FI68868C - Foerfarande foer framstaellning av pappersmassa - Google Patents
Foerfarande foer framstaellning av pappersmassa Download PDFInfo
- Publication number
- FI68868C FI68868C FI773661A FI773661A FI68868C FI 68868 C FI68868 C FI 68868C FI 773661 A FI773661 A FI 773661A FI 773661 A FI773661 A FI 773661A FI 68868 C FI68868 C FI 68868C
- Authority
- FI
- Finland
- Prior art keywords
- cooking
- aid
- cooking aid
- weight
- group
- Prior art date
Links
- 238000010411 cooking Methods 0.000 claims description 64
- 238000000034 method Methods 0.000 claims description 49
- 230000008569 process Effects 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- MUVQKFGNPGZBII-UHFFFAOYSA-N 1-anthrol Chemical class C1=CC=C2C=C3C(O)=CC=CC3=CC2=C1 MUVQKFGNPGZBII-UHFFFAOYSA-N 0.000 claims description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- 239000012978 lignocellulosic material Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- NPRZDDJMZQXFBQ-UHFFFAOYSA-N 1,2-dihydroanthracene-9,10-diol Chemical compound C1=CC=C2C(O)=C(CCC=C3)C3=C(O)C2=C1 NPRZDDJMZQXFBQ-UHFFFAOYSA-N 0.000 claims description 5
- JIKINXKGAKAVAP-UHFFFAOYSA-N 2,3-dihydroxyanthracene-1-sulfonic acid Chemical compound C1=CC=C2C=C(C(=C(C(O)=C3)O)S(O)(=O)=O)C3=CC2=C1 JIKINXKGAKAVAP-UHFFFAOYSA-N 0.000 claims description 3
- 229930192627 Naphthoquinone Natural products 0.000 claims description 3
- 125000005577 anthracene group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000002791 naphthoquinones Chemical class 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 3
- 238000005698 Diels-Alder reaction Methods 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- FHSNICPEHCKJIG-UHFFFAOYSA-N 9,10-dihydroxyanthracene-1-carboxylic acid Chemical compound OC=1C2=CC=CC=C2C(=C2C=CC=C(C12)C(=O)O)O FHSNICPEHCKJIG-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 235000014347 soups Nutrition 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- UTCOUOISVRSLSH-UHFFFAOYSA-N 1,2-Anthracenediol Chemical compound C1=CC=CC2=CC3=C(O)C(O)=CC=C3C=C21 UTCOUOISVRSLSH-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000002023 wood Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000011121 hardwood Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 2
- 241000609240 Ambelania acida Species 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 2
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000010905 bagasse Substances 0.000 description 2
- 235000009120 camo Nutrition 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 235000005607 chanvre indien Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000011487 hemp Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- TZWRAFHCEQYNEB-UHFFFAOYSA-M sodium;2,3-dihydroxyanthracene-1-carboxylate Chemical compound [Na+].C1=CC=C2C=C(C(C([O-])=O)=C(C(O)=C3)O)C3=CC2=C1 TZWRAFHCEQYNEB-UHFFFAOYSA-M 0.000 description 2
- 239000011122 softwood Substances 0.000 description 2
- JTPNRXUCIXHOKM-UHFFFAOYSA-N 1-chloronaphthalene Chemical compound C1=CC=C2C(Cl)=CC=CC2=C1 JTPNRXUCIXHOKM-UHFFFAOYSA-N 0.000 description 1
- NLZXYHBLSOLTKF-UHFFFAOYSA-N 1-hydroxyanthracene-2-carboxylic acid Chemical compound C1=CC=CC2=CC3=C(O)C(C(=O)O)=CC=C3C=C21 NLZXYHBLSOLTKF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LBAUYFMNZLYLGG-UHFFFAOYSA-M C1=CC2=CC3=CC=CC=C3C=C2C2SC12.[OH-].O.O.[Na+] Chemical compound C1=CC2=CC3=CC=CC=C3C=C2C2SC12.[OH-].O.O.[Na+] LBAUYFMNZLYLGG-UHFFFAOYSA-M 0.000 description 1
- 229920002488 Hemicellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- LQEZQDLRBZVWLR-UHFFFAOYSA-N [Na].OC1=C(C2=CC3=CC=CC=C3C=C2C=C1)C(=O)O Chemical compound [Na].OC1=C(C2=CC3=CC=CC=C3C=C2C=C1)C(=O)O LQEZQDLRBZVWLR-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- -1 e.g. Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ZUFVXZVXEJHHBN-UHFFFAOYSA-N hydron;1,2,3,4-tetrahydroacridin-9-amine;chloride Chemical compound [Cl-].C1=CC=C2C([NH3+])=C(CCCC3)C3=NC2=C1 ZUFVXZVXEJHHBN-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- YZZLIHJEKCVDCO-UHFFFAOYSA-M sodium;2,3-dihydroxyanthracene-1-sulfonate Chemical compound [Na+].C1=CC=C2C=C(C(=C(C(O)=C3)O)S([O-])(=O)=O)C3=CC2=C1 YZZLIHJEKCVDCO-UHFFFAOYSA-M 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C3/00—Pulping cellulose-containing materials
- D21C3/22—Other features of pulping processes
- D21C3/222—Use of compounds accelerating the pulping processes
Landscapes
- Paper (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14849276 | 1976-12-10 | ||
| JP14849276A JPS5374101A (en) | 1976-12-10 | 1976-12-10 | Pulp making method |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI773661A7 FI773661A7 (fi) | 1978-06-11 |
| FI68868B FI68868B (fi) | 1985-07-31 |
| FI68868C true FI68868C (fi) | 1985-11-11 |
Family
ID=15453954
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI773661A FI68868C (fi) | 1976-12-10 | 1977-12-02 | Foerfarande foer framstaellning av pappersmassa |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | USRE32943E (enExample) |
| JP (1) | JPS5374101A (enExample) |
| AU (1) | AU513517B2 (enExample) |
| BR (1) | BR7708218A (enExample) |
| CA (1) | CA1106557A (enExample) |
| DE (1) | DE2754991C3 (enExample) |
| FI (1) | FI68868C (enExample) |
| FR (1) | FR2373637A1 (enExample) |
| NO (1) | NO150087C (enExample) |
| NZ (1) | NZ185734A (enExample) |
| SE (1) | SE437171B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51112903A (en) * | 1975-03-26 | 1976-10-05 | Honshu Paper Co Ltd | Process for digesting lignocellulose material with sulphites |
| US4036681A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with an alkaline pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone |
| US4036680A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with a soda pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone in admixture with a nitro aromatic compound |
| JPS6059356B2 (ja) * | 1977-12-05 | 1985-12-24 | 川崎化成工業株式会社 | パルプの製造方法 |
| FR2435457A1 (fr) * | 1978-06-29 | 1980-04-04 | Ugine Kuhlmann | Hexahydro-1,2,3,4,4a, 9a anthracene-dione-9,10, sa preparation et son application a la delignification des materiaux lignocellulosiques |
| JPS5512806A (en) * | 1978-07-04 | 1980-01-29 | Oji Paper Co | Alkali pulp producing method |
| FR2442912A1 (fr) * | 1978-07-27 | 1980-06-27 | Ugine Kuhlmann | Procede de cuisson de materiaux lignocellulosiques en vue de la production de pate a papier |
| JPS55128091A (en) * | 1979-03-23 | 1980-10-03 | Oji Paper Co | Pulping of lignocellulose material |
| JPS58125737U (ja) * | 1982-02-18 | 1983-08-26 | 株式会社シマノ | キヤリパ−ブレ−キ |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE326705C (de) * | 1919-10-17 | 1920-09-30 | Richard Hartmuth Dr | Verfahren zur Behandlung von Holz oder zellulosehaltigen Stoffen zwecks Gewinnung von Zellulose und kuenstlichem Harz, Lack, Asphalt u. dgl. |
| US1658213A (en) * | 1924-09-30 | 1928-02-07 | Otto C Strecker | Process for the production of cellulose by decomposition of vegetable fibers |
| US1705424A (en) * | 1924-09-30 | 1929-03-12 | Strecker Otto Carl | Process for the production of cellulose by decomposition of vegetable fibers |
| DE486533C (de) * | 1926-12-24 | 1929-11-19 | Otto C Strecker Fa Dr | Verfahren zum Gewinnen von Zellstoff |
| US1890040A (en) * | 1928-05-07 | 1932-12-06 | Gen Aniline Works Inc | Production of anthraquinone and derivatives thereof |
| BE370781A (enExample) * | 1929-06-07 | |||
| DE569853C (de) * | 1929-08-07 | 1933-02-09 | E H Willi Schacht Dr Ing | Verfahren zur Herstellung eines Halbzellstoffes aus Stroh und Graesern |
| US2883826A (en) * | 1953-01-07 | 1959-04-28 | Univ Minnesota | Process for conditioning plant fibers for spinning |
| FR72957E (enExample) * | 1956-11-05 | |||
| CA986662A (en) * | 1973-05-01 | 1976-04-06 | David L. Mccandless | Pretreatment of lignocellulosic material with anthraquinone salts in alkaline pulping |
| JPS51112903A (en) * | 1975-03-26 | 1976-10-05 | Honshu Paper Co Ltd | Process for digesting lignocellulose material with sulphites |
| JPS5143403A (en) * | 1974-10-09 | 1976-04-14 | Honshu Paper Co Ltd | Arukariparupuno seizohoho |
| JPS51109303A (ja) * | 1975-03-24 | 1976-09-28 | Honshu Paper Co Ltd | Arukariisansoshorinyoru rigunoseruroosubutsushitsuno datsuriguninho |
| CA1073161A (en) * | 1975-09-05 | 1980-03-11 | Canadian Industries Limited | Delignification process |
| ZA773044B (en) * | 1976-06-02 | 1978-04-26 | Australian Paper Manufacturers | Improvements in pulping processes |
| US4036681A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with an alkaline pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone |
-
1976
- 1976-12-10 JP JP14849276A patent/JPS5374101A/ja active Granted
-
1977
- 1977-11-21 NZ NZ185734A patent/NZ185734A/xx unknown
- 1977-11-23 SE SE7713266A patent/SE437171B/xx not_active IP Right Cessation
- 1977-11-23 AU AU30870/77A patent/AU513517B2/en not_active Expired
- 1977-11-28 NO NO774067A patent/NO150087C/no unknown
- 1977-11-30 CA CA292,069A patent/CA1106557A/en not_active Expired
- 1977-12-02 FI FI773661A patent/FI68868C/fi not_active IP Right Cessation
- 1977-12-09 FR FR7737226A patent/FR2373637A1/fr active Granted
- 1977-12-09 DE DE2754991A patent/DE2754991C3/de not_active Expired
- 1977-12-09 BR BR7708218A patent/BR7708218A/pt unknown
-
1981
- 1981-02-12 US US06/233,962 patent/USRE32943E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO774067L (no) | 1978-06-13 |
| FI68868B (fi) | 1985-07-31 |
| FR2373637A1 (fr) | 1978-07-07 |
| NO150087C (no) | 1984-08-15 |
| NZ185734A (en) | 1980-11-28 |
| DE2754991A1 (de) | 1978-06-15 |
| FR2373637B1 (enExample) | 1979-04-27 |
| DE2754991C3 (de) | 1987-06-19 |
| DE2754991B2 (de) | 1979-01-18 |
| SE7713266L (sv) | 1978-06-11 |
| CA1106557A (en) | 1981-08-11 |
| JPS5374101A (en) | 1978-07-01 |
| JPS5719239B2 (enExample) | 1982-04-21 |
| NO150087B (no) | 1984-05-07 |
| SE437171B (sv) | 1985-02-11 |
| FI773661A7 (fi) | 1978-06-11 |
| BR7708218A (pt) | 1978-09-05 |
| AU513517B2 (en) | 1980-12-04 |
| AU3087077A (en) | 1979-05-31 |
| USRE32943E (en) | 1989-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2844796B1 (de) | Verfahren zur herstellung von zellstoff mit niedrigem ligningehalt aus lignocellulosischem material | |
| FI68868C (fi) | Foerfarande foer framstaellning av pappersmassa | |
| FI117632B (fi) | Menetelmä massan valmistamiseksi | |
| JPH01104891A (ja) | リグノセルロース含有物質のパルプ化法 | |
| ES3015167T3 (en) | Biomass processing method | |
| US4181565A (en) | Process for cooking lignocellulosic material in the presence of hydroxyanthracenes and derivatives thereof | |
| US3832278A (en) | Prehydrolysis and digestion of bagasse fibers | |
| FI71780B (fi) | Kokningsfoerfarande foer lignocellulosamaterial i och foer framstaellning av pappersmassa | |
| JPS63126984A (ja) | リグノセルロ−ス材料の脱リグニン方法 | |
| RU2773160C1 (ru) | Способ получения целлюлозы | |
| SU931874A1 (ru) | Варочна жидкость дл получени целлюлозы | |
| CA1192009A (en) | Process for delignifying lignocellulosic material in the presence of phenazine compounds | |
| JPH0120276B2 (enExample) | ||
| SU1615261A1 (ru) | Способ получени целлюлозы | |
| WO1982001568A1 (en) | Use of ethanol in alkaline pulping | |
| US1035086A (en) | Method of producing alcohol from the waste sulfite-cellulose lyes. | |
| RU2019609C1 (ru) | Способ получения целлюлозного полуфабриката из древесины лиственных пород | |
| SU1020469A1 (ru) | Способ получени целлюлозы | |
| SU447468A1 (ru) | Способ получени волокнистого полуфабриката | |
| US1730383A (en) | of berlin | |
| SU1276704A1 (ru) | Способ получени целлюлозы | |
| SU1666607A1 (ru) | Способ приготовлени варочного раствора дл получени целлюлозы | |
| SU485178A1 (ru) | Способ получени сульфатной целлюлозы | |
| SU558995A1 (ru) | Способ получени волокнистого целлюлозного полуфабриката | |
| FI67104B (fi) | Foerfarande och alkalisk sulfit-sulfidkoklut foer framstaellning av massa ur ligninhaltigt cellulosaraomaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: HONSHU SEISHI KABUSHIKI KAISHA |