FI91754C - Analogiamenetelmä lääkeaineena käyttökelpoisen imidatsolijohdannaisen valmistamiseksi - Google Patents
Analogiamenetelmä lääkeaineena käyttökelpoisen imidatsolijohdannaisen valmistamiseksi Download PDFInfo
- Publication number
- FI91754C FI91754C FI875102A FI875102A FI91754C FI 91754 C FI91754 C FI 91754C FI 875102 A FI875102 A FI 875102A FI 875102 A FI875102 A FI 875102A FI 91754 C FI91754 C FI 91754C
- Authority
- FI
- Finland
- Prior art keywords
- group
- pyridyl
- ring
- imidazole
- recrystallized
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000002460 imidazoles Chemical class 0.000 title claims description 10
- 239000003814 drug Substances 0.000 title claims description 3
- -1 mercaptoimidazole compound Chemical class 0.000 claims description 101
- 150000001875 compounds Chemical class 0.000 claims description 84
- 150000003839 salts Chemical class 0.000 claims description 33
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 22
- 238000002360 preparation method Methods 0.000 claims description 21
- 125000003277 amino group Chemical group 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 16
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 15
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- FYNSNOXDRIVOCX-UHFFFAOYSA-N 2-[2-[(2-pyrrol-1-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridine Chemical compound N=1C=CN(C=2N=CC=CC=2)C=1S(=O)CC1=CC=CC=C1N1C=CC=C1 FYNSNOXDRIVOCX-UHFFFAOYSA-N 0.000 claims description 3
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- SXXIEEZWTIEPSV-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-methylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=NC=CC=C1C SXXIEEZWTIEPSV-UHFFFAOYSA-N 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- FPINXZJBEYYVDP-UHFFFAOYSA-N n,n-diethyl-2-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1C[S+]([O-])C(N1C=2N=CC=CC=2)=NC2=C1CCC2 FPINXZJBEYYVDP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 273
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 187
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 77
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 71
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 68
- 239000000047 product Substances 0.000 description 55
- 239000000203 mixture Substances 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 43
- 238000005481 NMR spectroscopy Methods 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 229960001701 chloroform Drugs 0.000 description 36
- 239000002904 solvent Substances 0.000 description 36
- 239000000243 solution Substances 0.000 description 32
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 30
- 239000003921 oil Substances 0.000 description 29
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 21
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 19
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 16
- 239000007858 starting material Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 238000005160 1H NMR spectroscopy Methods 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 230000027119 gastric acid secretion Effects 0.000 description 9
- 230000002401 inhibitory effect Effects 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 8
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 230000002255 enzymatic effect Effects 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 108091006112 ATPases Proteins 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- LSCOMGFYEWVYJG-UHFFFAOYSA-N 3-pyridin-2-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=CC=N1 LSCOMGFYEWVYJG-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 229910002651 NO3 Inorganic materials 0.000 description 4
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- XBPWUNNYJOLFGX-UHFFFAOYSA-N 2-aminocyclopentan-1-one Chemical compound NC1CCCC1=O XBPWUNNYJOLFGX-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 125000006519 CCH3 Chemical group 0.000 description 3
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- RGHUOXSZSHFHAN-UHFFFAOYSA-N 2-(n-methylanilino)benzoic acid Chemical compound C=1C=CC=C(C(O)=O)C=1N(C)C1=CC=CC=C1 RGHUOXSZSHFHAN-UHFFFAOYSA-N 0.000 description 2
- YRXITRNRDFGPIR-UHFFFAOYSA-N 2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 YRXITRNRDFGPIR-UHFFFAOYSA-N 0.000 description 2
- HUMHPEZUZRBDNQ-UHFFFAOYSA-N 2-[2-(chloromethyl)phenyl]isoindole-1,3-dione Chemical compound ClCC1=CC=CC=C1N1C(=O)C2=CC=CC=C2C1=O HUMHPEZUZRBDNQ-UHFFFAOYSA-N 0.000 description 2
- ZFWFGZSSKRXRDR-UHFFFAOYSA-N 2-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-ol Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=NC=CC=C1O ZFWFGZSSKRXRDR-UHFFFAOYSA-N 0.000 description 2
- WUWPZXWPOAGOSF-UHFFFAOYSA-N 2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)N)=C1 WUWPZXWPOAGOSF-UHFFFAOYSA-N 0.000 description 2
- HCCFYTHZAOITJV-UHFFFAOYSA-N 2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1CC1=CC=CC=N1 HCCFYTHZAOITJV-UHFFFAOYSA-N 0.000 description 2
- DXOFBTYTOILRFQ-UHFFFAOYSA-N 2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound NC1=CC=CC=C1CS(=O)C1=NC=CN1CC1=CC=CC=N1 DXOFBTYTOILRFQ-UHFFFAOYSA-N 0.000 description 2
- KMLPEYHLAKSCGX-UHFFFAOYSA-N 2-aminocyclohexan-1-one Chemical compound NC1CCCCC1=O KMLPEYHLAKSCGX-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 2
- BYFAUECJLSNQNO-UHFFFAOYSA-N 3a-hydroxy-3-pyridin-2-yl-4,5,6,6a-tetrahydro-1h-cyclopenta[d]imidazole-2-thione Chemical compound OC12CCCC1NC(=S)N2C1=CC=CC=N1 BYFAUECJLSNQNO-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 2
- ATELCLGEOYJVSY-UHFFFAOYSA-N 6-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 ATELCLGEOYJVSY-UHFFFAOYSA-N 0.000 description 2
- DKDJQLDWNHPZOA-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(N)C=N1 DKDJQLDWNHPZOA-UHFFFAOYSA-N 0.000 description 2
- UYUVDDBKHOYPAN-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-amine Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=C(N)C=N1 UYUVDDBKHOYPAN-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 108010009685 Cholinergic Receptors Proteins 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 2
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- 101100072408 Mus musculus Il21r gene Proteins 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 108010079943 Pentagastrin Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- 101100309620 Schizosaccharomyces pombe (strain 972 / ATCC 24843) sck2 gene Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- AVUOVVXVXIQQPB-UHFFFAOYSA-N [2-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=NC=CC=C1OC(C)=O AVUOVVXVXIQQPB-UHFFFAOYSA-N 0.000 description 2
- 102000034337 acetylcholine receptors Human genes 0.000 description 2
- 230000009858 acid secretion Effects 0.000 description 2
- 239000008186 active pharmaceutical agent Substances 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- 230000001363 autoimmune Effects 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 150000001923 cyclic compounds Chemical class 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 208000000718 duodenal ulcer Diseases 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000004211 gastric acid Anatomy 0.000 description 2
- 210000001156 gastric mucosa Anatomy 0.000 description 2
- 201000005917 gastric ulcer Diseases 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- NUPWBSFIUAOXLK-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-propan-2-yloxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CC(C)OC1=CC=CN=C1N1C(S(=O)CC=2C(=CC=CC=2)N(C)C)=NC=C1 NUPWBSFIUAOXLK-UHFFFAOYSA-N 0.000 description 2
- PCHLWFLTMQFXGH-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]formamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)S(=O)CC=2C(=CC=CC=2)NC=O)=C1 PCHLWFLTMQFXGH-UHFFFAOYSA-N 0.000 description 2
- ZNNNROZVKDIUCN-UHFFFAOYSA-N n-[6-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=C(NC(C)=O)C=N1 ZNNNROZVKDIUCN-UHFFFAOYSA-N 0.000 description 2
- HLYIDMKPDUKRNU-UHFFFAOYSA-N n-cyclohexyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound N=1C=CN(C=2N=CC=CC=2)C=1S(=O)CC1=CC=CC=C1NC1CCCCC1 HLYIDMKPDUKRNU-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229960000381 omeprazole Drugs 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 2
- 229960000444 pentagastrin Drugs 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229940097325 prolactin Drugs 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- HPRRRCJCXROIAC-UHFFFAOYSA-N 1,1-diethoxy-2-isothiocyanatoethane Chemical compound CCOC(OCC)CN=C=S HPRRRCJCXROIAC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ASYNZUWCVTYWOA-UHFFFAOYSA-N 1-(2,2-diethoxyethyl)-3-pyridin-2-ylthiourea Chemical compound CCOC(OCC)CNC(=S)NC1=CC=CC=N1 ASYNZUWCVTYWOA-UHFFFAOYSA-N 0.000 description 1
- SQURWHOXFNHVIN-UHFFFAOYSA-N 1-(2-oxocyclohexyl)-1-pyridin-2-ylthiourea Chemical compound N1=C(C=CC=C1)N(C(=S)N)C1C(CCCC1)=O SQURWHOXFNHVIN-UHFFFAOYSA-N 0.000 description 1
- RKISOGBHGFJTRJ-UHFFFAOYSA-N 1-(2-oxocyclohexyl)-3-pyridin-2-ylthiourea Chemical compound O=C1CCCCC1NC(=S)NC1=CC=CC=N1 RKISOGBHGFJTRJ-UHFFFAOYSA-N 0.000 description 1
- GTUQQNHWQTUHGR-UHFFFAOYSA-N 1-[2-(chloromethyl)phenyl]-n,n-dimethylmethanamine;hydrochloride Chemical compound Cl.CN(C)CC1=CC=CC=C1CCl GTUQQNHWQTUHGR-UHFFFAOYSA-N 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- FCMLOWOMGIHWSL-UHFFFAOYSA-N 2,4,6-trimethyl-n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 FCMLOWOMGIHWSL-UHFFFAOYSA-N 0.000 description 1
- FUFFKJLKVKILCF-UHFFFAOYSA-N 2,4-diethoxy-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane Chemical compound CCOP1(=S)SP(=S)(OCC)S1 FUFFKJLKVKILCF-UHFFFAOYSA-N 0.000 description 1
- MMJYFEBZBADSNQ-UHFFFAOYSA-N 2-(dimethylcarbamoyl)benzoic acid Chemical compound CN(C)C(=O)C1=CC=CC=C1C(O)=O MMJYFEBZBADSNQ-UHFFFAOYSA-N 0.000 description 1
- AXVUQSYGGYSPGJ-UHFFFAOYSA-N 2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound NC1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=CC=N1 AXVUQSYGGYSPGJ-UHFFFAOYSA-N 0.000 description 1
- HZGXPPSIBPSKMX-UHFFFAOYSA-N 2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 HZGXPPSIBPSKMX-UHFFFAOYSA-N 0.000 description 1
- UIRWRLMOBOGNNG-UHFFFAOYSA-N 2-[2-(chloromethyl)phenyl]-1h-imidazole Chemical compound ClCC1=CC=CC=C1C1=NC=CN1 UIRWRLMOBOGNNG-UHFFFAOYSA-N 0.000 description 1
- MIPSKKIKNOBWDF-UHFFFAOYSA-N 2-[2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]phenyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 MIPSKKIKNOBWDF-UHFFFAOYSA-N 0.000 description 1
- AJWIAURVZXLZCR-UHFFFAOYSA-N 2-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-ol Chemical compound OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 AJWIAURVZXLZCR-UHFFFAOYSA-N 0.000 description 1
- ZJPSRIFYFYAZTQ-UHFFFAOYSA-N 2-[2-[(3a-hydroxy-3-pyridin-2-yl-4,5,6,6a-tetrahydrocyclopenta[d]imidazol-2-yl)sulfanylmethyl]phenyl]isoindole-1,3-dione Chemical compound OC12CCCC1N=C(SCC=1C(=CC=CC=1)N1C(C3=CC=CC=C3C1=O)=O)N2C1=CC=CC=N1 ZJPSRIFYFYAZTQ-UHFFFAOYSA-N 0.000 description 1
- LVAXCYAGEXHOKJ-UHFFFAOYSA-N 2-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-ol Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=NC=CC=C1O LVAXCYAGEXHOKJ-UHFFFAOYSA-N 0.000 description 1
- KSPZWFCHYDBBQS-UHFFFAOYSA-N 2-[[1-(4-methoxy-6-methylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]-n,n-dimethylaniline Chemical compound COC1=CC(C)=NC(N2C(=NC=C2)[S+]([O-])CC=2C(=CC=CC=2)N(C)C)=C1 KSPZWFCHYDBBQS-UHFFFAOYSA-N 0.000 description 1
- BMQIBDSKDKZQRI-UHFFFAOYSA-N 2-[[1-(4-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]-n,n-dimethylaniline Chemical compound COC1=CC=NC(N2C(=NC=C2)[S+]([O-])CC=2C(=CC=CC=2)N(C)C)=C1 BMQIBDSKDKZQRI-UHFFFAOYSA-N 0.000 description 1
- DQDAIFUYYLPMLD-UHFFFAOYSA-N 2-[[1-(5-chloropyridin-2-yl)imidazol-2-yl]sulfinylmethyl]-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=C(Cl)C=N1 DQDAIFUYYLPMLD-UHFFFAOYSA-N 0.000 description 1
- WDLFLRDORRSKQU-UHFFFAOYSA-N 2-[[1-(5-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]-n,n-dimethylaniline Chemical compound N1=CC(OC)=CC=C1N1C([S+]([O-])CC=2C(=CC=CC=2)N(C)C)=NC=C1 WDLFLRDORRSKQU-UHFFFAOYSA-N 0.000 description 1
- LVRJLCMFZFIFHU-UHFFFAOYSA-N 2-[[2-(dimethylamino)phenyl]methylsulfanyl]-3-pyridin-2-yl-4,5,6,6a-tetrahydrocyclopenta[d]imidazol-3a-ol Chemical compound CN(C)C1=CC=CC=C1CSC(N1C=2N=CC=CC=2)=NC2C1(O)CCC2 LVRJLCMFZFIFHU-UHFFFAOYSA-N 0.000 description 1
- BDAXSKSCJXFWFX-UHFFFAOYSA-N 2-[phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C(C=1C=CC=CC=1)SC1=NC=2CCCC=2N1C1=CC=CC=N1 BDAXSKSCJXFWFX-UHFFFAOYSA-N 0.000 description 1
- HGHZKLDCXNJLJK-UHFFFAOYSA-N 2-aminocyclohexan-1-one;hydrochloride Chemical compound Cl.NC1CCCCC1=O HGHZKLDCXNJLJK-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- WFJPRCMYUOOTNS-UHFFFAOYSA-N 2-isothiocyanatopyridine Chemical class S=C=NC1=CC=CC=N1 WFJPRCMYUOOTNS-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- VXEIEKCYIDAZLW-UHFFFAOYSA-N 3-(5-nitropyridin-2-yl)-1h-imidazole-2-thione Chemical compound N1=CC([N+](=O)[O-])=CC=C1N1C(S)=NC=C1 VXEIEKCYIDAZLW-UHFFFAOYSA-N 0.000 description 1
- LLVZIOLOBGBRGF-UHFFFAOYSA-N 3-(chloromethyl)-n,n-dimethylaniline;hydrochloride Chemical compound Cl.CN(C)C1=CC=CC(CCl)=C1 LLVZIOLOBGBRGF-UHFFFAOYSA-N 0.000 description 1
- RFUCFMSXWUCZLP-UHFFFAOYSA-N 3-(pyridin-2-ylmethyl)-1h-imidazole-2-thione Chemical compound SC1=NC=CN1CC1=CC=CC=N1 RFUCFMSXWUCZLP-UHFFFAOYSA-N 0.000 description 1
- CAZSLNLKLCMOHE-UHFFFAOYSA-N 3-pyridin-2-yl-4,5,6,7-tetrahydro-1h-benzimidazole-2-thione Chemical compound S=C1NC=2CCCCC=2N1C1=CC=CC=N1 CAZSLNLKLCMOHE-UHFFFAOYSA-N 0.000 description 1
- DRVRMNTUPBDSES-UHFFFAOYSA-N 3-pyridin-4-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=NC=C1 DRVRMNTUPBDSES-UHFFFAOYSA-N 0.000 description 1
- DTDMBBZYSCGLKW-UHFFFAOYSA-N 4-[2-(chloromethyl)phenyl]morpholine Chemical compound ClCC1=CC=CC=C1N1CCOCC1 DTDMBBZYSCGLKW-UHFFFAOYSA-N 0.000 description 1
- VTHDEAVWONWWGB-UHFFFAOYSA-N 4-[2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]morpholine Chemical compound N1=CC([N+](=O)[O-])=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 VTHDEAVWONWWGB-UHFFFAOYSA-N 0.000 description 1
- YWZPKAQESBDJHO-UHFFFAOYSA-N 6-[2-[(2-morpholin-4-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1C(S(=O)CC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 YWZPKAQESBDJHO-UHFFFAOYSA-N 0.000 description 1
- AZGZAJMBDVNLER-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridine-3-carbonitrile Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=C(C#N)C=N1 AZGZAJMBDVNLER-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YYVMGMJYGMYQHZ-UHFFFAOYSA-N CC(C)N(C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC=CC=N3)C(C)C Chemical compound CC(C)N(C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC=CC=N3)C(C)C YYVMGMJYGMYQHZ-UHFFFAOYSA-N 0.000 description 1
- CATRGMCCMPFUQP-UHFFFAOYSA-N CCN(CC)C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC(=NC=C3)C Chemical compound CCN(CC)C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC(=NC=C3)C CATRGMCCMPFUQP-UHFFFAOYSA-N 0.000 description 1
- 101000654316 Centruroides limpidus Beta-toxin Cll2 Proteins 0.000 description 1
- 102100036952 Cytoplasmic protein NCK2 Human genes 0.000 description 1
- 108700037657 Cytoplasmic protein NCK2 Proteins 0.000 description 1
- 102100021022 Gastrin Human genes 0.000 description 1
- 108010052343 Gastrins Proteins 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- JHNWQRRMSURACO-UHFFFAOYSA-N N,2,4,6-tetramethyl-N-[2-[(5-pyridin-2-yl-1H-imidazol-2-yl)sulfanylmethyl]phenyl]benzenesulfonamide Chemical compound N1=C(C=CC=C1)C=1N=C(NC=1)SCC1=C(C=CC=C1)N(S(=O)(=O)C1=C(C=C(C=C1C)C)C)C JHNWQRRMSURACO-UHFFFAOYSA-N 0.000 description 1
- 101000831254 Oryza sativa subsp. japonica Cysteine proteinase inhibitor 2 Proteins 0.000 description 1
- 208000005374 Poisoning Diseases 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- RPIHVSOIWYEENT-UHFFFAOYSA-N [2-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=NC=CC=C1OC(C)=O RPIHVSOIWYEENT-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- WQJONRMBVKFKOB-UHFFFAOYSA-N cyanatosulfanyl cyanate Chemical compound N#COSOC#N WQJONRMBVKFKOB-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- RUWPGPOBTHOLHF-UHFFFAOYSA-N ethyl 2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1F RUWPGPOBTHOLHF-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000027143 gastrin-induced gastric acid secretion Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- XSTKEEDPXBWERP-UHFFFAOYSA-N n,n-diethyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=CC=N1 XSTKEEDPXBWERP-UHFFFAOYSA-N 0.000 description 1
- QNKBKPSAPPUDQK-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-2-yl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C(N1C=2N=CC=CC=2)=NC2=C1CCCC2 QNKBKPSAPPUDQK-UHFFFAOYSA-N 0.000 description 1
- UZOKJHNWKHNFEQ-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=CC=N1 UZOKJHNWKHNFEQ-UHFFFAOYSA-N 0.000 description 1
- OSQGLTCMYYZVNP-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 OSQGLTCMYYZVNP-UHFFFAOYSA-N 0.000 description 1
- TWXHIUYRFDAEEK-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-4-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=NC=C1 TWXHIUYRFDAEEK-UHFFFAOYSA-N 0.000 description 1
- XJIQCDYZEIKAJQ-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(2-pyridin-2-ylethyl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1CCC1=CC=CC=N1 XJIQCDYZEIKAJQ-UHFFFAOYSA-N 0.000 description 1
- SILICMKBLHWUSI-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-phenylmethoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=NC=CC=C1OCC1=CC=CC=C1 SILICMKBLHWUSI-UHFFFAOYSA-N 0.000 description 1
- TYQXTMSEVJJEGR-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-propan-2-yloxypyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC(C)OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N(C)C)=NC=C1 TYQXTMSEVJJEGR-UHFFFAOYSA-N 0.000 description 1
- JGEDAZAPADMKLK-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C([N+]([O-])=O)C=N1 JGEDAZAPADMKLK-UHFFFAOYSA-N 0.000 description 1
- MZPJNZSZBPJMFU-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=C([N+]([O-])=O)C=N1 MZPJNZSZBPJMFU-UHFFFAOYSA-N 0.000 description 1
- RRRUZGZEXUTDNJ-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1CC1=CC=CC=N1 RRRUZGZEXUTDNJ-UHFFFAOYSA-N 0.000 description 1
- WDBHHITUDZDUFL-UHFFFAOYSA-N n,n-dimethyl-3-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC(CSC=2N(C=CN=2)C=2N=CC=CC=2)=C1 WDBHHITUDZDUFL-UHFFFAOYSA-N 0.000 description 1
- ZQNOFYZLPHFCKC-UHFFFAOYSA-N n,n-dimethyl-3-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC(CS(=O)C=2N(C=CN=2)C=2N=CC=CC=2)=C1 ZQNOFYZLPHFCKC-UHFFFAOYSA-N 0.000 description 1
- KNHPLCLJKXWSPO-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 KNHPLCLJKXWSPO-UHFFFAOYSA-N 0.000 description 1
- HJAHIOWBFHXKQY-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=CC=N1 HJAHIOWBFHXKQY-UHFFFAOYSA-N 0.000 description 1
- INUDCIMREAPRAD-UHFFFAOYSA-N n-[2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 INUDCIMREAPRAD-UHFFFAOYSA-N 0.000 description 1
- LLXROWVGGDCVCB-UHFFFAOYSA-N n-[2-[[1-(3-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]acetamide Chemical compound COC1=CC=CN=C1N1C([S+]([O-])CC=2C(=CC=CC=2)NC(C)=O)=NC=C1 LLXROWVGGDCVCB-UHFFFAOYSA-N 0.000 description 1
- IJHBUGWSDXWHDX-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]formamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NC=O)=C1 IJHBUGWSDXWHDX-UHFFFAOYSA-N 0.000 description 1
- BLQXRKBYHAZWRB-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]methanesulfonamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NS(C)(=O)=O)=C1 BLQXRKBYHAZWRB-UHFFFAOYSA-N 0.000 description 1
- ZQIVRLQGHCBMTK-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)S(=O)CC=2C(=CC=CC=2)NS(C)(=O)=O)=C1 ZQIVRLQGHCBMTK-UHFFFAOYSA-N 0.000 description 1
- AUAUZYUTGCDGEI-UHFFFAOYSA-N n-[2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CS(=O)C1=NC=CN1CC1=CC=CC=N1 AUAUZYUTGCDGEI-UHFFFAOYSA-N 0.000 description 1
- DQEDGMAXHCAYHS-UHFFFAOYSA-N n-[6-[2-[(2-morpholin-4-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound N1=CC(NC(=O)C)=CC=C1N1C(S(=O)CC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 DQEDGMAXHCAYHS-UHFFFAOYSA-N 0.000 description 1
- QHARYXAUMSKDKD-UHFFFAOYSA-N n-[6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(NC(C)=O)C=N1 QHARYXAUMSKDKD-UHFFFAOYSA-N 0.000 description 1
- KMFMVTWAHVKBER-UHFFFAOYSA-N n-[chloro(phenyl)methyl]-2,4,6-trimethylbenzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC(Cl)C1=CC=CC=C1 KMFMVTWAHVKBER-UHFFFAOYSA-N 0.000 description 1
- XOISSNHOIAVKRQ-UHFFFAOYSA-N n-[phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methyl]acetamide Chemical compound C=1C=CC=CC=1C(NC(=O)C)SC1=NC=2CCCC=2N1C1=CC=CC=N1 XOISSNHOIAVKRQ-UHFFFAOYSA-N 0.000 description 1
- SALWLYRBESSZJM-UHFFFAOYSA-N n-methyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CNC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 SALWLYRBESSZJM-UHFFFAOYSA-N 0.000 description 1
- BROMWKUPZUWPON-UHFFFAOYSA-N n-methyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CNC1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=CC=N1 BROMWKUPZUWPON-UHFFFAOYSA-N 0.000 description 1
- FVCKNIKJDXGPLR-UHFFFAOYSA-N n-methyl-n-[phenyl-(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound C=1C=CC=CC=1N(C)C(C=1C=CC=CC=1)SC1=NC=CN1C1=CC=CC=N1 FVCKNIKJDXGPLR-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000008014 pharmaceutical binder Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000449 pharmaceutical disintegrant Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 239000008019 pharmaceutical lubricant Substances 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- WRTMQOHKMFDUKX-UHFFFAOYSA-N triiodide Chemical compound I[I-]I WRTMQOHKMFDUKX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP28751286 | 1986-12-02 | ||
| JP28751286 | 1986-12-02 | ||
| JP8047587 | 1987-03-31 | ||
| JP8047587 | 1987-03-31 | ||
| JP21581387 | 1987-08-28 | ||
| JP21581387 | 1987-08-28 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI875102A0 FI875102A0 (fi) | 1987-11-18 |
| FI875102L FI875102L (fi) | 1988-06-03 |
| FI91754B FI91754B (fi) | 1994-04-29 |
| FI91754C true FI91754C (fi) | 1994-08-10 |
Family
ID=27303307
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI875102A FI91754C (fi) | 1986-12-02 | 1987-11-18 | Analogiamenetelmä lääkeaineena käyttökelpoisen imidatsolijohdannaisen valmistamiseksi |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US5002945A (enExample) |
| EP (1) | EP0270091B1 (enExample) |
| JP (1) | JPH064623B2 (enExample) |
| KR (1) | KR930004843B1 (enExample) |
| CN (1) | CN1020902C (enExample) |
| AU (1) | AU597446B2 (enExample) |
| DE (1) | DE3782621T2 (enExample) |
| DK (1) | DK631587A (enExample) |
| ES (1) | ES2044901T3 (enExample) |
| FI (1) | FI91754C (enExample) |
| FR (1) | FR2607502B1 (enExample) |
| GR (1) | GR3006257T3 (enExample) |
| HU (2) | HU204812B (enExample) |
| IL (1) | IL84554A (enExample) |
| TW (1) | TW203048B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
| JP2614756B2 (ja) * | 1988-08-10 | 1997-05-28 | 日本ケミファ株式会社 | イミダゾール誘導体およびその製造法ならびにこれを含有する抗潰瘍剤 |
| MY106533A (en) * | 1990-02-20 | 1995-06-30 | Sumitomo Chemical Co | A 4-tert.-butyl imidazole derivative and its production and use. |
| SE9002043D0 (sv) * | 1990-06-07 | 1990-06-07 | Astra Ab | Improved method for synthesis |
| CA2036147A1 (en) * | 1990-06-29 | 1991-12-30 | Hiroki Tomioka | A 1-pyridylimidazole derivative and its production and use |
| MY110439A (en) * | 1991-02-07 | 1998-05-30 | Ishihara Sangyo Kaisha | N-phenylcarbamate compound, process for preparing the same and biocidal composition for control of harmful organisms |
| AU644297B2 (en) * | 1991-06-28 | 1993-12-02 | Sumitomo Chemical Company, Limited | A 1-pyridylimidazole derivative and its production and use |
| US5635521A (en) * | 1991-09-23 | 1997-06-03 | Sandoz Ltd. | Imidazolylmethyl-pyridines |
| DE19541146A1 (de) * | 1995-10-25 | 1997-04-30 | Schering Ag | Imidazolderivate und deren Verwendung als Stickstoffmonoxid-Synthase-Inhibitoren |
| EP1974730A1 (en) | 2003-11-03 | 2008-10-01 | AstraZeneca AB | Imidazo[1,2-a]pyridine derivatives for use in the treatment of sleep disturbance due to silent gastro-esophageal reflux |
| CA2566094A1 (en) * | 2004-05-26 | 2005-12-08 | Eisai R & D Management Co., Ltd. | Cinnamide compound |
| EP1810677A1 (en) * | 2004-10-08 | 2007-07-25 | Takeda Pharmaceutical Company Limited | Receptor function regulating agent |
| TWI370130B (en) | 2005-11-24 | 2012-08-11 | Eisai R&D Man Co Ltd | Two cyclic cinnamide compound |
| CL2008000582A1 (es) | 2007-02-28 | 2008-06-27 | Eisai R&D Man Co Ltd | Compuestos ciclicos derivados de oximorfolina condensados; farmacos que comprenden a dichos compuestos; y su uso para tratar enfermedad de alzheimer, demencia senil, sindrome de down o amiloidosis. |
| CA2694401C (en) | 2007-08-31 | 2012-12-04 | Eisai R&D Management Co., Ltd. | Polycyclic compound |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1234058A (enExample) * | 1968-10-21 | 1971-06-03 | ||
| IN148930B (enExample) * | 1977-09-19 | 1981-07-25 | Hoffmann La Roche | |
| EP0004648B1 (de) * | 1978-04-11 | 1982-08-25 | Ciba-Geigy Ag | Neue Mercaptoimidazolderivate, Verfahren zu deren Herstellung, Mercaptoimidazolderivate zur Behandlung entzündlicher Erkrankungen und diese enthaltende pharmazeutische Präparate |
| SE7804231L (sv) * | 1978-04-14 | 1979-10-15 | Haessle Ab | Magsyrasekretionsmedel |
| US4492708A (en) * | 1982-09-27 | 1985-01-08 | Eli Lilly And Company | Antiviral benzimidazoles |
| DE3369845D1 (en) * | 1982-12-20 | 1987-04-02 | Merck & Co Inc | 5-(amino or substituted amino) imidazoles |
| GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| FI833794A0 (fi) * | 1983-10-18 | 1983-10-18 | Farmos Oy | Substituerade 2-merkapto-imidazoler |
| GB8417171D0 (en) * | 1984-07-05 | 1984-08-08 | Beecham Group Plc | Compounds |
| EP0174717B1 (en) * | 1984-07-06 | 1992-01-22 | FISONS plc | Benzimidazoles, and their production formulation and use as gastric acid secretion inhibitors |
| AU568441B2 (en) * | 1984-09-24 | 1987-12-24 | Upjohn Company, The | 2-(pyridylalkenesulfinyl) benzimidazole derivatives |
| US4600430A (en) * | 1985-02-22 | 1986-07-15 | Eli Lilly And Company | Pyridinylimidazolidinone compounds |
| US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
| US4591377A (en) * | 1985-09-10 | 1986-05-27 | Stauffer Chemical Company | Herbicidal esters of 2-bromo-4-methylimidazole-5-carboxylic acid |
| JP2581556B2 (ja) * | 1986-05-06 | 1997-02-12 | メレルダウファーマスーティカルズ インコーポレーテッド | 新規なドパミンベ−タヒドロキシラ−ゼ抑制剤 |
| JPH0674273B2 (ja) * | 1986-06-19 | 1994-09-21 | 日産化学工業株式会社 | イミダゾ−ルスルホンアミド誘導体、製法および除草剤 |
-
1987
- 1987-11-18 FI FI875102A patent/FI91754C/fi not_active IP Right Cessation
- 1987-11-20 IL IL84554A patent/IL84554A/xx not_active IP Right Cessation
- 1987-11-23 TW TW076107112A patent/TW203048B/zh active
- 1987-11-26 JP JP62298783A patent/JPH064623B2/ja not_active Expired - Lifetime
- 1987-11-26 AU AU81812/87A patent/AU597446B2/en not_active Ceased
- 1987-12-01 HU HU905023A patent/HU204812B/hu unknown
- 1987-12-01 KR KR1019870013642A patent/KR930004843B1/ko not_active Expired - Fee Related
- 1987-12-01 CN CN87108111A patent/CN1020902C/zh not_active Expired - Fee Related
- 1987-12-01 DK DK631587A patent/DK631587A/da not_active Application Discontinuation
- 1987-12-01 HU HU875393A patent/HU201751B/hu not_active IP Right Cessation
- 1987-12-02 EP EP87117820A patent/EP0270091B1/en not_active Expired - Lifetime
- 1987-12-02 ES ES87117820T patent/ES2044901T3/es not_active Expired - Lifetime
- 1987-12-02 DE DE8787117820T patent/DE3782621T2/de not_active Expired - Fee Related
- 1987-12-02 FR FR878716732A patent/FR2607502B1/fr not_active Expired - Lifetime
-
1989
- 1989-06-09 US US07/364,999 patent/US5002945A/en not_active Expired - Fee Related
- 1989-06-28 US US07/372,534 patent/US4996217A/en not_active Expired - Fee Related
-
1990
- 1990-08-03 US US07/562,513 patent/US5053417A/en not_active Expired - Fee Related
-
1992
- 1992-11-16 GR GR920402604T patent/GR3006257T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU201751B (en) | 1990-12-28 |
| JPH01131175A (ja) | 1989-05-24 |
| DK631587A (da) | 1988-06-03 |
| FR2607502A1 (fr) | 1988-06-03 |
| TW203048B (enExample) | 1993-04-01 |
| FR2607502B1 (fr) | 1990-01-19 |
| JPH064623B2 (ja) | 1994-01-19 |
| US5002945A (en) | 1991-03-26 |
| AU597446B2 (en) | 1990-05-31 |
| GR3006257T3 (enExample) | 1993-06-21 |
| DK631587D0 (da) | 1987-12-01 |
| FI875102L (fi) | 1988-06-03 |
| HU204812B (en) | 1992-02-28 |
| FI91754B (fi) | 1994-04-29 |
| US5053417A (en) | 1991-10-01 |
| DE3782621T2 (de) | 1993-04-22 |
| CN87108111A (zh) | 1988-09-28 |
| ES2044901T3 (es) | 1994-01-16 |
| IL84554A (en) | 1992-03-29 |
| HU905023D0 (en) | 1991-01-28 |
| KR930004843B1 (ko) | 1993-06-09 |
| DE3782621D1 (de) | 1992-12-17 |
| EP0270091B1 (en) | 1992-11-11 |
| AU8181287A (en) | 1988-06-02 |
| US4996217A (en) | 1991-02-26 |
| EP0270091A1 (en) | 1988-06-08 |
| FI875102A0 (fi) | 1987-11-18 |
| IL84554A0 (en) | 1988-04-29 |
| HUT49128A (en) | 1989-08-28 |
| CN1020902C (zh) | 1993-05-26 |
| KR880007477A (ko) | 1988-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI91754C (fi) | Analogiamenetelmä lääkeaineena käyttökelpoisen imidatsolijohdannaisen valmistamiseksi | |
| US6005106A (en) | Naphthalene derivatives, process for the preparation therof, and intermediates thereof | |
| JP4559087B2 (ja) | タキキニン受容体アンタゴニストとしてのトリアゾール誘導体 | |
| AU599632B2 (en) | Sulphonylamido benzoyl- or benzyl-polymethylene-imine derivatives useful as anti-arrythmia agents | |
| US5760234A (en) | Certain 1-substituted aminomethyl imidazole and pyrrole derivatives: novel dopamine receptor subtype specific ligands | |
| US5681956A (en) | 4-aryl substituted piperazinylmethyl phenylimidazole derivatives; a new class of dopamine receptor subtype specific ligands | |
| KR19990022574A (ko) | 이미다졸 화합물 | |
| US5182289A (en) | Heterobicyclic compounds having antiinflammatory activity | |
| NZ230068A (en) | Indazole-3-carboxylic acid esters and amides of diaza compounds having 6,7, or 8 ring members: preparatory processes and pharmaceutical compositions | |
| NL7905775A (nl) | Pyrimidonderivaten, werkwijzen ter bereiding daarvan, alsmede farmaceutische preparaten die deze derivaten als actieve component bevatten. | |
| CA1266657A (en) | Imidazolyl alkyl guanidine derivatives, processes for their preparation and pharmaceutical preparations containing these compounds | |
| IE873063L (en) | Imidazolidinone compound | |
| US20110065725A1 (en) | Triazole amide derivatives for use in therapy | |
| IE910098A1 (en) | Imidazoles | |
| KR850000676B1 (ko) | 헤테로사이클릭 화합물의 제조방법 | |
| EP1318996B1 (en) | Substituted imidazoles as dual histamine h1 and h3 agonists or antagonists | |
| US4550118A (en) | Heterocyclic compounds | |
| EP0178438A1 (en) | Novel compounds | |
| EP0127371B1 (en) | 1,n-diaryl-4,5-dihydro-1h-pyrazol-3-amines, compositions containing them and methods for their preparation | |
| US6031097A (en) | 1-(N-(arylalkylaminoalkyl) aminoisoquinolines; a new class of dopamine receptor subtype specific ligands | |
| WO2002024657A2 (en) | Substituted imidazoles as dual histamine h1 and h3 agonists or antagonists | |
| JPH0674271B2 (ja) | ヒドロキノリン誘導体 | |
| JPH0249727A (ja) | 抗潰瘍剤 | |
| LT3594B (en) | Imidazole,triazole and tetrazole derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | Publication of examined application | ||
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: TANABE SEIYAKU CO., LTD. |