FI74702C - Foerfarande foer framstaellning av antiallergiska imidodisulfamidderivat. - Google Patents
Foerfarande foer framstaellning av antiallergiska imidodisulfamidderivat. Download PDFInfo
- Publication number
- FI74702C FI74702C FI811082A FI811082A FI74702C FI 74702 C FI74702 C FI 74702C FI 811082 A FI811082 A FI 811082A FI 811082 A FI811082 A FI 811082A FI 74702 C FI74702 C FI 74702C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- chloro
- chlorine
- bis
- prepared
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 30
- 238000002360 preparation method Methods 0.000 title claims description 26
- 230000003266 anti-allergic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 81
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 50
- 239000000460 chlorine Chemical group 0.000 claims description 44
- 229910052801 chlorine Chemical group 0.000 claims description 38
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 36
- -1 alkali metal salts Chemical class 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 229910052757 nitrogen Inorganic materials 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 28
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 claims description 17
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 15
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 15
- 229910052794 bromium Inorganic materials 0.000 claims description 15
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- PVMUVDSEICYOMA-UHFFFAOYSA-N n-chlorosulfonylsulfamoyl chloride Chemical compound ClS(=O)(=O)NS(Cl)(=O)=O PVMUVDSEICYOMA-UHFFFAOYSA-N 0.000 claims description 10
- 208000026935 allergic disease Diseases 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- 206010027654 Allergic conditions Diseases 0.000 claims description 2
- 206010020751 Hypersensitivity Diseases 0.000 claims description 2
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 claims 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims 1
- 230000007815 allergy Effects 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 125000001309 chloro group Chemical group Cl* 0.000 description 34
- 239000000243 solution Substances 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 239000007787 solid Substances 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000002431 hydrogen Chemical group 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 16
- AGLUHFDQESLMFH-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-1-sulfonyl chloride Chemical compound C1=CC=C2C(S(=O)(=O)Cl)NCCC2=C1 AGLUHFDQESLMFH-UHFFFAOYSA-N 0.000 description 15
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 125000001246 bromo group Chemical group Br* 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 210000001519 tissue Anatomy 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 10
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000000556 agonist Substances 0.000 description 9
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 150000001448 anilines Chemical class 0.000 description 7
- 150000003526 tetrahydroisoquinolines Chemical class 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 208000006673 asthma Diseases 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 238000007040 multi-step synthesis reaction Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VROHMYFSWKZSPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-1-thiol Chemical class C1=CC=C2C(S)NCCC2=C1 VROHMYFSWKZSPU-UHFFFAOYSA-N 0.000 description 4
- MULMLDROTQLKML-UHFFFAOYSA-N 2-acetyl-3,4-dihydro-1h-isoquinoline-7-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2CN(C(=O)C)CCC2=C1 MULMLDROTQLKML-UHFFFAOYSA-N 0.000 description 4
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000003042 antagnostic effect Effects 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical class COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 4
- 239000008024 pharmaceutical diluent Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 4
- JBPPSLURCSFQDH-UHFFFAOYSA-N 1-(3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=CC=C2CN(C(=O)C)CCC2=C1 JBPPSLURCSFQDH-UHFFFAOYSA-N 0.000 description 3
- MATYZNMRPBYULY-UHFFFAOYSA-N 1-(8-chloro-3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=CC(Cl)=C2CN(C(=O)C)CCC2=C1 MATYZNMRPBYULY-UHFFFAOYSA-N 0.000 description 3
- VPMKHGVPUCZCGT-UHFFFAOYSA-N 2-acetyl-8-chloro-3,4-dihydro-1h-isoquinoline-5-sulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C2=C1CN(C(=O)C)CC2 VPMKHGVPUCZCGT-UHFFFAOYSA-N 0.000 description 3
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- 238000006796 Pomeranz-Fritsch reaction Methods 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- HFDHDYGQEYMIPA-UHFFFAOYSA-N 2-acetyl-7-chloro-3,4-dihydro-1h-isoquinoline-6-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=C(Cl)C=C2CN(C(=O)C)CCC2=C1 HFDHDYGQEYMIPA-UHFFFAOYSA-N 0.000 description 2
- OMTNVLWKFRGEFK-UHFFFAOYSA-N 2-acetyl-7-chloro-3,4-dihydro-1h-isoquinoline-8-sulfonyl chloride Chemical compound C1=C(Cl)C(S(Cl)(=O)=O)=C2CN(C(=O)C)CCC2=C1 OMTNVLWKFRGEFK-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229960000265 cromoglicic acid Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- FMRFUKZPHGBWHF-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinolin-1-ol Chemical compound C1=CC=C2C(O)NCCC2=C1 FMRFUKZPHGBWHF-UHFFFAOYSA-N 0.000 description 1
- XQJUCECRAKYIHG-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-8-thiol Chemical compound C1CNCC2=C1C=CC=C2S XQJUCECRAKYIHG-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- PDYUNNFIOWTXLS-UHFFFAOYSA-N 1-(3,4,4a,5-tetrahydro-1h-isoquinolin-2-yl)ethanone Chemical class C1C=CC=C2CN(C(=O)C)CCC21 PDYUNNFIOWTXLS-UHFFFAOYSA-N 0.000 description 1
- PSQATYDOUXPBMP-UHFFFAOYSA-N 1-(7,8-dichloro-3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=C(Cl)C(Cl)=C2CN(C(=O)C)CCC2=C1 PSQATYDOUXPBMP-UHFFFAOYSA-N 0.000 description 1
- JYLGXYJNGDJZNE-UHFFFAOYSA-N 1-(7-chloro-3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=C(Cl)C=C2CN(C(=O)C)CCC2=C1 JYLGXYJNGDJZNE-UHFFFAOYSA-N 0.000 description 1
- MOMFXATYAINJML-UHFFFAOYSA-N 2-Acetylthiazole Chemical group CC(=O)C1=NC=CS1 MOMFXATYAINJML-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FMQJLOYDWUFNRO-UHFFFAOYSA-N 2-acetyl-5-chloro-3,4-dihydro-1h-isoquinoline-7-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=C2CN(C(=O)C)CCC2=C1Cl FMQJLOYDWUFNRO-UHFFFAOYSA-N 0.000 description 1
- IYVNIJXWWXAROM-UHFFFAOYSA-N 2-acetyl-6-chloro-3,4-dihydro-1h-isoquinoline-5-sulfonyl chloride Chemical compound C1=CC(Cl)=C(S(Cl)(=O)=O)C2=C1CN(C(=O)C)CC2 IYVNIJXWWXAROM-UHFFFAOYSA-N 0.000 description 1
- NSXCDSAFCAFQMM-UHFFFAOYSA-N 2-acetyl-7-bromo-3,4-dihydro-1h-isoquinoline-5-sulfonyl chloride Chemical compound C1=C(Br)C=C(S(Cl)(=O)=O)C2=C1CN(C(=O)C)CC2 NSXCDSAFCAFQMM-UHFFFAOYSA-N 0.000 description 1
- YXWXVRNARIWPQC-UHFFFAOYSA-N 2-acetyl-8-chloro-3,4-dihydro-1H-isoquinoline-7-sulfonyl chloride 7-methoxyisoquinoline Chemical compound COC1=CC=C2C=CN=CC2=C1.C(C)(=O)N1CC2=C(C(=CC=C2CC1)S(=O)(=O)Cl)Cl YXWXVRNARIWPQC-UHFFFAOYSA-N 0.000 description 1
- BLUDQYSSDUKOLU-UHFFFAOYSA-N 2-acetyl-8-chloro-3,4-dihydro-1h-isoquinoline-7-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C(Cl)=C2CN(C(=O)C)CCC2=C1 BLUDQYSSDUKOLU-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- SJKFSPMCULOHJC-UHFFFAOYSA-N 2-chloro-1-(2-isocyanatoethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCN=C=O)C(Cl)=C1 SJKFSPMCULOHJC-UHFFFAOYSA-N 0.000 description 1
- LNEVUNYUJNORRV-UHFFFAOYSA-N 2-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(Cl)=C1 LNEVUNYUJNORRV-UHFFFAOYSA-N 0.000 description 1
- IOYIDSMWPLNHRC-UHFFFAOYSA-N 2h-isoquinoline-1-thione Chemical compound C1=CC=C2C(S)=NC=CC2=C1 IOYIDSMWPLNHRC-UHFFFAOYSA-N 0.000 description 1
- KZOLMXOHXUCZTK-UHFFFAOYSA-N 3,4-dihydro-2h-quinoline-1-sulfonyl chloride Chemical compound C1=CC=C2N(S(=O)(=O)Cl)CCCC2=C1 KZOLMXOHXUCZTK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DTVYNUOOZIKEEX-UHFFFAOYSA-N 5-aminoisoquinoline Chemical compound N1=CC=C2C(N)=CC=CC2=C1 DTVYNUOOZIKEEX-UHFFFAOYSA-N 0.000 description 1
- OHOZWCJUZQXMAW-UHFFFAOYSA-N 5-chloro-1,2,3,4-tetrahydroisoquinoline Chemical compound C1NCCC2=C1C=CC=C2Cl OHOZWCJUZQXMAW-UHFFFAOYSA-N 0.000 description 1
- FFGZGGGYWZLXPL-UHFFFAOYSA-N 5-chloro-7-methoxy-3,4-dihydro-2h-isoquinolin-1-one Chemical compound C1CNC(=O)C2=CC(OC)=CC(Cl)=C21 FFGZGGGYWZLXPL-UHFFFAOYSA-N 0.000 description 1
- PJHSMEMFNSINJE-UHFFFAOYSA-N 5-chloroisoquinoline Chemical compound N1=CC=C2C(Cl)=CC=CC2=C1 PJHSMEMFNSINJE-UHFFFAOYSA-N 0.000 description 1
- YJNKVSVKLAVIMU-UHFFFAOYSA-N 5-nitro-1,2,3,4-tetrahydroisoquinoline Chemical compound C1NCCC2=C1C=CC=C2[N+](=O)[O-] YJNKVSVKLAVIMU-UHFFFAOYSA-N 0.000 description 1
- DGSJGBOBESCDCM-UHFFFAOYSA-N 6-chloro-8-methoxyisoquinoline Chemical compound C1=NC=C2C(OC)=CC(Cl)=CC2=C1 DGSJGBOBESCDCM-UHFFFAOYSA-N 0.000 description 1
- XZNUJESLPUNSNO-UHFFFAOYSA-N 6-methoxyisoquinoline Chemical class C1=NC=CC2=CC(OC)=CC=C21 XZNUJESLPUNSNO-UHFFFAOYSA-N 0.000 description 1
- PNNUXNXZDJVGSB-UHFFFAOYSA-N 7-methoxyisoquinoline Chemical compound C1=CN=CC2=CC(OC)=CC=C21 PNNUXNXZDJVGSB-UHFFFAOYSA-N 0.000 description 1
- PYSJYEZRPVRRLV-UHFFFAOYSA-N 8-chloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride Chemical compound Cl.C1CNCC2=C1C=CC=C2Cl PYSJYEZRPVRRLV-UHFFFAOYSA-N 0.000 description 1
- YYTANQIIJAWDDI-UHFFFAOYSA-N 8-chloro-6-methoxyisoquinoline Chemical compound C1=NC=CC2=CC(OC)=CC(Cl)=C21 YYTANQIIJAWDDI-UHFFFAOYSA-N 0.000 description 1
- ZNMOGEZXEJVMOB-UHFFFAOYSA-N 8-chloroisoquinoline-7-thiol Chemical compound C1=CN=CC2=C(Cl)C(S)=CC=C21 ZNMOGEZXEJVMOB-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- ZBAOLDGKAGXFPA-UHFFFAOYSA-N CC(CC1=C(C=C(C=C1)OC)Cl)C(=O)O Chemical compound CC(CC1=C(C=C(C=C1)OC)Cl)C(=O)O ZBAOLDGKAGXFPA-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 238000007192 Meerwein reaction reaction Methods 0.000 description 1
- ZPYGIJOUGZCKSD-UHFFFAOYSA-N NC1=C2C=CN=CC2=CC=C1.C(C)(=O)N1CC2=C(C=CC(=C2CC1)Cl)S(=O)(=O)Cl Chemical compound NC1=C2C=CN=CC2=CC=C1.C(C)(=O)N1CC2=C(C=CC(=C2CC1)Cl)S(=O)(=O)Cl ZPYGIJOUGZCKSD-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 238000005957 chlorosulfonylation reaction Methods 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- ZXSBDSGRQIWJPM-UHFFFAOYSA-N dimethylcarbamothioic s-acid Chemical class CN(C)C(S)=O ZXSBDSGRQIWJPM-UHFFFAOYSA-N 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- 239000002038 ethyl acetate fraction Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 210000003405 ileum Anatomy 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/08—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with a hetero atom directly attached to the ring nitrogen atom
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Immunology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14002180A | 1980-04-14 | 1980-04-14 | |
| US14002180 | 1980-04-14 | ||
| US06/159,340 US4315935A (en) | 1980-04-14 | 1980-06-13 | N,N'-Bis[substituted-1,2,3,4-tetrahydroisoquinolinolyl]disulfonylimides and antiallergic compositions and method of use |
| US15934080 | 1980-06-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI811082L FI811082L (fi) | 1981-10-15 |
| FI74702B FI74702B (fi) | 1987-11-30 |
| FI74702C true FI74702C (fi) | 1988-03-10 |
Family
ID=26837794
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI811082A FI74702C (fi) | 1980-04-14 | 1981-04-08 | Foerfarande foer framstaellning av antiallergiska imidodisulfamidderivat. |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4315935A (mber) |
| EP (1) | EP0038177B1 (mber) |
| KR (1) | KR850000272B1 (mber) |
| AR (1) | AR229160A1 (mber) |
| AU (1) | AU536754B2 (mber) |
| BG (1) | BG35328A3 (mber) |
| CA (1) | CA1162545A (mber) |
| CS (1) | CS222695B2 (mber) |
| DD (1) | DD158240A5 (mber) |
| DE (1) | DE3160805D1 (mber) |
| DK (1) | DK149846C (mber) |
| ES (1) | ES501195A0 (mber) |
| FI (1) | FI74702C (mber) |
| GR (1) | GR75217B (mber) |
| IE (1) | IE51220B1 (mber) |
| IL (1) | IL62631A (mber) |
| MX (1) | MX6697E (mber) |
| NO (1) | NO811278L (mber) |
| NZ (1) | NZ196773A (mber) |
| PL (1) | PL125404B1 (mber) |
| PT (1) | PT72828B (mber) |
| RO (1) | RO81944A (mber) |
| SU (1) | SU1017169A3 (mber) |
| YU (1) | YU98081A (mber) |
| ZW (1) | ZW8381A1 (mber) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1582884A (en) * | 1977-05-19 | 1981-01-14 | Beecham Group Ltd | Clavulanic acid derivatives their preparation and use |
| ZA804670B (en) * | 1979-08-03 | 1981-07-29 | Beecham Group Ltd | Derivatives of clavulanic acid, a process for their preparation and their use |
| EP0053893B1 (en) * | 1980-12-09 | 1985-03-20 | Beecham Group Plc | Derivatives of clavulanic acid, their preparation and their use |
| US4562182A (en) * | 1980-12-23 | 1985-12-31 | Beecham Group P.L.C. | Compounds containing beta-lactams |
| US4385047A (en) * | 1981-01-05 | 1983-05-24 | Smithkline Beckman Corporation | Antiallergic imidodisulfamides |
| US4456757A (en) * | 1981-03-20 | 1984-06-26 | Asahi Kasei Kogyo Kabushiki Kaisha | Isoquinolinesulfonyl derivatives and process for the preparation thereof |
| US4350698A (en) * | 1981-09-25 | 1982-09-21 | Smithkline Corporation | Antiallergic imidosulfamides |
| US4536510A (en) * | 1983-07-22 | 1985-08-20 | Smith Kline Beckman Corporation | Method of antagonizing the effects of thromboxane |
| US4678783B1 (en) * | 1983-11-04 | 1995-04-04 | Asahi Chemical Ind | Substituted isoquinolinesulfonyl compounds |
| GB8717374D0 (en) * | 1987-07-22 | 1987-08-26 | Smith Kline French Lab | Pharmaceutically active compounds |
| DE19719817A1 (de) * | 1997-05-13 | 1998-11-19 | Hoechst Ag | Substituierte 6- und 7-Aminotetrahydroisochinolincarbonsäuren |
| AU2001256733A1 (en) * | 2000-05-16 | 2001-11-26 | Takeda Chemical Industries Ltd. | Melanin-concentrating hormone antagonist |
| CA2619346A1 (en) * | 2005-08-22 | 2007-03-01 | Transfert Plus, S.E.C. | Process for preparing sulfonylimides and derivatives thereof |
| JP5630048B2 (ja) | 2009-03-31 | 2014-11-26 | セントラル硝子株式会社 | イミド酸化合物の製造方法 |
| JP5471045B2 (ja) | 2009-06-03 | 2014-04-16 | セントラル硝子株式会社 | イミド酸塩の製造方法 |
| AR080375A1 (es) * | 2010-03-05 | 2012-04-04 | Sanofi Aventis | Procedimiento para la preparacion de 2-(cicloheximetil)-n-{2-[(2s)-1-metilpirrolidin-2-il] etil}-1,2,3,4-tetrahidroisoquinolina- 7-sulfonamida |
| US9035059B2 (en) | 2011-03-14 | 2015-05-19 | Taisho Pharmaceutical Co., Ltd. | Nitrogen-containing condensed heterocyclic compound |
| CN103524387A (zh) * | 2013-10-25 | 2014-01-22 | 中国海洋石油总公司 | 一种双氟磺酰亚胺锂盐的制备方法 |
| CN109721037B (zh) | 2019-03-11 | 2019-12-24 | 上海如鲲新材料有限公司 | 一种双氟磺酰亚胺盐的新工艺 |
| CN115010102B (zh) * | 2022-06-29 | 2024-01-26 | 山东凯盛新材料股份有限公司 | 一种双氟磺酰亚胺的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1384530A (en) * | 1971-07-29 | 1975-02-19 | Fisons Ltd | Chromone derivatives |
| AT352135B (de) * | 1975-07-30 | 1979-09-10 | Thomae Gmbh Dr K | Verfahren zur herstellung neuer homophthalimide und ihrer salze |
| AU506657B2 (en) * | 1975-12-10 | 1980-01-17 | Wellcome Foundation Limited, The | Isoquinoline derivatives |
| US4192877A (en) * | 1977-08-01 | 1980-03-11 | Massachusetts General Hospital | Neuromuscular blocking agents |
| US4252818A (en) * | 1979-08-02 | 1981-02-24 | Merck & Co., Inc. | Novel benzopyran derivatives |
-
1980
- 1980-06-13 US US06/159,340 patent/US4315935A/en not_active Expired - Lifetime
-
1981
- 1981-04-08 AU AU69200/81A patent/AU536754B2/en not_active Ceased
- 1981-04-08 FI FI811082A patent/FI74702C/fi not_active IP Right Cessation
- 1981-04-08 RO RO81103970A patent/RO81944A/ro unknown
- 1981-04-08 CS CS812653A patent/CS222695B2/cs unknown
- 1981-04-08 CA CA000375005A patent/CA1162545A/en not_active Expired
- 1981-04-09 NZ NZ196773A patent/NZ196773A/xx unknown
- 1981-04-09 PT PT72828A patent/PT72828B/pt unknown
- 1981-04-09 DE DE8181301551T patent/DE3160805D1/de not_active Expired
- 1981-04-09 ES ES501195A patent/ES501195A0/es active Granted
- 1981-04-09 DK DK160681A patent/DK149846C/da not_active IP Right Cessation
- 1981-04-09 EP EP81301551A patent/EP0038177B1/en not_active Expired
- 1981-04-10 BG BG051608A patent/BG35328A3/xx unknown
- 1981-04-10 PL PL1981230622A patent/PL125404B1/pl unknown
- 1981-04-10 IL IL62631A patent/IL62631A/xx unknown
- 1981-04-10 ZW ZW83/81A patent/ZW8381A1/xx unknown
- 1981-04-13 NO NO811278A patent/NO811278L/no unknown
- 1981-04-13 KR KR1019810001251A patent/KR850000272B1/ko not_active Expired
- 1981-04-13 IE IE829/81A patent/IE51220B1/en unknown
- 1981-04-13 SU SU813277099A patent/SU1017169A3/ru active
- 1981-04-13 GR GR64670A patent/GR75217B/el unknown
- 1981-04-14 YU YU00980/81A patent/YU98081A/xx unknown
- 1981-04-14 MX MX819405U patent/MX6697E/es unknown
- 1981-04-14 AR AR284964A patent/AR229160A1/es active
- 1981-04-14 DD DD81229225A patent/DD158240A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES8207145A1 (es) | 1982-09-01 |
| PL125404B1 (en) | 1983-05-31 |
| PL230622A1 (mber) | 1981-12-23 |
| DD158240A5 (de) | 1983-01-05 |
| EP0038177A1 (en) | 1981-10-21 |
| ZW8381A1 (en) | 1981-07-08 |
| KR830005148A (ko) | 1983-08-03 |
| FI74702B (fi) | 1987-11-30 |
| YU98081A (en) | 1983-10-31 |
| NO811278L (no) | 1981-10-15 |
| CS222695B2 (en) | 1983-07-29 |
| PT72828B (en) | 1982-03-30 |
| SU1017169A3 (ru) | 1983-05-07 |
| IE810829L (en) | 1981-10-14 |
| AU536754B2 (en) | 1984-05-24 |
| ES501195A0 (es) | 1982-09-01 |
| KR850000272B1 (ko) | 1985-03-15 |
| RO81944A (ro) | 1983-06-01 |
| GR75217B (mber) | 1984-07-13 |
| FI811082L (fi) | 1981-10-15 |
| CA1162545A (en) | 1984-02-21 |
| DE3160805D1 (en) | 1983-10-06 |
| PT72828A (en) | 1981-05-01 |
| MX6697E (es) | 1985-10-21 |
| DK160681A (da) | 1981-10-15 |
| IE51220B1 (en) | 1986-11-12 |
| US4315935A (en) | 1982-02-16 |
| RO81944B (ro) | 1983-05-30 |
| AU6920081A (en) | 1981-10-22 |
| BG35328A3 (en) | 1984-03-15 |
| IL62631A (en) | 1984-05-31 |
| NZ196773A (en) | 1983-07-15 |
| DK149846B (da) | 1986-10-13 |
| AR229160A1 (es) | 1983-06-30 |
| DK149846C (da) | 1987-06-29 |
| EP0038177B1 (en) | 1983-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI74702C (fi) | Foerfarande foer framstaellning av antiallergiska imidodisulfamidderivat. | |
| AU600992B2 (en) | Tetrahydroisoquinolin-2-yl derivatives of carboxylic acids | |
| JPH0253762A (ja) | 新規スルホンアミドおよびこれを含有する、物質代謝機能病および血行障害治療薬 | |
| US4321254A (en) | Antiallergic imidodisulfamides | |
| US4317826A (en) | N,N'-Bis[substituted-1,2,3,4 tetrahydroisoquinolyl]disulfonylimides and antiallergic compositions and method of use | |
| ES2234044T3 (es) | Compuestos anulares de siete miembros, condensados sustituidos con sulfonamido con actividad bloqueante del canal de potasio. | |
| EP0074741B1 (en) | Method of producing alpha2 antagonism | |
| GB2125402A (en) | New tetrazine derivatives | |
| US4350698A (en) | Antiallergic imidosulfamides | |
| US4228170A (en) | 7- and/or 8-Sulfur substituted 1,2,3,4-tetrahydroisoquinoline compounds | |
| US4179512A (en) | 4-Substituted-2-arylimidazoles | |
| US4258049A (en) | Inhibiting phenylethanolamine N-methyltransferase with thiadiazolo and oxadiazolotetrahydroisoquinolines | |
| US4110456A (en) | 4-substituted-2-arylimidazoles | |
| HU184848B (en) | Proces for producing imidodisulfemides and antyaliergistic pharmaceutical compositions containing them as active agents | |
| US6333349B1 (en) | Sulfonamide-substituted fused 7-membered ring compounds, their use as a medicament, and pharmaceutical preparations comprising them | |
| EP0023761B1 (en) | Tetrahydroisoquinoline derivatives, process for preparing them and compositions containing them | |
| SK17698A3 (en) | Sulfonamide substituted compounds, a medicament containing same and their use | |
| Chiyanzu | Synthesis and biological evaluation of antiparasitic Cysteine protease inhibitors based on the Isatin Scaffold |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: SMITHKLINE BECKMAN CORPORATION |