HU201751B - Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient - Google Patents
Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient Download PDFInfo
- Publication number
- HU201751B HU201751B HU875393A HU539387A HU201751B HU 201751 B HU201751 B HU 201751B HU 875393 A HU875393 A HU 875393A HU 539387 A HU539387 A HU 539387A HU 201751 B HU201751 B HU 201751B
- Authority
- HU
- Hungary
- Prior art keywords
- pyridyl
- ring
- phenyl
- formula
- alkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 150
- 238000000034 method Methods 0.000 title claims description 46
- 150000002460 imidazoles Chemical class 0.000 title claims description 14
- 239000004480 active ingredient Substances 0.000 title claims description 11
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 10
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title description 7
- -1 nitro, amino Chemical group 0.000 claims description 132
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 95
- 150000003839 salts Chemical class 0.000 claims description 66
- 239000002253 acid Substances 0.000 claims description 49
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 47
- 239000007858 starting material Substances 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 19
- 125000003277 amino group Chemical group 0.000 claims description 15
- 125000003282 alkyl amino group Chemical group 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 12
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims description 5
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 5
- OXFSTTJBVAAALW-UHFFFAOYSA-N 1,3-dihydroimidazole-2-thione Chemical class SC1=NC=CN1 OXFSTTJBVAAALW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- AINLTCOAFIEVHN-UHFFFAOYSA-N cyclopenta[d]imidazole Chemical compound C1=NC2=CC=CC2=N1 AINLTCOAFIEVHN-UHFFFAOYSA-N 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 150000003613 toluenes Chemical class 0.000 claims description 4
- 125000004760 (C1-C4) alkylsulfonylamino group Chemical group 0.000 claims description 3
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 3
- SXXIEEZWTIEPSV-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-methylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=NC=CC=C1C SXXIEEZWTIEPSV-UHFFFAOYSA-N 0.000 claims description 3
- 239000000843 powder Substances 0.000 claims description 3
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 claims 10
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 3
- 239000000825 pharmaceutical preparation Substances 0.000 claims 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 3
- 239000003814 drug Substances 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 125000006536 (C1-C2)alkoxy group Chemical group 0.000 claims 1
- FYNSNOXDRIVOCX-UHFFFAOYSA-N 2-[2-[(2-pyrrol-1-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridine Chemical group N=1C=CN(C=2N=CC=CC=2)C=1S(=O)CC1=CC=CC=C1N1C=CC=C1 FYNSNOXDRIVOCX-UHFFFAOYSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 241001169121 Gabriella Species 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 239000012050 conventional carrier Substances 0.000 claims 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000003386 piperidinyl group Chemical group 0.000 claims 1
- 125000003226 pyrazolyl group Chemical group 0.000 claims 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 238000007493 shaping process Methods 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 309
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 195
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 84
- 239000000203 mixture Substances 0.000 description 83
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 78
- 239000003921 oil Substances 0.000 description 70
- 238000005481 NMR spectroscopy Methods 0.000 description 55
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 46
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- 230000000704 physical effect Effects 0.000 description 42
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 39
- 238000002844 melting Methods 0.000 description 35
- 230000008018 melting Effects 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 32
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 31
- 239000000243 solution Substances 0.000 description 28
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 25
- 239000002904 solvent Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 16
- 238000005160 1H NMR spectroscopy Methods 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 11
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 10
- 238000000354 decomposition reaction Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 8
- 230000027119 gastric acid secretion Effects 0.000 description 8
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 230000002255 enzymatic effect Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 4
- YRXITRNRDFGPIR-UHFFFAOYSA-N 2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 YRXITRNRDFGPIR-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- LSCOMGFYEWVYJG-UHFFFAOYSA-N 3-pyridin-2-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=CC=N1 LSCOMGFYEWVYJG-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 3
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- 208000008469 Peptic Ulcer Diseases 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000028327 secretion Effects 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RKISOGBHGFJTRJ-UHFFFAOYSA-N 1-(2-oxocyclohexyl)-3-pyridin-2-ylthiourea Chemical compound O=C1CCCCC1NC(=S)NC1=CC=CC=N1 RKISOGBHGFJTRJ-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- RGHUOXSZSHFHAN-UHFFFAOYSA-N 2-(n-methylanilino)benzoic acid Chemical compound C=1C=CC=C(C(O)=O)C=1N(C)C1=CC=CC=C1 RGHUOXSZSHFHAN-UHFFFAOYSA-N 0.000 description 2
- HUMHPEZUZRBDNQ-UHFFFAOYSA-N 2-[2-(chloromethyl)phenyl]isoindole-1,3-dione Chemical compound ClCC1=CC=CC=C1N1C(=O)C2=CC=CC=C2C1=O HUMHPEZUZRBDNQ-UHFFFAOYSA-N 0.000 description 2
- HCCFYTHZAOITJV-UHFFFAOYSA-N 2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1CC1=CC=CC=N1 HCCFYTHZAOITJV-UHFFFAOYSA-N 0.000 description 2
- DXOFBTYTOILRFQ-UHFFFAOYSA-N 2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound NC1=CC=CC=C1CS(=O)C1=NC=CN1CC1=CC=CC=N1 DXOFBTYTOILRFQ-UHFFFAOYSA-N 0.000 description 2
- KMLPEYHLAKSCGX-UHFFFAOYSA-N 2-aminocyclohexan-1-one Chemical compound NC1CCCCC1=O KMLPEYHLAKSCGX-UHFFFAOYSA-N 0.000 description 2
- XBPWUNNYJOLFGX-UHFFFAOYSA-N 2-aminocyclopentan-1-one Chemical compound NC1CCCC1=O XBPWUNNYJOLFGX-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- FJPFWMYTFGJMAN-UHFFFAOYSA-N 2-sulfinylimidazole Chemical class O=S=C1N=CC=N1 FJPFWMYTFGJMAN-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 2
- DKDJQLDWNHPZOA-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(N)C=N1 DKDJQLDWNHPZOA-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 125000006519 CCH3 Chemical group 0.000 description 2
- 108010009685 Cholinergic Receptors Proteins 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 108010079943 Pentagastrin Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 2
- 102000034337 acetylcholine receptors Human genes 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- AQIXAKUUQRKLND-UHFFFAOYSA-N cimetidine Chemical compound N#C/N=C(/NC)NCCSCC=1N=CNC=1C AQIXAKUUQRKLND-UHFFFAOYSA-N 0.000 description 2
- 229960001380 cimetidine Drugs 0.000 description 2
- 150000001923 cyclic compounds Chemical class 0.000 description 2
- 208000000718 duodenal ulcer Diseases 0.000 description 2
- 201000005917 gastric ulcer Diseases 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- PVKDSLRAFNOKMB-UHFFFAOYSA-N n,n-diethyl-2-[[1-(4-methoxy-6-methylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC(OC)=CC(C)=N1 PVKDSLRAFNOKMB-UHFFFAOYSA-N 0.000 description 2
- HLYIDMKPDUKRNU-UHFFFAOYSA-N n-cyclohexyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound N=1C=CN(C=2N=CC=CC=2)C=1S(=O)CC1=CC=CC=C1NC1CCCCC1 HLYIDMKPDUKRNU-UHFFFAOYSA-N 0.000 description 2
- 229960000381 omeprazole Drugs 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 2
- 229960000444 pentagastrin Drugs 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 229940097325 prolactin Drugs 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- HPRRRCJCXROIAC-UHFFFAOYSA-N 1,1-diethoxy-2-isothiocyanatoethane Chemical compound CCOC(OCC)CN=C=S HPRRRCJCXROIAC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ASYNZUWCVTYWOA-UHFFFAOYSA-N 1-(2,2-diethoxyethyl)-3-pyridin-2-ylthiourea Chemical compound CCOC(OCC)CNC(=S)NC1=CC=CC=N1 ASYNZUWCVTYWOA-UHFFFAOYSA-N 0.000 description 1
- GTUQQNHWQTUHGR-UHFFFAOYSA-N 1-[2-(chloromethyl)phenyl]-n,n-dimethylmethanamine;hydrochloride Chemical compound Cl.CN(C)CC1=CC=CC=C1CCl GTUQQNHWQTUHGR-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical compound C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- FUFFKJLKVKILCF-UHFFFAOYSA-N 2,4-diethoxy-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane Chemical compound CCOP1(=S)SP(=S)(OCC)S1 FUFFKJLKVKILCF-UHFFFAOYSA-N 0.000 description 1
- AXVUQSYGGYSPGJ-UHFFFAOYSA-N 2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound NC1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=CC=N1 AXVUQSYGGYSPGJ-UHFFFAOYSA-N 0.000 description 1
- HZGXPPSIBPSKMX-UHFFFAOYSA-N 2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound NC1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 HZGXPPSIBPSKMX-UHFFFAOYSA-N 0.000 description 1
- UIRWRLMOBOGNNG-UHFFFAOYSA-N 2-[2-(chloromethyl)phenyl]-1h-imidazole Chemical compound ClCC1=CC=CC=C1C1=NC=CN1 UIRWRLMOBOGNNG-UHFFFAOYSA-N 0.000 description 1
- MIPSKKIKNOBWDF-UHFFFAOYSA-N 2-[2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]phenyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 MIPSKKIKNOBWDF-UHFFFAOYSA-N 0.000 description 1
- AJWIAURVZXLZCR-UHFFFAOYSA-N 2-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-ol Chemical compound OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 AJWIAURVZXLZCR-UHFFFAOYSA-N 0.000 description 1
- YLGBHDQWJWALNZ-UHFFFAOYSA-N 2-[2-[(2-piperidin-1-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridine Chemical compound N=1C=CN(C=2N=CC=CC=2)C=1[S+]([O-])CC1=CC=CC=C1N1CCCCC1 YLGBHDQWJWALNZ-UHFFFAOYSA-N 0.000 description 1
- BHMCTYLXMBUQGW-UHFFFAOYSA-N 2-[2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]phenyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1CSC1=NC=CN1CC1=CC=CC=N1 BHMCTYLXMBUQGW-UHFFFAOYSA-N 0.000 description 1
- ZFWFGZSSKRXRDR-UHFFFAOYSA-N 2-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-ol Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=NC=CC=C1O ZFWFGZSSKRXRDR-UHFFFAOYSA-N 0.000 description 1
- LVAXCYAGEXHOKJ-UHFFFAOYSA-N 2-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-ol Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=NC=CC=C1O LVAXCYAGEXHOKJ-UHFFFAOYSA-N 0.000 description 1
- WUWPZXWPOAGOSF-UHFFFAOYSA-N 2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)N)=C1 WUWPZXWPOAGOSF-UHFFFAOYSA-N 0.000 description 1
- DQDAIFUYYLPMLD-UHFFFAOYSA-N 2-[[1-(5-chloropyridin-2-yl)imidazol-2-yl]sulfinylmethyl]-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=C(Cl)C=N1 DQDAIFUYYLPMLD-UHFFFAOYSA-N 0.000 description 1
- HGHZKLDCXNJLJK-UHFFFAOYSA-N 2-aminocyclohexan-1-one;hydrochloride Chemical compound Cl.NC1CCCCC1=O HGHZKLDCXNJLJK-UHFFFAOYSA-N 0.000 description 1
- XRWHJJIAVVNAMG-UHFFFAOYSA-N 2-aminocyclopentan-1-one;hydrochloride Chemical compound Cl.NC1CCCC1=O XRWHJJIAVVNAMG-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- WFJPRCMYUOOTNS-UHFFFAOYSA-N 2-isothiocyanatopyridine Chemical class S=C=NC1=CC=CC=N1 WFJPRCMYUOOTNS-UHFFFAOYSA-N 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- MCNQDGXBYQRUGL-UHFFFAOYSA-N 2-sulfonylimidazole Chemical group O=S(=O)=C1N=CC=N1 MCNQDGXBYQRUGL-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- LLVZIOLOBGBRGF-UHFFFAOYSA-N 3-(chloromethyl)-n,n-dimethylaniline;hydrochloride Chemical compound Cl.CN(C)C1=CC=CC(CCl)=C1 LLVZIOLOBGBRGF-UHFFFAOYSA-N 0.000 description 1
- QIGGDOVRVSHHTE-UHFFFAOYSA-N 3-methyl-2-[2-[(2-piperidin-1-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridine Chemical compound CC1=CC=CN=C1N1C([S+]([O-])CC=2C(=CC=CC=2)N2CCCCC2)=NC=C1 QIGGDOVRVSHHTE-UHFFFAOYSA-N 0.000 description 1
- CAZSLNLKLCMOHE-UHFFFAOYSA-N 3-pyridin-2-yl-4,5,6,7-tetrahydro-1h-benzimidazole-2-thione Chemical compound S=C1NC=2CCCCC=2N1C1=CC=CC=N1 CAZSLNLKLCMOHE-UHFFFAOYSA-N 0.000 description 1
- DRVRMNTUPBDSES-UHFFFAOYSA-N 3-pyridin-4-yl-1h-imidazole-2-thione Chemical compound S=C1NC=CN1C1=CC=NC=C1 DRVRMNTUPBDSES-UHFFFAOYSA-N 0.000 description 1
- BYFAUECJLSNQNO-UHFFFAOYSA-N 3a-hydroxy-3-pyridin-2-yl-4,5,6,6a-tetrahydro-1h-cyclopenta[d]imidazole-2-thione Chemical compound OC12CCCC1NC(=S)N2C1=CC=CC=N1 BYFAUECJLSNQNO-UHFFFAOYSA-N 0.000 description 1
- CIFIVCCKVZFJFT-UHFFFAOYSA-N 4-(4-chlorophenyl)-n-(2-imidazol-1-yl-1-phenylethyl)benzamide Chemical compound C1=CC(Cl)=CC=C1C1=CC=C(C(=O)NC(CN2C=NC=C2)C=2C=CC=CC=2)C=C1 CIFIVCCKVZFJFT-UHFFFAOYSA-N 0.000 description 1
- DTDMBBZYSCGLKW-UHFFFAOYSA-N 4-[2-(chloromethyl)phenyl]morpholine Chemical compound ClCC1=CC=CC=C1N1CCOCC1 DTDMBBZYSCGLKW-UHFFFAOYSA-N 0.000 description 1
- HSFJYWJTQZKKPT-UHFFFAOYSA-N 4-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]phenyl]morpholine Chemical compound N=1C=CN(C=2N=CC=CC=2)C=1S(=O)CC1=CC=CC=C1N1CCOCC1 HSFJYWJTQZKKPT-UHFFFAOYSA-N 0.000 description 1
- SSXIISFXVGKSIJ-UHFFFAOYSA-N 4-[2-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfinylmethyl]phenyl]morpholine Chemical compound N=1C=2CCCC=2N(C=2N=CC=CC=2)C=1[S+]([O-])CC1=CC=CC=C1N1CCOCC1 SSXIISFXVGKSIJ-UHFFFAOYSA-N 0.000 description 1
- XVTUCURXKWATAK-UHFFFAOYSA-N 4-[2-[[1-(3-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]morpholine Chemical compound COC1=CC=CN=C1N1C([S+]([O-])CC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 XVTUCURXKWATAK-UHFFFAOYSA-N 0.000 description 1
- ZACHDLXRILPBFQ-UHFFFAOYSA-N 4-[2-[[1-(3-methylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]morpholine Chemical compound CC1=CC=CN=C1N1C([S+]([O-])CC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 ZACHDLXRILPBFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ATELCLGEOYJVSY-UHFFFAOYSA-N 6-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-amine Chemical compound N1=CC(N)=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 ATELCLGEOYJVSY-UHFFFAOYSA-N 0.000 description 1
- UYUVDDBKHOYPAN-UHFFFAOYSA-N 6-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-amine Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=C(N)C=N1 UYUVDDBKHOYPAN-UHFFFAOYSA-N 0.000 description 1
- YYVMGMJYGMYQHZ-UHFFFAOYSA-N CC(C)N(C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC=CC=N3)C(C)C Chemical compound CC(C)N(C1=CC=CC=C1CS(=O)C2=NC=CN2C3=CC=CC=N3)C(C)C YYVMGMJYGMYQHZ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 102100021022 Gastrin Human genes 0.000 description 1
- 108010052343 Gastrins Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- NUWKKUFLLDPNLT-UHFFFAOYSA-N [2-[2-[(2-morpholin-4-ylphenyl)methylsulfinyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CC(=O)OC1=CC=CN=C1N1C(S(=O)CC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 NUWKKUFLLDPNLT-UHFFFAOYSA-N 0.000 description 1
- AVUOVVXVXIQQPB-UHFFFAOYSA-N [2-[2-[[2-(dimethylamino)phenyl]methylsulfinyl]imidazol-1-yl]pyridin-3-yl] acetate Chemical compound CN(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=NC=CC=C1OC(C)=O AVUOVVXVXIQQPB-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000362 adenosine triphosphatase inhibitor Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- WQJONRMBVKFKOB-UHFFFAOYSA-N cyanatosulfanyl cyanate Chemical compound N#COSOC#N WQJONRMBVKFKOB-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 1
- RUWPGPOBTHOLHF-UHFFFAOYSA-N ethyl 2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1F RUWPGPOBTHOLHF-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 230000027143 gastrin-induced gastric acid secretion Effects 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- XSTKEEDPXBWERP-UHFFFAOYSA-N n,n-diethyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=CC=N1 XSTKEEDPXBWERP-UHFFFAOYSA-N 0.000 description 1
- FPINXZJBEYYVDP-UHFFFAOYSA-N n,n-diethyl-2-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1C[S+]([O-])C(N1C=2N=CC=CC=2)=NC2=C1CCC2 FPINXZJBEYYVDP-UHFFFAOYSA-N 0.000 description 1
- GLTJUAHCOAIPCZ-UHFFFAOYSA-N n,n-diethyl-2-[[1-(3-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CCN(CC)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=NC=CC=C1OC GLTJUAHCOAIPCZ-UHFFFAOYSA-N 0.000 description 1
- QNKBKPSAPPUDQK-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-2-yl-4,5,6,7-tetrahydrobenzimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C(N1C=2N=CC=CC=2)=NC2=C1CCCC2 QNKBKPSAPPUDQK-UHFFFAOYSA-N 0.000 description 1
- UZOKJHNWKHNFEQ-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1C1=CC=CC=N1 UZOKJHNWKHNFEQ-UHFFFAOYSA-N 0.000 description 1
- OSQGLTCMYYZVNP-UHFFFAOYSA-N n,n-dimethyl-2-[(1-pyridin-4-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=NC=C1 OSQGLTCMYYZVNP-UHFFFAOYSA-N 0.000 description 1
- DXEJKZUHTOZSHQ-UHFFFAOYSA-N n,n-dimethyl-2-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC(N1C=2N=CC=CC=2)=NC2=C1CCC2 DXEJKZUHTOZSHQ-UHFFFAOYSA-N 0.000 description 1
- TYQXTMSEVJJEGR-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-propan-2-yloxypyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CC(C)OC1=CC=CN=C1N1C(SCC=2C(=CC=CC=2)N(C)C)=NC=C1 TYQXTMSEVJJEGR-UHFFFAOYSA-N 0.000 description 1
- NUPWBSFIUAOXLK-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(3-propan-2-yloxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CC(C)OC1=CC=CN=C1N1C(S(=O)CC=2C(=CC=CC=2)N(C)C)=NC=C1 NUPWBSFIUAOXLK-UHFFFAOYSA-N 0.000 description 1
- JGEDAZAPADMKLK-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(5-nitropyridin-2-yl)imidazol-2-yl]sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C([N+]([O-])=O)C=N1 JGEDAZAPADMKLK-UHFFFAOYSA-N 0.000 description 1
- RRRUZGZEXUTDNJ-UHFFFAOYSA-N n,n-dimethyl-2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]aniline Chemical compound CN(C)C1=CC=CC=C1C[S+]([O-])C1=NC=CN1CC1=CC=CC=N1 RRRUZGZEXUTDNJ-UHFFFAOYSA-N 0.000 description 1
- WDBHHITUDZDUFL-UHFFFAOYSA-N n,n-dimethyl-3-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CN(C)C1=CC=CC(CSC=2N(C=CN=2)C=2N=CC=CC=2)=C1 WDBHHITUDZDUFL-UHFFFAOYSA-N 0.000 description 1
- KNHPLCLJKXWSPO-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 KNHPLCLJKXWSPO-UHFFFAOYSA-N 0.000 description 1
- WSMJISBJPVXQPF-UHFFFAOYSA-N n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]phenyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 WSMJISBJPVXQPF-UHFFFAOYSA-N 0.000 description 1
- KNVWJPKWRSNJBI-UHFFFAOYSA-N n-[2-[(1-pyridin-4-ylimidazol-2-yl)sulfinylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=NC=C1 KNVWJPKWRSNJBI-UHFFFAOYSA-N 0.000 description 1
- LLXROWVGGDCVCB-UHFFFAOYSA-N n-[2-[[1-(3-methoxypyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]acetamide Chemical compound COC1=CC=CN=C1N1C([S+]([O-])CC=2C(=CC=CC=2)NC(C)=O)=NC=C1 LLXROWVGGDCVCB-UHFFFAOYSA-N 0.000 description 1
- IJHBUGWSDXWHDX-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]formamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NC=O)=C1 IJHBUGWSDXWHDX-UHFFFAOYSA-N 0.000 description 1
- BLQXRKBYHAZWRB-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfanylmethyl]phenyl]methanesulfonamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)SCC=2C(=CC=CC=2)NS(C)(=O)=O)=C1 BLQXRKBYHAZWRB-UHFFFAOYSA-N 0.000 description 1
- ZQIVRLQGHCBMTK-UHFFFAOYSA-N n-[2-[[1-(4,6-dimethylpyridin-2-yl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide Chemical compound CC1=CC(C)=NC(N2C(=NC=C2)S(=O)CC=2C(=CC=CC=2)NS(C)(=O)=O)=C1 ZQIVRLQGHCBMTK-UHFFFAOYSA-N 0.000 description 1
- AUAUZYUTGCDGEI-UHFFFAOYSA-N n-[2-[[1-(pyridin-2-ylmethyl)imidazol-2-yl]sulfinylmethyl]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1CS(=O)C1=NC=CN1CC1=CC=CC=N1 AUAUZYUTGCDGEI-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- SYOZTVHNAHNFHE-UHFFFAOYSA-N n-[6-[2-[(2-morpholin-4-ylphenyl)methylsulfanyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound N1=CC(NC(=O)C)=CC=C1N1C(SCC=2C(=CC=CC=2)N2CCOCC2)=NC=C1 SYOZTVHNAHNFHE-UHFFFAOYSA-N 0.000 description 1
- QHARYXAUMSKDKD-UHFFFAOYSA-N n-[6-[2-[[2-(dimethylamino)phenyl]methylsulfanyl]imidazol-1-yl]pyridin-3-yl]acetamide Chemical compound CN(C)C1=CC=CC=C1CSC1=NC=CN1C1=CC=C(NC(C)=O)C=N1 QHARYXAUMSKDKD-UHFFFAOYSA-N 0.000 description 1
- KMFMVTWAHVKBER-UHFFFAOYSA-N n-[chloro(phenyl)methyl]-2,4,6-trimethylbenzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC(Cl)C1=CC=CC=C1 KMFMVTWAHVKBER-UHFFFAOYSA-N 0.000 description 1
- XOISSNHOIAVKRQ-UHFFFAOYSA-N n-[phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methyl]acetamide Chemical compound C=1C=CC=CC=1C(NC(=O)C)SC1=NC=2CCCC=2N1C1=CC=CC=N1 XOISSNHOIAVKRQ-UHFFFAOYSA-N 0.000 description 1
- SALWLYRBESSZJM-UHFFFAOYSA-N n-methyl-2-[(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound CNC1=CC=CC=C1CSC1=NC=CN1C1=CC=CC=N1 SALWLYRBESSZJM-UHFFFAOYSA-N 0.000 description 1
- LBNVTNIHTSCLFX-UHFFFAOYSA-N n-methyl-n-[2-[(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]phenyl]acetamide Chemical compound CC(=O)N(C)C1=CC=CC=C1CS(=O)C1=NC=CN1C1=CC=CC=N1 LBNVTNIHTSCLFX-UHFFFAOYSA-N 0.000 description 1
- FVCKNIKJDXGPLR-UHFFFAOYSA-N n-methyl-n-[phenyl-(1-pyridin-2-ylimidazol-2-yl)sulfanylmethyl]aniline Chemical compound C=1C=CC=CC=1N(C)C(C=1C=CC=CC=1)SC1=NC=CN1C1=CC=CC=N1 FVCKNIKJDXGPLR-UHFFFAOYSA-N 0.000 description 1
- AQXFWIUJNKQEEI-UHFFFAOYSA-N n-methyl-n-[phenyl-(1-pyridin-2-ylimidazol-2-yl)sulfinylmethyl]aniline Chemical compound C=1C=CC=CC=1N(C)C(S(=O)C=1N(C=CN=1)C=1N=CC=CC=1)C1=CC=CC=C1 AQXFWIUJNKQEEI-UHFFFAOYSA-N 0.000 description 1
- 230000018791 negative regulation of catalytic activity Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 210000001711 oxyntic cell Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- YNLIMSABDSQYMV-UHFFFAOYSA-N phenyl-[(3-pyridin-2-yl-5,6-dihydro-4h-cyclopenta[d]imidazol-2-yl)sulfanyl]methanamine Chemical compound C=1C=CC=CC=1C(N)SC1=NC=2CCCC=2N1C1=CC=CC=N1 YNLIMSABDSQYMV-UHFFFAOYSA-N 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000004962 sulfoxyl group Chemical group 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 238000000772 tip-enhanced Raman spectroscopy Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000008359 toxicosis Effects 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP28751286 | 1986-12-02 | ||
JP8047587 | 1987-03-31 | ||
JP21581387 | 1987-08-28 |
Publications (2)
Publication Number | Publication Date |
---|---|
HUT49128A HUT49128A (en) | 1989-08-28 |
HU201751B true HU201751B (en) | 1990-12-28 |
Family
ID=27303307
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
HU875393A HU201751B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient |
HU905023A HU204812B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
HU905023A HU204812B (en) | 1986-12-02 | 1987-12-01 | Process for producing imidazole derivatives |
Country Status (15)
Country | Link |
---|---|
US (3) | US5002945A (instruction) |
EP (1) | EP0270091B1 (instruction) |
JP (1) | JPH064623B2 (instruction) |
KR (1) | KR930004843B1 (instruction) |
CN (1) | CN1020902C (instruction) |
AU (1) | AU597446B2 (instruction) |
DE (1) | DE3782621T2 (instruction) |
DK (1) | DK631587A (instruction) |
ES (1) | ES2044901T3 (instruction) |
FI (1) | FI91754C (instruction) |
FR (1) | FR2607502B1 (instruction) |
GR (1) | GR3006257T3 (instruction) |
HU (2) | HU201751B (instruction) |
IL (1) | IL84554A (instruction) |
TW (1) | TW203048B (instruction) |
Families Citing this family (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
JP2614756B2 (ja) * | 1988-08-10 | 1997-05-28 | 日本ケミファ株式会社 | イミダゾール誘導体およびその製造法ならびにこれを含有する抗潰瘍剤 |
KR910021381A (ko) * | 1990-02-20 | 1991-12-20 | 모리 히데오 | 4-3급 부틸이미다졸 유도체, 및 이의 제조방법 및 용도 |
SE9002043D0 (sv) * | 1990-06-07 | 1990-06-07 | Astra Ab | Improved method for synthesis |
CA2036147A1 (en) * | 1990-06-29 | 1991-12-30 | Hiroki Tomioka | A 1-pyridylimidazole derivative and its production and use |
MY110439A (en) * | 1991-02-07 | 1998-05-30 | Ishihara Sangyo Kaisha | N-phenylcarbamate compound, process for preparing the same and biocidal composition for control of harmful organisms |
US5252590A (en) * | 1991-06-28 | 1993-10-12 | Sumitomo Chemical Company, Limited | 1-pyridylimidazole derivative |
US5635521A (en) * | 1991-09-23 | 1997-06-03 | Sandoz Ltd. | Imidazolylmethyl-pyridines |
DE19541146A1 (de) * | 1995-10-25 | 1997-04-30 | Schering Ag | Imidazolderivate und deren Verwendung als Stickstoffmonoxid-Synthase-Inhibitoren |
KR20060099524A (ko) | 2003-11-03 | 2006-09-19 | 아스트라제네카 아베 | 무증상 위식도 역류의 치료를 위한 이미다조[1,2-a]피리딘유도체 |
EP1757591A4 (en) * | 2004-05-26 | 2010-05-05 | Eisai R&D Man Co Ltd | ZIMTSÄUREAMIDVERBINDUNG |
WO2006038738A1 (ja) * | 2004-10-08 | 2006-04-13 | Takeda Pharmaceutical Company Limited | 受容体機能調節剤 |
TWI370130B (en) | 2005-11-24 | 2012-08-11 | Eisai R&D Man Co Ltd | Two cyclic cinnamide compound |
PE20081791A1 (es) | 2007-02-28 | 2009-02-07 | Eisai Randd Man Co Ltd | Dos derivados ciclicos de oxomorfolina |
ES2529648T3 (es) | 2007-08-31 | 2015-02-24 | Eisai R&D Management Co., Ltd. | Compuesto policíclico |
Family Cites Families (16)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1234058A (instruction) * | 1968-10-21 | 1971-06-03 | ||
IN148930B (instruction) * | 1977-09-19 | 1981-07-25 | Hoffmann La Roche | |
CY1302A (en) * | 1978-04-11 | 1985-12-06 | Ciba Geigy Ag | Mercapto-imidazole derivatives,their preparation,their pharmaceutical compositions and applications |
SE7804231L (sv) * | 1978-04-14 | 1979-10-15 | Haessle Ab | Magsyrasekretionsmedel |
US4492708A (en) * | 1982-09-27 | 1985-01-08 | Eli Lilly And Company | Antiviral benzimidazoles |
EP0113570B1 (en) * | 1982-12-20 | 1987-02-25 | Merck & Co. Inc. | 5-(amino or substituted amino) imidazoles |
GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
FI833794A0 (fi) * | 1983-10-18 | 1983-10-18 | Farmos Oy | Substituerade 2-merkapto-imidazoler |
GB8417171D0 (en) * | 1984-07-05 | 1984-08-08 | Beecham Group Plc | Compounds |
CA1341314C (en) * | 1984-07-06 | 2001-11-06 | David Cox | Derivatives of benzimidazole, benzothiazole and benzoxazole |
AU568441B2 (en) * | 1984-09-24 | 1987-12-24 | Upjohn Company, The | 2-(pyridylalkenesulfinyl) benzimidazole derivatives |
US4600430A (en) * | 1985-02-22 | 1986-07-15 | Eli Lilly And Company | Pyridinylimidazolidinone compounds |
US4634711A (en) * | 1985-08-02 | 1987-01-06 | Smithkline Beckman Corporation | Pyridylalkyl imidazole-2-thiols |
US4591377A (en) * | 1985-09-10 | 1986-05-27 | Stauffer Chemical Company | Herbicidal esters of 2-bromo-4-methylimidazole-5-carboxylic acid |
IL82401A0 (en) * | 1986-05-06 | 1987-11-30 | Merrell Dow Pharma | Dopamine beta hydroxy-lase inhibiting imidazole derivatives and pharmaceutical compositions containing them |
JPH0674273B2 (ja) * | 1986-06-19 | 1994-09-21 | 日産化学工業株式会社 | イミダゾ−ルスルホンアミド誘導体、製法および除草剤 |
-
1987
- 1987-11-18 FI FI875102A patent/FI91754C/fi not_active IP Right Cessation
- 1987-11-20 IL IL84554A patent/IL84554A/xx not_active IP Right Cessation
- 1987-11-23 TW TW076107112A patent/TW203048B/zh active
- 1987-11-26 AU AU81812/87A patent/AU597446B2/en not_active Ceased
- 1987-11-26 JP JP62298783A patent/JPH064623B2/ja not_active Expired - Lifetime
- 1987-12-01 HU HU875393A patent/HU201751B/hu not_active IP Right Cessation
- 1987-12-01 KR KR1019870013642A patent/KR930004843B1/ko not_active Expired - Fee Related
- 1987-12-01 DK DK631587A patent/DK631587A/da not_active Application Discontinuation
- 1987-12-01 HU HU905023A patent/HU204812B/hu unknown
- 1987-12-01 CN CN87108111A patent/CN1020902C/zh not_active Expired - Fee Related
- 1987-12-02 FR FR878716732A patent/FR2607502B1/fr not_active Expired - Lifetime
- 1987-12-02 DE DE8787117820T patent/DE3782621T2/de not_active Expired - Fee Related
- 1987-12-02 EP EP87117820A patent/EP0270091B1/en not_active Expired - Lifetime
- 1987-12-02 ES ES87117820T patent/ES2044901T3/es not_active Expired - Lifetime
-
1989
- 1989-06-09 US US07/364,999 patent/US5002945A/en not_active Expired - Fee Related
- 1989-06-28 US US07/372,534 patent/US4996217A/en not_active Expired - Fee Related
-
1990
- 1990-08-03 US US07/562,513 patent/US5053417A/en not_active Expired - Fee Related
-
1992
- 1992-11-16 GR GR920402604T patent/GR3006257T3/el unknown
Also Published As
Publication number | Publication date |
---|---|
FR2607502A1 (fr) | 1988-06-03 |
EP0270091B1 (en) | 1992-11-11 |
FI91754B (fi) | 1994-04-29 |
AU597446B2 (en) | 1990-05-31 |
DK631587D0 (da) | 1987-12-01 |
DE3782621T2 (de) | 1993-04-22 |
FI875102A0 (fi) | 1987-11-18 |
IL84554A0 (en) | 1988-04-29 |
KR880007477A (ko) | 1988-08-27 |
HUT49128A (en) | 1989-08-28 |
DK631587A (da) | 1988-06-03 |
US5002945A (en) | 1991-03-26 |
US4996217A (en) | 1991-02-26 |
FI875102L (fi) | 1988-06-03 |
HU204812B (en) | 1992-02-28 |
JPH01131175A (ja) | 1989-05-24 |
IL84554A (en) | 1992-03-29 |
FI91754C (fi) | 1994-08-10 |
ES2044901T3 (es) | 1994-01-16 |
JPH064623B2 (ja) | 1994-01-19 |
TW203048B (instruction) | 1993-04-01 |
CN87108111A (zh) | 1988-09-28 |
AU8181287A (en) | 1988-06-02 |
HU905023D0 (en) | 1991-01-28 |
FR2607502B1 (fr) | 1990-01-19 |
GR3006257T3 (instruction) | 1993-06-21 |
CN1020902C (zh) | 1993-05-26 |
US5053417A (en) | 1991-10-01 |
KR930004843B1 (ko) | 1993-06-09 |
DE3782621D1 (de) | 1992-12-17 |
EP0270091A1 (en) | 1988-06-08 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
HU201751B (en) | Process for producing imidazole derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
CA2407231A1 (en) | Cyclic compounds | |
US5021436A (en) | 2-thiomethyl-substituted-1,4-dihydropyridines, and pharmaceutical compositions containing same and antihypertensive properties | |
US5118689A (en) | Piperidine derivative and pharmaceutical composition containing the same | |
US4711890A (en) | Pharmaceutical compositions containing azanaphthalene-carboxamide derivatives, azanaphthalene-carboxamide derivatives and process for their use | |
US5017573A (en) | Indazole-3-carboxylic acid derivatives | |
EP0554829A2 (en) | Pyrazole derivatives with antiinflammatory, analgesic and antithrombolic activity | |
CZ392597A3 (cs) | Imidazolové sloučeniny, způsob jejich přípravy, farmaceutické prostředky s jejich obsahem a způsob ošetřování | |
CZ151297A3 (cs) | Dihydropyrimidinové sloučeniny a farmaceutické prostředky na jejich bázi | |
NO314543B1 (no) | 1,4-substituerte cykliske aminderivater, fremgangsmåte for deres fremstilling, midler omfattende nevnte derivater, anvendelse derav samtmellomprodukt derfor | |
CZ68498A3 (cs) | Derivát 4-(oxyalkoxyfenyl)-3-oxypiperidinu, způsob jeho přípravy, meziprodukt pro jeho přípravu a farmaceutický prostředek, který ho obsahuje | |
AU620114B2 (en) | Derivatives of (aza) naphthalenesultam, their preparation and compositions containing them | |
AU2013275209A1 (en) | Branched chain alkyl heteroaromatic ring derivative | |
EP0077983B1 (en) | Triazine derivatives, processes for preparation thereof and pharmaceutical compositions comprising the same | |
CA2078208A1 (en) | Imidazoles | |
AU702609B2 (en) | Pyridylthio compounds for controlling helicobacter bacteria | |
IE873063L (en) | Imidazolidinone compound | |
CA2194563A1 (en) | Anti-helicobacter heterocyclic derivatives of azolones | |
US4665187A (en) | Certain 1,2,3,6-tetrahydro-pyridyl-N-lower-alkanoyl-pyridines as intermediates | |
EP0127371B1 (en) | 1,n-diaryl-4,5-dihydro-1h-pyrazol-3-amines, compositions containing them and methods for their preparation | |
AU674058B2 (en) | Substituted heteroarylalkylthiopyridines for controlling helicobacter bacteria | |
EP1641756B1 (en) | 4-arylsulphonylpiperidine derivatives for antagonism of the 5-ht2a receptor | |
SK157796A3 (en) | Thiopyridines, method of producing same and their use | |
US5166341A (en) | 6-amino-1,4-hexahydro-1H-diazepine derivatives | |
US5922720A (en) | Piperazinothiopyridines for the control of Helicobacter bacteria |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
HMM4 | Cancellation of final prot. due to non-payment of fee |