FR2550528A1 - - Google Patents
Download PDFInfo
- Publication number
- FR2550528A1 FR2550528A1 FR8412475A FR8412475A FR2550528A1 FR 2550528 A1 FR2550528 A1 FR 2550528A1 FR 8412475 A FR8412475 A FR 8412475A FR 8412475 A FR8412475 A FR 8412475A FR 2550528 A1 FR2550528 A1 FR 2550528A1
- Authority
- FR
- France
- Prior art keywords
- sum
- polymer
- group
- average values
- carbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229920000642 polymer Polymers 0.000 claims abstract description 106
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 49
- 239000000203 mixture Substances 0.000 claims abstract description 49
- -1 POLYETHYLENE Polymers 0.000 claims abstract description 32
- 239000004793 Polystyrene Substances 0.000 claims abstract description 3
- 229920002223 polystyrene Polymers 0.000 claims abstract description 3
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 24
- 125000000962 organic group Chemical group 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 229920001903 high density polyethylene Polymers 0.000 claims description 14
- 239000004700 high-density polyethylene Substances 0.000 claims description 14
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 12
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 6
- 239000004743 Polypropylene Substances 0.000 claims description 5
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 5
- 229920000578 graft copolymer Polymers 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920000728 polyester Polymers 0.000 claims description 2
- 229920001155 polypropylene Polymers 0.000 claims description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims 2
- 125000004799 bromophenyl group Chemical group 0.000 claims 1
- 229910000019 calcium carbonate Inorganic materials 0.000 claims 1
- 229920001684 low density polyethylene Polymers 0.000 claims 1
- 239000004702 low-density polyethylene Substances 0.000 claims 1
- 239000004417 polycarbonate Substances 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 abstract description 21
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract description 14
- 230000009970 fire resistant effect Effects 0.000 abstract description 12
- 239000004698 Polyethylene Substances 0.000 abstract description 4
- 229920000573 polyethylene Polymers 0.000 abstract description 4
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 abstract 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 abstract 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 abstract 1
- 230000004927 fusion Effects 0.000 abstract 1
- 238000010348 incorporation Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 40
- 239000000047 product Substances 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 32
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 27
- 239000000654 additive Substances 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 23
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000007787 solid Substances 0.000 description 18
- 230000000996 additive effect Effects 0.000 description 17
- 238000000034 method Methods 0.000 description 17
- 239000000463 material Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 14
- 238000012360 testing method Methods 0.000 description 13
- 230000004580 weight loss Effects 0.000 description 13
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 12
- 150000002009 diols Chemical class 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 229910052801 chlorine Inorganic materials 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- 239000007789 gas Substances 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000012299 nitrogen atmosphere Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000000155 melt Substances 0.000 description 8
- 229910052760 oxygen Inorganic materials 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 6
- 238000002485 combustion reaction Methods 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 238000004811 liquid chromatography Methods 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- QLMQRJJLWGQDDG-UHFFFAOYSA-N (2,3,4,5,6-pentabromophenyl) carbonochloridate Chemical compound ClC(=O)OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br QLMQRJJLWGQDDG-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 238000004566 IR spectroscopy Methods 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000005755 formation reaction Methods 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 238000002411 thermogravimetry Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 238000007707 calorimetry Methods 0.000 description 4
- 235000011089 carbon dioxide Nutrition 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000005485 electric heating Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000003063 flame retardant Substances 0.000 description 4
- 239000003365 glass fiber Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- SVHOVVJFOWGYJO-UHFFFAOYSA-N pentabromophenol Chemical compound OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br SVHOVVJFOWGYJO-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000001175 calcium sulphate Substances 0.000 description 3
- 235000011132 calcium sulphate Nutrition 0.000 description 3
- 125000005587 carbonate group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229910052787 antimony Inorganic materials 0.000 description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 125000004997 halocarbonyl group Chemical group 0.000 description 2
- 229920005669 high impact polystyrene Polymers 0.000 description 2
- 239000004797 high-impact polystyrene Substances 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001707 polybutylene terephthalate Polymers 0.000 description 2
- 229920002959 polymer blend Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NCQKSUNJAAZVJW-UKTHLTGXSA-N (2e)-2-(2-phenylethylhydrazinylidene)propanoic acid Chemical compound OC(=O)C(/C)=N/NCCC1=CC=CC=C1 NCQKSUNJAAZVJW-UKTHLTGXSA-N 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- BTFMCMVEUCGQDX-UHFFFAOYSA-N 1-[10-[3-[4-(2-hydroxyethyl)-1-piperidinyl]propyl]-2-phenothiazinyl]ethanone Chemical compound C12=CC(C(=O)C)=CC=C2SC2=CC=CC=C2N1CCCN1CCC(CCO)CC1 BTFMCMVEUCGQDX-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- RGUIGXFOHAOFLG-UHFFFAOYSA-N 2-n,3-n-dimethylpyridine-2,3-diamine Chemical compound CNC1=CC=CN=C1NC RGUIGXFOHAOFLG-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- YHDSTFKCTSIXKN-UHFFFAOYSA-N [bromo(chloro)-$l^{3}-chloranyl]formyl chloride Chemical compound ClCl(Br)C(Cl)=O YHDSTFKCTSIXKN-UHFFFAOYSA-N 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GLMRCTIBJCEHLX-UHFFFAOYSA-N bis(2,3,4,5,6-pentabromophenyl) carbonate Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC(=O)OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br GLMRCTIBJCEHLX-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- OYQYHJRSHHYEIG-UHFFFAOYSA-N ethyl carbamate;urea Chemical compound NC(N)=O.CCOC(N)=O OYQYHJRSHHYEIG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 235000020544 functional carbonate Nutrition 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000001639 phenylmethylene group Chemical group [H]C(=*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960004265 piperacetazine Drugs 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G64/00—Macromolecular compounds obtained by reactions forming a carbonic ester link in the main chain of the macromolecule
- C08G64/16—Aliphatic-aromatic or araliphatic polycarbonates
- C08G64/1608—Aliphatic-aromatic or araliphatic polycarbonates saturated
- C08G64/1625—Aliphatic-aromatic or araliphatic polycarbonates saturated containing atoms other than carbon, hydrogen or oxygen
- C08G64/1633—Aliphatic-aromatic or araliphatic polycarbonates saturated containing atoms other than carbon, hydrogen or oxygen containing halogens
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/521,475 US4489189A (en) | 1983-08-08 | 1983-08-08 | Alkanediyl bromo-substituted arylenediyl carbonate polymers |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2550528A1 true FR2550528A1 (enExample) | 1985-02-15 |
| FR2550528B1 FR2550528B1 (enExample) | 1987-04-03 |
Family
ID=24076874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR8412475A Expired FR2550528B1 (enExample) | 1983-08-08 | 1984-08-07 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4489189A (enExample) |
| DE (1) | DE3428912A1 (enExample) |
| FR (1) | FR2550528B1 (enExample) |
| GB (1) | GB2145101B (enExample) |
| IL (1) | IL72586A (enExample) |
| NL (1) | NL185084C (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4622380A (en) * | 1985-06-20 | 1986-11-11 | Ppg Industries, Inc. | Alkylidene bromo-substituted arylene acetal and/or ketal polymers |
| USD1097819S1 (en) * | 2023-10-19 | 2025-10-14 | Pepsico, Inc. | Bottle |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2159896A5 (enExample) * | 1971-11-01 | 1973-06-22 | Gen Electric | |
| US3846469A (en) * | 1972-06-12 | 1974-11-05 | Dow Chemical Co | Isopropylidene bis(2,6-dihalo-p-phenylene) bis(poly-halophenyl) carbonates |
| US4235978A (en) * | 1975-06-02 | 1980-11-25 | General Electric Company | Flame retardant composition |
| FR2504919A1 (fr) * | 1981-05-04 | 1982-11-05 | Kotrelev Vladimir | Polycarbonates de masse moleculaire inferieure a groupements terminaux aryle, leur procede de preparation et composition de polycarbonates plastifiee les contenant |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA697041A (en) * | 1964-11-03 | E. Bissinger William | Mixed polycarbonates and process for preparing same | |
| US3688001A (en) * | 1970-08-03 | 1972-08-29 | Dow Chemical Co | Carbonates containing halogenated neopentyl groups |
| US3779984A (en) * | 1970-08-03 | 1973-12-18 | Dow Chemical Co | Halogenated carbonates as fire retardants for polyesters |
| US3823175A (en) * | 1971-03-19 | 1974-07-09 | Dow Chemical Co | Halogenated neopentyl chloroformates |
| IT959794B (it) * | 1971-06-11 | 1973-11-10 | Eastman Kodak Co | Fibre resistenti verso le fiamme |
| US3751400A (en) * | 1971-07-29 | 1973-08-07 | Gen Electric | High ignition temperature polymers substituted with halogen substituted aromatic groups |
| US3763644A (en) * | 1972-05-09 | 1973-10-09 | Eastman Kodak Co | Flame retardant textiles |
| CA1036744A (en) * | 1973-03-30 | 1978-08-15 | Heinrich Haupt | Process for preparing halogen-substituted aromatic polycarbonates |
| JPS52150496A (en) * | 1976-06-09 | 1977-12-14 | Mitsubishi Gas Chem Co Inc | Preparation of polycaronate oligomers |
| US4104264A (en) * | 1977-05-05 | 1978-08-01 | Air Products & Chemicals, Inc. | End capped polyalkylene carbonates having improved thermal stablity |
| US4301062A (en) * | 1978-10-23 | 1981-11-17 | Asahi Dow Limited | Diester of 3,5,3',5'-tetrabromo-bisphenol A with halogenated aromatic carboxylic acid |
| US4286086A (en) * | 1979-12-28 | 1981-08-25 | General Electric Company | Process for preparing polycarbonate using sterically hindered secondary amine catalysts |
| US4286085A (en) * | 1979-12-28 | 1981-08-25 | General Electric Company | Process for preparing polycarbonates using substituted pyridine catalysts |
-
1983
- 1983-08-08 US US06/521,475 patent/US4489189A/en not_active Expired - Fee Related
-
1984
- 1984-08-06 IL IL72586A patent/IL72586A/xx unknown
- 1984-08-06 DE DE19843428912 patent/DE3428912A1/de not_active Withdrawn
- 1984-08-07 GB GB08420091A patent/GB2145101B/en not_active Expired
- 1984-08-07 FR FR8412475A patent/FR2550528B1/fr not_active Expired
- 1984-08-08 NL NLAANVRAGE8402449,A patent/NL185084C/xx not_active IP Right Cessation
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2159896A5 (enExample) * | 1971-11-01 | 1973-06-22 | Gen Electric | |
| US3846469A (en) * | 1972-06-12 | 1974-11-05 | Dow Chemical Co | Isopropylidene bis(2,6-dihalo-p-phenylene) bis(poly-halophenyl) carbonates |
| US4235978A (en) * | 1975-06-02 | 1980-11-25 | General Electric Company | Flame retardant composition |
| FR2504919A1 (fr) * | 1981-05-04 | 1982-11-05 | Kotrelev Vladimir | Polycarbonates de masse moleculaire inferieure a groupements terminaux aryle, leur procede de preparation et composition de polycarbonates plastifiee les contenant |
Also Published As
| Publication number | Publication date |
|---|---|
| IL72586A0 (en) | 1984-11-30 |
| GB8420091D0 (en) | 1984-09-12 |
| IL72586A (en) | 1987-10-30 |
| DE3428912A1 (de) | 1985-02-21 |
| GB2145101A (en) | 1985-03-20 |
| FR2550528B1 (enExample) | 1987-04-03 |
| NL185084C (nl) | 1990-01-16 |
| GB2145101B (en) | 1987-01-21 |
| NL185084B (nl) | 1989-08-16 |
| NL8402449A (nl) | 1985-03-01 |
| US4489189A (en) | 1984-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4831109A (en) | Copolymerizable UV stabilizers | |
| US3365517A (en) | Mixtures of polycarbonates and polyarylene polyethers | |
| EP0359037A2 (de) | Leichtfliessende Polyamid-Formmassen und -Legierungen | |
| JPS60141723A (ja) | 熱可塑性ポリシロキサン‐ポリエステル(カーボナート)ブロツク共重合体 | |
| EP0840758B1 (de) | Verfahren zur herstellung von verkappten polyarylenethern | |
| US3657385A (en) | Lactam block copolymers | |
| US5342664A (en) | Alloys made from partly crystalline and amorphous poly (aryl ether ketone) compounds | |
| US5457169A (en) | Molding materials based on polyarylene ethers having terminal anhydride groups | |
| US3655822A (en) | Thermoplastic polymer alloy | |
| FR2550528A1 (enExample) | ||
| FR2483444A1 (fr) | Composition thermoplastique a base de resine de poly (oxyphenylene) et de copolymere de styrene-bromostyrene | |
| JPH0637555B2 (ja) | スピロ(ビス)インダン共ポリアミドの製造法 | |
| BE699028A (enExample) | ||
| US5145899A (en) | Polymers modified by ketonic and ether-ketonic compounds | |
| US5317066A (en) | Polyester-grafted polyamide, process for preparing the same, and thermoplastic resin composition containing the same | |
| JP3034601B2 (ja) | ポリエステルグラフト化ポリアミド、その製造法およびこれを用いた熱可塑性樹脂組成物 | |
| US4178432A (en) | Copolyoxalamide from branched chain diamine | |
| Matzner et al. | Condensation polymers derived from N, N′‐dialkyl‐and N, N′‐diarylarylenediamines | |
| Podkoscielny et al. | Linear polythioesters, XXIII. Products of interfacial polycondensation of 4, 4′‐dimercaptobiphenyl with acid dichlorides | |
| JPH05140296A (ja) | 新規ポリアリーレンエーテルケトン | |
| JPH04198267A (ja) | ポリアリーレンスルフィド系樹脂組成物 | |
| KR910004881B1 (ko) | Uv 안정성단량체로부터 제조된 중합체 및 그 제조방법 | |
| JP2786505B2 (ja) | ポリエステルグラフト化ポリアミドおよびその製造法 | |
| FR2550215A1 (fr) | Polyarylethers cristallisables reticulables et leur application a la formation de composites | |
| EP0857745A2 (de) | Verfahren zur Herstellung von Blockcopolymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ER | Errata listed in the french official journal (bopi) |
Free format text: 07/85 |
|
| ST | Notification of lapse |