HU185202B - Nematic mixtures containing liquid crystals - Google Patents
Nematic mixtures containing liquid crystals Download PDFInfo
- Publication number
- HU185202B HU185202B HU79FE1047A HUFE001047A HU185202B HU 185202 B HU185202 B HU 185202B HU 79FE1047 A HU79FE1047 A HU 79FE1047A HU FE001047 A HUFE001047 A HU FE001047A HU 185202 B HU185202 B HU 185202B
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- alkoxy
- liquid crystal
- hydrogen
- phenyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 18
- 239000004973 liquid crystal related substance Substances 0.000 title claims description 11
- 239000007788 liquid Substances 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000004905 tetrazines Chemical class 0.000 claims description 2
- 230000001954 sterilising effect Effects 0.000 claims 1
- 238000004659 sterilization and disinfection Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 abstract description 4
- 239000003086 colorant Substances 0.000 description 6
- HTJMXYRLEDBSLT-UHFFFAOYSA-N 1,2,4,5-tetrazine Chemical class C1=NN=CN=N1 HTJMXYRLEDBSLT-UHFFFAOYSA-N 0.000 description 5
- 239000004988 Nematic liquid crystal Substances 0.000 description 5
- 230000005684 electric field Effects 0.000 description 4
- 230000005693 optoelectronics Effects 0.000 description 4
- -1 cyanophenyl ester Chemical class 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- LGCWNHQHPFBPBP-UHFFFAOYSA-N 2-(4-hexoxyphenyl)-5-hexylpyrimidine Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=C(CCCCCC)C=N1 LGCWNHQHPFBPBP-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- MULRWMBGOFDCME-UHFFFAOYSA-N 3-(4-methylphenyl)-2H-tetrazine Chemical compound Cc1ccc(cc1)N1NN=CC=N1 MULRWMBGOFDCME-UHFFFAOYSA-N 0.000 description 1
- BALGERHMIXFENA-UHFFFAOYSA-N 4-butylcyclohexane-1-carboxylic acid Chemical compound CCCCC1CCC(C(O)=O)CC1 BALGERHMIXFENA-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- QCNUKEGGHOLBES-UHFFFAOYSA-N 4-propylcyclohexane-1-carboxylic acid Chemical compound CCCC1CCC(C(O)=O)CC1 QCNUKEGGHOLBES-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/52—Liquid crystal materials characterised by components which are not liquid crystals, e.g. additives with special physical aspect: solvents, solid particles
- C09K19/60—Pleochroic dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Liquid Crystal (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD20603878A DD137242B1 (de) | 1978-06-16 | 1978-06-16 | Nematische kristallin-fluessige mischungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185202B true HU185202B (en) | 1984-12-28 |
Family
ID=5513094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79FE1047A HU185202B (en) | 1978-06-16 | 1979-06-13 | Nematic mixtures containing liquid crystals |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4348298A (enExample) |
| JP (1) | JPS5516079A (enExample) |
| CH (1) | CH645399A5 (enExample) |
| DD (1) | DD137242B1 (enExample) |
| DE (1) | DE2918000C2 (enExample) |
| FR (1) | FR2428666A1 (enExample) |
| GB (1) | GB2025449B (enExample) |
| HU (1) | HU185202B (enExample) |
| SU (1) | SU1484827A1 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD137118B1 (de) * | 1978-02-06 | 1980-10-01 | Hermann Schubert | Elektrooptische anordnung zur lichtmodulation oder symbolanzeige |
| US4358589A (en) * | 1979-02-02 | 1982-11-09 | Veb Werk Fur Fernsehelektronik Im Veb Kombinat Mikroelektronik | Nematic liquid crystal compounds |
| CA1120478A (en) * | 1979-02-05 | 1982-03-23 | Arthur Boller | Cyclohexyl pyrimidines |
| JPS5662874A (en) * | 1979-10-29 | 1981-05-29 | Sharp Corp | Display device of liquid crystal |
| WO1982000472A1 (en) * | 1980-07-31 | 1982-02-18 | V Nefedov | Derivatives of 2,2-azoimidazole,method for the preparation thereof,liquid crystal material and electro-optical device |
| CH645102A5 (de) * | 1980-10-14 | 1984-09-14 | Hoffmann La Roche | Disubstituierte pyrimidine. |
| CH651025A5 (de) * | 1982-05-14 | 1985-08-30 | Hoffmann La Roche | Pyridazine und ihre verwendung als komponenten fluessigkristalliner gemische. |
| US4452718A (en) * | 1981-07-31 | 1984-06-05 | Hoffmann-La Roche Inc. | Pyridazines |
| JPS5857488A (ja) * | 1981-10-02 | 1983-04-05 | Mitsubishi Chem Ind Ltd | ゲスト−ホスト型液晶組成物 |
| EP0098522B1 (en) * | 1982-06-30 | 1989-06-07 | Hitachi, Ltd. | Liquid crystal composition |
| JPS5939876A (ja) * | 1982-08-26 | 1984-03-05 | Chisso Corp | ピリミジン誘導体 |
| DE3524489A1 (de) * | 1984-07-12 | 1986-01-23 | Kabushiki Kaisha Suwa Seikosha, Tokio/Tokyo | 2-phenylpyridinderivate und verfahren zu ihrer herstellung |
| DE3889490T2 (de) * | 1987-03-31 | 1994-12-01 | Ajinomoto Kk | Phenylpyrimidin-Flüssigkristall-Verbindungen und sie enthaltende Flüssigkristall-Zusammensetzungen. |
| DE3930119A1 (de) * | 1989-04-08 | 1990-10-11 | Merck Patent Gmbh | Trifluormethylcyclohexan-derivate |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1052877A (enExample) * | 1962-12-03 | |||
| US3703329A (en) * | 1969-12-29 | 1972-11-21 | Rca Corp | Liquid crystal color display |
| ZA73911B (en) * | 1972-03-15 | 1973-11-28 | Minnesota Mining & Mfg | Electrographic development process |
| JPS5328102B2 (enExample) * | 1973-04-16 | 1978-08-12 | ||
| DD105701A1 (enExample) * | 1973-07-02 | 1974-05-05 | ||
| SU498300A1 (ru) * | 1973-11-27 | 1976-01-05 | Институт Органической Химии Ан Украинской Сср | Способ получени производных 3,6-диарил-симм-тетразина |
| US4145114A (en) * | 1975-06-17 | 1979-03-20 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Pleochroic dyes |
| CH594897A5 (enExample) * | 1976-06-23 | 1978-01-31 | Bbc Brown Boveri & Cie | |
| DD132591A1 (de) * | 1977-08-31 | 1978-10-11 | Dietrich Demus | Nematische fluessig-kristalline gemische |
| DD138558A1 (de) * | 1977-12-08 | 1979-11-07 | Frank Kuschel | Nematische fluessig-kristalline gemische |
| DD137117B1 (de) * | 1978-01-23 | 1980-10-01 | Hermann Schubert | Nematische kristallin-fluessige substanzen |
| DD137118B1 (de) * | 1978-02-06 | 1980-10-01 | Hermann Schubert | Elektrooptische anordnung zur lichtmodulation oder symbolanzeige |
-
1978
- 1978-06-16 DD DD20603878A patent/DD137242B1/de not_active IP Right Cessation
-
1979
- 1979-05-04 DE DE2918000A patent/DE2918000C2/de not_active Expired
- 1979-05-22 SU SU797770594A patent/SU1484827A1/ru active
- 1979-05-23 GB GB7917962A patent/GB2025449B/en not_active Expired
- 1979-05-29 CH CH497079A patent/CH645399A5/de not_active IP Right Cessation
- 1979-06-13 HU HU79FE1047A patent/HU185202B/hu not_active IP Right Cessation
- 1979-06-15 FR FR7915429A patent/FR2428666A1/fr active Granted
- 1979-06-15 JP JP7478379A patent/JPS5516079A/ja active Pending
-
1980
- 1980-03-31 US US06/136,036 patent/US4348298A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2918000C2 (de) | 1986-11-27 |
| GB2025449B (en) | 1983-04-27 |
| CH645399A5 (de) | 1984-09-28 |
| GB2025449A (en) | 1980-01-23 |
| FR2428666B1 (enExample) | 1985-05-10 |
| SU1484827A1 (ru) | 1989-06-07 |
| DD137242B1 (de) | 1980-10-29 |
| US4348298A (en) | 1982-09-07 |
| JPS5516079A (en) | 1980-02-04 |
| FR2428666A1 (fr) | 1980-01-11 |
| DD137242A1 (de) | 1979-08-22 |
| DE2918000A1 (de) | 1980-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR850000050B1 (ko) | 다색성 염료를 함유하는 액정조성물 | |
| US4299720A (en) | Liquid crystal mixture | |
| CA1040411A (en) | Electro-optical display element | |
| HU185202B (en) | Nematic mixtures containing liquid crystals | |
| EP0068427B1 (en) | Liquid crystal composition | |
| US4408840A (en) | Liquid crystal compositions containing pleochroic anthraquinone dyes, liquid crystal devices containing the compositions, and the dyes | |
| GB2037803A (en) | Liquid crystal mixture | |
| US4428858A (en) | Composition based on liquid crystal for electro-optical device | |
| US4483594A (en) | Liquid crystal materials containing pleochroic anthraquinone dyes | |
| CA1199025A (en) | Liquid crystalline materials incorporating dichroic dye and optical displays utilizing same | |
| US4288147A (en) | Electro-optical composition of the guest-host type | |
| US4105299A (en) | Electro-optical devices containing methine arylidene dyes | |
| US4550980A (en) | Liquid crystal composition and display element including same | |
| JPH0517274B2 (enExample) | ||
| EP0293942B1 (en) | Liquid crystal composition containing a pleochroic azo type compound | |
| EP0098736A2 (en) | Anthraquinone dyes and liquid crystal compositions containing the dyes | |
| GB2064572A (en) | Liquid crystal composition | |
| KR920007662B1 (ko) | 치환된 안트라센형 등방성 염료를 포함하는 조성물 및 상기 조성물을 포함하는 액정 디스플레이 장치 | |
| Basturk et al. | Ester-substituted anthraquinone dyes soluble in nematic liquid crystal mixtures | |
| EP0120717B1 (en) | Anthraquinone dyes and liquid crystal compositions containing the dyes | |
| JPS627238B2 (enExample) | ||
| JPH03433B2 (enExample) | ||
| GB2041962A (en) | Guest-host liquid crystal composition | |
| JPS644557B2 (enExample) | ||
| JPH049187B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |