FI76366C - Miljoevaenligt foertunningstillsatsmedel foer borrningsslam som baserar sig pao salt och/eller soett vatten. - Google Patents
Miljoevaenligt foertunningstillsatsmedel foer borrningsslam som baserar sig pao salt och/eller soett vatten. Download PDFInfo
- Publication number
- FI76366C FI76366C FI834367A FI834367A FI76366C FI 76366 C FI76366 C FI 76366C FI 834367 A FI834367 A FI 834367A FI 834367 A FI834367 A FI 834367A FI 76366 C FI76366 C FI 76366C
- Authority
- FI
- Finland
- Prior art keywords
- salt
- additive
- environmentally friendly
- based drilling
- fresh water
- Prior art date
Links
- 238000005553 drilling Methods 0.000 claims description 54
- 239000000654 additive Substances 0.000 claims description 47
- 239000002002 slurry Substances 0.000 claims description 42
- 230000000996 additive effect Effects 0.000 claims description 40
- 239000003085 diluting agent Substances 0.000 claims description 19
- 229920001577 copolymer Polymers 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 12
- 239000013505 freshwater Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Substances [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 8
- -1 ethylene ester Chemical class 0.000 claims description 7
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 238000007334 copolymerization reaction Methods 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 3
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 150000003926 acrylamides Chemical class 0.000 claims description 2
- 230000001476 alcoholic effect Effects 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 2
- 239000000920 calcium hydroxide Substances 0.000 claims description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 2
- 125000004494 ethyl ester group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- 239000010695 polyglycol Substances 0.000 claims description 2
- 229920000151 polyglycol Polymers 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims 1
- 239000000908 ammonium hydroxide Substances 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 238000005498 polishing Methods 0.000 claims 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Substances [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 claims 1
- 238000002474 experimental method Methods 0.000 description 45
- 239000000706 filtrate Substances 0.000 description 18
- 238000000034 method Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000000178 monomer Substances 0.000 description 9
- 239000008186 active pharmaceutical agent Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 229910052500 inorganic mineral Inorganic materials 0.000 description 8
- 239000011707 mineral Substances 0.000 description 8
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 229920001732 Lignosulfonate Polymers 0.000 description 6
- UPHIPHFJVNKLMR-UHFFFAOYSA-N chromium iron Chemical compound [Cr].[Fe] UPHIPHFJVNKLMR-UHFFFAOYSA-N 0.000 description 6
- 238000005259 measurement Methods 0.000 description 6
- 239000013535 sea water Substances 0.000 description 6
- 235000012216 bentonite Nutrition 0.000 description 5
- 239000012530 fluid Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000000440 bentonite Substances 0.000 description 4
- 229910000278 bentonite Inorganic materials 0.000 description 4
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000282320 Panthera leo Species 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- 235000015895 biscuits Nutrition 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- CKFGINPQOCXMAZ-UHFFFAOYSA-N methanediol Chemical compound OCO CKFGINPQOCXMAZ-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical class [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- DPZHKLJPVMYFCU-UHFFFAOYSA-N 2-(5-bromopyridin-2-yl)acetonitrile Chemical compound BrC1=CC=C(CC#N)N=C1 DPZHKLJPVMYFCU-UHFFFAOYSA-N 0.000 description 1
- 229920000536 2-Acrylamido-2-methylpropane sulfonic acid Polymers 0.000 description 1
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 241000173529 Aconitum napellus Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical class CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940023019 aconite Drugs 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- UIERETOOQGIECD-ARJAWSKDSA-N angelic acid group Chemical group C(\C(\C)=C/C)(=O)O UIERETOOQGIECD-ARJAWSKDSA-N 0.000 description 1
- 230000002579 anti-swelling effect Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000003946 cyclohexylamines Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 150000005332 diethylamines Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 239000004459 forage Substances 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- YDZQQRWRVYGNER-UHFFFAOYSA-N iron;titanium;trihydrate Chemical compound O.O.O.[Ti].[Fe] YDZQQRWRVYGNER-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 239000008239 natural water Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- WSHYKIAQCMIPTB-UHFFFAOYSA-M potassium;2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate Chemical compound [K+].[O-]C=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 WSHYKIAQCMIPTB-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- LPXFITACVAQQAL-UHFFFAOYSA-M sodium;prop-2-enoylazanide Chemical compound [Na+].[NH-]C(=O)C=C LPXFITACVAQQAL-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F230/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and containing phosphorus, selenium, tellurium or a metal
- C08F230/02—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and containing phosphorus, selenium, tellurium or a metal containing phosphorus
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K8/00—Compositions for drilling of boreholes or wells; Compositions for treating boreholes or wells, e.g. for completion or for remedial operations
- C09K8/02—Well-drilling compositions
- C09K8/04—Aqueous well-drilling compositions
- C09K8/14—Clay-containing compositions
- C09K8/18—Clay-containing compositions characterised by the organic compounds
- C09K8/22—Synthetic organic compounds
- C09K8/24—Polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Dispersion Chemistry (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Polymers & Plastics (AREA)
- Soil Conditioners And Soil-Stabilizing Materials (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Bulkheads Adapted To Foundation Construction (AREA)
- Treatment Of Sludge (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8220241A FR2536758A1 (fr) | 1982-11-30 | 1982-11-30 | Adjuvant fluidifiant non polluant pour boues de forage a base d'eau saline et /ou d'eau douce |
| FR8220241 | 1982-11-30 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI834367A0 FI834367A0 (fi) | 1983-11-29 |
| FI834367A7 FI834367A7 (fi) | 1984-05-31 |
| FI76366B FI76366B (fi) | 1988-06-30 |
| FI76366C true FI76366C (fi) | 1988-10-10 |
Family
ID=9279739
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI834367A FI76366C (fi) | 1982-11-30 | 1983-11-29 | Miljoevaenligt foertunningstillsatsmedel foer borrningsslam som baserar sig pao salt och/eller soett vatten. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4782120A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS59113083A (cg-RX-API-DMAC7.html) |
| AU (1) | AU575546B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR8306574A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1191675A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3343053C2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK159019C (cg-RX-API-DMAC7.html) |
| FI (1) | FI76366C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2536758A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2133021B (cg-RX-API-DMAC7.html) |
| NL (1) | NL190782C (cg-RX-API-DMAC7.html) |
| NO (1) | NO158302C (cg-RX-API-DMAC7.html) |
| SE (1) | SE459257B (cg-RX-API-DMAC7.html) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4849129A (en) * | 1988-05-06 | 1989-07-18 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4886617A (en) * | 1983-10-26 | 1989-12-12 | Betz Laboratories, Inc. | Water soluble phosphonated polymers |
| US4863614A (en) * | 1983-10-26 | 1989-09-05 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4851490A (en) * | 1983-10-26 | 1989-07-25 | Betz Laboratories, Inc. | Water soluble phosphonated polymers |
| FR2571715B1 (fr) * | 1984-10-16 | 1986-12-26 | Coatex Sa | Composition cimentaire hydraulique a prise retardee pour cimentation a haute temperature et pression |
| CA1244997A (en) * | 1985-08-30 | 1988-11-15 | Calgon Corporation | Acrylic acid/2-acrylamido-2-methylpropyl-sulfonic acid/2-acrylamido-2-methylpropyl phosphonic polymers |
| FR2630728B1 (fr) * | 1988-05-02 | 1991-07-05 | Coatex Sa | Agent inhibiteur d'entartrage et de corrosion pour le traitement des eaux et/ou milieux aqueux |
| US5032295A (en) * | 1989-04-25 | 1991-07-16 | National Starch And Chemical Investment Holding Corporation | Polymers for use in drilling muds |
| US5292367A (en) * | 1990-04-18 | 1994-03-08 | Atlantic Richfield Company | Dispersant compositions for subterranean well drilling and completion |
| WO1991016522A1 (en) * | 1990-04-18 | 1991-10-31 | Atlantic Richfield Company | Dispersant compositions for subterranean well drilling and completion |
| DE4024192A1 (de) * | 1990-07-30 | 1992-02-06 | Uhu Gmbh | Waessrige klebstoffloesung ohne organisches loesungsmittel |
| GB9215228D0 (en) * | 1992-07-17 | 1992-09-02 | Oilfield Chem Tech Ltd | Drilling fluid loss additive |
| US5558171A (en) * | 1994-04-25 | 1996-09-24 | M-I Drilling Fluids L.L.C. | Well drilling process and clay stabilizing agent |
| US6384111B1 (en) * | 1996-12-20 | 2002-05-07 | Basf Aktiengesellschaft | Polymers containing carboxyl groups and polyalkylene ether side- chains as additives in mineral building materials |
| US6107256A (en) * | 1998-08-27 | 2000-08-22 | Fritz Industries, Inc. | Method of and additive for controlling fluid loss from a drilling fluid |
| US6130179A (en) * | 1998-11-12 | 2000-10-10 | Itc, Inc. | Purified attapulgite clay |
| US6444601B1 (en) * | 1998-11-12 | 2002-09-03 | Itc, Inc. | Purified attapulgite clay |
| US20030073586A1 (en) * | 2001-10-03 | 2003-04-17 | Martin Crossman | Scale control composition for high scaling environments |
| FR2902103B1 (fr) * | 2006-06-09 | 2011-11-18 | Coatex Sas | Procede pour epaissir des compositions aqueuses notamment a ph acide, au moyen de polymeres organophosphates, et compositions aqueuses obtenues |
| CN111454392A (zh) * | 2020-03-18 | 2020-07-28 | 滨州德润化工有限责任公司 | 一种钻井液用抗温抗复合盐降失水剂 |
| CN117986458B (zh) | 2024-04-02 | 2024-06-14 | 成都劳恩普斯科技有限公司 | 一种耐高温深穿透分子隔膜酸共聚物及其制备方法 |
| CN119331164B (zh) * | 2024-12-21 | 2025-03-25 | 石家庄华莱鼎盛科技有限公司 | 钻井液用防泥包剂丙烯烷基醇酯及其制备方法和应用 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1100287B (de) * | 1957-03-29 | 1961-02-23 | Rohm & Haas | Verfahren zur Herstellung von phosphorhaltigen Polymeren oder Mischpolymeren |
| FR1538572A (fr) * | 1967-07-26 | 1968-09-06 | Pechiney Saint Gobain | Perfectionnement à la polymérisation en masse à basse température de compositions monomères contenant du chlorure de vinyle, et produits en résultant |
| US3472325A (en) * | 1968-12-23 | 1969-10-14 | Pan American Petroleum Corp | Method of drilling with polymer-treated drilling fluid |
| US3921733A (en) * | 1972-02-09 | 1975-11-25 | Phillips Petroleum Co | Method of drilling a borehole using gelled polymers |
| US3764530A (en) * | 1972-03-15 | 1973-10-09 | Milchem Inc | Composition and process for the reduction of thermal degradation of aqueous drilling fluids |
| US3880764A (en) * | 1972-11-06 | 1975-04-29 | Amoco Prod Co | Polymer non-dispersed drilling fluids |
| US4059552A (en) * | 1974-06-21 | 1977-11-22 | The Dow Chemical Company | Cross-linked water-swellable polymer particles |
| JPS51132234A (en) * | 1975-04-21 | 1976-11-17 | Suriibondo:Kk | An anaerobic adhesive composition |
| JPS5436338A (en) * | 1977-08-26 | 1979-03-17 | Toyo Soda Mfg Co Ltd | Cold-curable water-based coating composition |
| JPS57134493A (en) * | 1981-02-12 | 1982-08-19 | Sankin Kogyo Kk | Phosphoric ester derivative |
| JPS58147412A (ja) * | 1982-02-26 | 1983-09-02 | Nippon Shokubai Kagaku Kogyo Co Ltd | 新規水溶性共重合体及びその製造方法 |
| DE3248019A1 (de) * | 1982-12-24 | 1984-06-28 | Cassella Ag, 6000 Frankfurt | Wasserloesliche copolymerisate, ihre herstellung und ihre verwendung |
| US4487859A (en) * | 1983-11-21 | 1984-12-11 | Scm Corporation | Self-curing water dispersed polymers |
-
1982
- 1982-11-30 FR FR8220241A patent/FR2536758A1/fr active Granted
-
1983
- 1983-11-24 GB GB08331429A patent/GB2133021B/en not_active Expired
- 1983-11-25 SE SE8306530A patent/SE459257B/sv not_active IP Right Cessation
- 1983-11-29 CA CA000442136A patent/CA1191675A/fr not_active Expired
- 1983-11-29 NO NO834391A patent/NO158302C/no not_active IP Right Cessation
- 1983-11-29 JP JP58225330A patent/JPS59113083A/ja active Granted
- 1983-11-29 NL NL8304088A patent/NL190782C/xx not_active IP Right Cessation
- 1983-11-29 DE DE3343053A patent/DE3343053C2/de not_active Expired - Fee Related
- 1983-11-29 DK DK545783A patent/DK159019C/da not_active IP Right Cessation
- 1983-11-29 FI FI834367A patent/FI76366C/fi not_active IP Right Cessation
- 1983-11-29 BR BR8306574A patent/BR8306574A/pt not_active IP Right Cessation
- 1983-11-30 AU AU21841/83A patent/AU575546B2/en not_active Ceased
-
1987
- 1987-04-13 US US07/038,483 patent/US4782120A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO158302B (no) | 1988-05-09 |
| JPH0377834B2 (cg-RX-API-DMAC7.html) | 1991-12-11 |
| DE3343053A1 (de) | 1984-06-28 |
| DK545783A (da) | 1984-05-31 |
| DK545783D0 (da) | 1983-11-29 |
| NL8304088A (nl) | 1984-06-18 |
| FR2536758A1 (fr) | 1984-06-01 |
| JPS59113083A (ja) | 1984-06-29 |
| SE459257B (sv) | 1989-06-19 |
| GB2133021B (en) | 1986-08-28 |
| CA1191675A (fr) | 1985-08-13 |
| GB8331429D0 (en) | 1984-01-04 |
| FI834367A7 (fi) | 1984-05-31 |
| BR8306574A (pt) | 1984-07-03 |
| FR2536758B1 (cg-RX-API-DMAC7.html) | 1985-03-15 |
| NL190782C (nl) | 1994-08-16 |
| GB2133021A (en) | 1984-07-18 |
| US4782120A (en) | 1988-11-01 |
| NO158302C (no) | 1988-08-17 |
| AU2184183A (en) | 1984-06-07 |
| DE3343053C2 (de) | 1995-04-13 |
| FI76366B (fi) | 1988-06-30 |
| SE8306530L (sv) | 1984-05-31 |
| NL190782B (nl) | 1994-03-16 |
| NO834391L (no) | 1984-06-01 |
| SE8306530D0 (sv) | 1983-11-25 |
| AU575546B2 (en) | 1988-08-04 |
| DK159019B (da) | 1990-08-20 |
| FI834367A0 (fi) | 1983-11-29 |
| DK159019C (da) | 1991-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI76366C (fi) | Miljoevaenligt foertunningstillsatsmedel foer borrningsslam som baserar sig pao salt och/eller soett vatten. | |
| US10023782B2 (en) | Salt-tolerant, thermally-stable rheology modifiers | |
| US2775557A (en) | Drilling muds containing acrylic acidacrylamide copolymer salts | |
| US6380137B1 (en) | Copolymers and their use as drilling aids | |
| US5032295A (en) | Polymers for use in drilling muds | |
| US6030928A (en) | Polymers useful in the recovery and processing of natural resources | |
| US4938803A (en) | Vinyl grafted lignite fluid loss additives | |
| US5270382A (en) | Compositions and applications thereof of water-soluble copolymers comprising an ampholytic imidazolium inner salt | |
| WO2017087748A1 (en) | Crosslinked polymers derived from monomers having acryloyl and lactam moieties and sulfonic acid/sulfonate comonomers, compositions thereof, and applications thereof | |
| US4681634A (en) | Composition cimentaire hydraulique a prise retardee pour cimentation a hautes temperature et pression | |
| NO894840L (no) | Tilsetningsmiddel for broennbehandlingsfluider. | |
| US5135909A (en) | Drilling mud comprising tetrapolymer consisting of N-vinyl-2-pyrrolidone, acrylamidopropanesulfonic acid, acrylamide, and acrylic acid | |
| SG172396A1 (en) | Use of vinyl phosphonic acid for producing biodegradable mixed polymers and the use thereof for exploring and extracting petroleum and natural gas | |
| US4637882A (en) | Polyampholytes - high temperature viscosifiers for high ionic strength drilling fluids | |
| US6608159B2 (en) | Polymeric, acrylamide-free water retention agent | |
| JPH0686592B2 (ja) | 淡水又は塩水をベースとするボーリング流体用の非汚染流動化剤 | |
| US7709420B2 (en) | Organophilic clays and methods for the preparation and use thereof | |
| CA2055011A1 (en) | Thermally stable hydrophobically associating rheological control additives for water-based drilling fluids | |
| CN115785922A (zh) | 一种超大位移井高温水基钻井液 | |
| FI80282C (fi) | Anvaendning av akrylpolymer foer inhibering av uppkomsten av partikelformigt material eller som dispergeringsmedel i vattensystem. | |
| CA2332322A1 (en) | Drilling mud conditionning agent | |
| JPS5938277A (ja) | 掘削泥水調整剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: COATEX S.A.S. Owner name: COMPAGNIE FRANCAISE DES PETROLES |