GB1033163A - New diphenylethers and herbicidal preparations containing them - Google Patents
New diphenylethers and herbicidal preparations containing themInfo
- Publication number
- GB1033163A GB1033163A GB3300/63A GB330063A GB1033163A GB 1033163 A GB1033163 A GB 1033163A GB 3300/63 A GB3300/63 A GB 3300/63A GB 330063 A GB330063 A GB 330063A GB 1033163 A GB1033163 A GB 1033163A
- Authority
- GB
- United Kingdom
- Prior art keywords
- nitro
- thiocyano
- cyano
- general formula
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title abstract 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 4
- -1 nitro, cyano, thiocyano Chemical group 0.000 abstract 4
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- 125000005843 halogen group Chemical group 0.000 abstract 3
- 125000000565 sulfonamide group Chemical group 0.000 abstract 3
- 239000004480 active ingredient Substances 0.000 abstract 2
- 239000000654 additive Substances 0.000 abstract 2
- 125000001188 haloalkyl group Chemical group 0.000 abstract 2
- TZGFQIXRVUHDLE-UHFFFAOYSA-N 1-chloro-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1Cl TZGFQIXRVUHDLE-UHFFFAOYSA-N 0.000 abstract 1
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 239000000853 adhesive Substances 0.000 abstract 1
- 230000001070 adhesive effect Effects 0.000 abstract 1
- 125000001246 bromo group Chemical group Br* 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 239000003995 emulsifying agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000000575 pesticide Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 230000008635 plant growth Effects 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000000080 wetting agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH156762A CH424364A (de) | 1962-02-08 | 1962-02-08 | Herbizide Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1033163A true GB1033163A (en) | 1966-06-15 |
Family
ID=4213434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB3300/63A Expired GB1033163A (en) | 1962-02-08 | 1963-01-25 | New diphenylethers and herbicidal preparations containing them |
Country Status (9)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3539928A1 (de) | 1984-11-12 | 1986-05-15 | Budapesti Vegyimüvek, Budapest | Substituierte benzoesaeurederivate, ein verfahren zur herstellung derselben und diese verbindungen enthaltende fungizide kompositionen |
| DE3525371A1 (de) * | 1984-07-17 | 1986-07-10 | Budapesti Vegyimüvek, Budapest | Synergetische wirkstoffkombinationen enthaltende herbizide mittel |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL136904C (US20110158925A1-20110630-C00013.png) * | 1962-02-08 | |||
| CH470846A (de) * | 1964-12-30 | 1969-04-15 | Agripat Sa | Beifuttermittel |
| CH485398A (de) * | 1967-03-08 | 1970-02-15 | Ciba Geigy | Schädlingsbekämpfungsmittel, insbesondere Mittel gegen Bakterien und Pilze |
| USRE31831E (en) * | 1969-04-25 | 1985-02-12 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and esters thereof |
| USRE32216E (en) * | 1969-04-25 | 1986-07-29 | Rhone-Poulenc Agrochimie | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32243E (en) * | 1969-04-25 | 1986-09-09 | Rhone-Poulenc Agrochimie | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| US4039588A (en) * | 1969-05-28 | 1977-08-02 | Rohm And Haas Company | Herbicidal 4-nitro-diphenyl ethers |
| US3764624A (en) * | 1970-08-05 | 1973-10-09 | United States Borax Chem | N-substituted-2,6-dinitro-3-(alkoxy or alkylthio)-4-substituted-aniline compounds |
| US3716585A (en) * | 1970-08-05 | 1973-02-13 | United States Borax Chem | Alkoxy trifluoromethylaniline compounds |
| USRE32215E (en) * | 1971-02-11 | 1986-07-22 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids compositions of the same and herbicidal use thereof |
| US4164408A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| PH18332A (en) * | 1972-01-27 | 1985-05-31 | Ishihara Sangyo Kaisha | Herbicide |
| US3753678A (en) * | 1972-02-09 | 1973-08-21 | Fmc Corp | Substituted dioxanes as herbicides |
| USRE31731E (en) * | 1972-03-14 | 1984-11-13 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers | |
| US3888932A (en) * | 1972-03-14 | 1975-06-10 | Rohm & Haas | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US4772744A (en) * | 1972-03-14 | 1988-09-20 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US4046798A (en) * | 1973-02-12 | 1977-09-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4'nitrodiphenyl ethers |
| USRE31455E (en) * | 1972-03-14 | 1983-12-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US3928416A (en) * | 1972-03-14 | 1975-12-23 | Rohm & Haas | Herbicidal 4-trifluoromethyl-4{40 nitrodiphenyl ethers |
| US4002662A (en) * | 1973-09-19 | 1977-01-11 | Mobil Oil Corporation | 2-Nitro-5-(cyano-trifluoromethyl-phenoxy)benzoic acids and esters |
| US4681622A (en) * | 1973-09-19 | 1987-07-21 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivatives thereof as herbicides |
| DE2433066C2 (de) * | 1974-07-10 | 1982-12-23 | Hoechst Ag, 6000 Frankfurt | 4-Trifluormethyl-4'-hydroxy-diphenyläther und Verfahren zu ihrer Herstellung |
| CH617834A5 (US20110158925A1-20110630-C00013.png) * | 1974-10-22 | 1980-06-30 | Ciba Geigy Ag | |
| US4124370A (en) * | 1975-05-08 | 1978-11-07 | Rohm And Haas Company | Diphenyl ethers for tobacco sucker control |
| US4335249A (en) * | 1975-09-03 | 1982-06-15 | Rohm And Haas Company | Herbicidal diphenyl ethers, sulfides, sulfoxides and sulfones |
| US4183743A (en) * | 1975-11-20 | 1980-01-15 | Ishihara Sangyo Kaisha Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| US4106925A (en) * | 1975-11-20 | 1978-08-15 | Ishihara Sangyo Kaisha Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| US4193790A (en) * | 1975-11-20 | 1980-03-18 | Ishihara Sangyo Kabushiki Kaisha Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| US4059435A (en) * | 1976-08-31 | 1977-11-22 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-3-cyanoalkoxy-4-nitro diphenyl ethers |
| US4086364A (en) * | 1976-11-19 | 1978-04-25 | Gaf Corporation | Fungicidal 2,6-dinitrodiphenylethers |
| US4087553A (en) * | 1976-11-19 | 1978-05-02 | Gaf Corporation | Fungicidal 2,6-dinitrodiphenylthioethers |
| US4105797A (en) * | 1977-01-14 | 1978-08-08 | Gaf Corporation | Fungicidal 3-amino-6-trifluoromethyl-2,4-dinitrodiphenylethers |
| US4112002A (en) * | 1977-01-21 | 1978-09-05 | Gaf Corporation | Mononitrotrifluoromethyl diphenylethers |
| US4350522A (en) * | 1977-06-20 | 1982-09-21 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| US4213775A (en) * | 1977-07-28 | 1980-07-22 | Ube Industries, Ltd. | Diphenyl ether derivatives and herbicidal compositions containing the same |
| DE2960206D1 (en) | 1978-02-03 | 1981-04-16 | Ciba Geigy Ag | Cyanomethyl ester of 4-(paratrifluormethylphenoxy)-alpha-phenoxypropionic acid; process for its preparation; composition containing this herbicidal compound, and its application |
| USRE30361E (en) * | 1979-03-09 | 1980-08-05 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US4744818A (en) * | 1981-07-27 | 1988-05-17 | Rhone-Poulenc Agrochimie | Herbicidal N-halo-5(substituted-phenoxy or -pyridyloxy)-2-substituted benzoic acid sulfonamides and sulfamates |
| US4382816A (en) * | 1981-07-27 | 1983-05-10 | Rhone-Poulenc Agrochimie | Herbicidal trithione derivatives of benzoic acid |
| US5304682A (en) * | 1989-08-17 | 1994-04-19 | Occidental Chemical Corporation | Method of making 1,1'-sulfonylbis[3-nitro-5-(trifluoromethyl)benzene] |
| US4990670A (en) * | 1989-08-17 | 1991-02-05 | Occidental Chemical Corporation | Method of making 1,1'-oxybis (3-nitro-5-trifluoromethyl)-benzene |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3002975A (en) * | 1958-08-25 | 1961-10-03 | Diamond Alkali Co | Process for the preparation of 1,3-dihalo-uracils |
| BE593743A (US20110158925A1-20110630-C00013.png) * | 1959-08-05 | |||
| BE602554A (US20110158925A1-20110630-C00013.png) * | 1960-04-13 | |||
| NL136904C (US20110158925A1-20110630-C00013.png) * | 1962-02-08 |
-
0
- NL NL136904D patent/NL136904C/xx active
- NL NL288695D patent/NL288695A/xx unknown
- BE BE628133D patent/BE628133A/xx unknown
-
1962
- 1962-02-08 CH CH156762A patent/CH424364A/de unknown
-
1963
- 1963-01-25 GB GB3300/63A patent/GB1033163A/en not_active Expired
- 1963-02-07 AT AT96163A patent/AT243018B/de active
- 1963-02-07 ES ES284924A patent/ES284924A1/es not_active Expired
- 1963-02-08 BR BR146808/63A patent/BR6346808D0/pt unknown
-
1964
- 1964-12-31 OA OA51371A patent/OA01190A/xx unknown
-
1966
- 1966-01-18 US US521427A patent/US3420892A/en not_active Expired - Lifetime
- 1966-01-18 US US521448A patent/US3322525A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3525371A1 (de) * | 1984-07-17 | 1986-07-10 | Budapesti Vegyimüvek, Budapest | Synergetische wirkstoffkombinationen enthaltende herbizide mittel |
| DE3539928A1 (de) | 1984-11-12 | 1986-05-15 | Budapesti Vegyimüvek, Budapest | Substituierte benzoesaeurederivate, ein verfahren zur herstellung derselben und diese verbindungen enthaltende fungizide kompositionen |
Also Published As
| Publication number | Publication date |
|---|---|
| CH424364A (de) | 1966-11-15 |
| DE1493512B2 (de) | 1973-02-01 |
| NL136904C (US20110158925A1-20110630-C00013.png) | |
| US3420892A (en) | 1969-01-07 |
| DE1792733B2 (de) | 1976-01-08 |
| DE1792733A1 (de) | 1973-01-11 |
| NL288695A (US20110158925A1-20110630-C00013.png) | |
| ES284924A1 (es) | 1963-07-16 |
| DE1493512A1 (de) | 1969-08-07 |
| AT243018B (de) | 1965-10-25 |
| OA01190A (fr) | 1969-01-25 |
| BR6346808D0 (pt) | 1973-06-14 |
| BE628133A (US20110158925A1-20110630-C00013.png) | |
| US3322525A (en) | 1967-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1033163A (en) | New diphenylethers and herbicidal preparations containing them | |
| GB927834A (en) | Dichlorofluoromethylthio group-containing compounds | |
| GB1501607A (en) | Substituted n-phenyl-n'-benzoyl-ureas and their use as insecticides | |
| US4066770A (en) | 3-Pyridylisoxazolidine fungicides | |
| GB1090813A (en) | Pesticidal preparations and new compounds for use therein | |
| SE7901811L (sv) | Pesticida kompositioner innehallande dinitrobensotrifluorid som aktivbestandesdel | |
| GB1079689A (en) | Herbicidal preparations and new compounds | |
| KR830001912A (ko) | 1-치환-1-트리아졸릴스티렌류의 기하이성체의 제조방법 | |
| GB955287A (en) | Herbicides and methods of using same | |
| ES8505975A1 (es) | Procedimiento para la produccion de s,s-dioxidos de 3-acilamino-benzoisotiazol | |
| ES367067A1 (es) | Un procedimiento para preparar un agente para reprimir afecciones de plantas. | |
| GB1070959A (en) | New compounds having insecticidal activity and their preparation and application | |
| GB1486984A (en) | Pyrazolium salts | |
| KR870009988A (ko) | 살진균성활성을 갖는 시아노아세트아미도 유도체 | |
| GB968807A (en) | Fungicides comprising diaryl-azo compounds | |
| GB898910A (en) | Phosphorothioic esters and process for obtaining them | |
| ES8406430A1 (es) | Procedimiento para preparar ureasssustituidas. | |
| GB971819A (en) | Improvements in and relating to herbicides and new anilides for use therein | |
| PH18972A (en) | Novel cyclopropanedcarboxylic acid derivatives,compositions and use | |
| GB917253A (en) | Herbicidal compounds and compositions and process for preparing same | |
| GB1009200A (en) | Trifluoromethylanilide derivatives | |
| DK515280A (da) | Silylbenzimidazol-2-carbamidsyreestere fremgangsmaade til fremstilling heraf samt anvendelse af disse forbindelser som fungicider | |
| GB824345A (en) | Gastropod combating compositions | |
| GB1035177A (en) | Compositions for destroying or preventing the growth of water plants | |
| GB1010569A (en) | Novel n-(substituted phenyl) amic acid esters as plant growth regulants |