FI68868C - Foerfarande foer framstaellning av pappersmassa - Google Patents
Foerfarande foer framstaellning av pappersmassa Download PDFInfo
- Publication number
- FI68868C FI68868C FI773661A FI773661A FI68868C FI 68868 C FI68868 C FI 68868C FI 773661 A FI773661 A FI 773661A FI 773661 A FI773661 A FI 773661A FI 68868 C FI68868 C FI 68868C
- Authority
- FI
- Finland
- Prior art keywords
- cooking
- aid
- cooking aid
- weight
- group
- Prior art date
Links
- 238000010411 cooking Methods 0.000 claims description 64
- 238000000034 method Methods 0.000 claims description 49
- 230000008569 process Effects 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- MUVQKFGNPGZBII-UHFFFAOYSA-N 1-anthrol Chemical class C1=CC=C2C=C3C(O)=CC=CC3=CC2=C1 MUVQKFGNPGZBII-UHFFFAOYSA-N 0.000 claims description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- 239000012978 lignocellulosic material Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- NPRZDDJMZQXFBQ-UHFFFAOYSA-N 1,2-dihydroanthracene-9,10-diol Chemical compound C1=CC=C2C(O)=C(CCC=C3)C3=C(O)C2=C1 NPRZDDJMZQXFBQ-UHFFFAOYSA-N 0.000 claims description 5
- JIKINXKGAKAVAP-UHFFFAOYSA-N 2,3-dihydroxyanthracene-1-sulfonic acid Chemical compound C1=CC=C2C=C(C(=C(C(O)=C3)O)S(O)(=O)=O)C3=CC2=C1 JIKINXKGAKAVAP-UHFFFAOYSA-N 0.000 claims description 3
- 229930192627 Naphthoquinone Natural products 0.000 claims description 3
- 125000005577 anthracene group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000002791 naphthoquinones Chemical class 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 3
- 238000005698 Diels-Alder reaction Methods 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- FHSNICPEHCKJIG-UHFFFAOYSA-N 9,10-dihydroxyanthracene-1-carboxylic acid Chemical compound OC=1C2=CC=CC=C2C(=C2C=CC=C(C12)C(=O)O)O FHSNICPEHCKJIG-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 235000014347 soups Nutrition 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- UTCOUOISVRSLSH-UHFFFAOYSA-N 1,2-Anthracenediol Chemical compound C1=CC=CC2=CC3=C(O)C(O)=CC=C3C=C21 UTCOUOISVRSLSH-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000002023 wood Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000011121 hardwood Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 2
- 241000609240 Ambelania acida Species 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 2
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000010905 bagasse Substances 0.000 description 2
- 235000009120 camo Nutrition 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 235000005607 chanvre indien Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000011487 hemp Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- TZWRAFHCEQYNEB-UHFFFAOYSA-M sodium;2,3-dihydroxyanthracene-1-carboxylate Chemical compound [Na+].C1=CC=C2C=C(C(C([O-])=O)=C(C(O)=C3)O)C3=CC2=C1 TZWRAFHCEQYNEB-UHFFFAOYSA-M 0.000 description 2
- 239000011122 softwood Substances 0.000 description 2
- JTPNRXUCIXHOKM-UHFFFAOYSA-N 1-chloronaphthalene Chemical compound C1=CC=C2C(Cl)=CC=CC2=C1 JTPNRXUCIXHOKM-UHFFFAOYSA-N 0.000 description 1
- NLZXYHBLSOLTKF-UHFFFAOYSA-N 1-hydroxyanthracene-2-carboxylic acid Chemical compound C1=CC=CC2=CC3=C(O)C(C(=O)O)=CC=C3C=C21 NLZXYHBLSOLTKF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LBAUYFMNZLYLGG-UHFFFAOYSA-M C1=CC2=CC3=CC=CC=C3C=C2C2SC12.[OH-].O.O.[Na+] Chemical compound C1=CC2=CC3=CC=CC=C3C=C2C2SC12.[OH-].O.O.[Na+] LBAUYFMNZLYLGG-UHFFFAOYSA-M 0.000 description 1
- 229920002488 Hemicellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- LQEZQDLRBZVWLR-UHFFFAOYSA-N [Na].OC1=C(C2=CC3=CC=CC=C3C=C2C=C1)C(=O)O Chemical compound [Na].OC1=C(C2=CC3=CC=CC=C3C=C2C=C1)C(=O)O LQEZQDLRBZVWLR-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- -1 e.g. Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ZUFVXZVXEJHHBN-UHFFFAOYSA-N hydron;1,2,3,4-tetrahydroacridin-9-amine;chloride Chemical compound [Cl-].C1=CC=C2C([NH3+])=C(CCCC3)C3=NC2=C1 ZUFVXZVXEJHHBN-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- YZZLIHJEKCVDCO-UHFFFAOYSA-M sodium;2,3-dihydroxyanthracene-1-sulfonate Chemical compound [Na+].C1=CC=C2C=C(C(=C(C(O)=C3)O)S([O-])(=O)=O)C3=CC2=C1 YZZLIHJEKCVDCO-UHFFFAOYSA-M 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C3/00—Pulping cellulose-containing materials
- D21C3/22—Other features of pulping processes
- D21C3/222—Use of compounds accelerating the pulping processes
Landscapes
- Paper (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14849276 | 1976-12-10 | ||
| JP14849276A JPS5374101A (en) | 1976-12-10 | 1976-12-10 | Pulp making method |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI773661A7 FI773661A7 (fi) | 1978-06-11 |
| FI68868B FI68868B (fi) | 1985-07-31 |
| FI68868C true FI68868C (fi) | 1985-11-11 |
Family
ID=15453954
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI773661A FI68868C (fi) | 1976-12-10 | 1977-12-02 | Foerfarande foer framstaellning av pappersmassa |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | USRE32943E (OSRAM) |
| JP (1) | JPS5374101A (OSRAM) |
| AU (1) | AU513517B2 (OSRAM) |
| BR (1) | BR7708218A (OSRAM) |
| CA (1) | CA1106557A (OSRAM) |
| DE (1) | DE2754991C3 (OSRAM) |
| FI (1) | FI68868C (OSRAM) |
| FR (1) | FR2373637A1 (OSRAM) |
| NO (1) | NO150087C (OSRAM) |
| NZ (1) | NZ185734A (OSRAM) |
| SE (1) | SE437171B (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51112903A (en) * | 1975-03-26 | 1976-10-05 | Honshu Paper Co Ltd | Process for digesting lignocellulose material with sulphites |
| US4036680A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with a soda pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone in admixture with a nitro aromatic compound |
| US4036681A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with an alkaline pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone |
| JPS6059356B2 (ja) * | 1977-12-05 | 1985-12-24 | 川崎化成工業株式会社 | パルプの製造方法 |
| FR2435457A1 (fr) * | 1978-06-29 | 1980-04-04 | Ugine Kuhlmann | Hexahydro-1,2,3,4,4a, 9a anthracene-dione-9,10, sa preparation et son application a la delignification des materiaux lignocellulosiques |
| JPS5512806A (en) * | 1978-07-04 | 1980-01-29 | Oji Paper Co | Alkali pulp producing method |
| FR2442912A1 (fr) * | 1978-07-27 | 1980-06-27 | Ugine Kuhlmann | Procede de cuisson de materiaux lignocellulosiques en vue de la production de pate a papier |
| JPS55128091A (en) * | 1979-03-23 | 1980-10-03 | Oji Paper Co | Pulping of lignocellulose material |
| JPS58125737U (ja) * | 1982-02-18 | 1983-08-26 | 株式会社シマノ | キヤリパ−ブレ−キ |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE326705C (de) * | 1919-10-17 | 1920-09-30 | Richard Hartmuth Dr | Verfahren zur Behandlung von Holz oder zellulosehaltigen Stoffen zwecks Gewinnung von Zellulose und kuenstlichem Harz, Lack, Asphalt u. dgl. |
| US1705424A (en) * | 1924-09-30 | 1929-03-12 | Strecker Otto Carl | Process for the production of cellulose by decomposition of vegetable fibers |
| US1658213A (en) * | 1924-09-30 | 1928-02-07 | Otto C Strecker | Process for the production of cellulose by decomposition of vegetable fibers |
| DE486533C (de) * | 1926-12-24 | 1929-11-19 | Otto C Strecker Fa Dr | Verfahren zum Gewinnen von Zellstoff |
| US1890040A (en) * | 1928-05-07 | 1932-12-06 | Gen Aniline Works Inc | Production of anthraquinone and derivatives thereof |
| BE370781A (OSRAM) * | 1929-06-07 | |||
| DE569853C (de) * | 1929-08-07 | 1933-02-09 | E H Willi Schacht Dr Ing | Verfahren zur Herstellung eines Halbzellstoffes aus Stroh und Graesern |
| US2883826A (en) * | 1953-01-07 | 1959-04-28 | Univ Minnesota | Process for conditioning plant fibers for spinning |
| FR72957E (OSRAM) * | 1956-11-05 | |||
| CA986662A (en) * | 1973-05-01 | 1976-04-06 | David L. Mccandless | Pretreatment of lignocellulosic material with anthraquinone salts in alkaline pulping |
| JPS51112903A (en) * | 1975-03-26 | 1976-10-05 | Honshu Paper Co Ltd | Process for digesting lignocellulose material with sulphites |
| JPS5143403A (en) * | 1974-10-09 | 1976-04-14 | Honshu Paper Co Ltd | Arukariparupuno seizohoho |
| JPS51109303A (ja) * | 1975-03-24 | 1976-09-28 | Honshu Paper Co Ltd | Arukariisansoshorinyoru rigunoseruroosubutsushitsuno datsuriguninho |
| CA1073161A (en) * | 1975-09-05 | 1980-03-11 | Canadian Industries Limited | Delignification process |
| ZA773044B (en) * | 1976-06-02 | 1978-04-26 | Australian Paper Manufacturers | Improvements in pulping processes |
| US4036681A (en) * | 1976-12-14 | 1977-07-19 | Canadian Industries, Ltd. | Delignification of lignocellulosic material with an alkaline pulping liquor containing a Diels Alder adduct of benzoquinone or naphthoquinone |
-
1976
- 1976-12-10 JP JP14849276A patent/JPS5374101A/ja active Granted
-
1977
- 1977-11-21 NZ NZ185734A patent/NZ185734A/xx unknown
- 1977-11-23 SE SE7713266A patent/SE437171B/xx not_active IP Right Cessation
- 1977-11-23 AU AU30870/77A patent/AU513517B2/en not_active Expired
- 1977-11-28 NO NO774067A patent/NO150087C/no unknown
- 1977-11-30 CA CA292,069A patent/CA1106557A/en not_active Expired
- 1977-12-02 FI FI773661A patent/FI68868C/fi not_active IP Right Cessation
- 1977-12-09 BR BR7708218A patent/BR7708218A/pt unknown
- 1977-12-09 DE DE2754991A patent/DE2754991C3/de not_active Expired
- 1977-12-09 FR FR7737226A patent/FR2373637A1/fr active Granted
-
1981
- 1981-02-12 US US06/233,962 patent/USRE32943E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU3087077A (en) | 1979-05-31 |
| BR7708218A (pt) | 1978-09-05 |
| SE7713266L (sv) | 1978-06-11 |
| FI773661A7 (fi) | 1978-06-11 |
| DE2754991A1 (de) | 1978-06-15 |
| FR2373637B1 (OSRAM) | 1979-04-27 |
| NO150087B (no) | 1984-05-07 |
| AU513517B2 (en) | 1980-12-04 |
| JPS5374101A (en) | 1978-07-01 |
| SE437171B (sv) | 1985-02-11 |
| NO150087C (no) | 1984-08-15 |
| NO774067L (no) | 1978-06-13 |
| USRE32943E (en) | 1989-06-06 |
| DE2754991B2 (de) | 1979-01-18 |
| JPS5719239B2 (OSRAM) | 1982-04-21 |
| NZ185734A (en) | 1980-11-28 |
| FR2373637A1 (fr) | 1978-07-07 |
| CA1106557A (en) | 1981-08-11 |
| DE2754991C3 (de) | 1987-06-19 |
| FI68868B (fi) | 1985-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI68868C (fi) | Foerfarande foer framstaellning av pappersmassa | |
| FI117632B (fi) | Menetelmä massan valmistamiseksi | |
| US20150122429A1 (en) | Method for producing pulp having low lignin content from lignocellulosic material | |
| ES3015167T3 (en) | Biomass processing method | |
| US4181565A (en) | Process for cooking lignocellulosic material in the presence of hydroxyanthracenes and derivatives thereof | |
| US2996540A (en) | Preparation of para-hydroxybenzoic acid | |
| FI63267B (fi) | Foerfarande foer framstaellning av specialcellulosa med hoegt alfatal genom flerstegskokning innefattande syrafoerhydrolys | |
| SE8200756L (sv) | Sett att framstella kemimekanisk pappersmassa | |
| JPS6128093A (ja) | 急速フルフラ−ル分析による亜硫酸塩パルプ化および加水分解プロセスのコントロ−ル方法 | |
| GB542471A (en) | Improvements in or relating to the treatment of lignin and the products resulting therefrom | |
| US3832278A (en) | Prehydrolysis and digestion of bagasse fibers | |
| FI71780C (fi) | Kokningsfoerfarande foer lignosellulosamaterial i och foer framstaellning av pappersmassa. | |
| JPS63126984A (ja) | リグノセルロ−ス材料の脱リグニン方法 | |
| RU2773160C1 (ru) | Способ получения целлюлозы | |
| SU931874A1 (ru) | Варочна жидкость дл получени целлюлозы | |
| JPH0120276B2 (OSRAM) | ||
| SU1615261A1 (ru) | Способ получени целлюлозы | |
| WO1982001568A1 (en) | Use of ethanol in alkaline pulping | |
| US1035086A (en) | Method of producing alcohol from the waste sulfite-cellulose lyes. | |
| RU2019609C1 (ru) | Способ получения целлюлозного полуфабриката из древесины лиственных пород | |
| SU447468A1 (ru) | Способ получени волокнистого полуфабриката | |
| SU943359A1 (ru) | Способ получени волокнистого полуфабриката | |
| SU1666607A1 (ru) | Способ приготовлени варочного раствора дл получени целлюлозы | |
| SU485178A1 (ru) | Способ получени сульфатной целлюлозы | |
| RU2158326C1 (ru) | Способ получения целлюлозы |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: HONSHU SEISHI KABUSHIKI KAISHA |