GB1458474A - Water-soluble azo dyestuffs their preparation and use - Google Patents
Water-soluble azo dyestuffs their preparation and useInfo
- Publication number
- GB1458474A GB1458474A GB4501174A GB4501174A GB1458474A GB 1458474 A GB1458474 A GB 1458474A GB 4501174 A GB4501174 A GB 4501174A GB 4501174 A GB4501174 A GB 4501174A GB 1458474 A GB1458474 A GB 1458474A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- dye
- dyes
- prepared
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 abstract 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 abstract 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 abstract 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 abstract 1
- WREXGNDJZBDHPT-UHFFFAOYSA-N 5-naphthalen-1-yl-1h-pyrazol-3-amine Chemical compound N1N=C(N)C=C1C1=CC=CC2=CC=CC=C12 WREXGNDJZBDHPT-UHFFFAOYSA-N 0.000 abstract 1
- ANZOLUQAPGRPSU-UHFFFAOYSA-N C1(=CC=CC2=CC=CC=C12)N1N=CCC1=O Chemical class C1(=CC=CC2=CC=CC=C12)N1N=CCC1=O ANZOLUQAPGRPSU-UHFFFAOYSA-N 0.000 abstract 1
- 229920000742 Cotton Polymers 0.000 abstract 1
- 239000004952 Polyamide Substances 0.000 abstract 1
- 229920000297 Rayon Polymers 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 150000003927 aminopyridines Chemical class 0.000 abstract 1
- 238000006149 azo coupling reaction Methods 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 230000008878 coupling Effects 0.000 abstract 1
- 238000010168 coupling process Methods 0.000 abstract 1
- 238000005859 coupling reaction Methods 0.000 abstract 1
- -1 linen Polymers 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 abstract 1
- 229920005615 natural polymer Polymers 0.000 abstract 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 1
- 229920002647 polyamide Polymers 0.000 abstract 1
- 150000007519 polyprotic acids Polymers 0.000 abstract 1
- 229920002635 polyurethane Polymers 0.000 abstract 1
- 239000004814 polyurethane Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 239000004627 regenerated cellulose Substances 0.000 abstract 1
- 229920001059 synthetic polymer Polymers 0.000 abstract 1
- 239000004753 textile Substances 0.000 abstract 1
- 210000002268 wool Anatomy 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
- C09B62/51—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732351970 DE2351970C3 (de) | 1973-10-17 | Wasserlösliche Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als faserreaktive Farbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1458474A true GB1458474A (en) | 1976-12-15 |
Family
ID=5895601
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4501174A Expired GB1458474A (en) | 1973-10-17 | 1974-10-17 | Water-soluble azo dyestuffs their preparation and use |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4066638A (en:Method) |
| JP (1) | JPS5855987B2 (en:Method) |
| BE (1) | BE821193A (en:Method) |
| CA (1) | CA1038377A (en:Method) |
| CH (1) | CH586739A5 (en:Method) |
| FR (1) | FR2248301B1 (en:Method) |
| GB (1) | GB1458474A (en:Method) |
| IN (1) | IN143191B (en:Method) |
| IT (1) | IT1022897B (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0043575A1 (de) * | 1980-07-09 | 1982-01-13 | Hoechst Aktiengesellschaft | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1556908A (en) * | 1977-06-08 | 1979-11-28 | Ici Ltd | Reactiv dyes containing the residue of 1-hydroxy-7-amino-88-5-amino-2'4'-disulphophenylazo naphtaline-3,l-disulphoniic acid |
| US4271072A (en) * | 1977-12-20 | 1981-06-02 | American Hoechst Corporation | Azo dyestuffs containing -SO2 CH2 CH2 OSO3 H and -N(CH2 CH2 OSO3 H)2 groups |
| DE3113001A1 (de) * | 1980-11-06 | 1982-06-09 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3139657A1 (de) | 1980-11-06 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3134357A1 (de) * | 1981-08-31 | 1983-03-10 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3427188A1 (de) * | 1984-07-24 | 1986-01-30 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche pyridon-monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| US4837310A (en) * | 1986-01-16 | 1989-06-06 | Sumitomo Chemical Company, Limited | Red or bluish-red fiber-reactive monoazo compound having 7-substituted amino-1-naphthol-sulfonic acid as coupling component between the chromophore and fiber reactive portions of the compound |
| DE3703565A1 (de) * | 1987-02-06 | 1988-08-18 | Hoechst Ag | Wasserloesliche monoazo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3717667A1 (de) * | 1987-05-26 | 1988-12-15 | Hoechst Ag | Wasserloesliche naphthyl-azo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| EP0637615B1 (en) * | 1993-08-02 | 1999-05-06 | DyStar Japan Ltd. | Red reactive dyes, their compositions and dyeing method employing them |
| US5446090A (en) * | 1993-11-12 | 1995-08-29 | Shearwater Polymers, Inc. | Isolatable, water soluble, and hydrolytically stable active sulfones of poly(ethylene glycol) and related polymers for modification of surfaces and molecules |
| US5456727A (en) * | 1994-05-24 | 1995-10-10 | Hoechst Celanese Corporation | Dye compositions for polyamides |
| DE4434989A1 (de) * | 1994-09-30 | 1996-04-04 | Basf Ag | Reaktive Azofarbstoffe mit einer Kupplungskomponente aus der Aminonaphthalinreihe |
| DE19511691A1 (de) * | 1995-03-30 | 1996-10-02 | Basf Ag | Reaktive Azofarbstoffe mit einer Kupplungskomponente aus der Reihe der Aminoaphthalinsulfonsäuren |
| DE19731166A1 (de) * | 1997-07-21 | 1999-01-28 | Basf Ag | Verwendung von Reaktivfarbstoffen zum Färben von Haaren |
| DE10110552A1 (de) * | 2001-03-05 | 2002-09-12 | Basf Ag | Neue Reaktivfarbstoffe und deren Verwendung zum Färben von Substraten, welche nucleophile Gruppen enthalten |
| DE10120531A1 (de) * | 2001-04-26 | 2002-10-31 | Basf Ag | Neue Reaktivfarbstoffe und deren Verwendung zum Färben von Substraten, welche nucleophile Gruppen enthalten |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE500513A (en:Method) * | 1950-01-09 | |||
| DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| DE1289929B (de) * | 1963-06-10 | 1969-02-27 | Hoechst Ag | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen |
| DE1282213B (de) * | 1964-12-03 | 1968-11-07 | Hoechst Ag | Wasserloeslicher gelber Monoazofarbstoff und Verfahren zu seiner Herstellung |
| DE1644162C3 (de) * | 1966-06-04 | 1975-05-22 | Hoechst Ag, 6000 Frankfurt | Ein wasserlöslicher Pyrazolon-monoazofarbstoff und Verfahren zu dessen Herstellung |
| US3553189A (en) * | 1967-04-13 | 1971-01-05 | Sumitomo Chemical Co | Amino-naphthol-azo-phenyl dyes |
| GB1220422A (en) * | 1968-02-28 | 1971-01-27 | Sumitomo Chemical Co | Reactive yellow monoazo dyes of the phenylazo-pyrazole series and process for the preparation thereof |
| US3642765A (en) * | 1969-04-01 | 1972-02-15 | Ciba Ltd | Mono azo dyestuffs containing a fiber-reactive group |
-
1974
- 1974-10-14 CH CH1376474A patent/CH586739A5/xx not_active IP Right Cessation
- 1974-10-15 IT IT28453/74A patent/IT1022897B/it active
- 1974-10-15 US US05/514,994 patent/US4066638A/en not_active Expired - Lifetime
- 1974-10-16 CA CA211,552A patent/CA1038377A/en not_active Expired
- 1974-10-16 JP JP49118324A patent/JPS5855987B2/ja not_active Expired
- 1974-10-17 FR FR7434949A patent/FR2248301B1/fr not_active Expired
- 1974-10-17 BE BE149636A patent/BE821193A/xx not_active IP Right Cessation
- 1974-10-17 IN IN2305/CAL/74A patent/IN143191B/en unknown
- 1974-10-17 GB GB4501174A patent/GB1458474A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0043575A1 (de) * | 1980-07-09 | 1982-01-13 | Hoechst Aktiengesellschaft | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| AU7435274A (en) | 1976-04-29 |
| IT1022897B (it) | 1978-04-20 |
| CH586739A5 (en:Method) | 1977-04-15 |
| DE2351970A1 (de) | 1975-05-15 |
| IN143191B (en:Method) | 1977-10-15 |
| JPS5067840A (en:Method) | 1975-06-06 |
| FR2248301B1 (en:Method) | 1978-11-24 |
| DE2351970B2 (de) | 1977-02-17 |
| JPS5855987B2 (ja) | 1983-12-13 |
| FR2248301A1 (en:Method) | 1975-05-16 |
| BE821193A (fr) | 1975-04-17 |
| CA1038377A (en) | 1978-09-12 |
| US4066638A (en) | 1978-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1458474A (en) | Water-soluble azo dyestuffs their preparation and use | |
| GB1488952A (en) | Fibre-reactive tetrazo dyes their manufacture and use | |
| JPS5757754A (en) | Reactive disazo dye | |
| GB1512151A (en) | Fibre-reactive disazo dyestuffs their production and their use | |
| GB1470633A (en) | Soluble trisazo dyestuffs and their production and use | |
| GB1502149A (en) | Watersoluble benzene azo pyrazolone reactive monoazo dyestuffs processes for their preparation and use | |
| GB1457371A (en) | Monoazo compounds | |
| GB994502A (en) | New reactive monoazo dyestuffs and their use | |
| GB1434418A (en) | Water-soluble monoazo dyestuffs and process for their preparation | |
| GB506740A (en) | Colouration of textile and other materials | |
| GB1523709A (en) | Azo dyes based on pyridine or pyridone coupling component | |
| GB1472815A (en) | Polyazo dyestuffs | |
| GB907759A (en) | Disazo dyes for colour photography | |
| IE41126L (en) | Soluble trisazo dyestuffs | |
| US2049433A (en) | Coloring of materials made with or containing cellulose derivatives | |
| GB1376399A (en) | Water-soluble monoazo dyestuffs | |
| GB1401831A (en) | Azonaphthimidazole dyestuffs their manufacture and use | |
| GB1501994A (en) | Acid dyes of the 2,6-diaminopyridine series | |
| GB1413315A (en) | Watersoluble reactive azo dyestuffs | |
| GB1357700A (en) | Water-insoluble azo dyestuffs containing sulphonamide groups and process for preparing them | |
| GB1491595A (en) | Phosphonic acid azo dyestuffs | |
| ES474439A1 (es) | Procedimiento para preparar colorantes azoicos. | |
| GB1385938A (en) | Watersoluble reactive azo dyestuffs | |
| JPS57207650A (en) | Reactive disazo dye | |
| GB1262397A (en) | Water-soluble monoazo dyestuffs and process for their manufacture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |