HU179966B - Process for preparing 3-exomethylene-cefem-sulphoxide derivatives from 6-acylamido-penam-sulphoxides - Google Patents
Process for preparing 3-exomethylene-cefem-sulphoxide derivatives from 6-acylamido-penam-sulphoxides Download PDFInfo
- Publication number
- HU179966B HU179966B HU77EI747A HUEI000747A HU179966B HU 179966 B HU179966 B HU 179966B HU 77EI747 A HU77EI747 A HU 77EI747A HU EI000747 A HUEI000747 A HU EI000747A HU 179966 B HU179966 B HU 179966B
- Authority
- HU
- Hungary
- Prior art keywords
- reaction
- mixture
- reaction mixture
- chloro
- chloride
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 7
- 238000000034 method Methods 0.000 claims abstract description 46
- -1 sulfoxide ester Chemical class 0.000 claims abstract description 36
- 230000008569 process Effects 0.000 claims abstract description 33
- 238000002360 preparation method Methods 0.000 claims abstract description 25
- 230000002140 halogenating effect Effects 0.000 claims abstract description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 117
- 238000006243 chemical reaction Methods 0.000 claims description 67
- 239000011541 reaction mixture Substances 0.000 claims description 59
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 46
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 40
- 239000000292 calcium oxide Substances 0.000 claims description 40
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 40
- 239000000203 mixture Substances 0.000 claims description 40
- 239000002904 solvent Substances 0.000 claims description 29
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- WDRFYIPWHMGQPN-UHFFFAOYSA-N 2-chloroisoindole-1,3-dione Chemical group C1=CC=C2C(=O)N(Cl)C(=O)C2=C1 WDRFYIPWHMGQPN-UHFFFAOYSA-N 0.000 claims description 20
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 19
- 239000007858 starting material Substances 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 14
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 12
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical group ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 239000002198 insoluble material Substances 0.000 claims description 3
- 239000012320 chlorinating reagent Substances 0.000 claims description 2
- 238000005660 chlorination reaction Methods 0.000 claims 2
- 239000000543 intermediate Substances 0.000 abstract description 10
- 229930182555 Penicillin Natural products 0.000 abstract description 9
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 abstract description 9
- 229940049954 penicillin Drugs 0.000 abstract description 8
- 150000001875 compounds Chemical class 0.000 description 32
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical class N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 description 16
- 239000000463 material Substances 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- 238000006798 ring closing metathesis reaction Methods 0.000 description 12
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- WNMFNGGUHIIQJE-BEZSAJEZSA-N (4-nitrophenyl)methyl (5r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(C(S2=O)(C)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)COC1=CC=CC=C1 WNMFNGGUHIIQJE-BEZSAJEZSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 7
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 6
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 6
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 230000032050 esterification Effects 0.000 description 6
- 238000005886 esterification reaction Methods 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 150000002118 epoxides Chemical class 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 150000003462 sulfoxides Chemical class 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- HBKWKOGDTHDLLR-IUAJRMLHSA-N (4-nitrophenyl)methyl (6r)-3-methylidene-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]octane-2-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)C1C(=C)CS(=O)[C@H]2N1C(=O)C2NC(=O)COC1=CC=CC=C1 HBKWKOGDTHDLLR-IUAJRMLHSA-N 0.000 description 3
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 3
- KDXFMMHNGFNJFA-UHFFFAOYSA-N 4-oxoazetidine-2-sulfinyl chloride Chemical compound ClS(=O)C1CC(=O)N1 KDXFMMHNGFNJFA-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- ZUBXPSDFPQTKQN-ZCFIWIBFSA-N (6r)-3-hydroxy-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC(O)=CN2C(=O)C[C@H]21 ZUBXPSDFPQTKQN-ZCFIWIBFSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229930195708 Penicillin V Natural products 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- ZRRLCCCOCSDAKF-UHFFFAOYSA-N azetidin-2-one thionyl dichloride Chemical compound ClS(Cl)=O.O=C1CCN1 ZRRLCCCOCSDAKF-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 150000001781 cephams Chemical class 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- ICDQOGMPYSAZFB-UHFFFAOYSA-N ethyl n-chlorocarbamate Chemical class CCOC(=O)NCl ICDQOGMPYSAZFB-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 229940056367 penicillin v Drugs 0.000 description 2
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- LDSFHWZIWJYFQI-CCIXAMRTSA-N (4-nitrophenyl)methyl (5r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(C(S2=O)(C)C)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)NC(=O)CC1=CC=CC=C1 LDSFHWZIWJYFQI-CCIXAMRTSA-N 0.000 description 1
- HDJANSGQJOAJSX-SSDOTTSWSA-N (6r)-3-methoxy-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical class S1CC(OC)=CN2C(=O)C[C@H]21 HDJANSGQJOAJSX-SSDOTTSWSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- WEBVTPPSMMFBQU-UHFFFAOYSA-N 1,1-dibromo-2-chloroethane Chemical compound ClCC(Br)Br WEBVTPPSMMFBQU-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- SCEKDQTVGHRSNS-UHFFFAOYSA-N 1,3,5-trimethyl-2-nitrobenzene Chemical group CC1=CC(C)=C([N+]([O-])=O)C(C)=C1 SCEKDQTVGHRSNS-UHFFFAOYSA-N 0.000 description 1
- MDBJCGQXJIHVHH-UHFFFAOYSA-N 1,3-dichloro-1,3-dicyclohexylurea Chemical compound C1CCCCC1N(Cl)C(=O)N(Cl)C1CCCCC1 MDBJCGQXJIHVHH-UHFFFAOYSA-N 0.000 description 1
- FNCSJAFFQNJYRQ-UHFFFAOYSA-N 1,3-dichloro-1-(3-chlorophenyl)-3-methylurea Chemical compound CN(Cl)C(=O)N(Cl)C1=CC=CC(Cl)=C1 FNCSJAFFQNJYRQ-UHFFFAOYSA-N 0.000 description 1
- MJBAWHUBZXMVOC-UHFFFAOYSA-N 1,3-dichloro-1-(4-methylphenyl)-3-propan-2-ylurea Chemical compound CC(C)N(Cl)C(=O)N(Cl)C1=CC=C(C)C=C1 MJBAWHUBZXMVOC-UHFFFAOYSA-N 0.000 description 1
- HGUWAJIBWQYNAV-UHFFFAOYSA-N 1,3-dichloro-1-(4-methylphenyl)urea Chemical compound CC1=CC=C(N(Cl)C(=O)NCl)C=C1 HGUWAJIBWQYNAV-UHFFFAOYSA-N 0.000 description 1
- DZVQYJTYQVGELN-UHFFFAOYSA-N 1,3-dichloro-1-cyclohexyl-3-(4-nitrophenyl)urea Chemical compound C1=CC([N+](=O)[O-])=CC=C1N(Cl)C(=O)N(Cl)C1CCCCC1 DZVQYJTYQVGELN-UHFFFAOYSA-N 0.000 description 1
- PGAJRUFQINAARK-UHFFFAOYSA-N 1,3-dichloro-1-cyclohexyl-3-ethylurea Chemical compound CCN(Cl)C(=O)N(Cl)C1CCCCC1 PGAJRUFQINAARK-UHFFFAOYSA-N 0.000 description 1
- GOVGRIDEZYYAEV-UHFFFAOYSA-N 1,3-dichloro-1-methylurea Chemical compound CN(Cl)C(=O)NCl GOVGRIDEZYYAEV-UHFFFAOYSA-N 0.000 description 1
- TUQCXXYUMOIHKA-UHFFFAOYSA-N 1,3-dichloro-1-phenylurea Chemical compound ClNC(=O)N(Cl)C1=CC=CC=C1 TUQCXXYUMOIHKA-UHFFFAOYSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- ADFIFDHDLIZVFW-UHFFFAOYSA-N 1-chloropiperidine-2,6-dione Chemical compound ClN1C(=O)CCCC1=O ADFIFDHDLIZVFW-UHFFFAOYSA-N 0.000 description 1
- IMUCGPSOMHEPED-LVMGPCFASA-N 2,2,2-trichloroethyl (5r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(C(S2=O)(C)C)C(=O)OCC(Cl)(Cl)Cl)NC(=O)COC1=CC=CC=C1 IMUCGPSOMHEPED-LVMGPCFASA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ZMPRRFPMMJQXPP-UHFFFAOYSA-N 2-sulfobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1S(O)(=O)=O ZMPRRFPMMJQXPP-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- OURSFPZPOXNNKX-UHFFFAOYSA-N 3-sulfopropanoic acid Chemical compound OC(=O)CCS(O)(=O)=O OURSFPZPOXNNKX-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- APOAEMIYHVGWEZ-UHFFFAOYSA-N 4-chloroisoindole-1,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)NC2=O APOAEMIYHVGWEZ-UHFFFAOYSA-N 0.000 description 1
- 239000005997 Calcium carbide Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- WHTNHYRHHHFFBV-UHFFFAOYSA-N ClNS(=O)=O Chemical class ClNS(=O)=O WHTNHYRHHHFFBV-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 208000034693 Laceration Diseases 0.000 description 1
- NXTVQNIVUKXOIL-UHFFFAOYSA-N N-chlorotoluene-p-sulfonamide Chemical compound CC1=CC=C(S(=O)(=O)NCl)C=C1 NXTVQNIVUKXOIL-UHFFFAOYSA-N 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006244 carboxylic acid protecting group Chemical group 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- LQRWQRNSWOFFML-UHFFFAOYSA-N chloro-[(3-chlorophenyl)methyl]carbamic acid Chemical compound C1=CC(=CC(=C1)Cl)CN(C(=O)O)Cl LQRWQRNSWOFFML-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- NLVXFGVZNJMFDC-UHFFFAOYSA-N cyclohexyl n,n-dichlorocarbamate Chemical compound ClN(Cl)C(=O)OC1CCCCC1 NLVXFGVZNJMFDC-UHFFFAOYSA-N 0.000 description 1
- UJUFCZFKGZMCDF-UHFFFAOYSA-N cyclohexyl n-chloro-n-cyclohexylcarbamate Chemical compound C1CCCCC1OC(=O)N(Cl)C1CCCCC1 UJUFCZFKGZMCDF-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- PCGGNOFZZFFFLU-UHFFFAOYSA-N ethyl n,n-dichlorocarbamate Chemical compound CCOC(=O)N(Cl)Cl PCGGNOFZZFFFLU-UHFFFAOYSA-N 0.000 description 1
- CDPVPXHQPQQRFB-UHFFFAOYSA-N ethyl n-chloro-n-cyclohexylcarbamate Chemical compound CCOC(=O)N(Cl)C1CCCCC1 CDPVPXHQPQQRFB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- HXSLDKNUBFXDRG-UHFFFAOYSA-N methyl n,n-dichlorocarbamate Chemical compound COC(=O)N(Cl)Cl HXSLDKNUBFXDRG-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- APZTZCAKUURTTG-UHFFFAOYSA-N n,3-dichloro-n-methylbenzenesulfonamide Chemical compound CN(Cl)S(=O)(=O)C1=CC=CC(Cl)=C1 APZTZCAKUURTTG-UHFFFAOYSA-N 0.000 description 1
- KZYWTQNZACMDPS-UHFFFAOYSA-N n,4-dichlorobenzamide Chemical compound ClNC(=O)C1=CC=C(Cl)C=C1 KZYWTQNZACMDPS-UHFFFAOYSA-N 0.000 description 1
- ARGDYOIRHYLIMT-UHFFFAOYSA-N n,n-dichloro-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(Cl)Cl)C=C1 ARGDYOIRHYLIMT-UHFFFAOYSA-N 0.000 description 1
- ROVVHEKSEBLOOM-UHFFFAOYSA-N n,n-dichloroacetamide Chemical compound CC(=O)N(Cl)Cl ROVVHEKSEBLOOM-UHFFFAOYSA-N 0.000 description 1
- DGRUXRBLCZEODA-UHFFFAOYSA-N n,n-dichlorocyclohexanesulfonamide Chemical compound ClN(Cl)S(=O)(=O)C1CCCCC1 DGRUXRBLCZEODA-UHFFFAOYSA-N 0.000 description 1
- GAWNGUCWYPXWOA-UHFFFAOYSA-N n,n-dichloromethanesulfonamide Chemical compound CS(=O)(=O)N(Cl)Cl GAWNGUCWYPXWOA-UHFFFAOYSA-N 0.000 description 1
- DHHIKEVWSRQXQP-UHFFFAOYSA-N n-chloro-4-methylbenzamide Chemical compound CC1=CC=C(C(=O)NCl)C=C1 DHHIKEVWSRQXQP-UHFFFAOYSA-N 0.000 description 1
- DTMXHYUPALBXFG-UHFFFAOYSA-N n-chloro-n,4-dimethylbenzenesulfonamide Chemical compound CN(Cl)S(=O)(=O)C1=CC=C(C)C=C1 DTMXHYUPALBXFG-UHFFFAOYSA-N 0.000 description 1
- PMXQDTBJZLOVSV-UHFFFAOYSA-N n-chloro-n-cyclohexylacetamide Chemical compound CC(=O)N(Cl)C1CCCCC1 PMXQDTBJZLOVSV-UHFFFAOYSA-N 0.000 description 1
- RWVOAAWFMJRINI-UHFFFAOYSA-N n-chloro-n-cyclohexylbenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(Cl)C1CCCCC1 RWVOAAWFMJRINI-UHFFFAOYSA-N 0.000 description 1
- YTYAPSXIGOPIOH-UHFFFAOYSA-N n-chloro-n-cyclohexylcyclohexanesulfonamide Chemical compound C1CCCCC1S(=O)(=O)N(Cl)C1CCCCC1 YTYAPSXIGOPIOH-UHFFFAOYSA-N 0.000 description 1
- YEXVRBUZIOSARW-UHFFFAOYSA-N n-chloro-n-cyclohexylethanesulfonamide Chemical compound CCS(=O)(=O)N(Cl)C1CCCCC1 YEXVRBUZIOSARW-UHFFFAOYSA-N 0.000 description 1
- FGJCTKGHKMARPX-UHFFFAOYSA-N n-chloro-n-ethyl-3-nitrobenzenesulfonamide Chemical compound CCN(Cl)S(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 FGJCTKGHKMARPX-UHFFFAOYSA-N 0.000 description 1
- XPTJWKPOBFHDHX-UHFFFAOYSA-N n-chloro-n-ethylbenzamide Chemical compound CCN(Cl)C(=O)C1=CC=CC=C1 XPTJWKPOBFHDHX-UHFFFAOYSA-N 0.000 description 1
- DQJKBIDVOSQVEV-UHFFFAOYSA-N n-chloro-n-methylacetamide Chemical compound CN(Cl)C(C)=O DQJKBIDVOSQVEV-UHFFFAOYSA-N 0.000 description 1
- WQJHFILPJKSLJW-UHFFFAOYSA-N n-chloro-n-phenylbenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(Cl)C1=CC=CC=C1 WQJHFILPJKSLJW-UHFFFAOYSA-N 0.000 description 1
- RKLUHJIBJTXOQU-UHFFFAOYSA-N n-chloro-n-phenylpropanamide Chemical compound CCC(=O)N(Cl)C1=CC=CC=C1 RKLUHJIBJTXOQU-UHFFFAOYSA-N 0.000 description 1
- UFICRBPXWFJZFC-UHFFFAOYSA-N n-chloro-n-propylbenzenesulfonamide Chemical compound CCCN(Cl)S(=O)(=O)C1=CC=CC=C1 UFICRBPXWFJZFC-UHFFFAOYSA-N 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- QQZCYGRKEOWFAG-UHFFFAOYSA-N n-chlorocyclohexanecarboxamide Chemical compound ClNC(=O)C1CCCCC1 QQZCYGRKEOWFAG-UHFFFAOYSA-N 0.000 description 1
- KFKMOYYBYVVHQQ-UHFFFAOYSA-N n-chloromethanesulfonamide Chemical compound CS(=O)(=O)NCl KFKMOYYBYVVHQQ-UHFFFAOYSA-N 0.000 description 1
- UPSNOKIUEULXHF-UHFFFAOYSA-N n-chloropropanamide Chemical compound CCC(=O)NCl UPSNOKIUEULXHF-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- MIFYHUACUWQUKT-GPUHXXMPSA-N penicillin N Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2[C@H](NC(=O)CCC[C@@H](N)C(O)=O)C(=O)N21 MIFYHUACUWQUKT-GPUHXXMPSA-N 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- QRUSAMIBASLVND-UHFFFAOYSA-N phenyl n,n-dichlorocarbamate Chemical compound ClN(Cl)C(=O)OC1=CC=CC=C1 QRUSAMIBASLVND-UHFFFAOYSA-N 0.000 description 1
- WXVSGQIVJIHVKH-UHFFFAOYSA-N phenyl n-chloro-n-phenylcarbamate Chemical compound C=1C=CC=CC=1N(Cl)C(=O)OC1=CC=CC=C1 WXVSGQIVJIHVKH-UHFFFAOYSA-N 0.000 description 1
- LAIWRIKKCCMYIX-UHFFFAOYSA-N phenyl n-chloro-n-propylcarbamate Chemical compound CCCN(Cl)C(=O)OC1=CC=CC=C1 LAIWRIKKCCMYIX-UHFFFAOYSA-N 0.000 description 1
- FJVNNOMOBHNDRT-UHFFFAOYSA-N phenyl n-chlorocarbamate Chemical compound ClNC(=O)OC1=CC=CC=C1 FJVNNOMOBHNDRT-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CLZWAWBPWVRRGI-UHFFFAOYSA-N tert-butyl 2-[2-[2-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-bromophenoxy]ethoxy]-4-methyl-n-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]anilino]acetate Chemical compound CC1=CC=C(N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)C(OCCOC=2C(=CC=C(Br)C=2)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)=C1 CLZWAWBPWVRRGI-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/696,674 US4075203A (en) | 1976-06-16 | 1976-06-16 | Process for preparing a 3-exomethylenecepham sulfoxide from penicillin sulfoxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU179966B true HU179966B (en) | 1983-01-28 |
Family
ID=24798089
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU77EI747A HU179966B (en) | 1976-06-16 | 1977-06-15 | Process for preparing 3-exomethylene-cefem-sulphoxide derivatives from 6-acylamido-penam-sulphoxides |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4075203A (enExample) |
| JP (1) | JPS6043339B2 (enExample) |
| AR (1) | AR219926A1 (enExample) |
| AT (1) | AT352138B (enExample) |
| AU (1) | AU508748B2 (enExample) |
| BE (1) | BE855694A (enExample) |
| CA (1) | CA1083579A (enExample) |
| CH (1) | CH627161A5 (enExample) |
| CS (1) | CS198246B2 (enExample) |
| DD (1) | DD131018A5 (enExample) |
| DE (1) | DE2726394A1 (enExample) |
| DK (1) | DK264577A (enExample) |
| ES (1) | ES459838A1 (enExample) |
| FR (1) | FR2355005A1 (enExample) |
| GB (1) | GB1584105A (enExample) |
| HU (1) | HU179966B (enExample) |
| IE (1) | IE45195B1 (enExample) |
| IL (1) | IL52117A (enExample) |
| NL (1) | NL189609C (enExample) |
| NZ (1) | NZ184136A (enExample) |
| PH (1) | PH13001A (enExample) |
| PL (1) | PL103103B1 (enExample) |
| PT (1) | PT66642B (enExample) |
| RO (1) | RO71066A (enExample) |
| SE (1) | SE438329B (enExample) |
| YU (1) | YU143177A (enExample) |
| ZA (1) | ZA772907B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138553A (en) * | 1976-11-11 | 1979-02-06 | Teijin Limited | 3-Methylene cephalosporanic acid derivatives and process for preparation thereof |
| US4159272A (en) * | 1977-09-01 | 1979-06-26 | Eli Lilly And Company | Process for 2-chlorosulfinylazetidin-4-ones |
| US4289695A (en) * | 1978-11-13 | 1981-09-15 | Eli Lilly And Company | Process for preparing 2-chlorosulfinylazetidinones |
| US5126446A (en) * | 1991-01-04 | 1992-06-30 | Eli Lilly And Company | Process for 3-exomethylenecepham sulfoxide esters |
| US5350845A (en) * | 1992-04-08 | 1994-09-27 | Eli Lilly And Company | Process for preparing 7-substituted-amino-3-hydroxy-3-cephem-4-protected carboxy-sulfoxide esters |
| US5347000A (en) * | 1992-11-05 | 1994-09-13 | Ranbaxy Laboratories Ltd. | Process for the preparation of 2-chlorosulfinylazetidinone |
| US5604222A (en) * | 1993-12-27 | 1997-02-18 | Lupin Laboratories, Ltd. | Method for the preparation of 2-chloro sulfinyl azetidinones |
| US5578721A (en) * | 1994-07-11 | 1996-11-26 | Lupin Laboratories Limited | Process for preparation of 3-exomethylene cepham sulfoxide esters |
| US6116362A (en) * | 1998-07-09 | 2000-09-12 | Case Corporation | Articulated vehicle |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS551272B2 (enExample) * | 1972-04-14 | 1980-01-12 | ||
| US3843682A (en) * | 1972-05-15 | 1974-10-22 | Lilly Co Eli | 2-chlorosulfinyl-3-imido-azetedin-4-ones |
| GB1442785A (en) * | 1972-12-09 | 1976-07-14 | Nikken Chemicals Co Ltd | Desacetoxy ceaphalosporanic acids |
| NL7411505A (nl) * | 1973-09-06 | 1975-03-10 | Rhone Poulenc Sa | Werkwijze voor de bereiding en toepassing van nieuwe 7-trichlooraceetamido-3-desacetoxy-cefa- losporanzuurpreparaten. |
| CA1069126A (en) * | 1974-12-24 | 1980-01-01 | Eli Lilly And Company | Sulfinyl halides and their preparation from penicillin sulfoxides |
-
1976
- 1976-06-16 US US05/696,674 patent/US4075203A/en not_active Expired - Lifetime
-
1977
- 1977-05-13 CA CA278,389A patent/CA1083579A/en not_active Expired
- 1977-05-16 ZA ZA00772907A patent/ZA772907B/xx unknown
- 1977-05-16 IE IE996/77A patent/IE45195B1/en not_active IP Right Cessation
- 1977-05-18 IL IL52117A patent/IL52117A/xx unknown
- 1977-05-18 NZ NZ184136A patent/NZ184136A/xx unknown
- 1977-05-24 AU AU25427/77A patent/AU508748B2/en not_active Expired
- 1977-06-06 PT PT66642A patent/PT66642B/pt unknown
- 1977-06-09 GB GB24262/77A patent/GB1584105A/en not_active Expired
- 1977-06-09 YU YU01431/77A patent/YU143177A/xx unknown
- 1977-06-10 PH PH19871A patent/PH13001A/en unknown
- 1977-06-10 DE DE19772726394 patent/DE2726394A1/de active Granted
- 1977-06-15 NL NLAANVRAGE7706604,A patent/NL189609C/xx not_active IP Right Cessation
- 1977-06-15 RO RO7790694A patent/RO71066A/ro unknown
- 1977-06-15 PL PL1977198878A patent/PL103103B1/pl unknown
- 1977-06-15 JP JP52071548A patent/JPS6043339B2/ja not_active Expired
- 1977-06-15 SE SE7706948A patent/SE438329B/xx not_active IP Right Cessation
- 1977-06-15 CH CH737877A patent/CH627161A5/de not_active IP Right Cessation
- 1977-06-15 HU HU77EI747A patent/HU179966B/hu unknown
- 1977-06-15 BE BE1008193A patent/BE855694A/xx not_active IP Right Cessation
- 1977-06-15 AT AT423777A patent/AT352138B/de not_active IP Right Cessation
- 1977-06-15 AR AR268068A patent/AR219926A1/es active
- 1977-06-15 CS CS773959A patent/CS198246B2/cs unknown
- 1977-06-15 DK DK264577A patent/DK264577A/da not_active Application Discontinuation
- 1977-06-16 FR FR7718551A patent/FR2355005A1/fr active Granted
- 1977-06-16 ES ES459838A patent/ES459838A1/es not_active Expired
- 1977-06-16 DD DD7700199521A patent/DD131018A5/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU179966B (en) | Process for preparing 3-exomethylene-cefem-sulphoxide derivatives from 6-acylamido-penam-sulphoxides | |
| JPS5851951B2 (ja) | ペニシリンスルホキサイドカラノ スルフイニルハライドノセイホウ | |
| US4122262A (en) | Intermediates and methods for preparing 7-acylamino-8-oxo-oxa-1-azabicyclo[4.2.0]octane-2-carboxylic acid derivatives | |
| EP0018546B1 (en) | Process for the production of phenylglycyl chloride hydrochlorides | |
| US4122086A (en) | Isopenicillins | |
| PL126949B1 (en) | Method of obtaining new derivatives of 1,1-penane dioxide | |
| Murphy et al. | Chemistry of cephlosporin antibiotics. XVIII. Synthesis of 7-acyl-3-methyl-2-cephem-4-carboxylic acid esters | |
| US4000154A (en) | 3-Substituted-6β-(amino- and acylamino)-7-oxo-1,3-diazabicyclo[3.2.0]-h | |
| US4281117A (en) | Process for 3-chloro cephalosporin nucleus | |
| GB2179348A (en) | Process for the preparation of 6-D-( alpha )-(4-ethyl-2,3-dioxo-1 1-piperazinylcarbonylamin)- alpha -phenylacetamido- penicillanic acid | |
| DE2429166A1 (de) | Verfahren zur selektiven spaltung der amidsaeurefunktion eines 7-(amidsaeure)cephalosporins | |
| US4165316A (en) | Process for preparing sulfinyl chlorides from penicillin sulfoxides | |
| EP0122002B1 (en) | Process for preparing azetidinone derivatives | |
| JPS6048936A (ja) | 酸への脱エステル化方法 | |
| IE42380B1 (en) | Deacetoxycephalosporins via penicillin sulfoxide rearrangement | |
| EP0081824B1 (en) | Processes for the production of antibiotic 1-oxadethiacephalosporins | |
| IE44230B1 (en) | 1,3-diaza-bicyclo/3,2,0/ heptane derivatives | |
| US4187375A (en) | Process for preparing oxazine ring compounds | |
| HU211101B (en) | Process for preparing 1-[/2s/-methyl-3-mercapto-propionyl]-pyrrolidine-/2s/-carboxylic acid | |
| US4301072A (en) | Process for preparing aminopenicillins | |
| JPH0327354A (ja) | 3―エキソメチレンセファムスルホキシド誘導体及びその中間体の製造方法 | |
| KR800000412B1 (ko) | 세팔로스포린 에스텔의 제조방법 | |
| JP2604794B2 (ja) | 4−アセトキシ−3−ヒドロキシエチルアゼチジン−2−オンの製造法 | |
| US4231954A (en) | Dane salt and process for preparing aminopenicillins therefrom | |
| JPH0553788B2 (enExample) |