GB803198A - Process and catalyst for polymerisation of polymerizable hydrocarbons - Google Patents
Process and catalyst for polymerisation of polymerizable hydrocarbonsInfo
- Publication number
- GB803198A GB803198A GB37458/56A GB3745856A GB803198A GB 803198 A GB803198 A GB 803198A GB 37458/56 A GB37458/56 A GB 37458/56A GB 3745856 A GB3745856 A GB 3745856A GB 803198 A GB803198 A GB 803198A
- Authority
- GB
- United Kingdom
- Prior art keywords
- tri
- olefines
- chloride
- halide
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title abstract 3
- 229930195733 hydrocarbon Natural products 0.000 title 1
- 150000002430 hydrocarbons Chemical class 0.000 title 1
- -1 alkali metal Chemical class 0.000 abstract 8
- 150000004820 halides Chemical class 0.000 abstract 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 abstract 4
- 229910052783 alkali metal Inorganic materials 0.000 abstract 4
- 150000001340 alkali metals Chemical class 0.000 abstract 4
- 229910052782 aluminium Inorganic materials 0.000 abstract 4
- 125000003118 aryl group Chemical group 0.000 abstract 4
- 229910052790 beryllium Inorganic materials 0.000 abstract 4
- 229910052738 indium Inorganic materials 0.000 abstract 4
- 239000010936 titanium Substances 0.000 abstract 4
- 229910052719 titanium Inorganic materials 0.000 abstract 4
- 229910052726 zirconium Inorganic materials 0.000 abstract 4
- 229910052716 thallium Inorganic materials 0.000 abstract 3
- ATWLRNODAYAMQS-UHFFFAOYSA-N 1,1-dibromopropane Chemical compound CCC(Br)Br ATWLRNODAYAMQS-UHFFFAOYSA-N 0.000 abstract 2
- NPNPZTNLOVBDOC-UHFFFAOYSA-N 1,1-difluoroethane Chemical compound CC(F)F NPNPZTNLOVBDOC-UHFFFAOYSA-N 0.000 abstract 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 abstract 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 2
- 229910010084 LiAlH4 Inorganic materials 0.000 abstract 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 abstract 2
- 125000005234 alkyl aluminium group Chemical group 0.000 abstract 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 abstract 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 abstract 2
- 229940073608 benzyl chloride Drugs 0.000 abstract 2
- 229910001639 beryllium iodide Inorganic materials 0.000 abstract 2
- 229910052793 cadmium Inorganic materials 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 abstract 2
- NDTCXABJQNJPCF-UHFFFAOYSA-N chlorocyclopentane Chemical compound ClC1CCCC1 NDTCXABJQNJPCF-UHFFFAOYSA-N 0.000 abstract 2
- 125000004122 cyclic group Chemical group 0.000 abstract 2
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 abstract 2
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 abstract 2
- 229910052733 gallium Inorganic materials 0.000 abstract 2
- 229910052732 germanium Inorganic materials 0.000 abstract 2
- 229910052735 hafnium Inorganic materials 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical group 0.000 abstract 2
- 150000004678 hydrides Chemical class 0.000 abstract 2
- 239000003701 inert diluent Substances 0.000 abstract 2
- 239000012280 lithium aluminium hydride Substances 0.000 abstract 2
- 229910052749 magnesium Inorganic materials 0.000 abstract 2
- 229910052751 metal Inorganic materials 0.000 abstract 2
- 239000002184 metal Substances 0.000 abstract 2
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 abstract 2
- 125000002524 organometallic group Chemical group 0.000 abstract 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 abstract 2
- 229920000642 polymer Polymers 0.000 abstract 2
- 238000006116 polymerization reaction Methods 0.000 abstract 2
- 239000007858 starting material Substances 0.000 abstract 2
- 239000000126 substance Substances 0.000 abstract 2
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 2
- 229910001868 water Inorganic materials 0.000 abstract 2
- 229910052725 zinc Inorganic materials 0.000 abstract 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 abstract 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 abstract 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 abstract 1
- 150000001993 dienes Chemical class 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 230000000379 polymerizing effect Effects 0.000 abstract 1
- 229910052714 tellurium Inorganic materials 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/04—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US553435A US2832759A (en) | 1955-12-16 | 1955-12-16 | Process and catalyst for production of olefin polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB803198A true GB803198A (en) | 1958-10-22 |
Family
ID=24209383
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB37458/56A Expired GB803198A (en) | 1955-12-16 | 1956-12-07 | Process and catalyst for polymerisation of polymerizable hydrocarbons |
Country Status (8)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0072128A2 (en) | 1981-08-07 | 1983-02-16 | Imperial Chemical Industries Plc | Spraying solid |
Families Citing this family (93)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3058969A (en) * | 1962-10-16 | Three-component metal hydride-transi- | ||
| US3037011A (en) * | 1962-05-29 | Liquids | ||
| US3124561A (en) * | 1964-03-10 | Polymerization initiators for polar | ||
| US3094514A (en) * | 1958-02-13 | 1963-06-18 | Goodrich Gulf Chem Inc | Polymerization process for aliphatic, conjugated dienes |
| NL203326A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-01-05 | |||
| NL111783C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-10-17 | |||
| US2944048A (en) * | 1955-12-30 | 1960-07-05 | Phillips Petroleum Co | Process and catalyst for production of olefin polymers |
| US2969408A (en) * | 1955-12-30 | 1961-01-24 | Phillips Petroleum Co | Process and catalyst for polymerization of olefins |
| US3073810A (en) * | 1956-01-23 | 1963-01-15 | Exxon Research Engineering Co | Method for drying wet solid polymeric material |
| US2913446A (en) * | 1956-02-21 | 1959-11-17 | Exxon Research Engineering Co | Polymerization process |
| NL214695A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-02-24 | |||
| USB632416I5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-03-01 | 1976-03-09 | ||
| BE555478A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-03-05 | |||
| US2919267A (en) * | 1956-03-28 | 1959-12-29 | Standard Oil Co | Polymerization catalysts and processes |
| US3111505A (en) * | 1956-04-04 | 1963-11-19 | Hercules Powder Company Inc | Process for preparing polymers and copolymers of vinyl chloride |
| US2930785A (en) * | 1956-04-05 | 1960-03-29 | Phillips Petroleum Co | Process and catalyst for production of olefin polymers |
| GB827464A (en) * | 1956-05-01 | 1960-02-03 | Distillers Co Yeast Ltd | Polymerisation process |
| US3089866A (en) * | 1956-05-25 | 1963-05-14 | Minnesota Mining & Mfg | Process for the preparation of fluorine-containing polymers |
| US3012000A (en) * | 1956-06-05 | 1961-12-05 | Robert S Aries | Process of making a graft copolymer of butadiene and styrene-allyl methacrylate copolymer |
| US3449307A (en) * | 1956-06-05 | 1969-06-10 | Phillips Petroleum Co | Thermoplastic resins from aryl olefins |
| US2915514A (en) * | 1956-06-07 | 1959-12-01 | Monsanto Chemicals | Polymerization process |
| US3084144A (en) * | 1956-07-02 | 1963-04-02 | Minnesota Mining & Mfg | Process for polymerization of fluorinecontaining organic compounds |
| US2916478A (en) * | 1956-07-09 | 1959-12-08 | Exxon Research Engineering Co | Polymerization process |
| BE559111A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-07-11 | 1900-01-01 | ||
| BE559676A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-07-31 | |||
| US2953555A (en) * | 1956-08-07 | 1960-09-20 | Goodrich Gulf Chem Inc | Solvent separation treatment of olefin hydrocarbon polymers |
| US2991279A (en) * | 1956-08-07 | 1961-07-04 | Goodrich Gulf Chem Inc | Treatment of olefin polymers |
| BE560838A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-09-15 | |||
| US3153634A (en) * | 1956-09-26 | 1964-10-20 | Sun Oil Co | Gamma alumina supported titanium and zirconium subhalides polymerization catalysts and preparation thereof |
| US3020269A (en) * | 1957-01-10 | 1962-02-06 | Union Carbide Corp | Butadiene polymerization |
| NL94678C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-02-02 | |||
| US3284426A (en) * | 1957-03-18 | 1966-11-08 | Hercules Inc | Crystalline poly (vinyl ethers) and preparation thereof |
| US2921933A (en) * | 1957-03-18 | 1960-01-19 | Collier Carbon & Chemical Co | Manufacture of polyethylene |
| BE566971A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-04-23 | |||
| BE567031A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-04-29 | |||
| NL228219A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-06-06 | |||
| NL228220A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-06-06 | |||
| US3085997A (en) * | 1957-07-05 | 1963-04-16 | Union Carbide Corp | Vinyl ether polymerization catalysts |
| US3088939A (en) * | 1957-07-26 | 1963-05-07 | American Cyanamid Co | Method of making a crystallizable polymer with lithium as catalyst |
| US3008944A (en) * | 1957-08-16 | 1961-11-14 | Phillips Petroleum Co | Production of solid polymers of diolefins |
| US3088985A (en) * | 1957-09-02 | 1963-05-07 | Studiengesellschaft Kohle Mbh | New open-chain trimer and the production thereof |
| US3091601A (en) * | 1957-09-20 | 1963-05-28 | Union Carbide Corp | Olefinic copolymers |
| US3193540A (en) * | 1957-09-30 | 1965-07-06 | Hercules Powder Co Ltd | Process of polymerizing methyl methacrylate |
| US2979488A (en) * | 1957-09-30 | 1961-04-11 | Phillips Petroleum Co | Modification of linear rubbery polymers |
| US2996492A (en) * | 1957-10-01 | 1961-08-15 | Exxon Research Engineering Co | Recovery process for high molecular weight polymers |
| US2968652A (en) * | 1957-11-27 | 1961-01-17 | Sun Oil Co | Polymerization process with a catalyst prepared by subjecting ticl3 to ultrasonic vibrations and adding an aluminum alkyl |
| NL137055C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-12-11 | |||
| US3043793A (en) * | 1958-01-08 | 1962-07-10 | Sun Oil Co | Process for lowering the brittle point of solid heptane-insoluble polypropylene |
| NL235439A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-01-27 | |||
| US2951066A (en) * | 1958-03-31 | 1960-08-30 | Eastman Kodak Co | Three-component olefin polymerization catalyst containing an aluminum sesquihalide and a transition metal compound |
| FR1171437A (fr) * | 1958-01-27 | 1959-01-26 | Eastman Kodak Co | Procédé de fabrication de polyoléfines, produits obtenus et catalyseurs pour la mise en oeuvre de ce procédé |
| US2962487A (en) * | 1958-03-31 | 1960-11-29 | Eastman Kodak Co | Three-component aluminum-titanium tetrahalide catalyst for olefin polymerization therewith |
| US2972607A (en) * | 1958-03-31 | 1961-02-21 | Eastman Kodak Co | Four-component mixed metal-halogen catalysts for olefin polymerization |
| US3026309A (en) * | 1958-03-31 | 1962-03-20 | Eastman Kodak Co | Three-component aluminum-titanium tetrahalide catalysts for olefin polymerization |
| US2969346A (en) * | 1958-03-31 | 1961-01-24 | Eastman Kodak Co | Three-component catalyst for polymerizing olefins containing a mixture of metals and a halogen |
| NL235967A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-02-11 | |||
| US3435020A (en) * | 1958-03-07 | 1969-03-25 | Hercules Inc | Crystalline polymers of alpha,omega-diolefins |
| US2976268A (en) * | 1958-03-13 | 1961-03-21 | Du Pont | Polymer of 2, 6-disubstituted heptadiene-1, 6 |
| NL237353A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-03-21 | |||
| US3024225A (en) * | 1958-03-27 | 1962-03-06 | Dow Chemical Co | Polymerization of nu-vinylcarbazole |
| US3008945A (en) * | 1958-04-28 | 1961-11-14 | Goodyear Tire & Rubber | Methods of preparing 1, 4 trans polyisoprene |
| US3014897A (en) * | 1958-04-30 | 1961-12-26 | American Cyanamid Co | Stereospecific polymer and method of preparing |
| US3070587A (en) * | 1958-06-16 | 1962-12-25 | Phillips Petroleum Co | Polymerization of conjugated diolefins in the presence of ticl4 air3 and o2 |
| NL240204A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-06-16 | 1959-06-15 | ||
| US3095406A (en) * | 1958-07-28 | 1963-06-25 | Phillips Petroleum Co | Preparation of polymers of conjugated dienes |
| NL124339C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-08-11 | |||
| US3115526A (en) * | 1958-10-08 | 1963-12-24 | Dal Mon Research Co | Organo-metallo compounds and method of preparation |
| US3049524A (en) * | 1958-10-24 | 1962-08-14 | Sun Oil Co | Polymerization of styrene |
| NL244301A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-11-06 | |||
| BE584201A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-11-06 | |||
| US3131171A (en) * | 1958-11-14 | 1964-04-28 | Monsanto Chemicals | Catalyst for the polymerization of olefins containing the product of a titanium halide and an organoaluminum compound mixed with a lower alkyl halide solution of aluminum chloride |
| US3067188A (en) * | 1959-01-16 | 1962-12-04 | Phillips Petroleum Co | Polymerization of 1, 3-butadiene with a tici-mocl-znr catalyst |
| US3147238A (en) * | 1959-04-27 | 1964-09-01 | Shell Oil Co | Olefin polymerization process |
| US3027359A (en) * | 1959-06-19 | 1962-03-27 | Jurgeleit Hans Wolfgang | Tertiary phosphine polymerization catalysts system |
| US3060989A (en) * | 1959-08-17 | 1962-10-30 | Phillips Petroleum Co | Blends of cis-polybutadiene with either natural rubber or cis-polyisoprene, method of preparing same, and tire tread comprising same |
| US3061599A (en) * | 1959-08-28 | 1962-10-30 | California Research Corp | Catalytic polymerization of alkyl esters of acrylic and methacrylic acids in heterogeneous mixture |
| NL255885A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-09-14 | |||
| US3051692A (en) * | 1960-06-06 | 1962-08-28 | Phillips Petroleum Co | Production of solid olefin polymers |
| US2998416A (en) * | 1960-06-23 | 1961-08-29 | Cities Service Res & Dev Co | Ylide-transition metal compound catalyst system, process of making and method of using |
| US3242155A (en) * | 1960-07-01 | 1966-03-22 | Phillips Petroleum Co | Olefin polymerization catalysts and process |
| NL269012A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1960-09-07 | |||
| US3194799A (en) * | 1960-11-25 | 1965-07-13 | Eastman Kodak Co | Three-component aluminum-titanium tetrahalide catalysts for olefin polymerization |
| US3159613A (en) * | 1960-12-27 | 1964-12-01 | Hercules Powder Co Ltd | Preparation of crystalline poly |
| US3314931A (en) * | 1961-03-06 | 1967-04-18 | Continental Oil Co | Polymerization in non-aqueous systems |
| FR1317871A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1961-04-07 | 1963-05-08 | ||
| US3251901A (en) * | 1961-06-29 | 1966-05-17 | Chevron Res | Preparation of normally liquid higher molecular weight olefins |
| NL285994A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1961-11-30 | |||
| US3222296A (en) * | 1963-07-29 | 1965-12-07 | Cabot Corp | Lewis base stabilization of polymerization catalyst in storage |
| US3341619A (en) * | 1964-04-13 | 1967-09-12 | Exxon Research Engineering Co | Polymerization of cis type ii olefins |
| US4026822A (en) * | 1969-04-29 | 1977-05-31 | Atlantic Richfield Company | Zirconium phosphine complex catalyst |
| US3855341A (en) * | 1969-04-29 | 1974-12-17 | Atlantic Richfield Co | Propylene oligomerization process |
| US4493903A (en) * | 1981-05-12 | 1985-01-15 | Conoco Inc. | Polymerization process for drag reducing substances |
| FR2737210B1 (fr) * | 1995-07-24 | 1997-08-22 | Atochem Elf Sa | Procede de polymerisation de l'ethylene en presence d'un compose phosphore |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA502597A (en) * | 1954-05-18 | W. Larchar Arthur | Polymerization of ethylene at super pressures | |
| US2520601A (en) * | 1947-07-03 | 1950-08-29 | Max M Lee | Polymerization promoters |
| DE973626C (de) * | 1953-11-17 | 1960-04-14 | Karl Dr Dr E H Ziegler | Verfahren zur Herstellung von hochmolekularen Polyaethylenen |
| DE1012460B (de) * | 1953-11-17 | 1957-07-18 | Dr Dr E H Karl Ziegler | Verfahren zur Herstellung von hochmolekularen Polyaethylenen |
| DE1016022B (de) * | 1954-01-19 | 1957-09-19 | Dr Dr E H Karl Ziegler | Verfahren zur Herstellung von hochmolekularen Polyaethylenen |
| US2712189A (en) * | 1954-02-12 | 1955-07-05 | Grossman Ralph Emery | Painting kit |
| CH356913A (de) * | 1954-06-08 | 1961-09-15 | Montedison Spa | Verfahren zur Polymerisation von olefinisch ungesättigten Kohlenwasserstoffen |
-
0
- NL NL96005D patent/NL96005C/xx active
- NL NL213007D patent/NL213007A/xx unknown
- BE BE638937D patent/BE638937A/xx unknown
-
1955
- 1955-12-16 US US553435A patent/US2832759A/en not_active Expired - Lifetime
-
1956
- 1956-12-07 GB GB37458/56A patent/GB803198A/en not_active Expired
- 1956-12-14 FR FR1168164D patent/FR1168164A/fr not_active Expired
- 1956-12-15 DK DK438556AA patent/DK101484C/da active
- 1956-12-15 DE DEP17613A patent/DE1266504B/de active Pending
- 1956-12-17 CH CH4074956A patent/CH366395A/fr unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0072128A2 (en) | 1981-08-07 | 1983-02-16 | Imperial Chemical Industries Plc | Spraying solid |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1266504B (de) | 1968-04-18 |
| US2832759A (en) | 1958-04-29 |
| CH366395A (fr) | 1962-12-31 |
| FR1168164A (fr) | 1958-12-04 |
| NL96005C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| DK101484C (da) | 1965-04-12 |
| NL213007A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| BE638937A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB803198A (en) | Process and catalyst for polymerisation of polymerizable hydrocarbons | |
| GB803779A (en) | Process and catalyst for polymerization of polymerizable hydrocarbons | |
| GB953930A (en) | Process for polymerising vinyl chloride | |
| GB809838A (en) | Improvements in grafting polymers or copolymers | |
| ES231910A1 (es) | UN MÉTODO PARA LA POLIMERIZACIoN CATALiTICA DE HIDROCARBUROS POLIMERIZABLES | |
| GB824374A (en) | Process and catalyst for polymerization of polymerizable hydrocarbons | |
| GB779540A (en) | Improvements in the polymerisation of ethylene | |
| GB891566A (en) | Improvements in the polymerisation of vinyl compounds | |
| GB1112176A (en) | Modified polymers of conjugated dienes | |
| GB1115730A (en) | Method of manufacturing polyethylene | |
| GB827464A (en) | Polymerisation process | |
| GB840497A (en) | Improvements in and relating to the treatment of polymers | |
| GB953689A (en) | Polymerisation of butadiene using monovalent magnesium halide catalysts | |
| SE7705264L (sv) | Forfarande for fordrojning av polymeruppbyggnad i polymerisationsreaktorer | |
| JPS5347486A (en) | Polymerization of vinyl chloride | |
| ES364321A1 (es) | Procedimiento para elevar el peso molecular de un polimero reactivo, derivado en parte por lo menos de un monomero de vinilideno. | |
| GB825882A (en) | Process for producing modified polymers | |
| ES233860A1 (es) | PROCEDIMIENTO PARA LA PREPARACIoN DE UN POLiMERO ISOTáCTICO DE ESTIRENO | |
| GB1313204A (en) | Synthetic paper material and process for producing the same | |
| GB950769A (en) | Process for polymerising vinyl chloride | |
| GB863416A (en) | Process for polymerizing lower olefines | |
| GB937314A (en) | Radioactive polymers | |
| GB845878A (en) | Process for polymerising ethylene with catalysts containing organo-tin compounds | |
| GB801555A (en) | Improvements in or relating to the polymerisation of vinyl-aromatic compounds | |
| ES303297A1 (es) | Procedimiento de preparacion de polimeros de injerto. |