2065198A1/en not_active Abandoned
- 1992-04-09 IL IL101549A patent/IL101549A0/xx unknown
- 1992-04-09 AU AU14752/92A patent/AU646552B2/en not_active Ceased
- 1992-04-09 TW TW081102739A patent/TW213908B/zh active
- 1992-04-10 FI FI921614A patent/FI921614A7/fi not_active Application Discontinuation
- 1992-04-10 EP EP92303197A patent/EP0508800A1/en not_active Withdrawn
- 1992-04-10 OA OA60183A patent/OA09575A/en unknown
- 1992-04-10 HU HU9201235A patent/HUT60728A/hu unknown
- 1992-04-10 MA MA22780A patent/MA22498A1/fr unknown
- 1992-04-10 MX MX9201653A patent/MX9201653A/es unknown
- 1992-04-10 CS CS921105A patent/CS110592A3/cs unknown
- 1992-04-10 IE IE115492A patent/IE921154A1/en unknown
- 1992-04-10 YU YU37792A patent/YU37792A/sh unknown
- 1992-04-10 TR TR92/0333A patent/TR26643A/xx unknown
- 1992-04-10 PL PL29418692A patent/PL294186A1/xx unknown
- 1992-04-10 JP JP4091018A patent/JPH05112557A/ja active Pending
- 1992-04-11 CN CN92102670A patent/CN1067653A/zh active Pending
- 1992-04-11 KR KR1019920006068A patent/KR920019773A/ko not_active Withdrawn
- 1992-04-13 BR BR929201460A patent/BR9201460A/pt not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CS110592A3 (en) | 1992-10-14 |
| IL101549A0 (en) | 1992-12-30 |
| GB9107742D0 (en) | 1991-05-29 |
| MX9201653A (es) | 1992-11-01 |
| TR26643A (tr) | 1995-03-15 |
| KR920019773A (ko) | 1992-11-20 |
| OA09575A (en) | 1993-01-31 |
| FI921614A0 (fi) | 1992-04-10 |
| HU9201235D0 (en) | 1992-07-28 |
| AU646552B2 (en) | 1994-02-24 |
| TW213908B (OSRAM) | 1993-10-01 |
| AU1475292A (en) | 1992-10-15 |
| CA2065198A1 (en) | 1992-10-12 |
| FI921614A7 (fi) | 1992-10-12 |
| MA22498A1 (fr) | 1992-12-31 |
| CN1067653A (zh) | 1993-01-06 |
| EP0508800A1 (en) | 1992-10-14 |
| BR9201460A (pt) | 1992-12-01 |
| PL294186A1 (en) | 1993-04-19 |
| YU37792A (sh) | 1994-06-10 |
| JPH05112557A (ja) | 1993-05-07 |
| IE921154A1 (en) | 1992-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3078661B2 (ja) | 新規な除草剤 | |
| EP0411153B1 (en) | Triazine derivative and herbicide containing the same as active ingredient | |
| US4693741A (en) | N-phenylsulfonyl-N'-pyrimidinylureas | |
| HUT60728A (en) | Benzimidazole derivatives, herbicidal compositions comprising such compounds and process for producing such compounds | |
| US5104443A (en) | Heterocyclic 2-alkoxyphenoxysulfonylureas and the use thereof as herbicides or plant growth regulators | |
| JPS5989669A (ja) | 除草活性を有する尿素誘導体 | |
| CS20592A3 (en) | 2-cyano-1,3-dione derivatives, process of their preparation and herbicidalcompositions containing said derivatives | |
| HU212433B (en) | Herbicidal compositions containing 4-benzoylisoxazole derivatives, process for the production of active ingredients and their application | |
| CS20492A3 (en) | 2-cyano-1,3-dione derivatives, process of their preparation and herbicidalcompositions containing said derivatives | |
| EP0634413A1 (en) | Herbicides | |
| HU216047B (hu) | Herbicid hatású izoxazolszármazékok, eljárás a vegyületek előállítására, hatóanyagként e vegyületeket tartalmazó készítmények, és eljárás az alkalmazásukra | |
| HUT60727A (en) | Benzimidazole derivatives, herbicidal compositions comprising such compounds and process for producing such compounds | |
| JP3557230B2 (ja) | 新規な除草剤 | |
| SI9400058A (en) | Novel herbicidal 4-benzoylisoxazole derivatives | |
| US5139565A (en) | Substituted pyridinesulfonamide compounds, and herbicidal compositions containing them | |
| US6369270B1 (en) | Benzoic acid intermediates to 4-benzoylisoxazole herbicides | |
| JPH08504781A (ja) | 4−ベンゾイルイソオキサゾール誘導体及び除草剤としてのその使用 | |
| AU659647B2 (en) | Substituted benzothiazole derivatives, their preparation and use as herbicides | |
| HU203084B (en) | Herbicidal compositions comprising sulfonanilide derivatives as active ingredient and process for producing the active ingredient | |
| PH26072A (en) | Heterocyclic-substituted phenylsulfamates processes for their preparation and their use as herbicides and plant growth regulators | |
| EP0384973A2 (en) | Heterocyclic compounds, method for preparing the same and herbicidal compositions containing the compounds as effective components | |
| US5116405A (en) | Pyridinesulfonamide derivatives and herbicides | |
| CA2177586C (en) | 4-benzoylisoxazoles and their use as herbicides | |
| EP0397295A2 (de) | 2-Phenyl-perhydro-isoindol-1-one und -1-thione, Verfahren zu ihrer Herstellung und ihre Verwendung als Mittel mit herbizider Wirkung | |
| JPH05202009A (ja) | 除草剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DFA9 | Temporary protection cancelled due to abandonment | ||
| DFC4 | Cancellation of temporary protection due to refusal |