HU187273B - Process for preparing new 2-/2-pyridyl/-tetrahydro-thiophene derivatives - Google Patents
Process for preparing new 2-/2-pyridyl/-tetrahydro-thiophene derivatives Download PDFInfo
- Publication number
- HU187273B HU187273B HU80739A HU73980A HU187273B HU 187273 B HU187273 B HU 187273B HU 80739 A HU80739 A HU 80739A HU 73980 A HU73980 A HU 73980A HU 187273 B HU187273 B HU 187273B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- pyridyl
- alkyl
- hydrogen
- tetrahydrothiophene
- Prior art date
Links
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims description 42
- MCXIBJPBLIURRN-UHFFFAOYSA-N 2-(thiolan-2-yl)pyridine Chemical class C1CCSC1C1=CC=CC=N1 MCXIBJPBLIURRN-UHFFFAOYSA-N 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 125000003282 alkyl amino group Chemical group 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000012988 Dithioester Substances 0.000 claims description 5
- 125000005022 dithioester group Chemical group 0.000 claims description 5
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 4
- 150000002540 isothiocyanates Chemical class 0.000 claims description 4
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 238000010511 deprotection reaction Methods 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 125000006239 protecting group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 150000002642 lithium compounds Chemical class 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000000945 filler Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 137
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 67
- 239000000243 solution Substances 0.000 description 65
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 56
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- 238000001914 filtration Methods 0.000 description 49
- 239000013078 crystal Substances 0.000 description 44
- 239000000047 product Substances 0.000 description 44
- 239000011541 reaction mixture Substances 0.000 description 39
- 239000000706 filtrate Substances 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000012153 distilled water Substances 0.000 description 30
- 239000000203 mixture Substances 0.000 description 30
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 22
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 21
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 20
- 238000001816 cooling Methods 0.000 description 17
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 16
- -1 methylsulfonyloxy Chemical group 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 15
- 239000003610 charcoal Substances 0.000 description 14
- 239000000284 extract Substances 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- LBMTWMDNTPKVGP-UHFFFAOYSA-N methyl 2-pyridin-2-ylthiolane-2-carbodithioate Chemical compound C=1C=CC=NC=1C1(C(=S)SC)CCCS1 LBMTWMDNTPKVGP-UHFFFAOYSA-N 0.000 description 12
- 230000007935 neutral effect Effects 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 12
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 11
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 10
- 239000003480 eluent Substances 0.000 description 9
- WACQKHWOTAEEFS-UHFFFAOYSA-N cyclohexane;ethyl acetate Chemical compound CCOC(C)=O.C1CCCCC1 WACQKHWOTAEEFS-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000004809 thin layer chromatography Methods 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 7
- PAUTVGCJEKOAPC-UHFFFAOYSA-N 2-(3-chloropropylsulfanylmethyl)pyridine Chemical compound ClCCCSCC1=CC=CC=N1 PAUTVGCJEKOAPC-UHFFFAOYSA-N 0.000 description 6
- ZMHNEMDQJWHVMD-UHFFFAOYSA-N [amino(pyridin-1-ium-2-ylmethylsulfanyl)methylidene]azanium;dichloride Chemical compound Cl.Cl.NC(=N)SCC1=CC=CC=N1 ZMHNEMDQJWHVMD-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052744 lithium Inorganic materials 0.000 description 6
- 150000003222 pyridines Chemical class 0.000 description 6
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 229940043279 diisopropylamine Drugs 0.000 description 5
- 150000002641 lithium Chemical class 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- WXNMWLBMXBCYPG-UHFFFAOYSA-N (4-methylpyridin-2-yl)methyl carbamimidothioate;dihydrochloride Chemical compound Cl.Cl.CC1=CC=NC(CSC(N)=N)=C1 WXNMWLBMXBCYPG-UHFFFAOYSA-N 0.000 description 3
- LTZULLZNVRKYLN-UHFFFAOYSA-N (5-methylpyridin-2-yl)methyl carbamimidothioate;dihydrochloride Chemical compound Cl.Cl.CC1=CC=C(CSC(N)=N)N=C1 LTZULLZNVRKYLN-UHFFFAOYSA-N 0.000 description 3
- LKUIJNQQIVNISE-UHFFFAOYSA-N (6-methylpyridin-2-yl)methanethiol Chemical compound CC1=CC=CC(CS)=N1 LKUIJNQQIVNISE-UHFFFAOYSA-N 0.000 description 3
- 125000006732 (C1-C15) alkyl group Chemical group 0.000 description 3
- ZEMGOLYWOFYEJY-UHFFFAOYSA-N 2-(3-chloropropylsulfanylmethyl)-4-methylpyridine Chemical compound CC1=CC=NC(CSCCCCl)=C1 ZEMGOLYWOFYEJY-UHFFFAOYSA-N 0.000 description 3
- WMUSPGCOPDGKLP-UHFFFAOYSA-N 2-(3-chloropropylsulfanylmethyl)-5-methylpyridine Chemical compound CC1=CC=C(CSCCCCl)N=C1 WMUSPGCOPDGKLP-UHFFFAOYSA-N 0.000 description 3
- QFLPSIUFCCCRMI-UHFFFAOYSA-N 2-(chloromethyl)-6-methylpyridine;hydron;chloride Chemical compound Cl.CC1=CC=CC(CCl)=N1 QFLPSIUFCCCRMI-UHFFFAOYSA-N 0.000 description 3
- OQGOBPLAUUHRTM-UHFFFAOYSA-N 2-methyl-6-(thiolan-2-yl)pyridine Chemical compound CC1=CC=CC(C2SCCC2)=N1 OQGOBPLAUUHRTM-UHFFFAOYSA-N 0.000 description 3
- ATTLDIXCCSQRLE-UHFFFAOYSA-N 4-butyl-2-(chloromethyl)pyridine;hydrochloride Chemical compound Cl.CCCCC1=CC=NC(CCl)=C1 ATTLDIXCCSQRLE-UHFFFAOYSA-N 0.000 description 3
- IBCQULDZSGOMSI-UHFFFAOYSA-N 4-butyl-2-(thiolan-2-yl)pyridine Chemical compound CCCCC1=CC=NC(C2SCCC2)=C1 IBCQULDZSGOMSI-UHFFFAOYSA-N 0.000 description 3
- NBJFGVBISUHCOW-UHFFFAOYSA-N 4-methyl-2-(thiolan-2-yl)pyridine Chemical compound CC1=CC=NC(C2SCCC2)=C1 NBJFGVBISUHCOW-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000010908 decantation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- ITNLONMDUMHEOK-UHFFFAOYSA-N n-methyl-2-pyridin-2-ylthiolane-2-carbothioamide Chemical compound C=1C=CC=NC=1C1(C(=S)NC)CCCS1 ITNLONMDUMHEOK-UHFFFAOYSA-N 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- SJIIDWBFRZACDQ-UHFFFAOYSA-N pyridin-2-ylmethanethiol Chemical compound SCC1=CC=CC=N1 SJIIDWBFRZACDQ-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- UAVXBDKRDOIJSV-UHFFFAOYSA-N (4-butylpyridin-2-yl)methanol Chemical compound CCCCC1=CC=NC(CO)=C1 UAVXBDKRDOIJSV-UHFFFAOYSA-N 0.000 description 2
- VWSRNBARLCPHPR-UHFFFAOYSA-N (4-butylpyridin-2-yl)methyl carbamimidothioate;dihydrochloride Chemical compound Cl.Cl.CCCCC1=CC=NC(CSC(N)=N)=C1 VWSRNBARLCPHPR-UHFFFAOYSA-N 0.000 description 2
- CYVVVQAWAVQPJY-UHFFFAOYSA-N (6-methylpyridin-2-yl)methyl carbamimidothioate;dihydrochloride Chemical compound Cl.Cl.CC1=CC=CC(CSC(N)=N)=N1 CYVVVQAWAVQPJY-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- ZEPINNMMCXODOY-UHFFFAOYSA-N 2-(chloromethyl)-4-methylpyridine;hydrochloride Chemical compound Cl.CC1=CC=NC(CCl)=C1 ZEPINNMMCXODOY-UHFFFAOYSA-N 0.000 description 2
- OXXWQLSFICBOMG-UHFFFAOYSA-N 2-(chloromethyl)-5-methylpyridin-1-ium;chloride Chemical compound Cl.CC1=CC=C(CCl)N=C1 OXXWQLSFICBOMG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- JXPSQSQUIUGVJC-UHFFFAOYSA-N 5-methyl-2-(thiolan-2-yl)pyridine Chemical compound N1=CC(C)=CC=C1C1SCCC1 JXPSQSQUIUGVJC-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- SZAVVKVUMPLRRS-UHFFFAOYSA-N lithium;propane Chemical compound [Li+].C[CH-]C SZAVVKVUMPLRRS-UHFFFAOYSA-N 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- ZVNLWUALIJQEOC-UHFFFAOYSA-N (6-methylpyridin-2-yl)methyl carbamimidothioate Chemical compound CC1=CC=CC(CSC(N)=N)=N1 ZVNLWUALIJQEOC-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- OOHLEROWPBFNTQ-UHFFFAOYSA-N 2-(4-butylpyridin-2-yl)-n-methylthiolane-2-carbothioamide Chemical compound CCCCC1=CC=NC(C2(SCCC2)C(=S)NC)=C1 OOHLEROWPBFNTQ-UHFFFAOYSA-N 0.000 description 1
- SFXPZXIAMUCHJK-UHFFFAOYSA-N 2-(6-methylpyridin-2-yl)thiolane-2-carbothioamide Chemical compound CC1=CC=CC(C2(SCCC2)C(N)=S)=N1 SFXPZXIAMUCHJK-UHFFFAOYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- UNNUPWJXIRUBLE-UHFFFAOYSA-N 2-pyridin-2-ylthiolane-2-carbothioamide Chemical compound C=1C=CC=NC=1C1(C(=S)N)CCCS1 UNNUPWJXIRUBLE-UHFFFAOYSA-N 0.000 description 1
- MNOCTFZHUCINGC-UHFFFAOYSA-N 3-chloro-2-(chloromethyl)pyridine Chemical compound ClCC1=NC=CC=C1Cl MNOCTFZHUCINGC-UHFFFAOYSA-N 0.000 description 1
- CVWLOFJXKUFJJQ-UHFFFAOYSA-N 4-butyl-2-(3-chloropropylsulfanylmethyl)pyridine Chemical compound CCCCC1=CC=NC(CSCCCCl)=C1 CVWLOFJXKUFJJQ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000005852 acetolysis reaction Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LIMQQADUEULBSO-UHFFFAOYSA-N butyl isothiocyanate Chemical compound CCCCN=C=S LIMQQADUEULBSO-UHFFFAOYSA-N 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- AZHPQDXIVJOSHB-UHFFFAOYSA-N morpholin-4-yl-(2-pyridin-2-ylthiolan-2-yl)methanethione Chemical compound C1CCSC1(C=1N=CC=CC=1)C(=S)N1CCOCC1 AZHPQDXIVJOSHB-UHFFFAOYSA-N 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- CKRXOYNNGMXSGJ-UHFFFAOYSA-N n-benzyl-2-pyridin-2-ylthiolane-2-carbothioamide Chemical compound C1CCSC1(C=1N=CC=CC=1)C(=S)NCC1=CC=CC=C1 CKRXOYNNGMXSGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UVLABEAWQLXGGD-UHFFFAOYSA-N n-butyl-2-pyridin-2-ylthiolane-2-carbothioamide Chemical compound C=1C=CC=NC=1C1(C(=S)NCCCC)CCCS1 UVLABEAWQLXGGD-UHFFFAOYSA-N 0.000 description 1
- IMKRJJCKINOENQ-UHFFFAOYSA-N n-ethyl-2-pyridin-2-ylthiolane-2-carbothioamide Chemical compound C=1C=CC=NC=1C1(C(=S)NCC)CCCS1 IMKRJJCKINOENQ-UHFFFAOYSA-N 0.000 description 1
- OXUOVGYWTQHVRY-UHFFFAOYSA-N n-methyl-2-(5-methylpyridin-2-yl)thiolane-2-carbothioamide Chemical compound C=1C=C(C)C=NC=1C1(C(=S)NC)CCCS1 OXUOVGYWTQHVRY-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- HXAIMYRRXHDROM-UHFFFAOYSA-N piperidin-1-yl-(2-pyridin-2-ylthiolan-2-yl)methanethione Chemical compound C1CCSC1(C=1N=CC=CC=1)C(=S)N1CCCCC1 HXAIMYRRXHDROM-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- OXPYXRLBNTVGFB-UHFFFAOYSA-N thiolane-2-carbothioamide Chemical compound NC(=S)C1CCCS1 OXPYXRLBNTVGFB-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/26—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7908032A FR2452488A1 (fr) | 1979-03-30 | 1979-03-30 | Nouveaux derives du (pyridyl-2)-2 tetrahydrothiophene, leur preparation et les medicaments qui les contiennent |
| FR8001500A FR2474500A1 (fr) | 1980-01-24 | 1980-01-24 | Nouveaux derives du (pyridyl-2)-2 tetrahydrothiophene, leur preparation et les medicaments qui les contiennent |
| FR8001499A FR2474499A2 (fr) | 1980-01-24 | 1980-01-24 | Nouveaux derives du (pyridyl-2)-2 tetrahydrothiophene, leur preparation et les medicaments qui les contiennent |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU187273B true HU187273B (en) | 1985-12-28 |
Family
ID=27250910
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU80739A HU187273B (en) | 1979-03-30 | 1980-03-28 | Process for preparing new 2-/2-pyridyl/-tetrahydro-thiophene derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4272534A (https=) |
| AU (1) | AU532337B2 (https=) |
| CA (1) | CA1134361A (https=) |
| CH (1) | CH644858A5 (https=) |
| DE (1) | DE3012142C2 (https=) |
| DK (1) | DK135480A (https=) |
| ES (1) | ES8101071A1 (https=) |
| FI (1) | FI66862C (https=) |
| GB (1) | GB2046265B (https=) |
| GR (1) | GR67614B (https=) |
| HU (1) | HU187273B (https=) |
| IE (1) | IE49570B1 (https=) |
| IL (1) | IL59719A (https=) |
| IT (1) | IT1193524B (https=) |
| LU (1) | LU82307A1 (https=) |
| NL (1) | NL8001687A (https=) |
| NO (1) | NO153055C (https=) |
| NZ (1) | NZ193268A (https=) |
| PH (1) | PH14804A (https=) |
| PT (1) | PT71026A (https=) |
| SE (1) | SE8002426L (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2488609A1 (fr) * | 1980-08-18 | 1982-02-19 | Rhone Poulenc Ind | Nouveaux derives de la thioformamide, leur preparation et les medicaments qui les contiennent |
| FR2511371A1 (fr) * | 1981-08-11 | 1983-02-18 | Rhone Poulenc Sante | Nouveaux nitriles heterocycliques, leur preparation et leur utilisation pour la preparation de medicaments |
| FR2528849B1 (fr) * | 1982-06-17 | 1985-06-21 | Rhone Poulenc Sante | Nouveaux derives de la thioformamide, leur preparation et les medicaments qui les contiennent |
| FR2573428B1 (fr) * | 1984-11-20 | 1987-01-30 | Rhone Poulenc Sante | Nouveaux derives de la thioformamide, leur preparation et les medicaments qui les contiennent |
| JPH0680041B2 (ja) * | 1985-11-08 | 1994-10-12 | サントリー株式会社 | 2−ピリジル酢酸誘導体、その製法およびそれを含む医薬 |
| FR2653770B1 (fr) * | 1989-10-31 | 1992-01-03 | Rhone Poulenc Sante | Procede de preparation de (pyridyl-3)-2 tetrahydrothiopyrannecarbothioamide-2-oxydes-1-(1r,2r), les (pyridyl-3)-2 tetrhydrothiopyrannecarbothioamide-2-oxydes-1-(1r,2r) ainsi obtenus et les compositions pharmaceutiques qui les contiennent. |
| IL136181A0 (en) | 1997-11-19 | 2001-05-20 | Natural Drug Sciences Llc | 5H-PYRANO[2,3-d:6,5-d'] DIPYRIMIDINE DERIVATIVES HAVING AN ANTIBACTERIAL, ANTIVIRAL, AND IMMUNO-MODULATING ACTIVITY |
| JP7290627B2 (ja) | 2017-08-17 | 2023-06-13 | ボード オブ レジェンツ,ザ ユニバーシティ オブ テキサス システム | Atrキナーゼの複素環式阻害剤 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2100970B1 (https=) * | 1970-07-30 | 1975-08-01 | Fujisawa Pharmaceutical Co | |
| US3873536A (en) * | 1972-01-24 | 1975-03-25 | Smithkline Corp | 2-(2-Pyridyl)-N-tertiary amino methylthioacetamides |
| US3740409A (en) * | 1972-03-21 | 1973-06-19 | Smith Kline French Lab | 2-amino(and 2-aminomethyl)-2-heterocyclic-thioacetamides |
| US3917593A (en) * | 1972-05-22 | 1975-11-04 | Smithkline Corp | N-alkenyl and N-alkynyl (2-quinolyl)thio-acetamides |
| US3898228A (en) * | 1972-05-22 | 1975-08-05 | Smithkline Corp | N-alkenyl and N-alkynyl 2-pyridine thioacetamides |
| DK627174A (https=) * | 1974-01-17 | 1975-09-08 | Ciba Geigy Ag |
-
1980
- 1980-03-20 IE IE620/80A patent/IE49570B1/en unknown
- 1980-03-21 NL NL8001687A patent/NL8001687A/nl not_active Application Discontinuation
- 1980-03-26 GB GB8010133A patent/GB2046265B/en not_active Expired
- 1980-03-26 NZ NZ193268A patent/NZ193268A/xx unknown
- 1980-03-26 AU AU56847/80A patent/AU532337B2/en not_active Ceased
- 1980-03-26 US US06/134,311 patent/US4272534A/en not_active Expired - Lifetime
- 1980-03-26 IL IL59719A patent/IL59719A/xx unknown
- 1980-03-26 PH PH23816A patent/PH14804A/en unknown
- 1980-03-28 IT IT21029/80A patent/IT1193524B/it active
- 1980-03-28 CA CA000348680A patent/CA1134361A/fr not_active Expired
- 1980-03-28 HU HU80739A patent/HU187273B/hu unknown
- 1980-03-28 NO NO800910A patent/NO153055C/no unknown
- 1980-03-28 DK DK135480A patent/DK135480A/da not_active Application Discontinuation
- 1980-03-28 ES ES490061A patent/ES8101071A1/es not_active Expired
- 1980-03-28 DE DE3012142A patent/DE3012142C2/de not_active Expired
- 1980-03-28 SE SE8002426A patent/SE8002426L/xx not_active Application Discontinuation
- 1980-03-28 PT PT198071026A patent/PT71026A/pt unknown
- 1980-03-28 LU LU82307A patent/LU82307A1/fr unknown
- 1980-03-28 CH CH247380A patent/CH644858A5/fr not_active IP Right Cessation
- 1980-03-28 GR GR61565A patent/GR67614B/el unknown
- 1980-03-28 FI FI800971A patent/FI66862C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL8001687A (nl) | 1980-10-02 |
| DE3012142A1 (de) | 1980-10-09 |
| FI800971A7 (fi) | 1980-10-01 |
| DK135480A (da) | 1980-10-01 |
| GB2046265B (en) | 1983-02-16 |
| CH644858A5 (fr) | 1984-08-31 |
| IE800620L (en) | 1980-09-30 |
| IL59719A0 (en) | 1980-06-30 |
| NO153055C (no) | 1986-01-08 |
| IT1193524B (it) | 1988-07-08 |
| CA1134361A (fr) | 1982-10-26 |
| US4272534A (en) | 1981-06-09 |
| AU532337B2 (en) | 1983-09-29 |
| GB2046265A (en) | 1980-11-12 |
| AU5684780A (en) | 1980-07-10 |
| GR67614B (https=) | 1981-08-31 |
| PT71026A (en) | 1980-03-31 |
| DE3012142C2 (de) | 1983-10-06 |
| FI66862C (fi) | 1984-12-10 |
| ES490061A0 (es) | 1980-12-01 |
| LU82307A1 (fr) | 1980-10-08 |
| SE8002426L (sv) | 1980-10-01 |
| PH14804A (en) | 1981-12-14 |
| IT8021029A0 (it) | 1980-03-28 |
| IL59719A (en) | 1984-01-31 |
| NO800910L (no) | 1980-10-01 |
| ES8101071A1 (es) | 1980-12-01 |
| NZ193268A (en) | 1982-02-23 |
| NO153055B (no) | 1985-09-30 |
| IE49570B1 (en) | 1985-10-30 |
| FI66862B (fi) | 1984-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4624962A (en) | Substituted derivatives of 2-azabicyclo-[3.3.0]octanes | |
| AU624147B2 (en) | 1-indolylalkyl-4-(substituted pyridinyl) piperazines | |
| US4684727A (en) | Zwitterionic 1,8-naphthyridine and pyrazino[2,3-b]pyridine containing compounds useful as anti-allergic, anti-inflammatory and cycloprotective agents | |
| CA2490097A1 (en) | Di-aryl-substituted-ethane pyridone pde4 inhibitors | |
| CA2468716A1 (en) | Heterocyclic amide compounds as apolipoprotein b inhibitors | |
| NZ270816A (en) | (biphenyl)piperazine derivatives, pharmaceutical compositions | |
| HU187273B (en) | Process for preparing new 2-/2-pyridyl/-tetrahydro-thiophene derivatives | |
| KR100196985B1 (ko) | 피페리딘 유도체 | |
| EP0262448A1 (de) | Imidazolylguanidinderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| KR900006742B1 (ko) | N-[(2-옥소피롤리딘-1-일)아세틸]피페라진 유도체 및 노인성 치매용 약제 | |
| HU195962B (en) | Process for producing pyrimidinyl-methyl-thio-benzimidazole derivatives and pharmaceutics comprising the same | |
| US4379154A (en) | Thiocarboxamide derivatives and their use as pharmaceuticals | |
| EP0083186B1 (en) | Thiazole derivatives as h2-receptor antagonists | |
| US4461768A (en) | Anti-inflammatory 1,2-benzothiazines | |
| CA2137443A1 (en) | Thienothiazinderivatives, process for their preparation and their use | |
| JPS6134433B2 (https=) | ||
| CA1122601A (en) | 4-(2'-pyridylamino)phenylacetic acid derivatives | |
| KR840000075B1 (ko) | 2-(피리드-2-일)테트라하이드로티오펜 유도체의 제조방법 | |
| EP0035259B1 (en) | Tetrahydrothiopyrano(3,2-b)indole derivatives, process for their preparation and pharmaceutical composition containing these compounds | |
| CA1088068A (en) | Piperidino-quinazolines | |
| US4590192A (en) | Benzisothiazoles, their pharmaceutical compositions, and method of use | |
| JPS62108863A (ja) | 2−ピリジル酢酸誘導体、その製法およびそれを含む医薬 | |
| CS228505B2 (en) | Method for the production of new 2-/2-pyridyl/tetrahydrothiophene derivates | |
| SU1037840A3 (ru) | Способ получени производных 2-/2-пиридил/-тетрагидротиофена | |
| US4680303A (en) | Thioformamide derivatives and use in inhibiting gastric secretion |