FI65249C - Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-enyl-8-bensimidazol-1-ylpropyl-1,3,8-triazaspiro(4,5)deka n--onderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-enyl-8-bensimidazol-1-ylpropyl-1,3,8-triazaspiro(4,5)deka n--onderivat Download PDFInfo
- Publication number
- FI65249C FI65249C FI813935A FI813935A FI65249C FI 65249 C FI65249 C FI 65249C FI 813935 A FI813935 A FI 813935A FI 813935 A FI813935 A FI 813935A FI 65249 C FI65249 C FI 65249C
- Authority
- FI
- Finland
- Prior art keywords
- parts
- dihydro
- formula
- benzimidazol
- triazaspiro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 9
- 230000001225 therapeutic effect Effects 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- MKJDUHZPLQYUCB-UHFFFAOYSA-N decan-4-one Chemical compound CCCCCCC(=O)CCC MKJDUHZPLQYUCB-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 125000004185 ester group Chemical group 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- -1 alkenyl radical Chemical class 0.000 description 41
- 239000000243 solution Substances 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 239000007858 starting material Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 9
- 229960001701 chloroform Drugs 0.000 description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 230000003474 anti-emetic effect Effects 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- GUMPYDGUYXOYML-UHFFFAOYSA-N 3-(3-chloropropyl)-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(CCCCl)C2=C1 GUMPYDGUYXOYML-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 239000002111 antiemetic agent Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- MKZOYCWVYJRSAQ-UHFFFAOYSA-N 1-(3-chloropropyl)-3-prop-1-en-2-ylbenzimidazol-2-one Chemical compound C1=CC=C2N(CCCCl)C(=O)N(C(=C)C)C2=C1 MKZOYCWVYJRSAQ-UHFFFAOYSA-N 0.000 description 2
- OKLVRBSVPJLGSS-UHFFFAOYSA-N 1-(3-chloropropyl)-5,6-dimethyl-3-(1-phenylprop-1-en-2-yl)benzimidazol-2-one Chemical compound C12=CC(C)=C(C)C=C2N(CCCCl)C(=O)N1C(C)=CC1=CC=CC=C1 OKLVRBSVPJLGSS-UHFFFAOYSA-N 0.000 description 2
- ORPVEAJIYCFESN-UHFFFAOYSA-N 1-(3-iodopropyl)-3-methylbenzimidazol-2-one Chemical compound C1=CC=C2N(CCCI)C(=O)N(C)C2=C1 ORPVEAJIYCFESN-UHFFFAOYSA-N 0.000 description 2
- 125000006018 1-methyl-ethenyl group Chemical group 0.000 description 2
- HTQWGIHCFPWKAS-UHFFFAOYSA-N 1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one Chemical compound C1CNCCC11C(=O)NCN1C1=CC=CC=C1 HTQWGIHCFPWKAS-UHFFFAOYSA-N 0.000 description 2
- JYCMQSHPLUEKNM-UHFFFAOYSA-N 3-(3-chloropropyl)-5,6-dimethyl-1h-benzimidazol-2-one Chemical compound C1=C(C)C(C)=CC2=C1N(CCCCl)C(=O)N2 JYCMQSHPLUEKNM-UHFFFAOYSA-N 0.000 description 2
- BHXIYRGPJDFULT-UHFFFAOYSA-N 3-(3-hydroxypropyl)-1h-benzimidazol-2-one;hydrate Chemical compound O.C1=CC=C2NC(=O)N(CCCO)C2=C1 BHXIYRGPJDFULT-UHFFFAOYSA-N 0.000 description 2
- QXIVMLSEDNETKC-UHFFFAOYSA-N 3-(3-hydroxypropyl)-6-(trifluoromethyl)-1h-benzimidazol-2-one Chemical compound C1=C(C(F)(F)F)C=C2NC(=O)N(CCCO)C2=C1 QXIVMLSEDNETKC-UHFFFAOYSA-N 0.000 description 2
- OEEAQEQEGLABTM-UHFFFAOYSA-N 3-(3-hydroxypropyl)-6-methyl-1h-benzimidazol-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.CC1=CC=C2N(CCCO)C(=O)NC2=C1 OEEAQEQEGLABTM-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000002973 anti-dopamine Effects 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical class CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- TZGFQIXRVUHDLE-UHFFFAOYSA-N 1-chloro-2-nitro-4-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1Cl TZGFQIXRVUHDLE-UHFFFAOYSA-N 0.000 description 1
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical class O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BWSIZHBAHHICRX-UHFFFAOYSA-N 3-(2-amino-4,5-dichloroanilino)propan-1-ol;hydrochloride Chemical compound Cl.NC1=CC(Cl)=C(Cl)C=C1NCCCO BWSIZHBAHHICRX-UHFFFAOYSA-N 0.000 description 1
- BIPGVMAXJISQLS-UHFFFAOYSA-N 3-(2-amino-4-methylanilino)propan-1-ol Chemical compound CC1=CC=C(NCCCO)C(N)=C1 BIPGVMAXJISQLS-UHFFFAOYSA-N 0.000 description 1
- GCKLCWVPTCYIKI-UHFFFAOYSA-N 3-(2-aminoanilino)propan-1-ol;hydrochloride Chemical compound Cl.NC1=CC=CC=C1NCCCO GCKLCWVPTCYIKI-UHFFFAOYSA-N 0.000 description 1
- OYFHYJXODLSMCD-UHFFFAOYSA-N 3-(2-chloro-6-nitroanilino)propan-1-ol Chemical compound OCCCNC1=C(Cl)C=CC=C1[N+]([O-])=O OYFHYJXODLSMCD-UHFFFAOYSA-N 0.000 description 1
- JPDLWRGYOGEWID-UHFFFAOYSA-N 3-(2-nitroanilino)propan-1-ol Chemical compound OCCCNC1=CC=CC=C1[N+]([O-])=O JPDLWRGYOGEWID-UHFFFAOYSA-N 0.000 description 1
- PQQLJCVRVGFNQI-UHFFFAOYSA-N 3-(3-chloropropyl)-6-(trifluoromethyl)-1h-benzimidazol-2-one Chemical compound FC(F)(F)C1=CC=C2N(CCCCl)C(=O)NC2=C1 PQQLJCVRVGFNQI-UHFFFAOYSA-N 0.000 description 1
- ZELXVUVWXATHED-UHFFFAOYSA-N 3-(3-hydroxypropyl)-1h-benzimidazol-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1=CC=C2NC(=O)N(CCCO)C2=C1 ZELXVUVWXATHED-UHFFFAOYSA-N 0.000 description 1
- LVLKAZRCSJLJAT-UHFFFAOYSA-N 3-(3-hydroxypropyl)-6-methyl-1h-benzimidazol-2-one Chemical compound CC1=CC=C2N(CCCO)C(=O)NC2=C1 LVLKAZRCSJLJAT-UHFFFAOYSA-N 0.000 description 1
- WZGADTJOHPLKOF-UHFFFAOYSA-N 3-(5,6-dichloro-2-oxo-3h-benzimidazol-1-yl)propyl methanesulfonate Chemical compound ClC1=C(Cl)C=C2NC(=O)N(CCCOS(=O)(=O)C)C2=C1 WZGADTJOHPLKOF-UHFFFAOYSA-N 0.000 description 1
- UVXLFYRLDYPWCS-UHFFFAOYSA-N 3-(7-chloro-2-oxo-3h-benzimidazol-1-yl)propyl methanesulfonate Chemical compound C1=CC=C2NC(=O)N(CCCOS(=O)(=O)C)C2=C1Cl UVXLFYRLDYPWCS-UHFFFAOYSA-N 0.000 description 1
- PJZMYOBKMMLKAC-UHFFFAOYSA-N 3-[2-amino-4-(trifluoromethyl)anilino]propan-1-ol Chemical compound NC1=CC(C(F)(F)F)=CC=C1NCCCO PJZMYOBKMMLKAC-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- XFASJWLBXHWUMW-UHFFFAOYSA-N 3-prop-1-en-2-yl-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(C(=C)C)C2=C1 XFASJWLBXHWUMW-UHFFFAOYSA-N 0.000 description 1
- IOYVQMNSESZFIE-UHFFFAOYSA-N 4-chloro-3-(3-hydroxypropyl)-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(CCCO)C2=C1Cl IOYVQMNSESZFIE-UHFFFAOYSA-N 0.000 description 1
- PVBPSJYPNCNXNX-UHFFFAOYSA-N 4-chloro-3-(3-hydroxypropyl)-1h-benzimidazol-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1=CC=C2NC(=O)N(CCCO)C2=C1Cl PVBPSJYPNCNXNX-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- MEXPSQZNVPJMOL-UHFFFAOYSA-N 5,6-dichloro-3-(3-hydroxypropyl)-1h-benzimidazol-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.ClC1=C(Cl)C=C2NC(=O)N(CCCO)C2=C1 MEXPSQZNVPJMOL-UHFFFAOYSA-N 0.000 description 1
- DVYJEKLROBFOOG-UHFFFAOYSA-N 5,6-dimethyl-3-(1-phenylprop-1-en-2-yl)-1h-benzimidazol-2-one Chemical compound C12=CC(C)=C(C)C=C2NC(=O)N1C(C)=CC1=CC=CC=C1 DVYJEKLROBFOOG-UHFFFAOYSA-N 0.000 description 1
- PBGMZDKEQJHNQB-UHFFFAOYSA-N 5-chloro-3-(3-chloropropyl)-1h-benzimidazol-2-one Chemical compound ClC1=CC=C2NC(=O)N(CCCCl)C2=C1 PBGMZDKEQJHNQB-UHFFFAOYSA-N 0.000 description 1
- DYDUXVJCACLGTR-UHFFFAOYSA-N 6-chloro-3-(3-chloropropyl)-1h-benzimidazol-2-one Chemical compound C1=C(Cl)C=C2NC(=O)N(CCCCl)C2=C1 DYDUXVJCACLGTR-UHFFFAOYSA-N 0.000 description 1
- KWZXVSVGUXKSJY-UHFFFAOYSA-N 6-chloro-3-(3-hydroxypropyl)-1h-benzimidazol-2-one Chemical compound C1=C(Cl)C=C2NC(=O)N(CCCO)C2=C1 KWZXVSVGUXKSJY-UHFFFAOYSA-N 0.000 description 1
- YKIFAYYTVKMBDS-UHFFFAOYSA-N 8-[3-(6-chloro-2-oxo-3h-benzimidazol-1-yl)propyl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one Chemical compound C1=CC(F)=CC=C1N1C2(CCN(CCCN3C(NC4=CC=C(Cl)C=C43)=O)CC2)C(=O)NC1 YKIFAYYTVKMBDS-UHFFFAOYSA-N 0.000 description 1
- GNLXALIJPRFFJB-UHFFFAOYSA-N 8-[3-(6-chloro-2-oxo-3h-benzimidazol-1-yl)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N1CCCN(CC1)CCC1(C(NC1)=O)N1C1=CC=CC=C1 GNLXALIJPRFFJB-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical class C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003354 anti-apomorphinic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 1
- 229960004046 apomorphine Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000004694 iodide salts Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- DKGZKTPJOSAWFA-UHFFFAOYSA-N spiperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C(NCN2C=2C=CC=CC=2)=O)CC1 DKGZKTPJOSAWFA-UHFFFAOYSA-N 0.000 description 1
- 229950001675 spiperone Drugs 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Claims (2)
1. Förfarande för framställning av terapeutiskt användbara 1-fenyl-8-bensimidazolylpropy1-1,3,8-triaza-^ spiro/4,5_7dekan-4-onderivat med formeln I och farmaceut-iskt godtagbara syraadditionssalter därav B N-CH0-CH0-CH0-N \A
10 X—C \_A\_ (I) A, A 1 2 där R och R betecknar väte, halogen, C^^-alkyl eller trifluormetyl, B är en bivalent radikal -N=CH- eller 0 20 " -NL-C-, varvid L är väte, C^^-alkyl elXer C2_^-alkenyl och den bivalenta radikalen är bunden tili bensenringen 4 5 via heteroatomen, R är väte och C. ,--alkyl och R och 6 1 j R betecknar väte, halogen, C^_g-alkyl eller trifluor- metyl, kännetecknat därav, atten förening ^ med formeln B^~^N-CH„-CH0-CH_-X (II) \_/ 2 2 2 Ä 1 2 där R , R och B betecknar samma som ovan och X är en reaktiv estergrupp, som är härledd frän motsvarande 35 alkohol, omsätts med en förening med formeln i!
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59779375A | 1975-07-21 | 1975-07-21 | |
| US59779375 | 1975-07-21 | ||
| US68713976 | 1976-05-17 | ||
| US05/687,139 US4066772A (en) | 1975-07-21 | 1976-05-17 | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| KR760001697 | 1976-07-12 | ||
| KR7601697A KR810000334B1 (ko) | 1975-07-21 | 1976-07-12 | 1-(벤즈 아조릴알킬) 피페리딘 유도체의 제조방법 |
| FI762086A FI62667C (fi) | 1975-07-21 | 1976-07-20 | Foerfarande foer framstaellning av antiemetiska 1-(benzazolylalkyl)piperidinderivat |
| FI762086 | 1976-07-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI813935L FI813935L (fi) | 1981-12-08 |
| FI65249B FI65249B (fi) | 1983-12-30 |
| FI65249C true FI65249C (fi) | 1984-04-10 |
Family
ID=27444048
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI813935A FI65249C (fi) | 1975-07-21 | 1981-12-08 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-enyl-8-bensimidazol-1-ylpropyl-1,3,8-triazaspiro(4,5)deka n--onderivat |
Country Status (1)
| Country | Link |
|---|---|
| FI (1) | FI65249C (sv) |
-
1981
- 1981-12-08 FI FI813935A patent/FI65249C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI65249B (fi) | 1983-12-30 |
| FI813935L (fi) | 1981-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66609B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara (piperidinylalkyl)kinazolinderivat | |
| FI71737C (sv) | Förfarande för framställning av nya terapeutiskt användbara 3-(piperid inylalkyl)-4H-pyrido/1,2-a/ pyrimidin-4-on-derivat. | |
| DE60013803T2 (de) | Tetracyclische azepinoindol verbindungen als 5-ht rezeptor liganden | |
| US4582837A (en) | Imidazo[4,5-b] and [4,5-c]pyridine derivatives having cardiotonic activity | |
| DK174161B1 (da) | Anellerede indolderivater, fremgangsmåde til deres fremstilling og fremgangsmåde til fremstilling af farmaceutisk præparat indeholdende dem | |
| FI62667C (fi) | Foerfarande foer framstaellning av antiemetiska 1-(benzazolylalkyl)piperidinderivat | |
| JPS6193183A (ja) | 8−(ベンゾアゾリルアルキル)−1,3,8−トリアザスピロ〔4,5〕デカン−4−オン誘導体 | |
| IE53400B1 (en) | Novel bicyclic pyrimidin-5-one derivatives | |
| JPH0613511B2 (ja) | 新規1,2‐ベンズイソキサゾール‐3‐イル及び1,2‐ベンズイソチアゾール‐3‐イル誘導体 | |
| FI63228C (fi) | Foerfarande foer framstaellning av 1-bensazolyl-4-substituerade piperidiner anvaendbara saosom neuroleptiska medel | |
| NZ253121A (en) | N-heterocyclyl(alkyl) substituted 3-azabicyclo-[3.2.0]heptane derivatives and pharmaceutical compositions thereof | |
| PT86331B (pt) | Processo para a preparacao de novos pirrolobenzimidazois e de composicoes farmaceuticas que os contem | |
| EP0906297A1 (en) | 1,2,4-benzothiadiazine derivatives, their preparation and use | |
| CA2210913C (en) | Antipsychotic 4-(1h-indolyl-1-yl)-1-substituted piperidine derivatives | |
| PL189549B1 (pl) | Pochodna 1,2,3,4-tetrahydro-benzofuro [3,2-c] pirydyny, jej zastosowanie, kompozycja farmaceutycznai sposób wytwarzania pochodnej 1,2,3,4-tetrahydro-benzofuro [3,2-c] pirydyny | |
| FI83220B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,3-dimetyl-1h-purin-2,6-dionderivat. | |
| FI65249C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-enyl-8-bensimidazol-1-ylpropyl-1,3,8-triazaspiro(4,5)deka n--onderivat | |
| DK141289B (da) | Analogifremgangsmåde til fremstilling af epimere blandinger eller individuelle epimere af bicykliske imidazoler eller pyrimidiner, eller syreadditionssalte deraf. | |
| US3732243A (en) | 2-(p-bromophenyl)-9-dimethyl-amino-propyl-9h-imidazo(1,2-a)benzimidazole | |
| IE51954B1 (en) | Hexahydro-trans-and tetrahydropyridoindole neuroleptic agents | |
| FI62086C (fi) | Foerfarande foer framstaellning av bronkosekreterolytiska 5,11-dihydro-5h-pyrido(2,3-b)(1,5)bensodiazepin-5-oner | |
| EP1904483A1 (en) | Benzimidazole derivatives as 5-ht6,5-ht24 | |
| KR910000165B1 (ko) | 1,2-벤즈이소옥사졸-3-일과 1,2-벤즈이소티아졸-3-일 유도체의 제조방법 | |
| HU194234B (en) | Process for preparing substituted pyrido/1,2-c/imidazo /1,2-a/benzimidazoles and pharmaceuticals comprising the compounds | |
| EP0743946A1 (en) | 5ht2b receptor antagonists condensed indoles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: JANSSEN PHARMACEUTICA N.V. |