HU178203B - Process for producing sulfonamido-pyridine derivatives - Google Patents
Process for producing sulfonamido-pyridine derivatives Download PDFInfo
- Publication number
- HU178203B HU178203B HU79CI1905A HUCI001905A HU178203B HU 178203 B HU178203 B HU 178203B HU 79CI1905 A HU79CI1905 A HU 79CI1905A HU CI001905 A HUCI001905 A HU CI001905A HU 178203 B HU178203 B HU 178203B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- group
- compound
- alkyl
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 63
- 238000002360 preparation method Methods 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 150000002513 isocyanates Chemical class 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 12
- 239000012948 isocyanate Substances 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 11
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 11
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 159000000000 sodium salts Chemical class 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- 239000002808 molecular sieve Substances 0.000 claims description 5
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000002425 furfuryl group Chemical group C(C1=CC=CO1)* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- JEOCBTLWXWAGJM-UHFFFAOYSA-N n-chlorosulfamoyl chloride Chemical compound ClNS(Cl)(=O)=O JEOCBTLWXWAGJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 claims description 3
- 125000006730 (C2-C5) alkynyl group Chemical group 0.000 claims description 3
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 claims description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 claims description 2
- FMLHTZVGNSACKP-UHFFFAOYSA-N pyridin-2-ylsulfonylurea Chemical compound NC(=O)NS(=O)(=O)C1=CC=CC=N1 FMLHTZVGNSACKP-UHFFFAOYSA-N 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 4
- WZHRJGWXUCLILI-UHFFFAOYSA-N sulfonylcarbamic acid Chemical class OC(=O)N=S(=O)=O WZHRJGWXUCLILI-UHFFFAOYSA-N 0.000 claims 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 125000006545 (C1-C9) alkyl group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000003944 tolyl group Chemical group 0.000 claims 1
- -1 isobromo group Chemical group 0.000 description 61
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- 229910002651 NO3 Inorganic materials 0.000 description 12
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 150000003927 aminopyridines Chemical class 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 230000001882 diuretic effect Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CVYKVSFYZNMXNE-UHFFFAOYSA-N C(C)NC(O)=O.NS(=O)(=O)C=1C(=NC=CC1C1=CC(=CC=C1)C)N Chemical compound C(C)NC(O)=O.NS(=O)(=O)C=1C(=NC=CC1C1=CC(=CC=C1)C)N CVYKVSFYZNMXNE-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 208000004880 Polyuria Diseases 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000002823 nitrates Chemical class 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- DWJMBQYORXLGAE-UHFFFAOYSA-N pyridine-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=N1 DWJMBQYORXLGAE-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FBJMAKKRHJCTDH-UHFFFAOYSA-N 1-[[2-amino-4-(3-methylphenyl)pyridin-3-yl]sulfamoyl]-N-propan-2-ylformamide Chemical compound C(C)(C)NC(=O)S(=O)(=O)NC=1C(=NC=CC1C1=CC(=CC=C1)C)N FBJMAKKRHJCTDH-UHFFFAOYSA-N 0.000 description 1
- FDHRGQIRBRQMPF-UHFFFAOYSA-N 2h-pyridin-1-amine Chemical compound NN1CC=CC=C1 FDHRGQIRBRQMPF-UHFFFAOYSA-N 0.000 description 1
- PDXCOWCINSIDPO-UHFFFAOYSA-N 2h-thiadiazine 1,1-dioxide Chemical compound O=S1(=O)NN=CC=C1 PDXCOWCINSIDPO-UHFFFAOYSA-N 0.000 description 1
- FDWIUWCUNDLRSE-UHFFFAOYSA-N 3-(3-methylphenyl)pyridin-2-amine Chemical compound CC1=CC=CC(C=2C(=NC=CC=2)N)=C1 FDWIUWCUNDLRSE-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- LYBKPDDZTNUNNM-UHFFFAOYSA-N isopropylbenzylamine Chemical compound CC(C)NCC1=CC=CC=C1 LYBKPDDZTNUNNM-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- SCBOHEAYJPFSBZ-UHFFFAOYSA-N n-(diethylamino)carbamoyl chloride Chemical compound CCN(CC)NC(Cl)=O SCBOHEAYJPFSBZ-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- QQJYAXDCMMXECR-UHFFFAOYSA-N piperidine-1-sulfonyl chloride Chemical compound ClS(=O)(=O)N1CCCCC1 QQJYAXDCMMXECR-UHFFFAOYSA-N 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000036325 urinary excretion Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/10—Antioedematous agents; Diuretics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3918/78A GB1593609A (en) | 1978-01-31 | 1978-01-31 | Pyridine sulfonamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU178203B true HU178203B (en) | 1982-03-28 |
Family
ID=9767352
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79CI1905A HU178203B (en) | 1978-01-31 | 1979-01-30 | Process for producing sulfonamido-pyridine derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4244950A (OSRAM) |
| EP (1) | EP0003383B1 (OSRAM) |
| JP (1) | JPS54119477A (OSRAM) |
| AR (2) | AR226154A1 (OSRAM) |
| AT (1) | AT375646B (OSRAM) |
| AU (1) | AU524287B2 (OSRAM) |
| BE (1) | BE873656A (OSRAM) |
| CA (1) | CA1124720A (OSRAM) |
| DD (1) | DD141309A5 (OSRAM) |
| DE (1) | DE2964681D1 (OSRAM) |
| ES (1) | ES476658A1 (OSRAM) |
| FR (1) | FR2416225A1 (OSRAM) |
| GB (1) | GB1593609A (OSRAM) |
| HU (1) | HU178203B (OSRAM) |
| IL (1) | IL56407A (OSRAM) |
| IT (1) | IT1109868B (OSRAM) |
| LU (1) | LU80856A1 (OSRAM) |
| NZ (1) | NZ189376A (OSRAM) |
| PT (1) | PT69147A (OSRAM) |
| ZA (1) | ZA7990B (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4435206A (en) | 1978-12-04 | 1984-03-06 | E. I. Du Pont De Nemours And Company | Agricultural pyridinesulfonamides |
| US4544401A (en) * | 1979-10-22 | 1985-10-01 | E. I. Du Pont De Nemours And Company | Agricultural pyridinesulfonamides |
| US4879249A (en) * | 1983-02-25 | 1989-11-07 | Baldwin Thomas O | Linker compounds, linker-compound-ligands and linker-compound-receptors |
| US4734275A (en) * | 1983-08-19 | 1988-03-29 | Research Corporation | Anti-curare agents |
| DE3529529A1 (de) * | 1985-08-17 | 1987-02-19 | Boehringer Mannheim Gmbh | Verfahren zur herstellung einer stabilen modifikation von torasemid |
| US4914203A (en) * | 1987-07-24 | 1990-04-03 | American Home Products Corporation | 5 step process for preparing certain 2,4-diamino-5-pyrimidine-sulfonyl ureas |
| US4853389A (en) * | 1987-07-24 | 1989-08-01 | American Home Products Corporation | Diuretic and antihypertensive substituted-5-pyrimidinesulfonylureas |
| FR2685917A1 (fr) * | 1992-01-06 | 1993-07-09 | Adir | Nouveau derive de la pyridylsulfonyluree des procedes de preparation et les compositions pharmaceutiques le contenant. |
| US5166162A (en) * | 1990-03-02 | 1992-11-24 | Adir Et Compagnie | Pyridylsulfonylurea and pyridylsulfonylthiourea compounds |
| FR2659080B1 (fr) * | 1990-03-02 | 1994-07-08 | Adir | Nouveaux derives de la pyridylsulfonyluree et de la pyridylsulfonylthiouree, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
| HUP0300241A3 (en) | 2000-03-20 | 2005-11-28 | Teva Pharma | Processes for preparing torsemide intermediate |
| EP1741429A3 (en) * | 2000-03-20 | 2007-01-17 | Teva Pharmaceutical Industries Ltd. | Processes for preparing torsemide |
| DE10027887A1 (de) | 2000-05-31 | 2001-12-13 | Jenapharm Gmbh | Verbindungen mit einer Sulfonamidgruppe und diese Verbindungen enthaltende pharmazeutische Zusammensetzungen |
| AR037097A1 (es) * | 2001-10-05 | 2004-10-20 | Novartis Ag | Compuestos acilsulfonamidas, composiciones farmaceuticas y el uso de dichos compuestos para la preparacion de un medicamento |
| PE20040167A1 (es) * | 2002-03-28 | 2004-05-26 | Novartis Ag | Amidas del acido sulfamico |
| IL149771A0 (en) * | 2002-05-21 | 2002-11-10 | Fintech Lab Ltd | Process for preparation of torsemide |
| US7378527B2 (en) * | 2004-03-16 | 2008-05-27 | Daqing Che | Process for the preparation of torsemide and related intermediates |
| US7534780B2 (en) | 2004-05-21 | 2009-05-19 | Bayer Schering Pharma Aktiengesellschaft | Estradiol prodrugs |
| DE102005057421A1 (de) * | 2005-11-30 | 2007-05-31 | Bayer Schering Pharma Ag | Heteroaromatische Sulfonamid-Prodrugs |
| AR061159A1 (es) | 2007-06-01 | 2008-08-06 | S A Cartocor | Procedimiento de fabricacion de un pallet modular y producto resultante |
| WO2019008029A1 (en) * | 2017-07-07 | 2019-01-10 | Inflazome Limited | SULFONYLURATES AND SULFONYLTHIOURES AS INHIBITORS OF NLRP3 |
| CN114456104B (zh) * | 2022-01-26 | 2023-08-25 | 南京正科医药股份有限公司 | 一种托拉塞米关键中间体的合成方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758749A (fr) * | 1969-11-12 | 1971-05-10 | Ciba Geigy | Procede de preparation de nouveaux acides pyridine-sulfoniques |
| GB1368948A (en) * | 1970-11-11 | 1974-10-02 | Manuf Prod Pharma | Pyridine derivatives |
| GB1414793A (en) * | 1972-07-28 | 1975-11-19 | Manuf Prod Pharma | Derivatives of phenylaminopyridine |
| US3956294A (en) * | 1972-06-22 | 1976-05-11 | Cassella Farbwerke Mainkur Aktiengesellschaft | Substituted pyridine compounds |
| GB1477664A (en) * | 1974-04-17 | 1977-06-22 | Christiaens Sa A | Pyridine derivatives |
-
1978
- 1978-01-31 GB GB3918/78A patent/GB1593609A/en not_active Expired
-
1979
- 1979-01-09 ZA ZA7990A patent/ZA7990B/xx unknown
- 1979-01-09 ES ES476658A patent/ES476658A1/es not_active Expired
- 1979-01-10 IL IL56407A patent/IL56407A/xx unknown
- 1979-01-12 AU AU43317/79A patent/AU524287B2/en not_active Ceased
- 1979-01-15 NZ NZ189376A patent/NZ189376A/xx unknown
- 1979-01-19 CA CA319,934A patent/CA1124720A/en not_active Expired
- 1979-01-22 EP EP79200037A patent/EP0003383B1/fr not_active Expired
- 1979-01-22 DE DE7979200037T patent/DE2964681D1/de not_active Expired
- 1979-01-23 BE BE0/193040A patent/BE873656A/xx unknown
- 1979-01-24 US US06/006,154 patent/US4244950A/en not_active Expired - Lifetime
- 1979-01-25 IT IT19614/79A patent/IT1109868B/it active
- 1979-01-25 AR AR275290A patent/AR226154A1/es active
- 1979-01-26 AT AT0059479A patent/AT375646B/de not_active IP Right Cessation
- 1979-01-26 FR FR7902109A patent/FR2416225A1/fr active Granted
- 1979-01-29 DD DD79210692A patent/DD141309A5/de not_active IP Right Cessation
- 1979-01-29 PT PT7969147A patent/PT69147A/pt unknown
- 1979-01-30 LU LU80856A patent/LU80856A1/fr unknown
- 1979-01-30 JP JP1026079A patent/JPS54119477A/ja active Pending
- 1979-01-30 HU HU79CI1905A patent/HU178203B/hu not_active IP Right Cessation
-
1980
- 1980-05-28 AR AR281219A patent/AR225922A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0003383A3 (en) | 1979-09-05 |
| IL56407A (en) | 1983-05-15 |
| AR225922A1 (es) | 1982-05-14 |
| AT375646B (de) | 1984-08-27 |
| DD141309A5 (de) | 1980-04-23 |
| AU4331779A (en) | 1979-08-09 |
| ZA7990B (en) | 1980-10-29 |
| AR226154A1 (es) | 1982-06-15 |
| BE873656A (fr) | 1979-07-23 |
| IT1109868B (it) | 1985-12-23 |
| IT7919614A0 (it) | 1979-01-25 |
| NZ189376A (en) | 1981-03-16 |
| FR2416225A1 (fr) | 1979-08-31 |
| GB1593609A (en) | 1981-07-22 |
| AU524287B2 (en) | 1982-09-09 |
| ES476658A1 (es) | 1979-07-16 |
| ATA59479A (de) | 1984-01-15 |
| DE2964681D1 (de) | 1983-03-17 |
| FR2416225B1 (OSRAM) | 1981-11-06 |
| EP0003383B1 (fr) | 1983-02-09 |
| CA1124720A (en) | 1982-06-01 |
| PT69147A (en) | 1979-02-01 |
| IL56407A0 (en) | 1979-03-12 |
| US4244950A (en) | 1981-01-13 |
| EP0003383A2 (fr) | 1979-08-08 |
| LU80856A1 (fr) | 1980-08-08 |
| JPS54119477A (en) | 1979-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU178203B (en) | Process for producing sulfonamido-pyridine derivatives | |
| US5183899A (en) | Pyrazole derivative | |
| US3669968A (en) | Trialkoxy quinazolines | |
| KR20040087335A (ko) | 질소 함유 복소환 화합물 | |
| US3971783A (en) | 4-Aminoquinazoline derivatives as cardiac stimulants | |
| ES2239732T3 (es) | Nuevas 4-aminofuropirimidinas y su uso. | |
| US3227713A (en) | Azine derivatives | |
| EP0330242A1 (en) | Pyridazinone derivatives, their preparation and use | |
| JP2000281654A (ja) | イソキノリン誘導体 | |
| US4216216A (en) | Aromatic piperazinyl substituted dihydrouracils | |
| US3280122A (en) | Diphenylalkyloxadiazoles | |
| NO852133L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrrolidinon-derivater. | |
| DK149852B (da) | Analogifremgangsmaade til fremstilling af substituerede 3-aminosydnoniminer eller et farmakologisk acceptabelt syreadditionssalt deraf | |
| EP0401707B1 (en) | Heterocyclic triazin or triazolo compounds having serotonin 2-receptor antagonistic activity | |
| JPH0321553B2 (OSRAM) | ||
| US3432493A (en) | Substituted sulfanilamides | |
| JPS6026115B2 (ja) | オキサジアゾロピリミジン誘導体 | |
| US2979502A (en) | Phenthiazine derivatives | |
| US3166554A (en) | Certificate of correction | |
| US3184460A (en) | 1-(alkoxyphenylalkyl)-2-imidazolinones, -2-imidazolidinones and -2-pyrimidinones | |
| US4268511A (en) | 3-Amino(1H,3H)quinazoline-2,4-dione derivatives and their therapeutic applications | |
| US3426017A (en) | Sulfonylurea compounds | |
| US3234219A (en) | 5-nitro-furyl-(2)-methylidene hydrazides | |
| KR880001105B1 (ko) | 1-벤질-4-[4-(2-피리미디닐아미노)벤질]-2,3-디옥소피페라진 유도체의 제조방법 | |
| EP0364091B1 (en) | Antipsychotic 4-(4-(3-benzisothiazolyl)-1-piperazinyl)butyl bridged bicyclic imides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |