HU217518B - Heterociklusos csoporttal szubsztituált piridinszármazékok, eljárás előállításukra, hatóanyagként ilyen vegyületeket tartalmazó herbicid készítmények, és eljárás alkalmazásukra - Google Patents
Heterociklusos csoporttal szubsztituált piridinszármazékok, eljárás előállításukra, hatóanyagként ilyen vegyületeket tartalmazó herbicid készítmények, és eljárás alkalmazásukra Download PDFInfo
- Publication number
- HU217518B HU217518B HU9501921A HU9501921A HU217518B HU 217518 B HU217518 B HU 217518B HU 9501921 A HU9501921 A HU 9501921A HU 9501921 A HU9501921 A HU 9501921A HU 217518 B HU217518 B HU 217518B
- Authority
- HU
- Hungary
- Prior art keywords
- yloxy
- methyl
- pyridine
- pyrazol
- trifluoromethyl
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 15
- 150000001875 compounds Chemical class 0.000 title claims description 80
- 239000000203 mixture Substances 0.000 title claims description 35
- 230000002363 herbicidal effect Effects 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 17
- 150000003222 pyridines Chemical class 0.000 title abstract description 9
- 239000004480 active ingredient Substances 0.000 title description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 104
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 67
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 45
- -1 2,6-disubstituted pyridine Chemical class 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000003573 thiols Chemical class 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 2
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000000109 phenylethoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])O* 0.000 claims description 2
- 239000003495 polar organic solvent Substances 0.000 claims description 2
- 125000005554 pyridyloxy group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- NBPVNUPDZYXQSL-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)pyridine Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=CC=CC=N1 NBPVNUPDZYXQSL-UHFFFAOYSA-N 0.000 claims 1
- HGVXNBUEDKYWEA-UHFFFAOYSA-N 2-[(2,4-difluorophenyl)methoxy]pyridine Chemical compound FC1=C(COC2=CC=CC=N2)C=CC(=C1)F HGVXNBUEDKYWEA-UHFFFAOYSA-N 0.000 claims 1
- FHKRCXZOEKWEGE-UHFFFAOYSA-N 2-phenoxy-6-pyridin-2-yloxypyridine Chemical compound N1=C(C=CC=C1)OC1=NC(=CC=C1)OC1=CC=CC=C1 FHKRCXZOEKWEGE-UHFFFAOYSA-N 0.000 claims 1
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical group C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 claims 1
- 239000004009 herbicide Substances 0.000 abstract description 5
- 239000003921 oil Substances 0.000 description 63
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 54
- 210000002435 tendon Anatomy 0.000 description 47
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 239000002689 soil Substances 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- 241000196324 Embryophyta Species 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 229960001866 silicon dioxide Drugs 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003818 flash chromatography Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- OHBIPNNTWKNAGC-UHFFFAOYSA-N 2,6-dibromo-4-methylpyridine Chemical compound CC1=CC(Br)=NC(Br)=C1 OHBIPNNTWKNAGC-UHFFFAOYSA-N 0.000 description 3
- FEYDZHNIIMENOB-UHFFFAOYSA-N 2,6-dibromopyridine Chemical compound BrC1=CC=CC(Br)=N1 FEYDZHNIIMENOB-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 238000003973 irrigation Methods 0.000 description 3
- 230000002262 irrigation Effects 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000002791 soaking Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- IREZYNKPQCIUME-UHFFFAOYSA-N 2,6-bis(phenylmethoxy)pyridine Chemical class C=1C=CC=CC=1COC(N=1)=CC=CC=1OCC1=CC=CC=C1 IREZYNKPQCIUME-UHFFFAOYSA-N 0.000 description 2
- VBEHFOMFHUQAOW-UHFFFAOYSA-N 2-chloro-1h-pyridin-4-one Chemical compound OC1=CC=NC(Cl)=C1 VBEHFOMFHUQAOW-UHFFFAOYSA-N 0.000 description 2
- ABYCTYJDRLQBMT-UHFFFAOYSA-N 6-bromo-4-methylpyridin-2-amine Chemical compound CC1=CC(N)=NC(Br)=C1 ABYCTYJDRLQBMT-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 description 2
- 240000006240 Linum usitatissimum Species 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 235000004426 flaxseed Nutrition 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 1
- MBTGBRYMJKYYOE-UHFFFAOYSA-N 2,6-difluoropyridine Chemical compound FC1=CC=CC(F)=N1 MBTGBRYMJKYYOE-UHFFFAOYSA-N 0.000 description 1
- HNMMGGMSQSKUMF-UHFFFAOYSA-N 2,6-diphenoxypyridine Chemical class C=1C=CC(OC=2C=CC=CC=2)=NC=1OC1=CC=CC=C1 HNMMGGMSQSKUMF-UHFFFAOYSA-N 0.000 description 1
- VVHFXJOCUKBZFS-UHFFFAOYSA-N 2-(chloromethyl)-2-methyloxirane Chemical compound ClCC1(C)CO1 VVHFXJOCUKBZFS-UHFFFAOYSA-N 0.000 description 1
- MFDBYHAXXAGPNF-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenoxy]pyridine Chemical compound FC(F)(F)C1=CC=CC(OC=2N=CC=CC=2)=C1 MFDBYHAXXAGPNF-UHFFFAOYSA-N 0.000 description 1
- GYLJAPGWLWSFLI-UHFFFAOYSA-N 2-bromo-6-[(4-fluorophenyl)methoxy]pyridine Chemical compound C1=CC(F)=CC=C1COC1=CC=CC(Br)=N1 GYLJAPGWLWSFLI-UHFFFAOYSA-N 0.000 description 1
- WEMPEMXDSUATEK-UHFFFAOYSA-N 2-bromo-6-phenylmethoxypyridine Chemical compound BrC1=CC=CC(OCC=2C=CC=CC=2)=N1 WEMPEMXDSUATEK-UHFFFAOYSA-N 0.000 description 1
- VACQCCAAMIGMCD-UHFFFAOYSA-N 2-fluoro-6-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxypyridine Chemical compound CN1N=C(C(F)(F)F)C=C1OC1=CC=CC(F)=N1 VACQCCAAMIGMCD-UHFFFAOYSA-N 0.000 description 1
- DGXRGGUNBXNJRI-UHFFFAOYSA-N 2-methyl-4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C(C)=C1 DGXRGGUNBXNJRI-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JMYCGBHPZNFSLX-UHFFFAOYSA-N 3-hydroxy-3-methylpentanedinitrile Chemical compound N#CCC(O)(C)CC#N JMYCGBHPZNFSLX-UHFFFAOYSA-N 0.000 description 1
- IQIUZZCTONTNIY-UHFFFAOYSA-N 4-methyl-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one Chemical compound CC1=C(C(F)(F)F)NNC1=O IQIUZZCTONTNIY-UHFFFAOYSA-N 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KMZIZRHLLMNWNT-UHFFFAOYSA-N 5-phenoxy-1h-pyrazole Chemical class C=1C=CC=CC=1OC=1C=CNN=1 KMZIZRHLLMNWNT-UHFFFAOYSA-N 0.000 description 1
- VOMMPWVMVDGZEM-UHFFFAOYSA-N 6-bromo-1h-pyridin-2-one Chemical compound OC1=CC=CC(Br)=N1 VOMMPWVMVDGZEM-UHFFFAOYSA-N 0.000 description 1
- TYGHHXCOTIUZQO-UHFFFAOYSA-N 6-bromo-4-methyl-1h-pyridin-2-one Chemical compound CC1=CC(O)=NC(Br)=C1 TYGHHXCOTIUZQO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 240000006995 Abutilon theophrasti Species 0.000 description 1
- 244000036975 Ambrosia artemisiifolia Species 0.000 description 1
- 235000003133 Ambrosia artemisiifolia Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- UGVAQFVQIHNCJV-UHFFFAOYSA-N CN1N=C(C(F)(F)F)C=C1O Chemical compound CN1N=C(C(F)(F)F)C=C1O UGVAQFVQIHNCJV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 240000004585 Dactylis glomerata Species 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- 240000007218 Ipomoea hederacea Species 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 1
- 244000067505 Xanthium strumarium Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 239000003124 biologic agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical group C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 235000015872 dietary supplement Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- VYQNWZOUAUKGHI-UHFFFAOYSA-N monobenzone Chemical compound C1=CC(O)=CC=C1OCC1=CC=CC=C1 VYQNWZOUAUKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229960004029 silicic acid Drugs 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/56—1,2-Diazoles; Hydrogenated 1,2-diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP93105006 | 1993-03-26 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU9501921D0 HU9501921D0 (en) | 1995-09-28 |
| HUT73165A HUT73165A (en) | 1996-06-28 |
| HU217518B true HU217518B (hu) | 2000-02-28 |
Family
ID=8212745
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU9501921A HU217518B (hu) | 1993-03-26 | 1994-03-25 | Heterociklusos csoporttal szubsztituált piridinszármazékok, eljárás előállításukra, hatóanyagként ilyen vegyületeket tartalmazó herbicid készítmények, és eljárás alkalmazásukra |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US5840654A (enExample) |
| EP (1) | EP0690846B1 (enExample) |
| JP (1) | JPH08508277A (enExample) |
| KR (1) | KR100316679B1 (enExample) |
| CN (1) | CN1083433C (enExample) |
| AT (1) | ATE161831T1 (enExample) |
| AU (1) | AU696016B2 (enExample) |
| BR (1) | BR9405910A (enExample) |
| CZ (1) | CZ248395A3 (enExample) |
| DE (1) | DE69407770T2 (enExample) |
| DK (1) | DK0690846T3 (enExample) |
| ES (1) | ES2111925T3 (enExample) |
| GR (1) | GR3026187T3 (enExample) |
| HU (1) | HU217518B (enExample) |
| IL (1) | IL109104A (enExample) |
| MD (1) | MD1761B2 (enExample) |
| RU (1) | RU2140739C1 (enExample) |
| SK (1) | SK282475B6 (enExample) |
| TJ (1) | TJ247B (enExample) |
| TW (1) | TW261513B (enExample) |
| UA (1) | UA58478C2 (enExample) |
| WO (1) | WO1994022833A1 (enExample) |
| ZA (1) | ZA942126B (enExample) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997001538A1 (en) * | 1995-06-28 | 1997-01-16 | Zeneca Limited | Process for the preparation of 2-(6-substituted pyrid-2-yloxymethyl)phenylacetate |
| US5807804A (en) * | 1996-02-22 | 1998-09-15 | American Cyanamid Company | Substituted pyridine herbicidal agents |
| US5677303A (en) * | 1996-06-20 | 1997-10-14 | American Cyanamid Company | Enolethers and their use as a fungicide |
| US5977026A (en) * | 1996-07-30 | 1999-11-02 | American Cyanamid | Herbicidal mixtures |
| AU3816997A (en) * | 1996-07-30 | 1998-02-20 | American Cyanamid Company | Herbicidal substituted pyridine compounds |
| US5922738A (en) * | 1996-07-30 | 1999-07-13 | American Cyanamid Company | Heteroarylpyridine herbicides |
| AU734339B2 (en) * | 1996-07-30 | 2001-06-14 | American Cyanamid Company | Trisubstituted pyridine compounds for herbicidal use |
| JPH11513043A (ja) * | 1996-07-30 | 1999-11-09 | アメリカン・サイアナミド・カンパニー | 除草剤混合物 |
| US5981437A (en) * | 1996-07-30 | 1999-11-09 | American Cyanamid Company | Herbicidal substituted pyridine compounds |
| FR2753450B1 (fr) * | 1996-09-19 | 1999-01-15 | American Cyanamid Co | Heteroaryloxypyridines herbicides |
| US5851952A (en) * | 1997-11-07 | 1998-12-22 | American Cyanamid Company | Herbicidal thienyloxyazines |
| US6121202A (en) * | 1997-11-07 | 2000-09-19 | American Cyanamid Company | Thienyloxypyridines and-pyrimidines useful as herbicidal agents |
| EP1028959B1 (en) * | 1997-11-07 | 2007-06-27 | Basf Aktiengesellschaft | Herbicidal furanyl- and thienyloxyazines |
| US5985796A (en) * | 1998-01-22 | 1999-11-16 | American Cyanamid Company | Herbicidal mixtures |
| US6130188A (en) | 1998-05-05 | 2000-10-10 | American Cyanamid Company | Herbicidal pyridine compounds |
| CA2270843A1 (en) * | 1998-05-05 | 1999-11-05 | American Cyanamid Company | Herbicidal pyridine compounds |
| EP0955292A1 (en) * | 1998-05-05 | 1999-11-10 | American Cyanamid Company | Herbicidal 2-(cycloalk(en)yloxy)-6-(hetero)aryloxy(thio)pyridines |
| PL357501A1 (en) * | 1999-11-12 | 2004-07-26 | Basf Aktiengesellschaft | Herbicidal 2-aryloxy-6-fluoroalkylthioalk(en)yloxy-pyridine |
| US6534447B1 (en) | 1999-11-12 | 2003-03-18 | Basf Aktiengesellschaft | Herbicidal pyridine compounds |
| CA2326020A1 (en) * | 1999-11-17 | 2001-05-17 | Basf Corporation | Herbicidal 2-aryloxy-4-methyl-6-pyrazol-1-yl-pyridines |
| US6448204B1 (en) | 1999-11-17 | 2002-09-10 | Basf Aktiengesellschaft | Herbicidal 2-aryloxy-4-methyl-6-pyrazol-1-yl-pyridines |
| CN1278607C (zh) * | 1999-11-17 | 2006-10-11 | 拜尔公司 | 基于2,6-二取代的吡啶衍生物的选择性除草剂 |
| US6528456B2 (en) | 1999-12-08 | 2003-03-04 | Basf Aktiengesellschaft | Herbicidal 2-pyrazolyl-6-aryloxypyri(mi)dines |
| CA2459360A1 (en) * | 2001-09-07 | 2003-03-20 | Basf Aktiengesellschaft | 4-alkyl-substitute thienyloxy-pyridines |
| KR100641908B1 (ko) * | 2002-05-02 | 2006-11-02 | 주식회사 엘지생명과학 | 피리딘 유도체, 그의 제조방법, 및 제초제 중간체로서의용도 |
| DE102005014638A1 (de) * | 2005-03-31 | 2006-10-05 | Bayer Cropscience Gmbh | Substituierte Pyrazolyloxyphenylderivate als Herbizide |
| TWI471095B (zh) * | 2009-12-21 | 2015-02-01 | Nippon Soda Co | 環胺化合物及殺蟎劑 |
| AR081721A1 (es) | 2010-02-25 | 2012-10-17 | Nippon Soda Co | Compuesto de amina ciclica y acaricida |
| JP6303250B2 (ja) | 2012-12-21 | 2018-04-04 | 石原産業株式会社 | 有害生物防除剤 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3535328A (en) * | 1967-09-01 | 1970-10-20 | Exxon Research Engineering Co | Certain substituted aminothioethoxy pyridines |
| US3687959A (en) * | 1970-05-28 | 1972-08-29 | Exxon Research Engineering Co | Alkaryl-alkoxy, aryl-amido derivatives of pyridine |
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| CH620339A5 (enExample) * | 1976-03-05 | 1980-11-28 | Ciba Geigy Ag | |
| DE2711655A1 (de) * | 1977-03-17 | 1978-09-21 | Basf Ag | Pyridinyl-aminoalkylaether |
| DE2862490D1 (en) * | 1977-08-12 | 1988-04-21 | Ici Plc | Phenoxypyridine compound |
| US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
| EP0003313B1 (de) * | 1978-01-27 | 1981-01-07 | Ciba-Geigy Ag | Neue Pyridyloxy-phenoxy-alpha-propionsäure-aminoalkyl-ester mit herbizider Wirkung,ihre Herstellung, sie enthaltende Mittel und deren Verwendung |
| JPS55139361A (en) * | 1979-04-19 | 1980-10-31 | Ishihara Sangyo Kaisha Ltd | Preparation of 4-(pyridyl-2-oxy)phenoxyalkane-carboxylic acid or its derivative |
| DE2949728A1 (de) * | 1979-12-11 | 1981-06-19 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von optisch aktiven 2-phenoxypropionsaeuren |
| IL64220A (en) * | 1980-11-21 | 1985-06-30 | May & Baker Ltd | Nicotinamide derivatives,their preparation and their use as herbicides |
| US4493730A (en) * | 1982-09-10 | 1985-01-15 | Ishihara Sangyo Kaisha, Ltd. | Phenoxypyridine useful as a herbicide |
| CA1215067A (en) * | 1982-10-18 | 1986-12-09 | Sudarshan K. Malhotra | 2-(6-phenoxy-3-nitro-2-pyridinoxy)-propionate compounds |
| EP0180188B1 (en) * | 1984-10-30 | 1992-04-15 | Otsuka Pharmaceutical Co., Ltd. | A composition for increasing the anti-cancer activity of an anti-cancer compound |
| JP2531952B2 (ja) * | 1987-04-06 | 1996-09-04 | 大塚製薬株式会社 | フオスホリラ−ゼ阻害剤 |
| US5185025A (en) * | 1988-11-21 | 1993-02-09 | Monsanto Company | Substituted pyrazoles and their use as herbicides |
| TW231258B (enExample) * | 1992-05-27 | 1994-10-01 | Shell Internat Res Schappej B V |
-
1994
- 1994-03-24 IL IL10910494A patent/IL109104A/en active IP Right Grant
- 1994-03-25 SK SK1184-95A patent/SK282475B6/sk unknown
- 1994-03-25 RU RU95117980A patent/RU2140739C1/ru not_active IP Right Cessation
- 1994-03-25 AT AT94913064T patent/ATE161831T1/de not_active IP Right Cessation
- 1994-03-25 CN CN94192038A patent/CN1083433C/zh not_active Expired - Fee Related
- 1994-03-25 WO PCT/EP1994/000969 patent/WO1994022833A1/en not_active Ceased
- 1994-03-25 MD MD96-0282A patent/MD1761B2/ro not_active Application Discontinuation
- 1994-03-25 HU HU9501921A patent/HU217518B/hu not_active IP Right Cessation
- 1994-03-25 AU AU65365/94A patent/AU696016B2/en not_active Ceased
- 1994-03-25 EP EP94913064A patent/EP0690846B1/en not_active Expired - Lifetime
- 1994-03-25 JP JP6521658A patent/JPH08508277A/ja active Pending
- 1994-03-25 ZA ZA942126A patent/ZA942126B/xx unknown
- 1994-03-25 TJ TJ96000356A patent/TJ247B/xx unknown
- 1994-03-25 KR KR1019950704084A patent/KR100316679B1/ko not_active Expired - Fee Related
- 1994-03-25 UA UA95094238A patent/UA58478C2/uk unknown
- 1994-03-25 BR BR9405910A patent/BR9405910A/pt not_active IP Right Cessation
- 1994-03-25 DE DE69407770T patent/DE69407770T2/de not_active Expired - Fee Related
- 1994-03-25 DK DK94913064.5T patent/DK0690846T3/da active
- 1994-03-25 CZ CZ952483A patent/CZ248395A3/cs unknown
- 1994-03-25 ES ES94913064T patent/ES2111925T3/es not_active Expired - Lifetime
- 1994-03-25 US US08/525,690 patent/US5840654A/en not_active Expired - Lifetime
- 1994-03-30 TW TW083102793A patent/TW261513B/zh active
-
1998
- 1998-02-20 GR GR980400365T patent/GR3026187T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KR100316679B1 (ko) | 2002-05-30 |
| RU2140739C1 (ru) | 1999-11-10 |
| UA58478C2 (uk) | 2003-08-15 |
| EP0690846A1 (en) | 1996-01-10 |
| SK118495A3 (en) | 1996-06-05 |
| SK282475B6 (sk) | 2002-02-05 |
| US5840654A (en) | 1998-11-24 |
| WO1994022833A1 (en) | 1994-10-13 |
| HU9501921D0 (en) | 1995-09-28 |
| JPH08508277A (ja) | 1996-09-03 |
| KR960701018A (ko) | 1996-02-24 |
| DK0690846T3 (da) | 1998-03-16 |
| DE69407770T2 (de) | 1998-04-16 |
| EP0690846B1 (en) | 1998-01-07 |
| HUT73165A (en) | 1996-06-28 |
| IL109104A (en) | 1998-08-16 |
| CN1122596A (zh) | 1996-05-15 |
| TJ247B (en) | 1999-12-23 |
| MD960282A (en) | 1999-01-31 |
| ZA942126B (en) | 1994-11-10 |
| MD1761B2 (ro) | 2001-10-31 |
| ATE161831T1 (de) | 1998-01-15 |
| ES2111925T3 (es) | 1998-03-16 |
| CZ248395A3 (en) | 1996-03-13 |
| CN1083433C (zh) | 2002-04-24 |
| BR9405910A (pt) | 1995-12-26 |
| TW261513B (enExample) | 1995-11-01 |
| DE69407770D1 (de) | 1998-02-12 |
| GR3026187T3 (en) | 1998-05-29 |
| AU696016B2 (en) | 1998-08-27 |
| AU6536594A (en) | 1994-10-24 |
| IL109104A0 (en) | 1994-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU217518B (hu) | Heterociklusos csoporttal szubsztituált piridinszármazékok, eljárás előállításukra, hatóanyagként ilyen vegyületeket tartalmazó herbicid készítmények, és eljárás alkalmazásukra | |
| US4063928A (en) | Composition and method of controlling undesired plant growth with substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives | |
| US5374604A (en) | Herbicidal 2,6-substituted pyridines | |
| EA022864B1 (ru) | Производные 6-ацил-1,2,4-триазин-3,5-диона и гербициды | |
| RO111006B1 (ro) | Derivati de 2-cian-1,3-diona, procedee de preparare a acestora, compozitie erbicida si metoda pentru controlul cresterii buruienilor | |
| JPH0625162B2 (ja) | アミノピリジン | |
| EP0590045A1 (en) | Substituted pyridine herbicides | |
| HUT74440A (en) | Herbicidal aryl and heteroaryl pyrimidines and herbicidal compositions containing them as ingredients | |
| EP0723960A1 (en) | Herbicidal 2,6-disubstituted pyridines and 2,4-disubstituted pyrimidines | |
| US5849758A (en) | Herbicidal 2, 6-disubstituted pyridines and 2, 4-disubstituted pyrimidines | |
| US5824624A (en) | Herbicidal 2-(hectero)aryloxy-6-arypyridines and 2-aryl-4-(hetero)aryloxypyrimidines | |
| CS261243B2 (en) | Herbicide and plants' growth suppression agent and method of efficient component production | |
| US4003734A (en) | Substituted pyridinyloxy(thio)phenyl-acetamides, -ureas and urea derivatives and herbicidal compositions and methods containing said compounds | |
| US5747423A (en) | Herbicidal 6-thienyl and 4-thienyl pyrimidines | |
| US6110871A (en) | Herbicidal cyanopyridines | |
| US4003733A (en) | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives | |
| US4030910A (en) | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives, herbicidal compositions and methods containing same | |
| JPH0416468B2 (enExample) | ||
| FR2753450A1 (fr) | Heteroaryloxypyridines herbicides | |
| EP0820996A1 (en) | Herbicidal cyanopyridines | |
| US5922738A (en) | Heteroarylpyridine herbicides | |
| US5922726A (en) | Herbicidal 6-thienyl pyridines and 4-thienyl pyrimidines | |
| US4623376A (en) | Herbicidal pyridazines and method for controlling undesirable plant species | |
| US6008161A (en) | Herbicidal 2-(hetero)aryloxy-6-arylpyridines and 2-aryl-4-(hetero) aryloxypyrimidines | |
| AU750083B2 (en) | Herbicidal 3,5-difluoropyridines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of definitive patent protection due to non-payment of fees |