HU217815B - Guanidinek, azokat tartalmazó gyógyászati készítmények, és eljárás előállításukra - Google Patents
Guanidinek, azokat tartalmazó gyógyászati készítmények, és eljárás előállításukra Download PDFInfo
- Publication number
- HU217815B HU217815B HU206/91A HU220691A HU217815B HU 217815 B HU217815 B HU 217815B HU 206/91 A HU206/91 A HU 206/91A HU 220691 A HU220691 A HU 220691A HU 217815 B HU217815 B HU 217815B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- amidino
- methyl
- group
- ethylidene
- Prior art date
Links
- 150000002357 guanidines Chemical class 0.000 title claims abstract description 23
- 238000002360 preparation method Methods 0.000 title claims abstract description 23
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 11
- 238000000034 method Methods 0.000 title claims description 82
- 150000001875 compounds Chemical class 0.000 claims abstract description 93
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 52
- 150000003839 salts Chemical class 0.000 claims abstract description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 18
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 17
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims abstract description 14
- 108090000190 Thrombin Proteins 0.000 claims abstract description 11
- 229960004072 thrombin Drugs 0.000 claims abstract description 11
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims abstract description 10
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims abstract description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 8
- 125000001544 thienyl group Chemical group 0.000 claims abstract description 8
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims abstract description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims abstract description 5
- 206010053567 Coagulopathies Diseases 0.000 claims abstract description 4
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 4
- 230000035602 clotting Effects 0.000 claims abstract description 4
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims abstract description 3
- -1 benzyloxy, carboxyl Chemical group 0.000 claims description 368
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 82
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 71
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 34
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 125000000623 heterocyclic group Chemical group 0.000 claims description 21
- ZYUZLEUJKZZXNN-UHFFFAOYSA-N C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 Chemical group C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 ZYUZLEUJKZZXNN-UHFFFAOYSA-N 0.000 claims description 20
- 239000007858 starting material Substances 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical group 0.000 claims description 18
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 13
- 125000001072 heteroaryl group Chemical group 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 11
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical group NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 9
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 claims description 9
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000004043 oxo group Chemical group O=* 0.000 claims description 9
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000006303 iodophenyl group Chemical group 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 239000005977 Ethylene Substances 0.000 claims description 5
- 239000004471 Glycine Substances 0.000 claims description 5
- 239000004480 active ingredient Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 229940080818 propionamide Drugs 0.000 claims description 5
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- LWOANYVULDOLAQ-OXJNMPFZSA-N (2r)-n-[[(3s)-1-carbamimidoylpiperidin-3-yl]methyl]-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanamide Chemical compound C1N(C(=N)N)CCC[C@H]1CNC(=O)[C@H](NS(=O)(=O)C=1C=CC(I)=CC=1)CC1=CC=C([N+]([O-])=O)C=C1 LWOANYVULDOLAQ-OXJNMPFZSA-N 0.000 claims description 3
- DNRSDTTWBDTSTQ-UHFFFAOYSA-N 2-prop-2-enoyl-1,4-oxazepane-3-carboxylic acid Chemical group OC(=O)C1NCCCOC1C(=O)C=C DNRSDTTWBDTSTQ-UHFFFAOYSA-N 0.000 claims description 3
- 108010049003 Fibrinogen Proteins 0.000 claims description 3
- 102000008946 Fibrinogen Human genes 0.000 claims description 3
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 3
- 230000002862 amidating effect Effects 0.000 claims description 3
- 125000000748 anthracen-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([H])=C([*])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 3
- 125000003435 aroyl group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 3
- 125000005805 dimethoxy phenyl group Chemical group 0.000 claims description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 3
- 229940012952 fibrinogen Drugs 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 3
- WFNIHQZMCAGWQO-UQBPGWFLSA-N (3r)-n-[[(3s)-1-carbamimidoylpiperidin-3-yl]methyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1h-isoquinoline-3-carboxamide Chemical compound C1N(C(=N)N)CCC[C@H]1CNC(=O)[C@@H]1N(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CC2=CC=CC=C2C1 WFNIHQZMCAGWQO-UQBPGWFLSA-N 0.000 claims description 2
- OTVHXWFANORBAK-UHFFFAOYSA-N 3-(1h-indol-3-yl)propanamide Chemical compound C1=CC=C2C(CCC(=O)N)=CNC2=C1 OTVHXWFANORBAK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 2
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims description 2
- 206010029897 Obsessive thoughts Diseases 0.000 claims 10
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 6
- 125000001153 fluoro group Chemical group F* 0.000 claims 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 150000001721 carbon Chemical group 0.000 claims 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 2
- AENHCJDJHCBTHU-UHFFFAOYSA-N n-ethenylbenzohydrazide Chemical group C=CN(N)C(=O)C1=CC=CC=C1 AENHCJDJHCBTHU-UHFFFAOYSA-N 0.000 claims 2
- 239000000106 platelet aggregation inhibitor Substances 0.000 claims 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims 2
- VAMXDNCFZGMRCM-UHFFFAOYSA-N 1-(azocan-2-yl)prop-2-en-1-one Chemical group C=CC(=O)C1CCCCCCN1 VAMXDNCFZGMRCM-UHFFFAOYSA-N 0.000 claims 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 claims 1
- KTFGFGGLCMGYTP-UHFFFAOYSA-N 4-Anilino-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC1=CC=CC=C1 KTFGFGGLCMGYTP-UHFFFAOYSA-N 0.000 claims 1
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 claims 1
- 229940127218 antiplatelet drug Drugs 0.000 claims 1
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000005605 benzo group Chemical group 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 265
- 239000000243 solution Substances 0.000 description 163
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 144
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 129
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 108
- 239000000047 product Substances 0.000 description 90
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 86
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 83
- 239000011541 reaction mixture Substances 0.000 description 79
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 69
- 239000000203 mixture Substances 0.000 description 69
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 69
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 51
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 37
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- 239000000741 silica gel Substances 0.000 description 35
- 229910002027 silica gel Inorganic materials 0.000 description 35
- 239000002904 solvent Substances 0.000 description 34
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 25
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000000725 suspension Substances 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- AOPRFYAPABFRPU-UHFFFAOYSA-N amino(imino)methanesulfonic acid Chemical compound NC(=N)S(O)(=O)=O AOPRFYAPABFRPU-UHFFFAOYSA-N 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 10
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 10
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- CZOWYKOQKWYITK-HXUWFJFHSA-N (2r)-3-(1h-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)N[C@H](CC=3C4=CC=CC=C4NC=3)C(=O)O)=CC=C21 CZOWYKOQKWYITK-HXUWFJFHSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 5
- 239000007903 gelatin capsule Substances 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 5
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 5
- 239000003810 Jones reagent Substances 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 4
- 108090000631 Trypsin Proteins 0.000 description 4
- 102000004142 Trypsin Human genes 0.000 description 4
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229940024606 amino acid Drugs 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- VLESERUMBXLIGH-UZLCSXRZSA-N n-[[(3s)-1-carbamimidoylpiperidin-3-yl]methyl]-2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanamide;hydrochloride Chemical compound Cl.C1N(C(=N)N)CCC[C@H]1CNC(=O)C(NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CC=CC([N+]([O-])=O)=C1 VLESERUMBXLIGH-UZLCSXRZSA-N 0.000 description 4
- SWBLLSQMOMPTMC-UHFFFAOYSA-N naphthalene-2-sulfonamide Chemical compound C1=CC=CC2=CC(S(=O)(=O)N)=CC=C21 SWBLLSQMOMPTMC-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- VUNPWIPIOOMCPT-UHFFFAOYSA-N piperidin-3-ylmethanol Chemical compound OCC1CCCNC1 VUNPWIPIOOMCPT-UHFFFAOYSA-N 0.000 description 4
- 239000012453 solvate Substances 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- 239000012588 trypsin Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 108010022999 Serine Proteases Proteins 0.000 description 3
- 102000012479 Serine Proteases Human genes 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229960003767 alanine Drugs 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 3
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 3
- 239000008298 dragée Substances 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- OJCLHERKFHHUTB-VIFPVBQESA-N tert-butyl (3s)-3-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@H](CO)C1 OJCLHERKFHHUTB-VIFPVBQESA-N 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 239000002753 trypsin inhibitor Substances 0.000 description 3
- GTVVZTAFGPQSPC-MRVPVSSYSA-N (2r)-2-azaniumyl-3-(4-nitrophenyl)propanoate Chemical compound OC(=O)[C@H](N)CC1=CC=C([N+]([O-])=O)C=C1 GTVVZTAFGPQSPC-MRVPVSSYSA-N 0.000 description 2
- MALOGFVSIFXJGO-QGZVFWFLSA-N (2r)-3-(2,3-dioxoindol-1-yl)-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)N[C@H](CN3C4=CC=CC=C4C(=O)C3=O)C(=O)O)=CC=C21 MALOGFVSIFXJGO-QGZVFWFLSA-N 0.000 description 2
- GIYNSTWNEVPSJT-LURJTMIESA-N (3s)-3-(hydroxymethyl)piperidine-1-carboxylic acid Chemical compound OC[C@H]1CCCN(C(O)=O)C1 GIYNSTWNEVPSJT-LURJTMIESA-N 0.000 description 2
- CKZVBXBEDDAEFE-UHFFFAOYSA-N (4-benzylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1CC1=CC=CC=C1 CKZVBXBEDDAEFE-UHFFFAOYSA-N 0.000 description 2
- UJNQBJPFFGFZDX-NSHDSACASA-N (4s)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-1,3-oxazolidine-3-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC[C@H]1N(C(O)=O)C(C)(C)OC1 UJNQBJPFFGFZDX-NSHDSACASA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- KZKVPZSPWVMNMC-UHFFFAOYSA-N 2-(hydroxymethyl)morpholine-4-carboxylic acid Chemical compound OCC1CN(C(O)=O)CCO1 KZKVPZSPWVMNMC-UHFFFAOYSA-N 0.000 description 2
- LMONFJPVVMPUTF-UHFFFAOYSA-N 2-(phenylmethoxymethyl)morpholine Chemical compound C1NCCOC1COCC1=CC=CC=C1 LMONFJPVVMPUTF-UHFFFAOYSA-N 0.000 description 2
- GMOYUTKNPLBTMT-UHFFFAOYSA-N 2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OCC1=CC=CC=C1 GMOYUTKNPLBTMT-UHFFFAOYSA-N 0.000 description 2
- BXQOBXMSCWNLMU-UHFFFAOYSA-N 3-phenylpropanamide;hydrochloride Chemical compound Cl.NC(=O)CCC1=CC=CC=C1 BXQOBXMSCWNLMU-UHFFFAOYSA-N 0.000 description 2
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229930182827 D-tryptophan Natural products 0.000 description 2
- QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 102000004882 Lipase Human genes 0.000 description 2
- 239000004367 Lipase Substances 0.000 description 2
- 108090001060 Lipase Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 125000005001 aminoaryl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 235000019421 lipase Nutrition 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- FAQJJMHZNSSFSM-UHFFFAOYSA-N phenylglyoxylic acid Chemical compound OC(=O)C(=O)C1=CC=CC=C1 FAQJJMHZNSSFSM-UHFFFAOYSA-N 0.000 description 2
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 2
- 229910052939 potassium sulfate Inorganic materials 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical group CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012064 sodium phosphate buffer Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- OJCLHERKFHHUTB-SECBINFHSA-N tert-butyl (3r)-3-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H](CO)C1 OJCLHERKFHHUTB-SECBINFHSA-N 0.000 description 2
- WPWXYQIMXTUMJB-VIFPVBQESA-N tert-butyl (3s)-3-(aminomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H](CN)C1 WPWXYQIMXTUMJB-VIFPVBQESA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- ZZMXBZXBCMKBPA-IAFNJVLHSA-N (2R)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-2-thiophen-2-ylpropanamide sulfurous acid Chemical compound OS(O)=O.O=C([C@](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)(C)C=1SC=CC=1)NCC1CN(C(N)=N)CCO1 ZZMXBZXBCMKBPA-IAFNJVLHSA-N 0.000 description 1
- LXZCWMHHWHAJQQ-MRVPVSSYSA-N (2r)-1-tert-butylpiperidine-2-carboxylic acid Chemical compound CC(C)(C)N1CCCC[C@@H]1C(O)=O LXZCWMHHWHAJQQ-MRVPVSSYSA-N 0.000 description 1
- QSFALRDZFZTLPS-GOSISDBHSA-N (2r)-2-(naphthalen-2-ylsulfonylamino)-3-(4-nitrophenyl)propanoic acid Chemical compound C([C@H](C(=O)O)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C1=CC=C([N+]([O-])=O)C=C1 QSFALRDZFZTLPS-GOSISDBHSA-N 0.000 description 1
- FXEWXVAULDEYIL-XMMPIXPASA-N (2r)-2-(naphthalen-2-ylsulfonylamino)-3-[4-[(2-oxo-2-phenylacetyl)amino]phenyl]propanoic acid Chemical compound C([C@H](C(=O)O)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C(C=C1)=CC=C1NC(=O)C(=O)C1=CC=CC=C1 FXEWXVAULDEYIL-XMMPIXPASA-N 0.000 description 1
- OFMDGCPAESPZDL-LJQANCHMSA-N (2r)-2-(naphthalen-2-ylsulfonylamino)-4-phenylbutanoic acid Chemical compound C([C@H](C(=O)O)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CC=CC=C1 OFMDGCPAESPZDL-LJQANCHMSA-N 0.000 description 1
- UMOUVVKCYQVPTN-CQSZACIVSA-N (2r)-2-[(2-methoxycarbonylphenyl)sulfonylamino]-3-(4-nitrophenyl)propanoic acid Chemical compound COC(=O)C1=CC=CC=C1S(=O)(=O)N[C@@H](C(O)=O)CC1=CC=C([N+]([O-])=O)C=C1 UMOUVVKCYQVPTN-CQSZACIVSA-N 0.000 description 1
- MJRXBUYVXBLHAT-MRXNPFEDSA-N (2r)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-(1h-indol-3-yl)propanoic acid Chemical compound C1=C(OC)C(OC)=CC=C1S(=O)(=O)N[C@@H](C(O)=O)CC1=CNC2=CC=CC=C12 MJRXBUYVXBLHAT-MRXNPFEDSA-N 0.000 description 1
- NEZPNLSTNAICRW-GOSISDBHSA-N (2r)-2-[(4-iodophenyl)sulfonylamino]-3-naphthalen-2-ylpropanoic acid Chemical compound N([C@H](CC=1C=C2C=CC=CC2=CC=1)C(=O)O)S(=O)(=O)C1=CC=C(I)C=C1 NEZPNLSTNAICRW-GOSISDBHSA-N 0.000 description 1
- VWPYMRYWUGOQNV-HXUWFJFHSA-N (2r)-2-[(6-hydroxynaphthalen-2-yl)sulfonylamino]-3-(1h-indol-3-yl)propanoic acid Chemical compound C1=C(O)C=CC2=CC(S(=O)(=O)N[C@H](CC=3C4=CC=CC=C4NC=3)C(=O)O)=CC=C21 VWPYMRYWUGOQNV-HXUWFJFHSA-N 0.000 description 1
- CIRDYDVCOLZTTR-JOCHJYFZSA-N (2r)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-naphthalen-2-ylsulfonylamino]-3-phenylpropanoic acid Chemical compound C([C@@H](N(CC(=O)OC(C)(C)C)S(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C(O)=O)C1=CC=CC=C1 CIRDYDVCOLZTTR-JOCHJYFZSA-N 0.000 description 1
- JXUYPFWFQKLOLF-LJQANCHMSA-N (2r)-3-(1h-indol-3-yl)-2-(naphthalen-1-ylsulfonylamino)propanoic acid Chemical compound C1=CC=C2C(S(=O)(=O)N[C@H](CC=3C4=CC=CC=C4NC=3)C(=O)O)=CC=CC2=C1 JXUYPFWFQKLOLF-LJQANCHMSA-N 0.000 description 1
- BKKMBBYOWJSVNK-MRXNPFEDSA-N (2r)-3-(1h-indol-3-yl)-2-[(3-nitrophenyl)sulfonylamino]propanoic acid Chemical compound N([C@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)S(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 BKKMBBYOWJSVNK-MRXNPFEDSA-N 0.000 description 1
- PBXPAUUEFDCVCM-GOSISDBHSA-N (2r)-3-(1h-indol-3-yl)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]propanoic acid Chemical compound CC1=C(C)C(OC)=CC(C)=C1S(=O)(=O)N[C@@H](C(O)=O)CC1=CNC2=CC=CC=C12 PBXPAUUEFDCVCM-GOSISDBHSA-N 0.000 description 1
- KJJXWLQWLLITGC-MRXNPFEDSA-N (2r)-3-(1h-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanoic acid Chemical compound N([C@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 KJJXWLQWLLITGC-MRXNPFEDSA-N 0.000 description 1
- JBSCAUNSTNTECW-HSZRJFAPSA-N (2r)-3-(1h-indol-3-yl)-2-[(4-phenylmethoxyphenyl)sulfonylamino]propanoic acid Chemical compound N([C@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)S(=O)(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 JBSCAUNSTNTECW-HSZRJFAPSA-N 0.000 description 1
- DAGYTGGBYWXSKA-JOCHJYFZSA-N (2r)-3-(1h-indol-3-yl)-2-[(4-phenylphenyl)sulfonylamino]propanoic acid Chemical compound N([C@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)S(=O)(=O)C(C=C1)=CC=C1C1=CC=CC=C1 DAGYTGGBYWXSKA-JOCHJYFZSA-N 0.000 description 1
- YMRHPDCXRZUYMU-XMMPIXPASA-N (2r)-3-(1h-indol-3-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1S(=O)(=O)N[C@@H](C(O)=O)CC1=CNC2=CC=CC=C12 YMRHPDCXRZUYMU-XMMPIXPASA-N 0.000 description 1
- UWTHONUVTLWJQP-GOSISDBHSA-N (2r)-3-(4-aminophenyl)-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C1=CC(N)=CC=C1C[C@H](C(O)=O)NS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 UWTHONUVTLWJQP-GOSISDBHSA-N 0.000 description 1
- JENXCBGXYCPDFS-GOSISDBHSA-N (2r)-3-(4-chlorophenyl)-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C([C@H](C(=O)O)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C1=CC=C(Cl)C=C1 JENXCBGXYCPDFS-GOSISDBHSA-N 0.000 description 1
- MIJSJXMFBQJTSO-LJQANCHMSA-N (2r)-3-(4-cyanophenyl)-2-(naphthalen-2-ylsulfonylamino)propanoic acid Chemical compound C([C@H](C(=O)O)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)C1=CC=C(C#N)C=C1 MIJSJXMFBQJTSO-LJQANCHMSA-N 0.000 description 1
- CPFQHLRXMYOSFG-MBXXSUCOSA-N (2r)-n-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-3-(4-nitrophenyl)propanamide;sulfurous acid Chemical compound OS(O)=O.C1N(C(=N)N)CCCC1CNC(=O)[C@H](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CC=C([N+]([O-])=O)C=C1 CPFQHLRXMYOSFG-MBXXSUCOSA-N 0.000 description 1
- OQIXYNBIOMVGLV-HNJBWXLUSA-N (2r)-n-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-(1h-indol-3-yl)propanamide;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1S(=O)(=O)N[C@@H](C(=O)NCC1CN(CCC1)C(N)=N)CC1=CNC2=CC=CC=C12 OQIXYNBIOMVGLV-HNJBWXLUSA-N 0.000 description 1
- AICBNCFFBYZYFR-PZFASQSNSA-N (2r)-n-[(4-carbamimidoylmorpholin-2-yl)methyl]-2-naphthalen-2-ylsulfonyl-3-(4-nitrophenyl)propanamide;sulfurous acid Chemical compound OS(O)=O.C1N(C(=N)N)CCOC1CNC(=O)[C@H](S(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CC=C([N+]([O-])=O)C=C1 AICBNCFFBYZYFR-PZFASQSNSA-N 0.000 description 1
- FOXRXVSTFGNURG-VIFPVBQESA-N (2s)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid Chemical compound NC[C@@H](C(O)=O)NC(=O)OCC1=CC=CC=C1 FOXRXVSTFGNURG-VIFPVBQESA-N 0.000 description 1
- QZHRRVUUNSPCDW-LJQANCHMSA-N (3r)-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1h-isoquinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)N3CC4=CC=CC=C4C[C@@H]3C(=O)O)=CC=C21 QZHRRVUUNSPCDW-LJQANCHMSA-N 0.000 description 1
- OPGHDGTTZBZELG-ZCFIWIBFSA-N (3r)-3-(aminomethyl)piperidine-1-carboxylic acid Chemical compound NC[C@H]1CCCN(C(O)=O)C1 OPGHDGTTZBZELG-ZCFIWIBFSA-N 0.000 description 1
- YEVFLUKQHJTSMN-ZCFIWIBFSA-N (3r)-3-(hydroxymethyl)piperidine-1-carboximidamide Chemical compound NC(=N)N1CCC[C@@H](CO)C1 YEVFLUKQHJTSMN-ZCFIWIBFSA-N 0.000 description 1
- VACVYSRLSQNGRZ-LAUBAEHRSA-N (3r)-4-[[(3s)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methylamino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid Chemical compound C1N(C(=O)OC(C)(C)C)CCC[C@H]1CNC(=O)[C@@H](CC(O)=O)NS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 VACVYSRLSQNGRZ-LAUBAEHRSA-N 0.000 description 1
- ZZXSZQVLEPQHMN-SOCOPEQHSA-N (3r)-n-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1h-isoquinoline-3-carboxamide;hydrochloride Chemical compound Cl.C1N(C(=N)N)CCCC1CNC(=O)[C@@H]1N(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CC2=CC=CC=C2C1 ZZXSZQVLEPQHMN-SOCOPEQHSA-N 0.000 description 1
- ZZXSZQVLEPQHMN-SVZHALOMSA-N (3r)-n-[[(3s)-1-carbamimidoylpiperidin-3-yl]methyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1h-isoquinoline-3-carboxamide;hydrochloride Chemical compound Cl.C1N(C(=N)N)CCC[C@H]1CNC(=O)[C@@H]1N(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CC2=CC=CC=C2C1 ZZXSZQVLEPQHMN-SVZHALOMSA-N 0.000 description 1
- ZXDMKFJQAUELAX-ILKKLZGPSA-N (3s)-3-(aminomethyl)piperidine-1-carboximidamide;dihydrochloride Chemical compound Cl.Cl.NC[C@@H]1CCCN(C(N)=N)C1 ZXDMKFJQAUELAX-ILKKLZGPSA-N 0.000 description 1
- OPGHDGTTZBZELG-LURJTMIESA-N (3s)-3-(aminomethyl)piperidine-1-carboxylic acid Chemical compound NC[C@@H]1CCCN(C(O)=O)C1 OPGHDGTTZBZELG-LURJTMIESA-N 0.000 description 1
- XDNJYSMBVXPRDP-UHFFFAOYSA-N (4-carbamimidoylmorpholin-2-yl)methyl carbamate Chemical compound C(N)(OCC1CN(CCO1)C(N)=N)=O XDNJYSMBVXPRDP-UHFFFAOYSA-N 0.000 description 1
- OJPCTMYCKYJMRM-RXMQYKEDSA-N (4r)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid Chemical compound CC1(C)OC[C@@H](CO)N1C(O)=O OJPCTMYCKYJMRM-RXMQYKEDSA-N 0.000 description 1
- JAKLEZBNUKAJFA-LURJTMIESA-N (4s)-2,2-dimethyl-4-(methylsulfonyloxymethyl)-1,3-oxazolidine-3-carboxylic acid Chemical compound CC1(C)OC[C@@H](COS(C)(=O)=O)N1C(O)=O JAKLEZBNUKAJFA-LURJTMIESA-N 0.000 description 1
- QLKAEIJFEMKGNO-UHFFFAOYSA-N (6-chlorosulfonylnaphthalen-2-yl) acetate Chemical compound C1=C(S(Cl)(=O)=O)C=CC2=CC(OC(=O)C)=CC=C21 QLKAEIJFEMKGNO-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- VJCZYUDVOCSWKC-UHFFFAOYSA-N 1,4-oxazepane-3-carboxylic acid Chemical compound OC(=O)C1COCCCN1 VJCZYUDVOCSWKC-UHFFFAOYSA-N 0.000 description 1
- OYDFOSGPHZNUCV-SECBINFHSA-N 1-[(2r)-2-amino-3-hydroxypropyl]-3h-indol-2-one Chemical compound C1=CC=C2N(C[C@H](CO)N)C(=O)CC2=C1 OYDFOSGPHZNUCV-SECBINFHSA-N 0.000 description 1
- ILVVKNMFEKZDAJ-UHFFFAOYSA-N 1-piperidin-1-ylazepane Chemical compound C1CCCCN1N1CCCCCC1 ILVVKNMFEKZDAJ-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- MHQOJGVTYKBLJR-UHFFFAOYSA-N 2-(aminomethyl)morpholine-4-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NCC1CN(C(N)=N)CCO1 MHQOJGVTYKBLJR-UHFFFAOYSA-N 0.000 description 1
- SBGXJQKZNQXIMY-UHFFFAOYSA-N 2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanoic acid Chemical compound C=1C=C2C=CC=CC2=CC=1S(=O)(=O)NC(C(=O)O)CC1=CC=CC([N+]([O-])=O)=C1 SBGXJQKZNQXIMY-UHFFFAOYSA-N 0.000 description 1
- VZNFIMDHEQXWNZ-UHFFFAOYSA-N 2-(phenylmethoxymethyl)morpholine-4-carboxylic acid Chemical compound C1N(C(=O)O)CCOC1COCC1=CC=CC=C1 VZNFIMDHEQXWNZ-UHFFFAOYSA-N 0.000 description 1
- QNYBOILAKBSWFG-UHFFFAOYSA-N 2-(phenylmethoxymethyl)oxirane Chemical compound C1OC1COCC1=CC=CC=C1 QNYBOILAKBSWFG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- DBDHSVVBFZSJPV-OJPHEVSQSA-N 2-[3-[(2r)-3-[(1-carbamimidoylpiperidin-3-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]indol-1-yl]acetic acid;sulfurous acid Chemical compound OS(O)=O.C1N(C(=N)N)CCCC1CNC(=O)[C@H](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CN(CC(O)=O)C2=CC=CC=C12 DBDHSVVBFZSJPV-OJPHEVSQSA-N 0.000 description 1
- VTTXLPAJLGWREK-LUTIACGYSA-N 2-[[(2s)-1-[(1-carbamimidoylpiperidin-3-yl)methylamino]-3-(naphthalen-2-ylsulfonylamino)-1-oxopropan-2-yl]carbamoyl]benzoic acid Chemical compound C1N(C(=N)N)CCCC1CNC(=O)[C@@H](NC(=O)C=1C(=CC=CC=1)C(O)=O)CNS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 VTTXLPAJLGWREK-LUTIACGYSA-N 0.000 description 1
- PQJZHMCWDKOPQG-UHFFFAOYSA-N 2-anilino-2-oxoacetic acid Chemical compound OC(=O)C(=O)NC1=CC=CC=C1 PQJZHMCWDKOPQG-UHFFFAOYSA-N 0.000 description 1
- ZVHSTSPHNXVZSW-UHFFFAOYSA-N 2-anilino-2-oxoacetic acid;hydrochloride Chemical compound Cl.OC(=O)C(=O)NC1=CC=CC=C1 ZVHSTSPHNXVZSW-UHFFFAOYSA-N 0.000 description 1
- VGALFAWDSNRXJK-UHFFFAOYSA-N 2-azaniumyl-4-oxo-4-phenylmethoxybutanoate Chemical compound OC(=O)C(N)CC(=O)OCC1=CC=CC=C1 VGALFAWDSNRXJK-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- YJVGEKBXSUEJIN-UHFFFAOYSA-N 2-methylpropyl 2-chlorobutanoate Chemical compound CCC(Cl)C(=O)OCC(C)C YJVGEKBXSUEJIN-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- GIWRVUADKUVEGU-UHFFFAOYSA-N 2-oxo-2-thiophen-2-ylacetic acid Chemical compound OC(=O)C(=O)C1=CC=CS1 GIWRVUADKUVEGU-UHFFFAOYSA-N 0.000 description 1
- AGYXIUAGBLMBGV-UHFFFAOYSA-N 3,5-dimethylpyrazole-1-carboximidamide;nitric acid Chemical compound O[N+]([O-])=O.CC=1C=C(C)N(C(N)=N)N=1 AGYXIUAGBLMBGV-UHFFFAOYSA-N 0.000 description 1
- SZNYBEZFRYZZFS-UHFFFAOYSA-N 3-(aminomethyl)piperidine-1-carboximidamide;sulfurous acid Chemical compound OS(O)=O.NCC1CCCN(C(N)=N)C1 SZNYBEZFRYZZFS-UHFFFAOYSA-N 0.000 description 1
- MDYHYGXLOLOEJJ-UHFFFAOYSA-N 3-(butanoyloxymethyl)piperidine-1-carboxylic acid Chemical compound CCCC(=O)OCC1CCCN(C(O)=O)C1 MDYHYGXLOLOEJJ-UHFFFAOYSA-N 0.000 description 1
- YEVFLUKQHJTSMN-UHFFFAOYSA-N 3-(hydroxymethyl)piperidine-1-carboximidamide Chemical compound NC(=N)N1CCCC(CO)C1 YEVFLUKQHJTSMN-UHFFFAOYSA-N 0.000 description 1
- ZVHUQIMPAVOVTR-UHFFFAOYSA-N 4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=CC=C21 ZVHUQIMPAVOVTR-UHFFFAOYSA-N 0.000 description 1
- NJSPBZNGNRRLKD-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonamide Chemical compound C1=C(O)C=CC2=CC(S(=O)(=O)N)=CC=C21 NJSPBZNGNRRLKD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- WYZYXRNUCNOXBS-UHFFFAOYSA-N C(C(C)C)(=O)OC.C(C)(=O)O Chemical compound C(C(C)C)(=O)OC.C(C)(=O)O WYZYXRNUCNOXBS-UHFFFAOYSA-N 0.000 description 1
- FRJFDLINIBWLLU-ALTKQTKQSA-N CC(O)=O.C1C[C@H](OC(C)=O)[C@@H](C(=O)OCC)CN1C(=O)C[C@H](C(=O)NC[C@H]1CN(CCC1)C(N)=N)NS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 Chemical compound CC(O)=O.C1C[C@H](OC(C)=O)[C@@H](C(=O)OCC)CN1C(=O)C[C@H](C(=O)NC[C@H]1CN(CCC1)C(N)=N)NS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 FRJFDLINIBWLLU-ALTKQTKQSA-N 0.000 description 1
- GGQADHVEOHEUKR-UHFFFAOYSA-N CC(O)=O.CCCC(=O)OC Chemical compound CC(O)=O.CCCC(=O)OC GGQADHVEOHEUKR-UHFFFAOYSA-N 0.000 description 1
- YVJLCSBNFHDUCX-UHFFFAOYSA-N CC(O)=O.F.F.F Chemical compound CC(O)=O.F.F.F YVJLCSBNFHDUCX-UHFFFAOYSA-N 0.000 description 1
- WVJDRVXMQJXTST-VJTNNGHGSA-N CC1=CC=C(S(O)(=O)=O)C=C1.C1N(C(=N)N)CCC[C@H]1COC(=O)[C@H](NS(=O)(=O)C=1C=CC(I)=CC=1)CC1=CC=C(C=CC=C2)C2=C1 Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C1N(C(=N)N)CCC[C@H]1COC(=O)[C@H](NS(=O)(=O)C=1C=CC(I)=CC=1)CC1=CC=C(C=CC=C2)C2=C1 WVJDRVXMQJXTST-VJTNNGHGSA-N 0.000 description 1
- PCBZRNYXXCIELG-WYFCWLEVSA-N COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 Chemical compound COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 PCBZRNYXXCIELG-WYFCWLEVSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 206010008190 Cerebrovascular accident Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QNAYBMKLOCPYGJ-UWTATZPHSA-N D-alanine Chemical compound C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N D-alpha-Ala Natural products CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical compound OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 1
- COLNVLDHVKWLRT-MRVPVSSYSA-N D-phenylalanine Chemical compound OC(=O)[C@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-MRVPVSSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108010013563 Lipoprotein Lipase Proteins 0.000 description 1
- 102100022119 Lipoprotein lipase Human genes 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 208000009525 Myocarditis Diseases 0.000 description 1
- 108010080798 N(alpha)-(2-naphthylsulfonylglycyl)-4-amidinophenylalanine piperidide Proteins 0.000 description 1
- XXVQHRBIGDAYIS-UHFFFAOYSA-N N-methoxy-N-phenylmethoxyformamide Chemical compound O(C)N(OCC1=CC=CC=C1)C=O XXVQHRBIGDAYIS-UHFFFAOYSA-N 0.000 description 1
- YRNJREHLLDRVPC-UHFFFAOYSA-N NI[N+](=O)[O-] Chemical compound NI[N+](=O)[O-] YRNJREHLLDRVPC-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- KAJBMCZQVSQJDE-YFKPBYRVSA-N Nalpha-(tert-butoxycarbonyl)-l-aspartic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC(O)=O KAJBMCZQVSQJDE-YFKPBYRVSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- ZYTUAKODJSSPFK-UHFFFAOYSA-N OC(=O)C(CC=O)N1CCOCC1 Chemical compound OC(=O)C(CC=O)N1CCOCC1 ZYTUAKODJSSPFK-UHFFFAOYSA-N 0.000 description 1
- FMSSJIYYSUBOBV-SSMICEQESA-N OS(O)=O.O=C([C@@](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)(C)C=1C2=CC=CC=C2C=CC=1)NCC1CCCN(C(N)=N)C1 Chemical compound OS(O)=O.O=C([C@@](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)(C)C=1C2=CC=CC=C2C=CC=1)NCC1CCCN(C(N)=N)C1 FMSSJIYYSUBOBV-SSMICEQESA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000589540 Pseudomonas fluorescens Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- VIVJBLWTIRTLAX-KYSFMIDTSA-N [(3R)-1-carbamimidoylpiperidin-3-yl]methyl (2R)-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanoate 4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C1N(C(=N)N)CCC[C@H]1COC(=O)[C@H](NS(=O)(=O)C=1C=CC(I)=CC=1)CC1=CC=C([N+]([O-])=O)C=C1 VIVJBLWTIRTLAX-KYSFMIDTSA-N 0.000 description 1
- VIVJBLWTIRTLAX-VASSOYJASA-N [(3S)-1-carbamimidoylpiperidin-3-yl]methyl (2R)-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanoate 4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C1N(C(=N)N)CCC[C@@H]1COC(=O)[C@H](NS(=O)(=O)C=1C=CC(I)=CC=1)CC1=CC=C([N+]([O-])=O)C=C1 VIVJBLWTIRTLAX-VASSOYJASA-N 0.000 description 1
- IFUKRLDHUKAYCQ-AFMDSPMNSA-N [(3s)-piperidin-3-yl]methyl (2r)-3-(1h-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanoate Chemical compound O=C([C@@H](CC=1C2=CC=CC=C2NC=1)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)OC[C@H]1CCCNC1 IFUKRLDHUKAYCQ-AFMDSPMNSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- OCJFCFDLOJSGNG-UHFFFAOYSA-N acetic acid;propanamide Chemical compound CC(O)=O.CCC(N)=O OCJFCFDLOJSGNG-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- XJBVBGUCNBMKIH-UHFFFAOYSA-N alumane;ruthenium Chemical compound [AlH3].[Ru] XJBVBGUCNBMKIH-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 230000003024 amidolytic effect Effects 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003310 benzodiazepinyl group Chemical group N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- ZLZGBBIPWXUQST-XFULWGLBSA-N benzyl (2r)-2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C([C@@H](N)C(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 ZLZGBBIPWXUQST-XFULWGLBSA-N 0.000 description 1
- SOGXBRHOWDEKQB-UHFFFAOYSA-N benzyl 2-chloroacetate Chemical compound ClCC(=O)OCC1=CC=CC=C1 SOGXBRHOWDEKQB-UHFFFAOYSA-N 0.000 description 1
- IOBGWLZWSHGVHC-ZOWNYOTGSA-N benzyl n-[[(3s)-1-carbamimidoylpiperidin-3-yl]methyl]carbamate;hydrochloride Chemical compound Cl.C1N(C(=N)N)CCC[C@H]1CNC(=O)OCC1=CC=CC=C1 IOBGWLZWSHGVHC-ZOWNYOTGSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- UQMRAFJOBWOFNS-UHFFFAOYSA-N butyl 2-(2,4-dichlorophenoxy)acetate Chemical compound CCCCOC(=O)COC1=CC=C(Cl)C=C1Cl UQMRAFJOBWOFNS-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- JQRUYENXNMGOFK-UHFFFAOYSA-N chlorosulfonyl benzoate Chemical compound ClS(=O)(=O)OC(=O)C1=CC=CC=C1 JQRUYENXNMGOFK-UHFFFAOYSA-N 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000003593 chromogenic compound Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- WSYUEVRAMDSJKL-UHFFFAOYSA-N ethanolamine-o-sulfate Chemical compound NCCOS(O)(=O)=O WSYUEVRAMDSJKL-UHFFFAOYSA-N 0.000 description 1
- GHBNOCBWSUHAAA-HTQZYQBOSA-N ethyl (2r,4r)-4-methylpiperidine-2-carboxylate Chemical compound CCOC(=O)[C@H]1C[C@H](C)CCN1 GHBNOCBWSUHAAA-HTQZYQBOSA-N 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- XIWBSOUNZWSFKU-UHFFFAOYSA-N ethyl piperidine-3-carboxylate Chemical compound CCOC(=O)C1CCCNC1 XIWBSOUNZWSFKU-UHFFFAOYSA-N 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000005027 hydroxyaryl group Chemical group 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- CETVQRFGPOGIQJ-UHFFFAOYSA-N lithium;hexane Chemical compound [Li+].CCCCC[CH2-] CETVQRFGPOGIQJ-UHFFFAOYSA-N 0.000 description 1
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- HUNUAFNLLYVTQD-UHFFFAOYSA-N methyl 2-chlorosulfonylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S(Cl)(=O)=O HUNUAFNLLYVTQD-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- VLAZLCVSFAYIIL-UHFFFAOYSA-N morpholin-2-ylmethanol Chemical compound OCC1CNCCO1 VLAZLCVSFAYIIL-UHFFFAOYSA-N 0.000 description 1
- LICFRZDRPNUZFK-UHFFFAOYSA-N morpholin-4-ylmethanamine Chemical class NCN1CCOCC1 LICFRZDRPNUZFK-UHFFFAOYSA-N 0.000 description 1
- SEBNPZMOBUCYCA-UHFFFAOYSA-N morpholin-4-ylmethanol Chemical class OCN1CCOCC1 SEBNPZMOBUCYCA-UHFFFAOYSA-N 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- HYNCLRPFLRWIQE-GOSISDBHSA-N n-[(2r)-1-hydroxy-3-(2-oxo-3h-indol-1-yl)propan-2-yl]naphthalene-2-sulfonamide Chemical compound C1=CC=CC2=CC(S(=O)(=O)N[C@H](CN3C4=CC=CC=C4CC3=O)CO)=CC=C21 HYNCLRPFLRWIQE-GOSISDBHSA-N 0.000 description 1
- MOOIFSAMXBEZPU-BROMNNCMSA-N n-[(2r)-3-[[(3s)-1-carbamimidoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]benzamide;4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.C1N(C(=N)N)CCC[C@H]1CNC(=O)[C@H](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CNC(=O)C1=CC=CC=C1 MOOIFSAMXBEZPU-BROMNNCMSA-N 0.000 description 1
- DXZIYWITEICFFN-GOSISDBHSA-N n-[(2r)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propyl]-2-oxo-2-phenylacetamide Chemical compound C([C@H](CO)NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)NC(=O)C(=O)C1=CC=CC=C1 DXZIYWITEICFFN-GOSISDBHSA-N 0.000 description 1
- 125000004999 nitroaryl group Chemical group 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Substances ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 1
- 150000002917 oxazolidines Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- VDZXAOBGHPKGCS-UHFFFAOYSA-M sodium;1,4-dioxane;hydroxide Chemical compound [OH-].[Na+].C1COCCO1 VDZXAOBGHPKGCS-UHFFFAOYSA-M 0.000 description 1
- PZMLBZGDTJDWMJ-UHFFFAOYSA-M sodium;propan-2-one;hydroxide Chemical compound [OH-].[Na+].CC(C)=O PZMLBZGDTJDWMJ-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- IKKHJUNAQMPJBI-INIZCTEOSA-N tert-butyl (3s)-3-(phenylmethoxycarbonylaminomethyl)piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC[C@H]1CNC(=O)OCC1=CC=CC=C1 IKKHJUNAQMPJBI-INIZCTEOSA-N 0.000 description 1
- FBVKRAYXRNUAHT-PZGXJGMVSA-N tert-butyl (3s)-3-[[(2r)-3-(1h-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]oxymethyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC[C@@H]1COC(=O)[C@H](NS(=O)(=O)C=1C=C2C=CC=CC2=CC=1)CC1=CNC2=CC=CC=C12 FBVKRAYXRNUAHT-PZGXJGMVSA-N 0.000 description 1
- DWFOEHLGMZJBAA-MRVPVSSYSA-N tert-butyl (4r)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate Chemical compound CC(C)(C)OC(=O)N1[C@H](CO)COC1(C)C DWFOEHLGMZJBAA-MRVPVSSYSA-N 0.000 description 1
- MTMBHUYOIZWQAJ-UHFFFAOYSA-N tert-butyl 2-(aminomethyl)morpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCOC(CN)C1 MTMBHUYOIZWQAJ-UHFFFAOYSA-N 0.000 description 1
- GNPOTFNXILEQBA-UHFFFAOYSA-N tert-butyl 2-(aminomethyl)pyridine-3-carboxylate Chemical compound CC(C)(C)OC(=O)C1=CC=CN=C1CN GNPOTFNXILEQBA-UHFFFAOYSA-N 0.000 description 1
- SJMDMGHPMLKLHQ-UHFFFAOYSA-N tert-butyl 2-aminoacetate Chemical compound CC(C)(C)OC(=O)CN SJMDMGHPMLKLHQ-UHFFFAOYSA-N 0.000 description 1
- OSWULUXZFOQIRU-UHFFFAOYSA-N tert-butyl 2-aminoacetate;hydrochloride Chemical compound Cl.CC(C)(C)OC(=O)CN OSWULUXZFOQIRU-UHFFFAOYSA-N 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- OJCLHERKFHHUTB-UHFFFAOYSA-N tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CO)C1 OJCLHERKFHHUTB-UHFFFAOYSA-N 0.000 description 1
- IYHJNCQAADULQE-UHFFFAOYSA-N tert-butyl n-(morpholin-2-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CNCCO1 IYHJNCQAADULQE-UHFFFAOYSA-N 0.000 description 1
- KHPQHXGYYXYTDN-UHFFFAOYSA-N tert-butyl n-(piperidin-3-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCCNC1 KHPQHXGYYXYTDN-UHFFFAOYSA-N 0.000 description 1
- PGAZQSBUJDVGIX-UHFFFAOYSA-N thiazepane Chemical compound C1CCNSCC1 PGAZQSBUJDVGIX-UHFFFAOYSA-N 0.000 description 1
- 229960003766 thrombin (human) Drugs 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/04—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to acyclic carbon atoms of a carbon skeleton
- C07C279/12—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to acyclic carbon atoms of a carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
- C07D265/32—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH225090 | 1990-07-05 | ||
| CH131591 | 1991-05-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU912206D0 HU912206D0 (en) | 1991-12-30 |
| HUT58288A HUT58288A (en) | 1992-02-28 |
| HU217815B true HU217815B (hu) | 2000-04-28 |
Family
ID=25687300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU206/91A HU217815B (hu) | 1990-07-05 | 1991-07-01 | Guanidinek, azokat tartalmazó gyógyászati készítmények, és eljárás előállításukra |
Country Status (19)
| Country | Link |
|---|---|
| US (6) | US5260307A (enExample) |
| EP (1) | EP0468231B1 (enExample) |
| JP (1) | JPH0730022B2 (enExample) |
| KR (1) | KR100218600B1 (enExample) |
| AT (1) | ATE111890T1 (enExample) |
| AU (1) | AU650458B2 (enExample) |
| CA (1) | CA2044636A1 (enExample) |
| DE (1) | DE59103021D1 (enExample) |
| DK (1) | DK0468231T3 (enExample) |
| ES (1) | ES2061125T3 (enExample) |
| FI (1) | FI102966B1 (enExample) |
| HU (1) | HU217815B (enExample) |
| IE (1) | IE66047B1 (enExample) |
| IL (3) | IL98690A (enExample) |
| MC (1) | MC2261A1 (enExample) |
| NO (1) | NO177704C (enExample) |
| NZ (1) | NZ238773A (enExample) |
| PT (1) | PT98221B (enExample) |
| TW (1) | TW201303B (enExample) |
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW201303B (enExample) * | 1990-07-05 | 1993-03-01 | Hoffmann La Roche | |
| SE9103612D0 (sv) * | 1991-12-04 | 1991-12-04 | Astra Ab | New peptide derivatives |
| GB9200420D0 (en) * | 1992-01-09 | 1992-02-26 | James Black Foundation The Lim | Amino acid derivatives |
| TW223629B (enExample) * | 1992-03-06 | 1994-05-11 | Hoffmann La Roche | |
| SG48063A1 (en) * | 1992-03-06 | 1998-04-17 | Hoffmann La Roche | Sulfonamidocarboxamides |
| DE4242655A1 (de) * | 1992-12-17 | 1994-06-23 | Behringwerke Ag | Verwendung von Thrombin-Inhibitoren zur Inhibition okularer Fibrinbildung |
| JPH06340619A (ja) * | 1993-05-03 | 1994-12-13 | Bristol Myers Squibb Co | グアニジニルまたはアミジニル置換メチルアミノ複素環トロンビン抑制剤 |
| CA2122397A1 (en) * | 1993-05-03 | 1994-11-04 | Spencer D. Kimball | Guanidinyl- or amidinyl-substituted heterocyclic thrombin inhibitors |
| US5783563A (en) * | 1993-06-03 | 1998-07-21 | Astra Aktiebolag | Method for treatment or prophylaxis of venous thrombosis |
| US6984627B1 (en) | 1993-06-03 | 2006-01-10 | Astrazeneca Ab | Peptide derivatives |
| SE9301916D0 (sv) * | 1993-06-03 | 1993-06-03 | Ab Astra | New peptides derivatives |
| TW394760B (en) * | 1993-09-07 | 2000-06-21 | Hoffmann La Roche | Novel Carboxamides, process for their preparation and pharmaceutical composition containing the same |
| US5770575A (en) * | 1994-03-16 | 1998-06-23 | Ortho Pharmaceutical Corporation | Nipecotic acid derivatives as antithrombotic compounds |
| EP0684238A3 (en) * | 1994-04-27 | 1997-01-15 | Hoffmann La Roche | Process for the preparation of dicarboxamides. |
| US5536867A (en) * | 1994-04-27 | 1996-07-16 | Hoffmann-La Roche Inc. | Process for the manufacture of dicarboxamides |
| US5637599A (en) * | 1994-06-17 | 1997-06-10 | Corvas International, Inc. | Arginine mimic derivatives as enzyme inhibitors |
| SE9404196D0 (sv) * | 1994-12-02 | 1994-12-02 | Astra Ab | New antithrombotic formulation |
| US5731439A (en) * | 1995-03-24 | 1998-03-24 | The Dupont Merck Pharmaceutical Company | Piperidine containing aminobornic acids |
| SA96170106A (ar) * | 1995-07-06 | 2005-12-03 | أسترا أكتيبولاج | مشتقات حامض أميني جديدة |
| US5792769A (en) * | 1995-09-29 | 1998-08-11 | 3-Dimensional Pharmaceuticals, Inc. | Guanidino protease inhibitors |
| PL325954A1 (en) * | 1995-09-29 | 1998-08-17 | Dimiensional Pharmaceuticals 3 | Guanidinic protease inhibitors |
| WO1997018194A1 (de) * | 1995-11-13 | 1997-05-22 | Hoechst Aktiengesellschaft | CYCLISCHE UND HETEROCYCLISCHE N-SUBSTITUIERTE α-IMINOHYDROXAM- UND CARBONSÄUREN |
| TW541316B (en) * | 1995-12-21 | 2003-07-11 | Astrazeneca Ab | Prodrugs of thrombin inhibitors |
| HUP9902256A3 (en) * | 1995-12-29 | 2000-01-28 | Dimensional Pharm Inc | Amidino protease inhibitors and pharmaceutical compositions containing them |
| ZA9756B (en) * | 1996-01-16 | 1997-07-17 | Warner Lambert Co | Process for preparing 4,6-disubstituted pyrido[3,4-d]-pyrimidines |
| WO1997027174A1 (en) * | 1996-01-23 | 1997-07-31 | Shionogi & Co., Ltd. | Sulfonated amino acid derivatives and metalloproteinase inhibitors containing the same |
| CA2242416C (en) * | 1996-01-23 | 2006-03-21 | Shionogi & Co., Ltd. | Sulfonated amino acid derivatives and metalloproteinase inhibitors containing the same |
| US6919375B1 (en) | 1996-01-23 | 2005-07-19 | Shionogi & Co., Ltd. | Sulfonated amino acid derivatives and metalloproteinase inhibitors containing the same |
| US6025355A (en) | 1997-05-19 | 2000-02-15 | Cambridge Neuroscience, Inc. | Pharmaceutically active compounds and methods of use |
| US5780480A (en) * | 1996-02-28 | 1998-07-14 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| SE9602263D0 (sv) | 1996-06-07 | 1996-06-07 | Astra Ab | New amino acid derivatives |
| US5668289A (en) * | 1996-06-24 | 1997-09-16 | Merck & Co., Inc. | Pyridinone thrombin inhibitors |
| SE9602646D0 (sv) | 1996-07-04 | 1996-07-04 | Astra Ab | Pharmaceutically-useful compounds |
| US6242198B1 (en) | 1996-07-25 | 2001-06-05 | Cambridge Neuroscience, Inc. | Methods of treatment of eye trauma and disorders |
| US5872138A (en) * | 1996-09-13 | 1999-02-16 | Merck & Co., Inc. | Thrombin inhibitors |
| US5869487A (en) * | 1996-10-24 | 1999-02-09 | Merck & Co., Inc. | Pyrido 3,4-B!pyrazines for use as thrombin inhibitors |
| SG88737A1 (en) | 1996-10-30 | 2002-05-21 | Tanabe Seiyaku Co | S type 2-substituted hydroxy-2-indolidinylbutyric ester compounds and process for preparation thereof |
| US6017934A (en) * | 1997-01-22 | 2000-01-25 | Merck & Co., Inc. | Thrombin inhibitors |
| US5792779A (en) * | 1997-02-19 | 1998-08-11 | Merck & Co., Inc. | Pyridinone thrombin inhibitors |
| US5932606A (en) * | 1997-03-24 | 1999-08-03 | Merck & Co., Inc. | Pyrazinone, pyridinone, piperidine and pyrrolidine thrombin inhibitors |
| DE19719621A1 (de) * | 1997-05-09 | 1998-11-12 | Hoechst Ag | Sulfonylaminocarbonsäuren |
| DE59802394D1 (de) * | 1997-05-09 | 2002-01-24 | Hoechst Ag | Substituierte Diaminocarbonsäuren |
| DE19719817A1 (de) * | 1997-05-13 | 1998-11-19 | Hoechst Ag | Substituierte 6- und 7-Aminotetrahydroisochinolincarbonsäuren |
| AR013084A1 (es) | 1997-06-19 | 2000-12-13 | Astrazeneca Ab | Derivados de amidino utiles como inhibidores de la trombina, composicion farmaceutica, utilizacion de dichos compuestos para la preparacion demedicamentos y proceso para la preparacion de los compuestos mencionados |
| US6011038A (en) * | 1997-09-05 | 2000-01-04 | Merck & Co., Inc. | Pyrazinone thrombin inhibitors |
| US6087373A (en) * | 1997-09-23 | 2000-07-11 | Merck & Co., Inc. | Thrombin inhibitors |
| US6133297A (en) * | 1997-09-30 | 2000-10-17 | Merck & Co., Inc. | Thrombin inhibitors |
| SE9704543D0 (sv) | 1997-12-05 | 1997-12-05 | Astra Ab | New compounds |
| US6001855A (en) * | 1998-01-02 | 1999-12-14 | Hoffman-La Roche Inc. | Thiazole derivatives |
| EP0928793B1 (en) * | 1998-01-02 | 2002-05-15 | F. Hoffmann-La Roche Ag | Thiazole derivatives |
| NZ508005A (en) | 1998-04-24 | 2003-05-30 | Dimensional Pharm Inc | Amino acid amidinohydrazones, alkoxyguanidines and aminoguanidines useful as serine protease inhibitors |
| US6147078A (en) * | 1998-05-19 | 2000-11-14 | Merck & Co., Inc. | Pyrazinone thrombin inhibitors |
| CA2333040A1 (en) * | 1998-05-26 | 1999-12-02 | Merck & Co., Inc. | Imidazopyridine thrombin inhibitors |
| DE19824470A1 (de) * | 1998-05-30 | 1999-12-02 | Boehringer Ingelheim Pharma | Neue Neurokininantagonisten, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zusammensetzungen |
| ES2187171T3 (es) | 1998-07-16 | 2003-05-16 | Aventis Pharma Gmbh | Derivados de acidos fosfinico y fosfonico en calidad de medicamentos. |
| WO2000018762A1 (en) * | 1998-09-28 | 2000-04-06 | Merck & Co., Inc. | Thrombin inhibitors |
| JP2002528543A (ja) | 1998-10-30 | 2002-09-03 | メルク エンド カムパニー インコーポレーテッド | トロンビン阻害剤 |
| AU752186B2 (en) | 1998-10-30 | 2002-09-12 | Merck & Co., Inc. | Thrombin inhibitors |
| DE19851184A1 (de) | 1998-11-06 | 2000-05-11 | Aventis Pharma Gmbh | N-Arylsulfonyl-aminosäure-omega-amide |
| SE9804313D0 (sv) | 1998-12-14 | 1998-12-14 | Astra Ab | New compounds |
| JP2002535250A (ja) | 1999-01-13 | 2002-10-22 | アストラゼネカ アクチボラグ | 新規アミジノベンジルアミン誘導体およびトロンビン阻害物質としてのそれらの使用 |
| KR100377557B1 (ko) * | 1999-02-12 | 2003-03-26 | 주식회사 엘지생명과학 | 아실 구아니딘 작용기를 갖는 선택적 트롬빈 억제제 |
| JP2000302757A (ja) * | 1999-04-16 | 2000-10-31 | Shiseido Co Ltd | N−置換ピペリジン誘導体 |
| US6239132B1 (en) | 1999-04-23 | 2001-05-29 | Merck & Co., Inc. | Thrombin inhibitors |
| EP1189618A4 (en) | 1999-06-04 | 2002-06-19 | Merck & Co Inc | thrombin |
| UA58636C2 (uk) | 1999-06-04 | 2003-08-15 | Мерк Енд Ко., Інк. | Піразинонові інгібітори тромбіну, фармацевтична композиція, спосіб інгібування утворення тромбів у крові, спосіб лікування станів, пов'язаних із тромбоутворенням |
| CA2391012A1 (en) | 1999-11-23 | 2001-05-31 | Merck & Co., Inc. | Pyrazinone thrombin inhibitors |
| ES2189572B1 (es) * | 1999-12-31 | 2004-06-01 | Jose Manuel Valero Salinas | Maquina para aplicacion de refuerzo de fibra de vidrio en encofrados desechables para columnas. |
| WO2001070229A1 (en) | 2000-03-23 | 2001-09-27 | Merck & Co., Inc. | Thrombin inhibitors |
| SE0001803D0 (sv) | 2000-05-16 | 2000-05-16 | Astrazeneca Ab | New compounds i |
| US6433186B1 (en) | 2000-08-16 | 2002-08-13 | Astrazeneca Ab | Amidino derivatives and their use as thormbin inhibitors |
| US7129233B2 (en) | 2000-12-01 | 2006-10-31 | Astrazeneca Ab | Mandelic acid derivatives and their use as thrombin inhibitors |
| AR035216A1 (es) | 2000-12-01 | 2004-05-05 | Astrazeneca Ab | Derivados de acido mandelico ,derivados farmaceuticamente aceptables, uso de estos derivados para la fabricacion de medicamentos, metodos de tratamiento ,procesos para la preparacion de estos derivados, y compuestos intermediarios |
| PL362320A1 (en) * | 2000-12-06 | 2004-10-18 | Aventis Pharma Deutschland Gmbh | Guanidine and amidine derivatives as factor xa inhibitors |
| AR034517A1 (es) * | 2001-06-21 | 2004-02-25 | Astrazeneca Ab | Formulacion farmaceutica |
| EP1505061A4 (en) | 2002-05-16 | 2007-08-22 | Shionogi & Co | CONNECTION WITH PGD-2 RECEPTOR ANTAGONISM |
| SE0201661D0 (sv) * | 2002-05-31 | 2002-05-31 | Astrazeneca Ab | New salts |
| SE0201659D0 (sv) | 2002-05-31 | 2002-05-31 | Astrazeneca Ab | Modified release pharmaceutical formulation |
| US7781424B2 (en) * | 2003-05-27 | 2010-08-24 | Astrazeneca Ab | Modified release pharmaceutical formulation |
| DE10344936A1 (de) * | 2003-09-27 | 2005-04-21 | Aventis Pharma Gmbh | Bicyclische Iminosäurederivate als Inhibitoren von Matrix-Metalloproteinasen |
| US20070105937A1 (en) * | 2003-12-22 | 2007-05-10 | Miguel Pappolla | Indole-3-propionamide and derivatives thereof |
| US7795205B2 (en) | 2004-04-12 | 2010-09-14 | Canyon Pharmaceuticals, Inc. | Methods for effecting regression of tumor mass and size in a metastasized pancreatic tumor |
| TW200827336A (en) | 2006-12-06 | 2008-07-01 | Astrazeneca Ab | New crystalline forms |
| US20160068486A1 (en) | 2013-04-22 | 2016-03-10 | Reuter Chemische Apparatebau Kg | Process for preparing enantiomerically enriched 3-hydroxymethylpiperidine |
| EP3740482A1 (en) | 2018-01-17 | 2020-11-25 | Migal Galilee Research Institute Ltd. | New methionine metabolic pathway inhibitors |
| WO2019142191A1 (en) * | 2018-01-17 | 2019-07-25 | Gavish-Galilee Bio Applications Ltd. | New methionine metabolic pathway inhibitors |
| EP3958868A4 (en) * | 2019-04-22 | 2023-01-18 | The Penn State Research Foundation | METHODS AND COMPOSITIONS FOR INHIBITING ALDEHYDE DEHYDROGENaseS FOR THE TREATMENT OF CANCER |
| KR102271668B1 (ko) * | 2021-01-22 | 2021-07-02 | 김기련 | 원자력 발전소 증기발생기 랜싱 프로세스장치 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE420919B (sv) * | 1973-08-13 | 1981-11-09 | Mitsubishi Chem Ind | Forfarande for framstellning av n?722-dansyl-l-argininderivat och farmaceutiskt godtagbara syradditionssalter derav |
| US4258192A (en) * | 1977-12-16 | 1981-03-24 | Mitsubishi Chemical Industries Limited | N2 -Arylsulfonyl-L-argininamides and the pharmaceutically acceptable salts thereof |
| US4433152A (en) * | 1981-05-25 | 1984-02-21 | Nippon Chemiphar Co., Ltd. | Amidinopiperidine derivatives |
| JPS58194861A (ja) * | 1982-05-10 | 1983-11-12 | Nippon Chemiphar Co Ltd | 新規ピペリジン誘導体およびその製造法 |
| IT1231238B (it) * | 1987-09-21 | 1991-11-26 | Angeli Inst Spa | Derivati ammidinici |
| US5053393A (en) * | 1988-07-20 | 1991-10-01 | Monsanto Company | Novel platelet-aggregation inhibitor |
| US4879313A (en) * | 1988-07-20 | 1989-11-07 | Mosanto Company | Novel platelet-aggregation inhibitors |
| US5037808A (en) * | 1988-07-20 | 1991-08-06 | Monsanto Co. | Indolyl platelet-aggregation inhibitors |
| TW201303B (enExample) * | 1990-07-05 | 1993-03-01 | Hoffmann La Roche | |
| US5254569A (en) * | 1991-01-14 | 1993-10-19 | The Du Pont Merck Pharmaceutical Company | (Amidomethyl)nitrogen heterocyclic analgesics |
| TW223629B (enExample) * | 1992-03-06 | 1994-05-11 | Hoffmann La Roche |
-
1991
- 1991-06-13 TW TW080104619A patent/TW201303B/zh active
- 1991-06-14 CA CA002044636A patent/CA2044636A1/en not_active Abandoned
- 1991-06-24 US US07/719,429 patent/US5260307A/en not_active Expired - Fee Related
- 1991-06-27 MC MC912199A patent/MC2261A1/fr unknown
- 1991-06-28 NZ NZ238773A patent/NZ238773A/en unknown
- 1991-07-01 JP JP3185774A patent/JPH0730022B2/ja not_active Expired - Lifetime
- 1991-07-01 IL IL9869091A patent/IL98690A/en unknown
- 1991-07-01 AU AU79490/91A patent/AU650458B2/en not_active Ceased
- 1991-07-01 HU HU206/91A patent/HU217815B/hu not_active IP Right Cessation
- 1991-07-01 IL IL11271291A patent/IL112712A/en not_active IP Right Cessation
- 1991-07-02 AT AT91110928T patent/ATE111890T1/de active
- 1991-07-02 EP EP91110928A patent/EP0468231B1/de not_active Expired - Lifetime
- 1991-07-02 ES ES91110928T patent/ES2061125T3/es not_active Expired - Lifetime
- 1991-07-02 DE DE59103021T patent/DE59103021D1/de not_active Expired - Fee Related
- 1991-07-02 DK DK91110928.8T patent/DK0468231T3/da not_active Application Discontinuation
- 1991-07-04 NO NO912626A patent/NO177704C/no not_active IP Right Cessation
- 1991-07-04 IE IE234491A patent/IE66047B1/en not_active IP Right Cessation
- 1991-07-04 PT PT98221A patent/PT98221B/pt not_active IP Right Cessation
- 1991-07-04 KR KR1019910011300A patent/KR100218600B1/ko not_active Expired - Fee Related
- 1991-07-05 FI FI913282A patent/FI102966B1/fi active
-
1993
- 1993-06-15 US US08/077,476 patent/US5393760A/en not_active Expired - Fee Related
-
1994
- 1994-11-22 US US08/343,168 patent/US5532232A/en not_active Expired - Fee Related
-
1995
- 1995-02-21 IL IL11271295A patent/IL112712A0/xx unknown
- 1995-06-07 US US08/473,060 patent/US5595999A/en not_active Expired - Fee Related
- 1995-08-04 US US08/511,428 patent/US5583133A/en not_active Expired - Fee Related
-
1996
- 1996-09-17 US US08/715,038 patent/US5763436A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU217815B (hu) | Guanidinek, azokat tartalmazó gyógyászati készítmények, és eljárás előállításukra | |
| RU2133739C1 (ru) | Сульфонамидокарбоксамиды, их гидраты и физиологически приемлемые соли, фармацевтическая композиция на их основе | |
| RU2125991C1 (ru) | Карбоксамиды, их гидраты или сольваты и физиологически совместимые соли | |
| KR20010042042A (ko) | 아미노이소퀴놀린 유도체 | |
| US5244910A (en) | Renin inhibitors | |
| FI105474B (fi) | Välituotteina käytettäviä amiineja ja alkoholeja | |
| HRP930501A2 (en) | Guanidins | |
| JP2003522723A (ja) | メタロプロテイナーゼ阻害剤 | |
| SK14893A3 (en) | Process for preparing sulfoamidocarboxamides and their pharmaceutical compositions | |
| JPWO1999047503A1 (ja) | アミノイソキノリン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |