FI88611C - Foerfarande foer framstaellning av karboxylsyror samt rodiumkatalysatorkomplex anvaendbara i foerfarandet - Google Patents
Foerfarande foer framstaellning av karboxylsyror samt rodiumkatalysatorkomplex anvaendbara i foerfarandet Download PDFInfo
- Publication number
- FI88611C FI88611C FI861188A FI861188A FI88611C FI 88611 C FI88611 C FI 88611C FI 861188 A FI861188 A FI 861188A FI 861188 A FI861188 A FI 861188A FI 88611 C FI88611 C FI 88611C
- Authority
- FI
- Finland
- Prior art keywords
- cehs
- group
- carbon atoms
- formula
- rhcl
- Prior art date
Links
- 239000010948 rhodium Substances 0.000 title claims abstract description 82
- 238000000034 method Methods 0.000 title claims abstract description 50
- 229910052703 rhodium Inorganic materials 0.000 title claims abstract description 46
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 title claims abstract description 45
- 150000001735 carboxylic acids Chemical class 0.000 title claims abstract description 11
- 239000003054 catalyst Substances 0.000 title claims description 51
- 238000002360 preparation method Methods 0.000 title claims description 15
- 238000006243 chemical reaction Methods 0.000 claims abstract description 73
- 239000003446 ligand Substances 0.000 claims abstract description 28
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 25
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 21
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 15
- 150000002367 halogens Chemical class 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 238000006555 catalytic reaction Methods 0.000 claims abstract description 7
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 5
- 239000002815 homogeneous catalyst Substances 0.000 claims abstract description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 27
- 230000003197 catalytic effect Effects 0.000 claims description 7
- 238000011065 in-situ storage Methods 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- -1 iodide compound Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 abstract description 14
- 239000002184 metal Substances 0.000 abstract description 14
- 229910052698 phosphorus Inorganic materials 0.000 abstract description 8
- 125000004429 atom Chemical group 0.000 abstract description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 abstract description 6
- 239000011574 phosphorus Substances 0.000 abstract description 6
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 125000002877 alkyl aryl group Chemical group 0.000 abstract 1
- 125000004437 phosphorous atom Chemical group 0.000 abstract 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 17
- 239000000047 product Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 10
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 150000002894 organic compounds Chemical class 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 239000012190 activator Substances 0.000 description 4
- 238000005810 carbonylation reaction Methods 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 239000012263 liquid product Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000006315 carbonylation Effects 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004989 dicarbonyl group Chemical group 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 208000027697 autoimmune lymphoproliferative syndrome due to CTLA4 haploinsuffiency Diseases 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical group [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- 238000006317 isomerization reaction Methods 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 150000003284 rhodium compounds Chemical class 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- WNPGSEJRPYSCDQ-UHFFFAOYSA-N 3-(iodomethyl)heptane Chemical compound CCCCC(CC)CI WNPGSEJRPYSCDQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical class [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- UNMYWSMUMWPJLR-UHFFFAOYSA-L Calcium iodide Chemical compound [Ca+2].[I-].[I-] UNMYWSMUMWPJLR-UHFFFAOYSA-L 0.000 description 1
- 229920013683 Celanese Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- UKFWSNCTAHXBQN-UHFFFAOYSA-N ammonium iodide Chemical class [NH4+].[I-] UKFWSNCTAHXBQN-UHFFFAOYSA-N 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- SGUXGJPBTNFBAD-UHFFFAOYSA-L barium iodide Chemical compound [I-].[I-].[Ba+2] SGUXGJPBTNFBAD-UHFFFAOYSA-L 0.000 description 1
- 229910001638 barium iodide Inorganic materials 0.000 description 1
- 229940075444 barium iodide Drugs 0.000 description 1
- GPMUMMNTAZMBEC-UHFFFAOYSA-N bis(oxomethylidene)rhodium Chemical compound [Rh].[O+]#[C-].[O+]#[C-] GPMUMMNTAZMBEC-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910001640 calcium iodide Inorganic materials 0.000 description 1
- 229940046413 calcium iodide Drugs 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012018 catalyst precursor Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- ANGXTHKGHPNXFR-UHFFFAOYSA-N decylazanium;iodide Chemical compound [I-].CCCCCCCCCC[NH3+] ANGXTHKGHPNXFR-UHFFFAOYSA-N 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WERREMRZLGQBJN-UHFFFAOYSA-N ethylphosphanium;iodide Chemical compound [I-].CC[PH3+] WERREMRZLGQBJN-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002503 iridium Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- QRPRIOOKPZSVFN-UHFFFAOYSA-M methyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 QRPRIOOKPZSVFN-UHFFFAOYSA-M 0.000 description 1
- JNMIXMFEVJHFNY-UHFFFAOYSA-M methyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 JNMIXMFEVJHFNY-UHFFFAOYSA-M 0.000 description 1
- LLWRXQXPJMPHLR-UHFFFAOYSA-N methylazanium;iodide Chemical compound [I-].[NH3+]C LLWRXQXPJMPHLR-UHFFFAOYSA-N 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- GNPXKHTZVDUNOY-UHFFFAOYSA-N oxomethylidenerhodium Chemical compound O=C=[Rh] GNPXKHTZVDUNOY-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical class [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003283 rhodium Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229940083599 sodium iodide Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- UQFSVBXCNGCBBW-UHFFFAOYSA-M tetraethylammonium iodide Chemical compound [I-].CC[N+](CC)(CC)CC UQFSVBXCNGCBBW-UHFFFAOYSA-M 0.000 description 1
- BXYHVFRRNNWPMB-UHFFFAOYSA-N tetramethylphosphanium Chemical compound C[P+](C)(C)C BXYHVFRRNNWPMB-UHFFFAOYSA-N 0.000 description 1
- DKUNCCVNTUQRBB-UHFFFAOYSA-M tetraphenylazanium;iodide Chemical compound [I-].C1=CC=CC=C1[N+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 DKUNCCVNTUQRBB-UHFFFAOYSA-M 0.000 description 1
- CISYLVSCEPBMLO-UHFFFAOYSA-M tetrapropylphosphanium;iodide Chemical compound [I-].CCC[P+](CCC)(CCC)CCC CISYLVSCEPBMLO-UHFFFAOYSA-M 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- XFLOVLDXCZKNJM-UHFFFAOYSA-N tricyclohexylphosphane;hydroiodide Chemical compound [I-].C1CCCCC1[PH+](C1CCCCC1)C1CCCCC1 XFLOVLDXCZKNJM-UHFFFAOYSA-N 0.000 description 1
- CURCMGVZNYCRNY-UHFFFAOYSA-N trimethylazanium;iodide Chemical compound I.CN(C)C CURCMGVZNYCRNY-UHFFFAOYSA-N 0.000 description 1
- POXSDSRWVJZWCN-UHFFFAOYSA-N triphenylphosphanium;iodide Chemical compound I.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 POXSDSRWVJZWCN-UHFFFAOYSA-N 0.000 description 1
- LYBCNSYKOJEXOY-UHFFFAOYSA-N tris(4-methylphenyl)azanium;iodide Chemical compound [I-].C1=CC(C)=CC=C1[NH+](C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 LYBCNSYKOJEXOY-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/10—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide
- C07C51/12—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide on an oxygen-containing group in organic compounds, e.g. alcohols
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Manipulation Of Pulses (AREA)
- Dc Digital Transmission (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Steroid Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63302184A | 1984-07-20 | 1984-07-20 | |
| US63302184 | 1984-07-20 | ||
| PCT/US1985/001359 WO1986000888A1 (en) | 1984-07-20 | 1985-07-19 | Production of carboxylic acids from alcohols using rhodium complex catalysts |
| US8501359 | 1985-07-19 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI861188A7 FI861188A7 (fi) | 1986-03-20 |
| FI861188A0 FI861188A0 (fi) | 1986-03-20 |
| FI88611B FI88611B (fi) | 1993-02-26 |
| FI88611C true FI88611C (fi) | 1993-06-10 |
Family
ID=24537959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI861188A FI88611C (fi) | 1984-07-20 | 1986-03-20 | Foerfarande foer framstaellning av karboxylsyror samt rodiumkatalysatorkomplex anvaendbara i foerfarandet |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4670570A (ref) |
| EP (1) | EP0171652B1 (ref) |
| JP (1) | JPS61502757A (ref) |
| KR (1) | KR860700247A (ref) |
| CN (1) | CN85106097A (ref) |
| AT (1) | ATE32215T1 (ref) |
| AU (1) | AU579175B2 (ref) |
| CA (1) | CA1237728A (ref) |
| DE (1) | DE3561509D1 (ref) |
| FI (1) | FI88611C (ref) |
| MX (1) | MX162709A (ref) |
| NO (1) | NO162232C (ref) |
| WO (1) | WO1986000888A1 (ref) |
| ZA (1) | ZA855487B (ref) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1248549A (en) * | 1984-08-16 | 1989-01-10 | Richard W. Wegman | Production of anhydrous carboxylic acids from alcohols using rhodium complex catalysts and organic ester source |
| US4990654A (en) * | 1984-08-16 | 1991-02-05 | Union Carbide Chemicals And Plastics Company Inc. | Production of acetate esters from alcohols using rhodium complex catalysts |
| EP0545997B1 (en) * | 1990-08-31 | 1995-11-02 | The Governors Of The University Of Alberta | Carbonylation of methanol using a novel transition metal catalyst precursor |
| NO942248L (no) * | 1993-06-30 | 1995-01-02 | Bp Chem Int Ltd | Fremgangsmåte for karbonylering av metanol eller et reaktivt derivat derav |
| CN1053392C (zh) * | 1994-01-21 | 2000-06-14 | 中国科学院化学研究所 | 甲醇羰基化均相铑催化剂及其制法与用途 |
| DK1263698T3 (da) * | 2000-03-06 | 2008-09-29 | Woodland Biofuels Inc | Fremgangsmåde til omdannelse af cellulosemateriale til væskeformige carbonhydrider |
| TW567183B (en) * | 2001-10-05 | 2003-12-21 | China Petrochemical Dev Corp | Process for producing carboxylic acids |
| CN102952009B (zh) * | 2012-08-06 | 2015-07-22 | 刘长宝 | 利用乙二醇生产琥珀酸和1,4-丁二醇的方法、工艺和生产线 |
| CN113004139B (zh) * | 2019-12-18 | 2022-09-02 | 华东理工大学 | 一种低水含量下乙醇羰基合成丙酸的方法 |
| JP2024065526A (ja) | 2022-10-31 | 2024-05-15 | 高砂香料工業株式会社 | 有機第三級ジホスフィンを有機第三級ジホスフィンモノオキサイドに選択的に酸化するための触媒プロセス |
| KR20250149170A (ko) * | 2023-02-10 | 2025-10-15 | 라이온델바젤 아세틸, 엘엘씨 | 아세트산 제조에서의 요오드화물 제어 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1697109A (en) * | 1925-06-13 | 1929-01-01 | Dreyfus Henry | Manufacture of acetic acid |
| US2508513A (en) * | 1947-04-21 | 1950-05-23 | Celanese Corp | Conversion of methyl formate to acetic acid |
| DE1083801B (de) * | 1958-08-22 | 1960-06-23 | Basf Ag | Verfahren zur Herstellung von Essigsaeure oder deren Gemischen mit Methylacetat |
| US3839428A (en) * | 1969-05-28 | 1974-10-01 | Japan Gas Chemical Co | Process for preparation of organic carboxylic acid |
| US3798267A (en) * | 1970-02-25 | 1974-03-19 | Ajinomoto Kk | Process of producing acetic acid from methyl formate |
| JPS493513B1 (ref) * | 1970-02-25 | 1974-01-26 | ||
| US3769329A (en) * | 1970-03-12 | 1973-10-30 | Monsanto Co | Production of carboxylic acids and esters |
| US4194056A (en) * | 1970-09-30 | 1980-03-18 | Chevron Research Company | Acetic acid from methyl formate |
| FR2317269A1 (fr) * | 1975-07-10 | 1977-02-04 | Metaux Precieux Cie | Procede de fabrication d'acides et d'esters alcane carboxyliques par reaction d'alcools avec le monoxyde de carbone en presence de catalyseurs contenant de l'iridium |
| US4102920A (en) * | 1977-01-13 | 1978-07-25 | Air Products & Chemicals, Inc. | Production of carboxylic acids and esters |
| JPS5466614A (en) * | 1977-11-01 | 1979-05-29 | Mitsubishi Gas Chem Co Inc | Preparation of carboxylic acid or its ester |
| WO1980001689A1 (en) * | 1979-02-12 | 1980-08-21 | Exxon Research Engineering Co | Phosphine and phosphonium compound and catalyst and their use in hydrocarbon conversion processes |
| FR2455021A1 (fr) * | 1979-04-25 | 1980-11-21 | Rhone Poulenc Ind | Procede de preparation d'acides carboxyliques par carbonylation |
| US4473505A (en) * | 1980-02-12 | 1984-09-25 | Exxon Research And Engineering Co. | Phosphine and phosphonium compounds and catalysts |
| US4374278A (en) * | 1980-02-28 | 1983-02-15 | Union Carbide Corporation | Hydroformylation catalyst reactivation |
| US4918226A (en) * | 1980-08-04 | 1990-04-17 | Exxon Research And Engineering Company | Process for converting formate esters to carboxylic acids |
| US4461910A (en) * | 1981-05-15 | 1984-07-24 | Shell Oil Company | Process for the co-production of dicarboxylates and acids |
| US4491675A (en) * | 1981-08-17 | 1985-01-01 | Union Carbide Corporation | Hydroformylation process using triarylphosphine and bisphosphine monooxide ligands |
| US4400548A (en) * | 1981-08-17 | 1983-08-23 | Union Carbide Corporation | Hydroformylation process using bisphosphine monooxide ligands |
| EP0097978B1 (en) * | 1982-06-18 | 1985-12-18 | Shell Internationale Researchmaatschappij B.V. | A process for the co-production of carboxylic acids |
| CA1218999A (en) * | 1983-01-25 | 1987-03-10 | Eit Drent | Process for the preparation of carboxylic acids and/or esters |
| CA1231966A (en) * | 1983-12-02 | 1988-01-26 | David J. Schreck | Production of carboxylic acids from alcohols |
| CA1231965A (en) * | 1983-12-02 | 1988-01-26 | David J. Schreck | Synergistic production of carboxylic acids from alcohols |
| CA1252480A (en) * | 1984-07-20 | 1989-04-11 | Richard W. Wegman | Production of carboxylic acids from organic formate esters using rhodium complex catalysts |
-
1985
- 1985-07-05 CA CA000486416A patent/CA1237728A/en not_active Expired
- 1985-07-15 CN CN198585106097A patent/CN85106097A/zh active Pending
- 1985-07-19 DE DE8585109065T patent/DE3561509D1/de not_active Expired
- 1985-07-19 EP EP85109065A patent/EP0171652B1/en not_active Expired
- 1985-07-19 AT AT85109065T patent/ATE32215T1/de not_active IP Right Cessation
- 1985-07-19 AU AU46394/85A patent/AU579175B2/en not_active Ceased
- 1985-07-19 KR KR1019860700158A patent/KR860700247A/ko not_active Withdrawn
- 1985-07-19 JP JP60503390A patent/JPS61502757A/ja active Granted
- 1985-07-19 WO PCT/US1985/001359 patent/WO1986000888A1/en not_active Ceased
- 1985-07-19 MX MX206047A patent/MX162709A/es unknown
- 1985-07-19 ZA ZA855487A patent/ZA855487B/xx unknown
-
1986
- 1986-03-18 NO NO86861042A patent/NO162232C/no unknown
- 1986-03-20 FI FI861188A patent/FI88611C/fi not_active IP Right Cessation
- 1986-07-31 US US06/891,065 patent/US4670570A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CA1237728A (en) | 1988-06-07 |
| FI88611B (fi) | 1993-02-26 |
| NO162232C (no) | 1989-11-29 |
| FI861188A7 (fi) | 1986-03-20 |
| ZA855487B (en) | 1986-03-26 |
| DE3561509D1 (en) | 1988-03-03 |
| US4670570A (en) | 1987-06-02 |
| MX162709A (es) | 1991-06-17 |
| EP0171652B1 (en) | 1988-01-27 |
| CN85106097A (zh) | 1987-01-14 |
| WO1986000888A1 (en) | 1986-02-13 |
| KR860700247A (ko) | 1986-08-01 |
| AU579175B2 (en) | 1988-11-17 |
| ATE32215T1 (de) | 1988-02-15 |
| JPS61502757A (ja) | 1986-11-27 |
| NO162232B (no) | 1989-08-21 |
| EP0171652A1 (en) | 1986-02-19 |
| AU4639485A (en) | 1986-02-25 |
| FI861188A0 (fi) | 1986-03-20 |
| NO861042L (no) | 1986-03-18 |
| JPH0338258B2 (ref) | 1991-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI88611C (fi) | Foerfarande foer framstaellning av karboxylsyror samt rodiumkatalysatorkomplex anvaendbara i foerfarandet | |
| FI88917C (fi) | Foerfarande foer framstaellning av karboxylsyraanhydrider ur metylkarboxylater under anvaendande av rodiumkomplexkatalysatorer | |
| KR890001915B1 (ko) | 유기 카르복실산의 제조방법 | |
| FI89352B (fi) | Framstaellning av vattenfria karboxylsyror och -anhydrider ur alkoholer under anvaendande av rodiumkomplexkatalysatorer och en organisk esterkaella | |
| FI89040C (fi) | Foerfarande foer framstaellning av en blandning av metylacetat och etylacetat | |
| JPH02212453A (ja) | カルボン酸の異性化方法 | |
| US4250329A (en) | Carbonylation process | |
| US4532325A (en) | Carbonylation process | |
| US4927967A (en) | Production of carboxylic acids from organic formate esters using rhodium complex catalysts | |
| US5026907A (en) | Production of carboxylic acids from alcohols using rhodium complex catalysts and organic ester source | |
| US4318826A (en) | Carbonylation catalysts | |
| EP0146823B1 (en) | Production of carboxylic acids from organic formate esters | |
| US4990654A (en) | Production of acetate esters from alcohols using rhodium complex catalysts | |
| EP0171651A1 (en) | Production of carboxylic acids from organic formates using rhodium complex catalysts | |
| US4511741A (en) | Production of aldehydes from organic acid esters | |
| WO1985002400A1 (en) | Process for producing organic acids | |
| JPH0244456B2 (ref) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | Publication of examined application | ||
| MM | Patent lapsed |
Owner name: UNION CARBIDE CORPORATION |