HU182675B - Process for preparing imidazo-diazepine derivatives - Google Patents
Process for preparing imidazo-diazepine derivatives Download PDFInfo
- Publication number
- HU182675B HU182675B HU802390A HU239080A HU182675B HU 182675 B HU182675 B HU 182675B HU 802390 A HU802390 A HU 802390A HU 239080 A HU239080 A HU 239080A HU 182675 B HU182675 B HU 182675B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- ethyl
- methyl
- benzodiazepine
- hydrogen
- Prior art date
Links
- BMGXAZCDDYTVFV-UHFFFAOYSA-N imidazo[4,5-c]diazepine Chemical class C1=CN=NC2=NC=NC2=C1 BMGXAZCDDYTVFV-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 150
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 71
- 239000000203 mixture Substances 0.000 claims description 67
- 238000000034 method Methods 0.000 claims description 53
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 51
- 239000001257 hydrogen Substances 0.000 claims description 50
- 229910052739 hydrogen Inorganic materials 0.000 claims description 50
- 238000002360 preparation method Methods 0.000 claims description 39
- -1 isocyanoacetic acid ester Chemical class 0.000 claims description 37
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 21
- 239000007858 starting material Substances 0.000 claims description 19
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 17
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 14
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 claims description 14
- 229910052736 halogen Chemical group 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 12
- 125000006410 propenylene group Chemical group 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- OFBIFZUFASYYRE-UHFFFAOYSA-N flumazenil Chemical compound C1N(C)C(=O)C2=CC(F)=CC=C2N2C=NC(C(=O)OCC)=C21 OFBIFZUFASYYRE-UHFFFAOYSA-N 0.000 claims description 10
- HZABUXCSZMLBHU-UHFFFAOYSA-N 1H-1,4-benzodiazepine-3-carboxylic acid Chemical compound C1=NC(C(=O)O)=CNC2=CC=CC=C21 HZABUXCSZMLBHU-UHFFFAOYSA-N 0.000 claims description 8
- OFWFBJVJXBLXOP-UHFFFAOYSA-N 9h-pyrrolo[2,1-c][1,4]benzodiazepine-7-carboxylic acid Chemical compound C1=C2C=CC=CC2=NC=C2C(C(=O)O)=CCN21 OFWFBJVJXBLXOP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 7
- LMUVYJCAFWGNSY-UHFFFAOYSA-N 5-(2-chlorophenyl)-3-methyl-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound C12=CC([N+]([O-])=O)=CC=C2NC(=O)C(C)N=C1C1=CC=CC=C1Cl LMUVYJCAFWGNSY-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- 125000006239 protecting group Chemical group 0.000 claims description 6
- 238000005809 transesterification reaction Methods 0.000 claims description 6
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 5
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 5
- 230000003042 antagnostic effect Effects 0.000 claims description 5
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 claims description 5
- 239000003158 myorelaxant agent Substances 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 239000003874 central nervous system depressant Substances 0.000 claims description 4
- 230000000994 depressogenic effect Effects 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 230000000241 respiratory effect Effects 0.000 claims description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 230000003276 anti-hypertensive effect Effects 0.000 claims description 2
- 229940049706 benzodiazepine Drugs 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- SKGNKKNPQHEANX-UHFFFAOYSA-N ethyl 7-fluoro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=C(F)C=CC=C2N2C=NC(C(=O)OCC)=C21 SKGNKKNPQHEANX-UHFFFAOYSA-N 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 3
- 125000001153 fluoro group Chemical group F* 0.000 claims 3
- 230000002195 synergetic effect Effects 0.000 claims 3
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 claims 1
- MFJSFVSWZBOUCO-UHFFFAOYSA-N 3-nitro-1,4-benzodiazepin-2-one Chemical compound [N+](=O)([O-])C=1C(N=C2C(=CN1)C=CC=C2)=O MFJSFVSWZBOUCO-UHFFFAOYSA-N 0.000 claims 1
- 229940125898 compound 5 Drugs 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 161
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 156
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 106
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 102
- 239000000243 solution Substances 0.000 description 97
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 78
- 239000011541 reaction mixture Substances 0.000 description 73
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 72
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 37
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 36
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 36
- 235000019341 magnesium sulphate Nutrition 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 229960000583 acetic acid Drugs 0.000 description 29
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 26
- 238000003756 stirring Methods 0.000 description 25
- 238000001816 cooling Methods 0.000 description 24
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- HBLAXMITNSURQX-UHFFFAOYSA-N 2-isocyanobutanoic acid Chemical compound CCC([N+]#[C-])C(O)=O HBLAXMITNSURQX-UHFFFAOYSA-N 0.000 description 19
- 230000000694 effects Effects 0.000 description 19
- 229910052786 argon Inorganic materials 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 238000001953 recrystallisation Methods 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 241001465754 Metazoa Species 0.000 description 16
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000012312 sodium hydride Substances 0.000 description 16
- 229910000104 sodium hydride Inorganic materials 0.000 description 16
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- HNGRWUCKESPKRC-UHFFFAOYSA-N ethyl 5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC=CC=C2N2C=NC(C(=O)OCC)=C21 HNGRWUCKESPKRC-UHFFFAOYSA-N 0.000 description 15
- 239000002026 chloroform extract Substances 0.000 description 14
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 14
- 229920002261 Corn starch Polymers 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 13
- 239000013078 crystal Substances 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000008120 corn starch Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 12
- 239000003826 tablet Substances 0.000 description 12
- 239000012043 crude product Substances 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 235000019198 oils Nutrition 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 238000009835 boiling Methods 0.000 description 10
- 239000002775 capsule Substances 0.000 description 10
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- CEHKKWWXELBNPS-UHFFFAOYSA-N 1,4-benzodiazepine-1-carboxylic acid Chemical compound OC(=O)N1C=CN=CC2=CC=CC=C12 CEHKKWWXELBNPS-UHFFFAOYSA-N 0.000 description 9
- PPTYJKAXVCCBDU-UHFFFAOYSA-N Rohypnol Chemical compound N=1CC(=O)N(C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1F PPTYJKAXVCCBDU-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000004440 column chromatography Methods 0.000 description 9
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 9
- 229960003529 diazepam Drugs 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 229960002200 flunitrazepam Drugs 0.000 description 9
- 239000012362 glacial acetic acid Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 108010077895 Sarcosine Proteins 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 229940043230 sarcosine Drugs 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 241000699666 Mus <mouse, genus> Species 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- VUSVWZBQTTWZGJ-ZDUSSCGKSA-N ethyl (s)-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=CC=CC=C2N2C=NC(C(=O)OCC)=C2[C@@H]2CCCN21 VUSVWZBQTTWZGJ-ZDUSSCGKSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- MZHUTGQZAZLFKW-UHFFFAOYSA-N 1H-1,2-benzodiazepine-3-carboxylic acid Chemical compound C1=CC(C(=O)O)=NNC2=CC=CC=C21 MZHUTGQZAZLFKW-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 5
- 241000699800 Cricetinae Species 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 150000007942 carboxylates Chemical class 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 102000004300 GABA-A Receptors Human genes 0.000 description 4
- 108090000839 GABA-A Receptors Proteins 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000010171 animal model Methods 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- QRKPPWPLSQRGSU-UHFFFAOYSA-N diazepine-1-carboxylic acid Chemical compound OC(=O)N1C=CC=CC=N1 QRKPPWPLSQRGSU-UHFFFAOYSA-N 0.000 description 4
- FPULFENIJDPZBX-UHFFFAOYSA-N ethyl 2-isocyanoacetate Chemical compound CCOC(=O)C[N+]#[C-] FPULFENIJDPZBX-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 230000004899 motility Effects 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- IECJCROEVIVLJK-UHFFFAOYSA-N 1,4-diazepine-1-carboxylic acid Chemical compound OC(=O)N1C=CC=NC=C1 IECJCROEVIVLJK-UHFFFAOYSA-N 0.000 description 3
- QHTTXSWWWSYDRY-UHFFFAOYSA-N 1h-thieno[3,2-d][1,3]oxazine-2,4-dione Chemical compound O=C1OC(=O)NC2=C1SC=C2 QHTTXSWWWSYDRY-UHFFFAOYSA-N 0.000 description 3
- BKHGZIQXTHAVNJ-UHFFFAOYSA-N 7-fluoro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=C(F)C=C21 BKHGZIQXTHAVNJ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000001828 Gelatine Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 3
- 229930182821 L-proline Natural products 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000008298 dragée Substances 0.000 description 3
- OODGJVJCBIXWFZ-UHFFFAOYSA-N ethyl 5-methyl-6-sulfanylidene-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=S)C2=CC=CC=C2N2C=NC(C(=O)OCC)=C21 OODGJVJCBIXWFZ-UHFFFAOYSA-N 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229960002429 proline Drugs 0.000 description 3
- 230000033764 rhythmic process Effects 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 239000008215 water for injection Substances 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- BIEDPTYBGPLIKI-UHFFFAOYSA-N (2-carboxy-3-fluorophenyl)azanium;chloride Chemical compound Cl.NC1=CC=CC(F)=C1C(O)=O BIEDPTYBGPLIKI-UHFFFAOYSA-N 0.000 description 2
- GXXNSEYTZVNYNW-ZDUSSCGKSA-N (s)-(+)-ethyl-7-chloro-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=CC(Cl)=CC=C2N2C=NC(C(=O)OCC)=C2[C@@H]2CCCN21 GXXNSEYTZVNYNW-ZDUSSCGKSA-N 0.000 description 2
- CFMIOXCGQIHWJP-UHFFFAOYSA-N 1,2-benzodiazepine-1-carboxylic acid Chemical compound OC(=O)N1N=CC=CC2=CC=CC=C12 CFMIOXCGQIHWJP-UHFFFAOYSA-N 0.000 description 2
- GXPIVRKDWZKIKZ-UHFFFAOYSA-N 1-fluoro-2-methyl-3-nitrobenzene Chemical compound CC1=C(F)C=CC=C1[N+]([O-])=O GXPIVRKDWZKIKZ-UHFFFAOYSA-N 0.000 description 2
- LWRSYTXEQUUTKW-UHFFFAOYSA-N 2,4-dimethoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(OC)=C1 LWRSYTXEQUUTKW-UHFFFAOYSA-N 0.000 description 2
- BGWXTSKOBMAJMO-UHFFFAOYSA-N 2,6-dichloro-3,5-bis(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=C(Cl)N=C1Cl BGWXTSKOBMAJMO-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- AJVOIZUSHCYQHZ-UHFFFAOYSA-N 2-[(2,4-dimethoxyphenyl)methylazaniumyl]acetate Chemical compound COC1=CC=C(CNCC(O)=O)C(OC)=C1 AJVOIZUSHCYQHZ-UHFFFAOYSA-N 0.000 description 2
- MPDZCNPDHUUPRL-UHFFFAOYSA-N 2-fluoro-6-nitrobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC=C1[N+]([O-])=O MPDZCNPDHUUPRL-UHFFFAOYSA-N 0.000 description 2
- VBOVQIKWRROVRP-UHFFFAOYSA-N 2-hydroxyethyl 5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound O=C1N(C)CC2=C(C(=O)OCCO)N=CN2C2=CC=CC=C21 VBOVQIKWRROVRP-UHFFFAOYSA-N 0.000 description 2
- CFCNTIFLYGKEIO-UHFFFAOYSA-N 2-isocyanoacetic acid Chemical class OC(=O)C[N+]#[C-] CFCNTIFLYGKEIO-UHFFFAOYSA-N 0.000 description 2
- VYJBPROLJIGKEL-UHFFFAOYSA-N 4,6-dimethyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=CC(C)=C21 VYJBPROLJIGKEL-UHFFFAOYSA-N 0.000 description 2
- RFYZYCZBBFVBBG-UHFFFAOYSA-N 4-[(2,4-dimethoxyphenyl)methyl]-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound COC1=CC(OC)=CC=C1CN1C(=O)C2=CC=CC=C2NC(=O)C1 RFYZYCZBBFVBBG-UHFFFAOYSA-N 0.000 description 2
- MLSVJZRONQCNQA-UHFFFAOYSA-N 4-[(2,4-dimethoxyphenyl)methyl]-7-fluoro-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound COC1=CC(OC)=CC=C1CN1C(=O)C2=CC(F)=CC=C2NC(=O)C1 MLSVJZRONQCNQA-UHFFFAOYSA-N 0.000 description 2
- XJBLJAPFKKUUJZ-UHFFFAOYSA-N 4-methyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=C(C(F)(F)F)C=C21 XJBLJAPFKKUUJZ-UHFFFAOYSA-N 0.000 description 2
- VAAIGNBVENPUEI-UHFFFAOYSA-N 5-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2F VAAIGNBVENPUEI-UHFFFAOYSA-N 0.000 description 2
- KJBDXWPWJNDBOS-UHFFFAOYSA-N 5-methyl-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=C1C=CC=C2C KJBDXWPWJNDBOS-UHFFFAOYSA-N 0.000 description 2
- HAMDXJUAHDROHP-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(C(F)(F)F)=CC=C21 HAMDXJUAHDROHP-UHFFFAOYSA-N 0.000 description 2
- SQTOIFUJFBCCIA-UHFFFAOYSA-N 6-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=CC(Cl)=C21 SQTOIFUJFBCCIA-UHFFFAOYSA-N 0.000 description 2
- UBKGOWGNYKVYEF-UHFFFAOYSA-N 6-fluoro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(F)=CC=C21 UBKGOWGNYKVYEF-UHFFFAOYSA-N 0.000 description 2
- NJLZFBSRXZEKNR-UHFFFAOYSA-N 6-fluoro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=CC(F)=C21 NJLZFBSRXZEKNR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZJJCFMNEIJWWJM-AWEZNQCLSA-N C(C)C=1N=CN2C1[C@H]1N(C(C3=C2C=CC=C3)=O)CCC1 Chemical compound C(C)C=1N=CN2C1[C@H]1N(C(C3=C2C=CC=C3)=O)CCC1 ZJJCFMNEIJWWJM-AWEZNQCLSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 208000001953 Hypotension Diseases 0.000 description 2
- 238000012404 In vitro experiment Methods 0.000 description 2
- 241000699673 Mesocricetus auratus Species 0.000 description 2
- RLAHWVDQYNDAGG-UHFFFAOYSA-N Methanetriol Chemical compound OC(O)O RLAHWVDQYNDAGG-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229960003965 antiepileptics Drugs 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000004203 carnauba wax Substances 0.000 description 2
- 235000013869 carnauba wax Nutrition 0.000 description 2
- NTYBXVOZFGOCCH-UHFFFAOYSA-N chembl6752 Chemical compound COC(=O)C=1N=CN2C=1CN(C)C(=O)C1=C2C=CS1 NTYBXVOZFGOCCH-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- AVCOMZCMWMHMTH-UHFFFAOYSA-N ethyl 2-(4-methyl-5-oxo-1,3-dihydro-1,4-benzodiazepin-2-ylidene)acetate Chemical compound N1C(=CC(=O)OCC)CN(C)C(=O)C2=CC=CC=C21 AVCOMZCMWMHMTH-UHFFFAOYSA-N 0.000 description 2
- QODUFNRDAZCDEE-UHFFFAOYSA-N ethyl 5,7-dimethyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=C(C)C=CC=C2N2C=NC(C(=O)OCC)=C21 QODUFNRDAZCDEE-UHFFFAOYSA-N 0.000 description 2
- IFLUHBDEPBSPDX-UHFFFAOYSA-N ethyl 5-methyl-6-oxo-7-(trifluoromethyl)-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound CCOC(=O)C=1N=CN2C=1CN(C)C(=O)C1=C2C=CC=C1C(F)(F)F IFLUHBDEPBSPDX-UHFFFAOYSA-N 0.000 description 2
- ANZYZOJVUANJGY-UHFFFAOYSA-N ethyl 5-methyl-6-oxo-8-(trifluoromethyl)-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC(C(F)(F)F)=CC=C2N2C=NC(C(=O)OCC)=C21 ANZYZOJVUANJGY-UHFFFAOYSA-N 0.000 description 2
- GPUJMSDUDGAQJW-UHFFFAOYSA-N ethyl 6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1NC(=O)C2=CC=CC=C2N2C=NC(C(=O)OCC)=C21 GPUJMSDUDGAQJW-UHFFFAOYSA-N 0.000 description 2
- QORLMYYHZLDYOR-UHFFFAOYSA-N ethyl 8-chloro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC(Cl)=CC=C2N2C=NC(C(=O)OCC)=C21 QORLMYYHZLDYOR-UHFFFAOYSA-N 0.000 description 2
- CKWYELQELXZNMP-UHFFFAOYSA-N ethyl 8-fluoro-5-methyl-6-sulfanylidene-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=S)C2=CC(F)=CC=C2N2C=NC(C(=O)OCC)=C21 CKWYELQELXZNMP-UHFFFAOYSA-N 0.000 description 2
- VZVRAZNHBCFAMI-UHFFFAOYSA-N ethyl 8-fluoro-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1NC(=O)C2=CC(F)=CC=C2N2C=NC(C(=O)OCC)=C21 VZVRAZNHBCFAMI-UHFFFAOYSA-N 0.000 description 2
- KIHJNZROBMOIPP-UHFFFAOYSA-N ethyl 8-methyl-9-oxo-4-thia-1,8,12-triazatricyclo[8.3.0.02,6]trideca-2,5,10,12-tetraene-5-carboxylate Chemical compound C1N(C)C(=O)C2=CN=CN2C2=CSC(C(=O)OCC)=C21 KIHJNZROBMOIPP-UHFFFAOYSA-N 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 208000021822 hypotensive Diseases 0.000 description 2
- 230000001077 hypotensive effect Effects 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 2
- DJGRQYYJQXYLOL-UHFFFAOYSA-N methyl 4-[(2-chloroacetyl)amino]thiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1NC(=O)CCl DJGRQYYJQXYLOL-UHFFFAOYSA-N 0.000 description 2
- CEZSRUQETZLUKV-UHFFFAOYSA-N methyl 4-[[2-(methylamino)acetyl]amino]thiophene-3-carboxylate Chemical compound CNCC(=O)NC1=CSC=C1C(=O)OC CEZSRUQETZLUKV-UHFFFAOYSA-N 0.000 description 2
- QZZWDAILXQWHAG-UHFFFAOYSA-N methyl 5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC=CC=C2N2C=NC(C(=O)OC)=C21 QZZWDAILXQWHAG-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- AFAGUKXLJLMNSO-UHFFFAOYSA-N propan-2-yl 5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC=CC=C2N2C=NC(C(=O)OC(C)C)=C21 AFAGUKXLJLMNSO-UHFFFAOYSA-N 0.000 description 2
- YEYSXUKJJMCENU-UHFFFAOYSA-N propan-2-yl 8-fluoro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC(F)=CC=C2N2C=NC(C(=O)OC(C)C)=C21 YEYSXUKJJMCENU-UHFFFAOYSA-N 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- WSDBAFQWNWJTNG-UHFFFAOYSA-N sarmazenil Chemical compound C1N(C)C(=O)C2=C(Cl)C=CC=C2N2C=NC(C(=O)OCC)=C21 WSDBAFQWNWJTNG-UHFFFAOYSA-N 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 230000002618 waking effect Effects 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- GXFZCDMWGMFGFL-KKXMJGKMSA-N (+)-Tubocurarine chloride hydrochloride Chemical compound [Cl-].[Cl-].C([C@H]1[N+](C)(C)CCC=2C=C(C(=C(OC3=CC=C(C=C3)C[C@H]3C=4C=C(C(=CC=4CC[NH+]3C)OC)O3)C=21)O)OC)C1=CC=C(O)C3=C1 GXFZCDMWGMFGFL-KKXMJGKMSA-N 0.000 description 1
- YFTGBEBPZFFJFE-UHFFFAOYSA-N (2-methoxycarbonylthiophen-3-yl)azanium;chloride Chemical compound Cl.COC(=O)C=1SC=CC=1N YFTGBEBPZFFJFE-UHFFFAOYSA-N 0.000 description 1
- JGIRDDQLZLXRKQ-UHFFFAOYSA-N (4-methoxycarbonylthiophen-3-yl)azanium;chloride Chemical compound Cl.COC(=O)C1=CSC=C1N JGIRDDQLZLXRKQ-UHFFFAOYSA-N 0.000 description 1
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical class N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 description 1
- AXDNGJPEZJTYAN-UHFFFAOYSA-N 1h-imidazo[1,5-a][1,4]benzodiazepine Chemical class N1=CC2=CC=CC=C2N2CN=CC2=C1 AXDNGJPEZJTYAN-UHFFFAOYSA-N 0.000 description 1
- BESOQRFWCAJXLE-UHFFFAOYSA-N 2,3-bis(bromomethyl)-1,4-dimethoxybenzene Chemical compound COC1=CC=C(OC)C(CBr)=C1CBr BESOQRFWCAJXLE-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OPPFHJTVQJRUMB-UHFFFAOYSA-N 2-hydroxyethyl 8-fluoro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound O=C1N(C)CC2=C(C(=O)OCCO)N=CN2C2=CC=C(F)C=C21 OPPFHJTVQJRUMB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- IMXWNWBXKWASOM-UHFFFAOYSA-N 3h-imidazo[1,5-a][1,4]diazepine Chemical class N1=CC=CN2CN=CC2=C1 IMXWNWBXKWASOM-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ZVHUQIMPAVOVTR-UHFFFAOYSA-N 4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=CC=C21 ZVHUQIMPAVOVTR-UHFFFAOYSA-N 0.000 description 1
- GMFLMEHAXIVZLO-UHFFFAOYSA-N 4-methyl-1,3-dihydrothieno[3,2-e][1,4]diazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=C1SC=C2 GMFLMEHAXIVZLO-UHFFFAOYSA-N 0.000 description 1
- VVPPUEDQOCSLSJ-UHFFFAOYSA-N 4-methyl-1,3-dihydrothieno[3,4-e][1,4]diazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CSC=C21 VVPPUEDQOCSLSJ-UHFFFAOYSA-N 0.000 description 1
- JDBREFQUIHBDAU-UHFFFAOYSA-N 4-oxoimidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid Chemical compound O=C1N=CC2=CC=CC=C2N2C=NC(C(=O)O)=C21 JDBREFQUIHBDAU-UHFFFAOYSA-N 0.000 description 1
- WODYULWWVAMDCP-UHFFFAOYSA-N 5-(trifluoromethyl)-1h-indole-2,3-dione Chemical compound FC(F)(F)C1=CC=C2NC(=O)C(=O)C2=C1 WODYULWWVAMDCP-UHFFFAOYSA-N 0.000 description 1
- DXSMYDSFWCOSFM-UHFFFAOYSA-N 6-bromo-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(Br)=CC=C21 DXSMYDSFWCOSFM-UHFFFAOYSA-N 0.000 description 1
- KKJBJTGEGMJZCG-UHFFFAOYSA-N 7-bromo-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione Chemical compound O=C1N(C)CC(=O)NC2=CC=C(Br)C=C21 KKJBJTGEGMJZCG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- UCBPQHPNINCJKQ-UHFFFAOYSA-N 7H-thieno[3,2-e][1,4]diazepine-3-carboxylic acid Chemical compound N1=CC(=NC=C2C1=CCS2)C(=O)O UCBPQHPNINCJKQ-UHFFFAOYSA-N 0.000 description 1
- LIUMNBVCHBTLKH-UHFFFAOYSA-N 7h-thieno[3,2-e][1,4]diazepine Chemical compound N1=CC=NC2=CCSC2=C1 LIUMNBVCHBTLKH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 206010003591 Ataxia Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- HGLZPCIQFBNAHC-AWEZNQCLSA-N C(C)C=1N=CN2C1[C@H]1N(C(C3=C2C=CC=C3C)=O)CCC1 Chemical compound C(C)C=1N=CN2C1[C@H]1N(C(C3=C2C=CC=C3C)=O)CCC1 HGLZPCIQFBNAHC-AWEZNQCLSA-N 0.000 description 1
- 241001111317 Chondrodendron tomentosum Species 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 239000008709 Curare Substances 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000004756 Respiratory Insufficiency Diseases 0.000 description 1
- 206010038678 Respiratory depression Diseases 0.000 description 1
- 241000242678 Schistosoma Species 0.000 description 1
- 241000242680 Schistosoma mansoni Species 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000729 antidote Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 208000002925 dental caries Diseases 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- ZIEOUESBFJZRAI-UHFFFAOYSA-N diethyl 2-(4-methyl-5-oxo-1,3-dihydro-1,4-benzodiazepin-2-ylidene)propanedioate Chemical compound N1C(=C(C(=O)OCC)C(=O)OCC)CN(C)C(=O)C2=CC=CC=C21 ZIEOUESBFJZRAI-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 210000005110 dorsal hippocampus Anatomy 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- YSGOBGDYTSJDBX-ZDUSSCGKSA-N ethyl (7S)-14-methyl-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate Chemical compound O=C1C2=C(C)C=CC=C2N2C=NC(C(=O)OCC)=C2[C@@H]2CCCN21 YSGOBGDYTSJDBX-ZDUSSCGKSA-N 0.000 description 1
- HQGUQOHSCRHEFJ-LBPRGKRZSA-N ethyl (s)-8-chloro-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]-benzodiazepine-1-carboxylate Chemical compound O=C1C2=C(Cl)C=CC=C2N2C=NC(C(=O)OCC)=C2[C@@H]2CCCN21 HQGUQOHSCRHEFJ-LBPRGKRZSA-N 0.000 description 1
- AXJSHWLLFIXJIM-UHFFFAOYSA-N ethyl 5,6-dihydro-5-methyl-6-oxo-4h-imidazo[1,5-a]thieno[2,3-f][1,4]-diazepine-3-carboxylate Chemical compound CCOC(=O)C=1N=CN2C=1CN(C)C(=O)C1=C2C=CS1 AXJSHWLLFIXJIM-UHFFFAOYSA-N 0.000 description 1
- NJUZUDGPPNROER-UHFFFAOYSA-N ethyl 7-chloro-8-fluoro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=C(Cl)C(F)=CC=C2N2C=NC(C(=O)OCC)=C21 NJUZUDGPPNROER-UHFFFAOYSA-N 0.000 description 1
- NFMFVESVKLVYJR-UHFFFAOYSA-N ethyl 8-bromo-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC(Br)=CC=C2N2C=NC(C(=O)OCC)=C21 NFMFVESVKLVYJR-UHFFFAOYSA-N 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 210000001320 hippocampus Anatomy 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 231100000566 intoxication Toxicity 0.000 description 1
- 230000035987 intoxication Effects 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- HEOKNRFBEQLCFZ-QMMMGPOBSA-N methyl (s)-10,11,12,12a-tetrahydro-8-oxo-8h-imidazo[5,1-c]pyrrolo[1,2-a]thieno[3,2-e][1,4]diazepine-1-carboxylate Chemical compound O=C1N2CCC[C@H]2C2=C(C(=O)OC)N=CN2C2=C1SC=C2 HEOKNRFBEQLCFZ-QMMMGPOBSA-N 0.000 description 1
- PXHOJSQUOJCDDQ-LBPRGKRZSA-N methyl (s)-11,12,13,13a-tetrahydro-9-oxo-9h-imidazo[1,5-a]pyrrolo[2,1-c][1,4]benzodiazepine-1-carboxylate Chemical compound O=C1C2=CC=CC=C2N2C=NC(C(=O)OC)=C2[C@@H]2CCCN21 PXHOJSQUOJCDDQ-LBPRGKRZSA-N 0.000 description 1
- YBDFLMXWHXCQQQ-UHFFFAOYSA-N methyl 4-ethylbenzenesulfonate Chemical compound CCC1=CC=C(S(=O)(=O)OC)C=C1 YBDFLMXWHXCQQQ-UHFFFAOYSA-N 0.000 description 1
- JXEPEXMMOWPOCX-UHFFFAOYSA-N methyl 8-fluoro-5-methyl-6-oxo-4h-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate Chemical compound C1N(C)C(=O)C2=CC(F)=CC=C2N2C=NC(C(=O)OC)=C21 JXEPEXMMOWPOCX-UHFFFAOYSA-N 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- RGUOJYYIMVSCNC-UHFFFAOYSA-N n,n-dimethylformamide;2-methylpropanoic acid Chemical compound CN(C)C=O.CC(C)C(O)=O RGUOJYYIMVSCNC-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 210000003240 portal vein Anatomy 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- DPZNOMCNRMUKPS-UHFFFAOYSA-N resorcinol dimethyl ether Natural products COC1=CC=CC(OC)=C1 DPZNOMCNRMUKPS-UHFFFAOYSA-N 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- WVMADKBGYOAZKM-UHFFFAOYSA-M sodium;3-aminothiophene-2-carboxylate Chemical compound [Na+].NC=1C=CSC=1C([O-])=O WVMADKBGYOAZKM-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000009870 specific binding Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- GKTQKQTXHNUFSP-UHFFFAOYSA-N thieno[3,4-c]pyrrole-4,6-dione Chemical compound S1C=C2C(=O)NC(=O)C2=C1 GKTQKQTXHNUFSP-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003564 thiocarbonyl compounds Chemical class 0.000 description 1
- 150000003571 thiolactams Chemical class 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/10—Anthelmintics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P39/00—General protective or antinoxious agents
- A61P39/02—Antidotes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/42—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/12—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains three hetero rings
- C07D495/14—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Tropical Medicine & Parasitology (AREA)
- Toxicology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH897279 | 1979-10-04 | ||
| CH897179 | 1979-10-04 | ||
| CH1066579 | 1979-11-30 | ||
| CH1066479 | 1979-11-30 | ||
| CH571680 | 1980-07-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182675B true HU182675B (en) | 1984-02-28 |
Family
ID=27509256
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU802390A HU182675B (en) | 1979-10-04 | 1980-10-01 | Process for preparing imidazo-diazepine derivatives |
Country Status (23)
| Country | Link |
|---|---|
| US (10) | US4316839A (enExample) |
| EP (1) | EP0027214B1 (enExample) |
| JP (1) | JPH01156968A (enExample) |
| AR (1) | AR227293A1 (enExample) |
| AU (1) | AU533641B2 (enExample) |
| BR (1) | BR8006404A (enExample) |
| CA (1) | CA1143728A (enExample) |
| DE (1) | DE3067868D1 (enExample) |
| DK (1) | DK168094B1 (enExample) |
| FI (1) | FI73683C (enExample) |
| GB (1) | GB2060632B (enExample) |
| GR (1) | GR70772B (enExample) |
| HU (1) | HU182675B (enExample) |
| IE (1) | IE50318B1 (enExample) |
| IL (1) | IL61160A (enExample) |
| LU (1) | LU88298I2 (enExample) |
| MC (1) | MC1355A1 (enExample) |
| NL (1) | NL930056I2 (enExample) |
| NO (1) | NO155774C (enExample) |
| NZ (1) | NZ195071A (enExample) |
| PH (1) | PH16607A (enExample) |
| PT (1) | PT71874B (enExample) |
| ZW (1) | ZW21580A1 (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1143728A (en) * | 1979-10-04 | 1983-03-29 | Max Gerecke | Imidazodiazepine derivatives |
| US4352817A (en) * | 1981-02-27 | 1982-10-05 | Hoffmann-La Roche Inc. | Imidazo-diazepines and their use |
| CA1184175A (en) * | 1981-02-27 | 1985-03-19 | Walter Hunkeler | Imidazodiazepines |
| CA1173441A (en) * | 1981-02-27 | 1984-08-28 | Hoffmann-La Roche Limited | Imidazodiazepines |
| CA1185602A (en) * | 1981-02-27 | 1985-04-16 | Emilio Kyburz | Imidazodiazepines |
| CA1174673A (en) * | 1981-02-27 | 1984-09-18 | Walter Hunkeler | Imidazodiazepines |
| MC1528A1 (fr) * | 1982-07-21 | 1984-04-13 | Hoffmann La Roche | Imidazobenzodiazepines |
| DK151808C (da) * | 1982-11-16 | 1988-06-20 | Ferrosan As | Analogifremgangsmaade til fremstilling af oxadiazolylimidazo-oe1,4aa-benzodiazepinderivater |
| US4723003A (en) * | 1983-05-18 | 1988-02-02 | Hoechst-Roussel Pharmaceuticals Inc. | Benzopyrrolobenzodiazepines and quinobenzodiazepines |
| EP0150040B1 (de) * | 1984-01-19 | 1994-08-31 | F. Hoffmann-La Roche Ag | Imidazodiazepin-Derivate |
| AU587802B2 (en) * | 1985-03-08 | 1989-08-31 | Ferrosan A/S | Novel oxadiazolyl imidazobenzodiazepine derivatives and methods of preparing such compounds |
| US4622321A (en) * | 1985-05-17 | 1986-11-11 | As Ferrosan | Oxadiazolylimidazobenzodiazepine, compositions, and method |
| US4745112A (en) * | 1985-05-17 | 1988-05-17 | A/S Ferrosan | Oxadiazolylimidazobenzodiazepine, compositions, and method III |
| DK174086D0 (da) * | 1986-04-16 | 1986-04-16 | Ferrosan As | Nye benzodiazepinderivater samt fremgangsmaade til fremstilling af samme |
| FI880814A7 (fi) * | 1987-03-10 | 1988-09-11 | Hoffmann La Roche | Imidazodiazepin-derivat. |
| GB8720414D0 (en) * | 1987-08-28 | 1987-10-07 | Roussel Lab Ltd | Chemical compounds |
| NZ230193A (en) * | 1988-08-05 | 1992-01-29 | Hoffmann La Roche | A radioiodinated benzodiazepine derivative and brain imaging composition |
| US5096695A (en) * | 1988-08-05 | 1992-03-17 | Hoffmann-Laroche Inc. | Radioiodine benzodiazepines as brain imaging agents |
| CA1327572C (en) * | 1988-08-31 | 1994-03-08 | F. Hoffmann-La Roche Ag | Imidazodiazepine derivatives |
| GB8909700D0 (en) * | 1989-04-27 | 1989-06-14 | Roussel Lab Ltd | Chemical compounds |
| CA2015336A1 (en) * | 1989-05-19 | 1990-11-19 | F. Hoffmann-La Roche Ag | Imidazodiazepines for the treatment of neurological symptoms |
| FR2660310B1 (fr) * | 1990-03-27 | 1992-06-05 | Adir | Nouveaux derives de la 4h-pyrrolo[1,2a] thieno[2,3-f] diazepine[1,4], leur procede de preparation et les compositions pharmaceutiques les renfermant. |
| US5371080A (en) * | 1990-06-22 | 1994-12-06 | Novo Nordisk A/S | Imidazoquinazoline compounds and their use |
| US5276028A (en) * | 1990-06-22 | 1994-01-04 | Nordisk A/S | Imidazoquinoxaline compounds |
| TW201311B (enExample) * | 1991-06-17 | 1993-03-01 | Hoffmann La Roche | |
| US5250679A (en) * | 1991-10-18 | 1993-10-05 | Genentech, Inc. | Nonpeptidyl platelet aggregation inhibitors having specificity for the GPIIb III.sub. receptor |
| US5663166A (en) * | 1991-10-18 | 1997-09-02 | Genentech, Inc. | Nonpeptidyl integrin inhibitors having specificity for the GPIIb IIIa receptor |
| US5438035A (en) * | 1994-06-24 | 1995-08-01 | American Cyanamid Company | Methods for controlling undesirable plant species with benzodiazepine compounds |
| TW349100B (en) * | 1994-11-11 | 1999-01-01 | Hoffmann La Roche | Oxazolyl- and thiazolylimidazo-benzo- and thienodiazepines |
| US5670640A (en) * | 1996-02-02 | 1997-09-23 | Hoffmann-La Roche Inc. | Process for the manufacture of imidazodiazepine derivatives |
| GB2328940B (en) * | 1997-09-05 | 1999-12-08 | Dong Kook Pharm Co Ltd | A process for preparing benzodiazepine derivatives |
| WO2005060968A1 (en) | 2003-12-11 | 2005-07-07 | Sepracor Inc. | Combination of a sedative and a neurotransmitter modulator, and methods for improving sleep quality and treating depression |
| DE602005008633D1 (de) | 2004-10-12 | 2008-09-11 | Hoffmann La Roche | Imidazoä1,5aütriazoloä1,5dübenzodiazepin-derivative zur behandlung kognitiver störungen |
| JP4783375B2 (ja) | 2004-10-20 | 2011-09-28 | エフ.ホフマン−ラ ロシュ アーゲー | イミダゾベンゾジゼピン誘導体 |
| MX2007004640A (es) | 2004-10-20 | 2007-06-08 | Hoffmann La Roche | Derivados de benzodiazepina sustituidos con halogeno. |
| ES2307230T3 (es) | 2004-12-14 | 2008-11-16 | F. Hoffmann-La Roche Ag | Imidazo-benzodiacepinas tetraciclicas como moduladores de los receptores gaba. |
| EP1888594A2 (en) * | 2005-05-16 | 2008-02-20 | Wisys Technology Foundation, Inc. | Gabaergic agents to treat memory deficits |
| JP2009506069A (ja) | 2005-08-26 | 2009-02-12 | ブレインセルス,インコーポレイティド | ムスカリン性受容体調節による神経発生 |
| EP2258359A3 (en) | 2005-08-26 | 2011-04-06 | Braincells, Inc. | Neurogenesis by muscarinic receptor modulation with sabcomelin |
| US7985756B2 (en) | 2005-10-21 | 2011-07-26 | Braincells Inc. | Modulation of neurogenesis by PDE inhibition |
| WO2007053596A1 (en) | 2005-10-31 | 2007-05-10 | Braincells, Inc. | Gaba receptor mediated modulation of neurogenesis |
| CA2643199A1 (en) * | 2006-03-08 | 2007-09-13 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| US20100216734A1 (en) * | 2006-03-08 | 2010-08-26 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| WO2007134077A2 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| WO2007134136A2 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | Neurogenesis by modulating angiotensin |
| US20100009983A1 (en) * | 2006-05-09 | 2010-01-14 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| EP2068872A1 (en) * | 2006-09-08 | 2009-06-17 | Braincells, Inc. | Combinations containing a 4-acylaminopyridine derivative |
| EP2066355A2 (en) * | 2006-09-19 | 2009-06-10 | Braincells, Inc. | Combination comprising a peroxisome proliferator activated receptor agent and a second neurogenic agent for treating a nervous system disorder, increasing neurodifferentiation and increasing neurogenesis |
| US20090054412A1 (en) * | 2007-08-20 | 2009-02-26 | John Alan Kemp | Treatment of Sleep Disorders |
| US20100234359A1 (en) * | 2007-08-20 | 2010-09-16 | Evotec Neurosciences Gmbh | Treatment of sleep disorders |
| US20090270373A1 (en) * | 2008-04-11 | 2009-10-29 | Cypress Biosciences, Inc. | Treatment of down syndrom with benzodiazepine receptor antagonists |
| WO2010099217A1 (en) | 2009-02-25 | 2010-09-02 | Braincells, Inc. | Modulation of neurogenesis using d-cycloserine combinations |
| GB0917612D0 (en) * | 2009-10-08 | 2009-11-25 | Ge Healthcare Ltd | In vivo imaging agents |
| WO2012114342A1 (en) | 2011-02-23 | 2012-08-30 | Coeruleus Ltd. | Flumazenil complexes, compositions comprising same and uses thereof |
| CN102267999B (zh) * | 2011-07-15 | 2013-05-29 | 海南美兰史克制药有限公司 | 一种氟马西尼化合物及其制法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3933794A (en) * | 1971-08-04 | 1976-01-20 | The Upjohn Company | 2-(2-Alkynylamino)-3H-1,4-benzodiazepines |
| US4031079A (en) * | 1975-09-22 | 1977-06-21 | Mcneil Laboratories, Incorporated | Intermediates for 2-aminobenzodiazepine-5-ones |
| US4002610A (en) * | 1975-09-22 | 1977-01-11 | Mcneil Laboratories, Incorporated | 2-Aminobenzodiazepine-5-ones |
| US4118386A (en) * | 1977-04-04 | 1978-10-03 | Hoffmann-La Roche Inc. | Synthesis of imidazo[1,5-a]diazepine-3-carboxylates |
| ZA806016B (en) * | 1979-10-04 | 1981-09-30 | Hoffmann La Roche | Imidazodiazepine derivatives |
| CA1143728A (en) * | 1979-10-04 | 1983-03-29 | Max Gerecke | Imidazodiazepine derivatives |
| JPH089074B2 (ja) * | 1987-07-02 | 1996-01-31 | 株式会社アマダ | タレツトパンチプレス |
-
1980
- 1980-09-10 CA CA000360028A patent/CA1143728A/en not_active Expired
- 1980-09-15 DK DK391280A patent/DK168094B1/da not_active IP Right Cessation
- 1980-09-19 ZW ZW215/80A patent/ZW21580A1/xx unknown
- 1980-09-26 NZ NZ195071A patent/NZ195071A/en unknown
- 1980-09-29 AU AU62782/80A patent/AU533641B2/en not_active Expired
- 1980-09-29 IL IL61160A patent/IL61160A/xx not_active IP Right Cessation
- 1980-09-30 PH PH24651A patent/PH16607A/en unknown
- 1980-10-01 HU HU802390A patent/HU182675B/hu unknown
- 1980-10-02 MC MC801474A patent/MC1355A1/fr unknown
- 1980-10-02 EP EP80105970A patent/EP0027214B1/de not_active Expired
- 1980-10-02 DE DE8080105970T patent/DE3067868D1/de not_active Expired
- 1980-10-02 FI FI803135A patent/FI73683C/fi not_active IP Right Cessation
- 1980-10-02 GR GR63031A patent/GR70772B/el unknown
- 1980-10-03 IE IE2056/80A patent/IE50318B1/en not_active IP Right Cessation
- 1980-10-03 AR AR282769A patent/AR227293A1/es active
- 1980-10-03 GB GB8031902A patent/GB2060632B/en not_active Expired
- 1980-10-03 NO NO802946A patent/NO155774C/no unknown
- 1980-10-03 BR BR8006404A patent/BR8006404A/pt unknown
- 1980-10-03 US US06/193,775 patent/US4316839A/en not_active Expired - Lifetime
- 1980-10-03 PT PT71874A patent/PT71874B/pt unknown
-
1981
- 1981-11-16 US US06/321,492 patent/US4346031A/en not_active Expired - Lifetime
- 1981-11-16 US US06/321,821 patent/US4346033A/en not_active Expired - Lifetime
- 1981-11-16 US US06/322,091 patent/US4363762A/en not_active Expired - Lifetime
- 1981-11-16 US US06/322,113 patent/US4346036A/en not_active Expired - Lifetime
- 1981-11-16 US US06/321,491 patent/US4346030A/en not_active Expired - Lifetime
- 1981-11-16 US US06/321,519 patent/US4346032A/en not_active Expired - Lifetime
- 1981-11-16 US US06/321,941 patent/US4346034A/en not_active Expired - Lifetime
- 1981-11-16 US US06/321,942 patent/US4359420A/en not_active Expired - Lifetime
- 1981-11-16 US US06/322,031 patent/US4346035A/en not_active Expired - Lifetime
-
1988
- 1988-10-25 JP JP63267347A patent/JPH01156968A/ja active Granted
-
1993
- 1993-06-09 LU LU88298C patent/LU88298I2/fr unknown
- 1993-06-11 NL NL930056C patent/NL930056I2/nl unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4346030A (en) | Imidazodiazepine derivatives | |
| US4386028A (en) | Imidazo[1,5a][1,4]benzodiazepines | |
| US4280957A (en) | Imidazodiazepines and processes therefor | |
| JPH085895B2 (ja) | 新規ヘトラゼピンおよびその製法 | |
| IE41844B1 (en) | Imidazo diazepine derivatives and pharmaceutical compositions containing them | |
| HU185089B (en) | Process for producing imidazo-diazepine derivatives | |
| HU182213B (en) | Process for preparing new pyrazolo-benzodiazepine compounds | |
| US4401597A (en) | Imidazodiazepines and processes therefor | |
| US4440685A (en) | Imidazodiazepines and processes therefor | |
| US4347364A (en) | Imidazodiazepines | |
| JPS6411028B2 (enExample) | ||
| US4347365A (en) | Imidazodiazepines | |
| US4377523A (en) | Imidazodiazepines and processes therefor | |
| US4368159A (en) | Intermediates to produce imidazodiazepines | |
| US4368157A (en) | Intermediates to produce imidazodiazepines | |
| US4349477A (en) | Process for producing imidazodiazepines | |
| US3867370A (en) | 2-LOWER ALKYSULFONYL-1H-1,4-benzodiazepines | |
| US4349475A (en) | Process for producing imidazodiazepines | |
| US3868363A (en) | 1H-5-phenyl-1,4-benzodiazepines | |
| US4368158A (en) | Intermediates to produce imidazodiazepines | |
| US4390471A (en) | Imidazodiazepines and processes therefor | |
| US4376074A (en) | Imidazodiazepines and processes therefor | |
| US4371468A (en) | Intermediates to produce imidazodiazepines | |
| US4425272A (en) | Imidazodiazepines and processes therefor | |
| US4376075A (en) | Process for producing imidazodiazepines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |