HU204812B - Process for producing imidazole derivatives - Google Patents
Process for producing imidazole derivatives Download PDFInfo
- Publication number
- HU204812B HU204812B HU905023A HU502387A HU204812B HU 204812 B HU204812 B HU 204812B HU 905023 A HU905023 A HU 905023A HU 502387 A HU502387 A HU 502387A HU 204812 B HU204812 B HU 204812B
- Authority
- HU
- Hungary
- Prior art keywords
- group
- phenyl
- pyridyl
- ring
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 33
- 150000002460 imidazoles Chemical class 0.000 title claims description 7
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims description 6
- -1 hydroxy, cyano, pyridyl Chemical group 0.000 claims description 120
- 150000001875 compounds Chemical class 0.000 claims description 97
- 150000003839 salts Chemical class 0.000 claims description 55
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 44
- 239000007858 starting material Substances 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 37
- 238000002360 preparation method Methods 0.000 claims description 32
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 29
- 125000003282 alkyl amino group Chemical group 0.000 claims description 29
- 125000003277 amino group Chemical group 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 14
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- OXFSTTJBVAAALW-UHFFFAOYSA-N 1,3-dihydroimidazole-2-thione Chemical class SC1=NC=CN1 OXFSTTJBVAAALW-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 7
- 230000002829 reductive effect Effects 0.000 claims description 7
- 150000003613 toluenes Chemical class 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 claims description 6
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 5
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 4
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000005544 phthalimido group Chemical group 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 claims 11
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 8
- 125000001475 halogen functional group Chemical group 0.000 claims 5
- 125000002252 acyl group Chemical group 0.000 claims 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 3
- 125000004760 (C1-C4) alkylsulfonylamino group Chemical group 0.000 claims 2
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 claims 2
- 230000002152 alkylating effect Effects 0.000 claims 2
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 2
- 101100055261 Mus musculus Aldh2 gene Proteins 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 189
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 107
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 66
- 238000002844 melting Methods 0.000 description 58
- 230000008018 melting Effects 0.000 description 58
- 239000003921 oil Substances 0.000 description 51
- 239000000203 mixture Substances 0.000 description 50
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 44
- 238000005481 NMR spectroscopy Methods 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- 239000002904 solvent Substances 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 27
- 230000000704 physical effect Effects 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 17
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 17
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 238000001816 cooling Methods 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- 239000013078 crystal Substances 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 8
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000005160 1H NMR spectroscopy Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- LSCOMGFYEWVYJG-UHFFFAOYSA-N 3-pyridin-2-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=CC=N1 LSCOMGFYEWVYJG-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 4
- YRXITRNRDFGPIR-UHFFFAOYSA-N 2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 YRXITRNRDFGPIR-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 125000006519 CCH3 Chemical group 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 229960001340 histamine Drugs 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- RKISOGBHGFJTRJ-UHFFFAOYSA-N 1-(2-oxocyclohexyl)-3-pyridin-2-ylthiourea Chemical compound O=C1CCCCC1NC(=S)NC1=CC=CC=N1 RKISOGBHGFJTRJ-UHFFFAOYSA-N 0.000 description 2
- RGHUOXSZSHFHAN-UHFFFAOYSA-N 2-(n-methylanilino)benzoic acid Chemical compound C=1C=CC=C(C(O)=O)C=1N(C)C1=CC=CC=C1 RGHUOXSZSHFHAN-UHFFFAOYSA-N 0.000 description 2
- HUMHPEZUZRBDNQ-UHFFFAOYSA-N 2-[2-(chloromethyl)phenyl]isoindole-1,3-dione Chemical compound ClCC1=CC=CC=C1N1C(=O)C2=CC=CC=C2C1=O HUMHPEZUZRBDNQ-UHFFFAOYSA-N 0.000 description 2
- ZFWFGZSSKRXRDR-UHFFFAOYSA-N 2-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-ol Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=NC=CC=C1O ZFWFGZSSKRXRDR-UHFFFAOYSA-N 0.000 description 2
- WUWPZXWPOAGOSF-UHFFFAOYSA-N 2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)N)=C1 WUWPZXWPOAGOSF-UHFFFAOYSA-N 0.000 description 2
- HCCFYTHZAOITJV-UHFFFAOYSA-N 2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1CC1=CC=CC=N1 HCCFYTHZAOITJV-UHFFFAOYSA-N 0.000 description 2
- KMLPEYHLAKSCGX-UHFFFAOYSA-N 2-aminocyclohexan-1-one Chemical compound NC1CCCCC1=O KMLPEYHLAKSCGX-UHFFFAOYSA-N 0.000 description 2
- XBPWUNNYJOLFGX-UHFFFAOYSA-N 2-aminocyclopentan-1-one Chemical compound NC1CCCC1=O XBPWUNNYJOLFGX-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ATELCLGEOYJVSY-UHFFFAOYSA-N 6-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 ATELCLGEOYJVSY-UHFFFAOYSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 108010009685 Cholinergic Receptors Proteins 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 208000008469 Peptic Ulcer Diseases 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 102000034337 acetylcholine receptors Human genes 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 150000001923 cyclic compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000027119 gastric acid secretion Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- KNHPLCLJKXWSPO-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 KNHPLCLJKXWSPO-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- HPRRRCJCXROIAC-UHFFFAOYSA-N 1,1-diethoxy-2-isothiocyanatoethane Chemical compound CCOC(OCC)CN=C=S HPRRRCJCXROIAC-UHFFFAOYSA-N 0.000 description 1
- ASYNZUWCVTYWOA-UHFFFAOYSA-N 1-(2,2-diethoxyethyl)-3-pyridin-2-ylthiourea Chemical compound CCOC(OCC)CNC(=S)NC1=CC=CC=N1 ASYNZUWCVTYWOA-UHFFFAOYSA-N 0.000 description 1
- GTUQQNHWQTUHGR-UHFFFAOYSA-N 1-[2-(chloromethyl)phenyl]-n,n-dimethylmethanamine;hydrochloride Chemical compound Cl.CN(C)CC1=CC=CC=C1CCl GTUQQNHWQTUHGR-UHFFFAOYSA-N 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- FUFFKJLKVKILCF-UHFFFAOYSA-N 2,4-diethoxy-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane Chemical compound CCOP1(=S)SP(=S)(OCC)S1 FUFFKJLKVKILCF-UHFFFAOYSA-N 0.000 description 1
- MMJYFEBZBADSNQ-UHFFFAOYSA-N 2-(dimethylcarbamoyl)benzoic acid Chemical compound CN(C)C(=O)C1=CC=CC=C1C(O)=O MMJYFEBZBADSNQ-UHFFFAOYSA-N 0.000 description 1
- HZGXPPSIBPSKMX-UHFFFAOYSA-N 2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 HZGXPPSIBPSKMX-UHFFFAOYSA-N 0.000 description 1
- BDAXSKSCJXFWFX-UHFFFAOYSA-N 2-[phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C=1C=CC=CC=1)SC1=NC=2CCCC=2N1C1=CC=CC=N1 BDAXSKSCJXFWFX-UHFFFAOYSA-N 0.000 description 1
- HGHZKLDCXNJLJK-UHFFFAOYSA-N 2-aminocyclohexan-1-one;hydrochloride Chemical compound Cl.NC1CCCCC1=O HGHZKLDCXNJLJK-UHFFFAOYSA-N 0.000 description 1
- XRWHJJIAVVNAMG-UHFFFAOYSA-N 2-aminocyclopentan-1-one;hydrochloride Chemical compound Cl.NC1CCCC1=O XRWHJJIAVVNAMG-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- WFJPRCMYUOOTNS-UHFFFAOYSA-N 2-isothiocyanatopyridine Chemical class S=C=NC1=CC=CC=N1 WFJPRCMYUOOTNS-UHFFFAOYSA-N 0.000 description 1
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- VXEIEKCYIDAZLW-UHFFFAOYSA-N 3-(5-nitropyridin-2-yl)-1h-imidazole-2-thione Chemical compound N1=CC([N+](=O)[O-])=CC=C1N1C(S)=NC=C1 VXEIEKCYIDAZLW-UHFFFAOYSA-N 0.000 description 1
- LLVZIOLOBGBRGF-UHFFFAOYSA-N 3-(chloromethyl)-n,n-dimethylaniline;hydrochloride Chemical compound Cl.CN(C)C1=CC=CC(CCl)=C1 LLVZIOLOBGBRGF-UHFFFAOYSA-N 0.000 description 1
- RFUCFMSXWUCZLP-UHFFFAOYSA-N 3-(pyridin-2-ylmethyl)-1h-imidazole-2-thione Chemical compound SC1=NC=CN1CC1=CC=CC=N1 RFUCFMSXWUCZLP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- CAZSLNLKLCMOHE-UHFFFAOYSA-N 3-pyridin-2-yl-4,5,6,7-tetrahydro-1h-benzimidazole-2-thione Chemical compound S=C1NC=2CCCCC=2N1C1=CC=CC=N1 CAZSLNLKLCMOHE-UHFFFAOYSA-N 0.000 description 1
- DRVRMNTUPBDSES-UHFFFAOYSA-N 3-pyridin-4-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=NC=C1 DRVRMNTUPBDSES-UHFFFAOYSA-N 0.000 description 1
- BYFAUECJLSNQNO-UHFFFAOYSA-N 3a-hydroxy-3-pyridin-2-yl-4,5,6,6a-tetrahydro-1h-cyclopenta[d]imidazole-2-thione Chemical compound OC12CCCC1NC(=S)N2C1=CC=CC=N1 BYFAUECJLSNQNO-UHFFFAOYSA-N 0.000 description 1
- DTDMBBZYSCGLKW-UHFFFAOYSA-N 4-[2-(chloromethyl)phenyl]morpholine Chemical compound ClCC1=CC=CC=C1N1CCOCC1 DTDMBBZYSCGLKW-UHFFFAOYSA-N 0.000 description 1
- VTHDEAVWONWWGB-UHFFFAOYSA-N 4-[2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]morpholine Chemical compound N1=CC([N+](=O)[O-])=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 VTHDEAVWONWWGB-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- DKDJQLDWNHPZOA-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(N)C=N1 DKDJQLDWNHPZOA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- 102100021022 Gastrin Human genes 0.000 description 1
- 108010052343 Gastrins Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102000003946 Prolactin Human genes 0.000 description 1
- 108010057464 Prolactin Proteins 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- JOHSOKKYAHHTCN-UHFFFAOYSA-N [2-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CC(=O)OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 JOHSOKKYAHHTCN-UHFFFAOYSA-N 0.000 description 1
- RPIHVSOIWYEENT-UHFFFAOYSA-N [2-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=NC=CC=C1OC(C)=O RPIHVSOIWYEENT-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 1
- 229960001380 cimetidine Drugs 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- VCSZKSHWUBFOOE-UHFFFAOYSA-N dioxidanium;sulfate Chemical compound O.O.OS(O)(=O)=O VCSZKSHWUBFOOE-UHFFFAOYSA-N 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- RUWPGPOBTHOLHF-UHFFFAOYSA-N ethyl 2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1F RUWPGPOBTHOLHF-UHFFFAOYSA-N 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 201000005917 gastric ulcer Diseases 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- RQMPREZDZRGAIO-UHFFFAOYSA-N n,2,4,6-tetramethyl-n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]benzenesulfonamide Chemical compound CC=1C=C(C)C=C(C)C=1S(=O)(=O)N(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 RQMPREZDZRGAIO-UHFFFAOYSA-N 0.000 description 1
- OSQGLTCMYYZVNP-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 OSQGLTCMYYZVNP-UHFFFAOYSA-N 0.000 description 1
- IDGNPNTWUSXYKL-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-4-ylimidazol-2-yl)sulfonylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CS(=O)(=O)C1=NC=CN1C1=CC=NC=C1 IDGNPNTWUSXYKL-UHFFFAOYSA-N 0.000 description 1
- TYQXTMSEVJJEGR-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-propan-2-yloxypyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC(C)OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N(C)C)=NC=C1 TYQXTMSEVJJEGR-UHFFFAOYSA-N 0.000 description 1
- JGEDAZAPADMKLK-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C([N+]([O-])=O)C=N1 JGEDAZAPADMKLK-UHFFFAOYSA-N 0.000 description 1
- WDBHHITUDZDUFL-UHFFFAOYSA-N n,n-dimethyl-3-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC(CSC=2N(C=CN=2)C=2N=CC=CC=2)=C1 WDBHHITUDZDUFL-UHFFFAOYSA-N 0.000 description 1
- WSMJISBJPVXQPF-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 WSMJISBJPVXQPF-UHFFFAOYSA-N 0.000 description 1
- INUDCIMREAPRAD-UHFFFAOYSA-N n-[2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 INUDCIMREAPRAD-UHFFFAOYSA-N 0.000 description 1
- IJHBUGWSDXWHDX-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]formamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NC=O)=C1 IJHBUGWSDXWHDX-UHFFFAOYSA-N 0.000 description 1
- BLQXRKBYHAZWRB-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]methanesulfonamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NS(C)(=O)=O)=C1 BLQXRKBYHAZWRB-UHFFFAOYSA-N 0.000 description 1
- SYOZTVHNAHNFHE-UHFFFAOYSA-N n-[6-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound N1=CC(NC(=O)C)=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 SYOZTVHNAHNFHE-UHFFFAOYSA-N 0.000 description 1
- QHARYXAUMSKDKD-UHFFFAOYSA-N n-[6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(NC(C)=O)C=N1 QHARYXAUMSKDKD-UHFFFAOYSA-N 0.000 description 1
- KMFMVTWAHVKBER-UHFFFAOYSA-N n-[chloro(phenyl)methyl]-2,4,6-trimethylbenzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC(Cl)C1=CC=CC=C1 KMFMVTWAHVKBER-UHFFFAOYSA-N 0.000 description 1
- XOISSNHOIAVKRQ-UHFFFAOYSA-N n-[phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methyl]acetamide Chemical compound C=1C=CC=CC=1C(NC(=O)C)SC1=NC=2CCCC=2N1C1=CC=CC=N1 XOISSNHOIAVKRQ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SALWLYRBESSZJM-UHFFFAOYSA-N n-methyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CNC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 SALWLYRBESSZJM-UHFFFAOYSA-N 0.000 description 1
- BONLXZDDDJYFKJ-UHFFFAOYSA-N n-methyl-n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)N(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 BONLXZDDDJYFKJ-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229960000381 omeprazole Drugs 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 210000001711 oxyntic cell Anatomy 0.000 description 1
- YNLIMSABDSQYMV-UHFFFAOYSA-N phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methanamine Chemical compound C=1C=CC=CC=1C(N)SC1=NC=2CCCC=2N1C1=CC=CC=N1 YNLIMSABDSQYMV-UHFFFAOYSA-N 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 229940097325 prolactin Drugs 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 230000008359 toxicosis Effects 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP28751286 | 1986-12-02 | ||
| JP8047587 | 1987-03-31 | ||
| JP21581387 | 1987-08-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU905023D0 HU905023D0 (en) | 1991-01-28 |
| HU204812B true HU204812B (en) | 1992-02-28 |
Family
ID=27303307
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU905023A HU204812B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives |
| HU875393A HU201751B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU875393A HU201751B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US5002945A (enExample) |
| EP (1) | EP0270091B1 (enExample) |
| JP (1) | JPH064623B2 (enExample) |
| KR (1) | KR930004843B1 (enExample) |
| CN (1) | CN1020902C (enExample) |
| AU (1) | AU597446B2 (enExample) |
| DE (1) | DE3782621T2 (enExample) |
| DK (1) | DK631587A (enExample) |
| ES (1) | ES2044901T3 (enExample) |
| FI (1) | FI91754C (enExample) |
| FR (1) | FR2607502B1 (enExample) |
| GR (1) | GR3006257T3 (enExample) |
| HU (2) | HU204812B (enExample) |
| IL (1) | IL84554A (enExample) |
| TW (1) | TW203048B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
| JP2614756B2 (ja) * | 1988-08-10 | 1997-05-28 | 日本ケミファ株式会社 | イミダゾール誘導体およびその製造法ならびにこれを含有する抗潰瘍剤 |
| MY106533A (en) * | 1990-02-20 | 1995-06-30 | Sumitomo Chemical Co | A 4-tert.-butyl imidazole derivative and its production and use. |
| SE9002043D0 (sv) * | 1990-06-07 | 1990-06-07 | Astra Ab | Improved method for synthesis |
| CA2036147A1 (en) * | 1990-06-29 | 1991-12-30 | Hiroki Tomioka | A 1-pyridylimidazole derivative and its production and use |
| MY110439A (en) * | 1991-02-07 | 1998-05-30 | Ishihara Sangyo Kaisha | N-phenylcarbamate compound, process for preparing the same and biocidal composition for control of harmful organisms |
| AU644297B2 (en) * | 1991-06-28 | 1993-12-02 | Sumitomo Chemical Company, Limited | A 1-pyridylimidazole derivative and its production and use |
| US5635521A (en) * | 1991-09-23 | 1997-06-03 | Sandoz Ltd. | Imidazolylmethyl-pyridines |
| DE19541146A1 (de) * | 1995-10-25 | 1997-04-30 | Schering Ag | Imidazolderivate und deren Verwendung als Stickstoffmonoxid-Synthase-Inhibitoren |
| EP1974730A1 (en) | 2003-11-03 | 2008-10-01 | AstraZeneca AB | Imidazo[1,2-a]pyridine derivatives for use in the treatment of sleep disturbance due to silent gastro-esophageal reflux |
| CA2566094A1 (en) * | 2004-05-26 | 2005-12-08 | Eisai R & D Management Co., Ltd. | Cinnamide compound |
| EP1810677A1 (en) * | 2004-10-08 | 2007-07-25 | Takeda Pharmaceutical Company Limited | Receptor function regulating agent |
| TWI370130B (en) | 2005-11-24 | 2012-08-11 | Eisai R&D Man Co Ltd | Two cyclic cinnamide compound |
| CL2008000582A1 (es) | 2007-02-28 | 2008-06-27 | Eisai R&D Man Co Ltd | Compuestos ciclicos derivados de oximorfolina condensados; farmacos que comprenden a dichos compuestos; y su uso para tratar enfermedad de alzheimer, demencia senil, sindrome de down o amiloidosis. |
| CA2694401C (en) | 2007-08-31 | 2012-12-04 | Eisai R&D Management Co., Ltd. | Polycyclic compound |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1234058A (enExample) * | 1968-10-21 | 1971-06-03 | ||
| IN148930B (enExample) * | 1977-09-19 | 1981-07-25 | Hoffmann La Roche | |
| EP0004648B1 (de) * | 1978-04-11 | 1982-08-25 | Ciba-Geigy Ag | Neue Mercaptoimidazolderivate, Verfahren zu deren Herstellung, Mercaptoimidazolderivate zur Behandlung entzündlicher Erkrankungen und diese enthaltende pharmazeutische Präparate |
| SE7804231L (sv) * | 1978-04-14 | 1979-10-15 | Haessle Ab | Magsyrasekretionsmedel |
| US4492708A (en) * | 1982-09-27 | 1985-01-08 | Eli Lilly And Company | Antiviral benzimidazoles |
| DE3369845D1 (en) * | 1982-12-20 | 1987-04-02 | Merck & Co Inc | 5-(amino or substituted amino) imidazoles |
| GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| FI833794A0 (fi) * | 1983-10-18 | 1983-10-18 | Farmos Oy | Substituerade 2-merkapto-imidazoler |
| GB8417171D0 (en) * | 1984-07-05 | 1984-08-08 | Beecham Group Plc | Compounds |
| EP0174717B1 (en) * | 1984-07-06 | 1992-01-22 | FISONS plc | Benzimidazoles, and their production formulation and use as gastric acid secretion inhibitors |
| AU568441B2 (en) * | 1984-09-24 | 1987-12-24 | Upjohn Company, The | 2-(pyridylalkenesulfinyl) benzimidazole derivatives |
| US4600430A (en) * | 1985-02-22 | 1986-07-15 | Eli Lilly And Company | Pyridinylimidazolidinone compounds |
| US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
| US4591377A (en) * | 1985-09-10 | 1986-05-27 | Stauffer Chemical Company | Herbicidal esters of 2-bromo-4-methylimidazole-5-carboxylic acid |
| JP2581556B2 (ja) * | 1986-05-06 | 1997-02-12 | メレルダウファーマスーティカルズ インコーポレーテッド | 新規なドパミンベ−タヒドロキシラ−ゼ抑制剤 |
| JPH0674273B2 (ja) * | 1986-06-19 | 1994-09-21 | 日産化学工業株式会社 | イミダゾ−ルスルホンアミド誘導体、製法および除草剤 |
-
1987
- 1987-11-18 FI FI875102A patent/FI91754C/fi not_active IP Right Cessation
- 1987-11-20 IL IL84554A patent/IL84554A/xx not_active IP Right Cessation
- 1987-11-23 TW TW076107112A patent/TW203048B/zh active
- 1987-11-26 JP JP62298783A patent/JPH064623B2/ja not_active Expired - Lifetime
- 1987-11-26 AU AU81812/87A patent/AU597446B2/en not_active Ceased
- 1987-12-01 HU HU905023A patent/HU204812B/hu unknown
- 1987-12-01 KR KR1019870013642A patent/KR930004843B1/ko not_active Expired - Fee Related
- 1987-12-01 CN CN87108111A patent/CN1020902C/zh not_active Expired - Fee Related
- 1987-12-01 DK DK631587A patent/DK631587A/da not_active Application Discontinuation
- 1987-12-01 HU HU875393A patent/HU201751B/hu not_active IP Right Cessation
- 1987-12-02 EP EP87117820A patent/EP0270091B1/en not_active Expired - Lifetime
- 1987-12-02 ES ES87117820T patent/ES2044901T3/es not_active Expired - Lifetime
- 1987-12-02 DE DE8787117820T patent/DE3782621T2/de not_active Expired - Fee Related
- 1987-12-02 FR FR878716732A patent/FR2607502B1/fr not_active Expired - Lifetime
-
1989
- 1989-06-09 US US07/364,999 patent/US5002945A/en not_active Expired - Fee Related
- 1989-06-28 US US07/372,534 patent/US4996217A/en not_active Expired - Fee Related
-
1990
- 1990-08-03 US US07/562,513 patent/US5053417A/en not_active Expired - Fee Related
-
1992
- 1992-11-16 GR GR920402604T patent/GR3006257T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU201751B (en) | 1990-12-28 |
| JPH01131175A (ja) | 1989-05-24 |
| DK631587A (da) | 1988-06-03 |
| FR2607502A1 (fr) | 1988-06-03 |
| TW203048B (enExample) | 1993-04-01 |
| FR2607502B1 (fr) | 1990-01-19 |
| JPH064623B2 (ja) | 1994-01-19 |
| US5002945A (en) | 1991-03-26 |
| AU597446B2 (en) | 1990-05-31 |
| GR3006257T3 (enExample) | 1993-06-21 |
| DK631587D0 (da) | 1987-12-01 |
| FI875102L (fi) | 1988-06-03 |
| FI91754B (fi) | 1994-04-29 |
| FI91754C (fi) | 1994-08-10 |
| US5053417A (en) | 1991-10-01 |
| DE3782621T2 (de) | 1993-04-22 |
| CN87108111A (zh) | 1988-09-28 |
| ES2044901T3 (es) | 1994-01-16 |
| IL84554A (en) | 1992-03-29 |
| HU905023D0 (en) | 1991-01-28 |
| KR930004843B1 (ko) | 1993-06-09 |
| DE3782621D1 (de) | 1992-12-17 |
| EP0270091B1 (en) | 1992-11-11 |
| AU8181287A (en) | 1988-06-02 |
| US4996217A (en) | 1991-02-26 |
| EP0270091A1 (en) | 1988-06-08 |
| FI875102A0 (fi) | 1987-11-18 |
| IL84554A0 (en) | 1988-04-29 |
| HUT49128A (en) | 1989-08-28 |
| CN1020902C (zh) | 1993-05-26 |
| KR880007477A (ko) | 1988-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2053230C1 (ru) | Способ получения производных арил- или гетероарилпиперазинилбутилазолов | |
| HU204812B (en) | Process for producing imidazole derivatives | |
| US5698560A (en) | Imidazoquinazoline derivatives | |
| EP0748800B1 (en) | Pyrimidinedione, pyrimidinetrione, triazinedione derivatives as alpha-1-adrenergic receptor antagonists | |
| US5346896A (en) | 1-(aryl or heteroaryl)-4[ω-(aryl or heteroaryl)ω-(aryl or heteroaryl)alkylene]piperazines | |
| CA2407231A1 (en) | Cyclic compounds | |
| EP0456835B1 (en) | Quinazoline-3-alkanoic acid derivative, salt thereof, and production thereof | |
| KR19990022574A (ko) | 이미다졸 화합물 | |
| EP0554829A2 (en) | Pyrazole derivatives with antiinflammatory, analgesic and antithrombolic activity | |
| EP0167943A2 (en) | Benzimidazole derivatives, process for their preparation, and their use as pharmaceuticals | |
| JPS6339875A (ja) | ピリミジン誘導体 | |
| SK280812B6 (sk) | 1,3-substituované cykloalkány a 1,3-substituované cykloalkény, spôsoby ich prípravy a farmaceutické prípravky na ich báze | |
| AU702609B2 (en) | Pyridylthio compounds for controlling helicobacter bacteria | |
| CA2078208A1 (en) | Imidazoles | |
| EP0510036B1 (en) | 2-substituted 4,5-diphenyl-imidazoles | |
| NO173995B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrrolo(2,3b)indolderivater | |
| AU2006224336A1 (en) | Arylsulfonyl benzyl ethers as 5-HT2A antagonists | |
| EP1439174A1 (en) | 4-imidazolin-2-one compounds | |
| US4882343A (en) | Biarylalkylimidazole derivatives as anti-depressants | |
| EP0178438A1 (en) | Novel compounds | |
| NZ202974A (en) | Benzodioxine derivatives and pharmaceutical compositions | |
| WO2000023436A1 (en) | Quinazolinone derivatives | |
| EP0127371B1 (en) | 1,n-diaryl-4,5-dihydro-1h-pyrazol-3-amines, compositions containing them and methods for their preparation | |
| US4665187A (en) | Certain 1,2,3,6-tetrahydro-pyridyl-N-lower-alkanoyl-pyridines as intermediates | |
| EP0041359A1 (en) | Process for the preparation of heterocyclylalkyl guanidines; intermediates and their preparation |