FI61703C - Foerfarande foer framstaellning av farmakologiskt vaerdefulla hydroxialkylxantiner - Google Patents
Foerfarande foer framstaellning av farmakologiskt vaerdefulla hydroxialkylxantiner Download PDFInfo
- Publication number
- FI61703C FI61703C FI2065/74A FI206574A FI61703C FI 61703 C FI61703 C FI 61703C FI 2065/74 A FI2065/74 A FI 2065/74A FI 206574 A FI206574 A FI 206574A FI 61703 C FI61703 C FI 61703C
- Authority
- FI
- Finland
- Prior art keywords
- compounds
- carbon atoms
- group
- xanthine
- methyl
- Prior art date
Links
- 230000000144 pharmacologic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- -1 alkali metal salts Chemical class 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 14
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical class O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 229940083747 low-ceiling diuretics xanthine derivative Drugs 0.000 claims description 6
- 125000005188 oxoalkyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000002168 alkylating agent Substances 0.000 claims description 3
- 229940100198 alkylating agent Drugs 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 3
- 239000000194 fatty acid Substances 0.000 claims description 3
- 229930195729 fatty acid Natural products 0.000 claims description 3
- 150000004665 fatty acids Chemical class 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000004043 oxo group Chemical group O=* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 239000012279 sodium borohydride Substances 0.000 description 15
- 229910000033 sodium borohydride Inorganic materials 0.000 description 15
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- 230000000875 corresponding effect Effects 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229940075420 xanthine Drugs 0.000 description 5
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 4
- LRDJTSMTPGYDOZ-UHFFFAOYSA-N 7-(6-bromohexyl)-1,3-dimethylpurine-2,6-dione Chemical compound O=C1N(C)C(=O)N(C)C2=C1N(CCCCCCBr)C=N2 LRDJTSMTPGYDOZ-UHFFFAOYSA-N 0.000 description 3
- 208000009079 Bronchial Spasm Diseases 0.000 description 3
- 208000014181 Bronchial disease Diseases 0.000 description 3
- 206010006482 Bronchospasm Diseases 0.000 description 3
- YAPQBXQYLJRXSA-UHFFFAOYSA-N Theobromine Natural products CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229960000278 theophylline Drugs 0.000 description 3
- QIAYXEJPDSASPC-UHFFFAOYSA-N 1-(5-hydroxyhexyl)-3-methyl-7-(2-methylpropyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)O)C(=O)C2=C1N=CN2CC(C)C QIAYXEJPDSASPC-UHFFFAOYSA-N 0.000 description 2
- CERFGCPAKWKZEK-UHFFFAOYSA-N 1-(5-hydroxyhexyl)-3-methyl-7-propylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)O)C(=O)C2=C1N=CN2CCC CERFGCPAKWKZEK-UHFFFAOYSA-N 0.000 description 2
- URUOFHOSOMVNHE-UHFFFAOYSA-N 1-(6-hydroxyhexyl)-3-methyl-7-propylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCCCO)C(=O)C2=C1N=CN2CCC URUOFHOSOMVNHE-UHFFFAOYSA-N 0.000 description 2
- LLVKLIDLEVDUEE-UHFFFAOYSA-N 1-ethyl-7-(5-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound O=C1N(CC)C(=O)N(C)C2=C1N(CCCCC(C)O)C=N2 LLVKLIDLEVDUEE-UHFFFAOYSA-N 0.000 description 2
- GMSNIKWWOQHZGF-UHFFFAOYSA-N 3-methyl-9H-xanthine Chemical compound O=C1NC(=O)N(C)C2=C1N=CN2 GMSNIKWWOQHZGF-UHFFFAOYSA-N 0.000 description 2
- IUHVEMNMQVLXDE-UHFFFAOYSA-N 7-(5-hydroxyhexyl)-3-methyl-1-(2-methylpropyl)purine-2,6-dione Chemical compound O=C1N(CC(C)C)C(=O)N(C)C2=C1N(CCCCC(C)O)C=N2 IUHVEMNMQVLXDE-UHFFFAOYSA-N 0.000 description 2
- WPHMRMYOYROJQY-UHFFFAOYSA-N 7-(6-hydroxyhexyl)-1,3-dimethylpurine-2,6-dione Chemical compound O=C1N(C)C(=O)N(C)C2=C1N(CCCCCCO)C=N2 WPHMRMYOYROJQY-UHFFFAOYSA-N 0.000 description 2
- NBXBTNZUOPMZAB-UHFFFAOYSA-N 7-butyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)O)C(=O)C2=C1N=CN2CCCC NBXBTNZUOPMZAB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ZTMXELDJLGOCFM-UHFFFAOYSA-N CCN(C1=C(C(N2CC)=O)N(CCCCC(C)O)C=N1)C2=O Chemical compound CCN(C1=C(C(N2CC)=O)N(CCCCC(C)O)C=N1)C2=O ZTMXELDJLGOCFM-UHFFFAOYSA-N 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KYHQZNGJUGFTGR-UHFFFAOYSA-N Proxyphylline Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CC(O)C KYHQZNGJUGFTGR-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000002152 aqueous-organic solution Substances 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000004087 circulation Effects 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 229940076279 serotonin Drugs 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229960004559 theobromine Drugs 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- WYVZQGMSXUXEQW-UHFFFAOYSA-N 1,3-diethyl-7-(5-oxohexyl)purine-2,6-dione Chemical compound O=C1N(CC)C(=O)N(CC)C2=C1N(CCCCC(C)=O)C=N2 WYVZQGMSXUXEQW-UHFFFAOYSA-N 0.000 description 1
- DUJRIDILYIRPCA-UHFFFAOYSA-N 1,3-dimethyl-7-(2-methyl-3-oxobutyl)purine-2,6-dione Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CC(C)C(C)=O DUJRIDILYIRPCA-UHFFFAOYSA-N 0.000 description 1
- YWVFOTJZIOUHKI-UHFFFAOYSA-N 1,3-dimethyl-7-(3-oxopentyl)purine-2,6-dione Chemical compound CN1C(=O)N(C=2N=CN(C2C1=O)CCC(CC)=O)C YWVFOTJZIOUHKI-UHFFFAOYSA-N 0.000 description 1
- LHRHXWBJUQKYEL-UHFFFAOYSA-N 1,3-dimethyl-7h-purine-2,6-dione;ethane-1,2-diamine Chemical compound NCCN.O=C1N(C)C(=O)N(C)C2=C1NC=N2 LHRHXWBJUQKYEL-UHFFFAOYSA-N 0.000 description 1
- SGRHVVLXEBNBDV-UHFFFAOYSA-N 1,6-dibromohexane Chemical compound BrCCCCCCBr SGRHVVLXEBNBDV-UHFFFAOYSA-N 0.000 description 1
- GIHUMBWJDVZRRG-UHFFFAOYSA-N 1-(3-hydroxy-2-methylbutyl)-3,7-dimethylpurine-2,6-dione Chemical compound O=C1N(CC(C)C(O)C)C(=O)N(C)C2=C1N(C)C=N2 GIHUMBWJDVZRRG-UHFFFAOYSA-N 0.000 description 1
- NSMXQKNUPPXBRG-UHFFFAOYSA-N 1-(5-hydroxyhexyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione Chemical compound O=C1N(CCCCC(O)C)C(=O)N(C)C2=C1N(C)C=N2 NSMXQKNUPPXBRG-UHFFFAOYSA-N 0.000 description 1
- BMMSHXKNEHRMPT-UHFFFAOYSA-N 1-(5-hydroxyhexyl)-3-methyl-7h-purine-2,6-dione Chemical compound O=C1N(CCCCC(O)C)C(=O)N(C)C2=C1NC=N2 BMMSHXKNEHRMPT-UHFFFAOYSA-N 0.000 description 1
- DEBSCANOXPHKPD-UHFFFAOYSA-N 1-(5-hydroxypentyl)-3,7-dimethylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCCO)C(=O)C2=C1N=CN2C DEBSCANOXPHKPD-UHFFFAOYSA-N 0.000 description 1
- FQMLNCMGNMEXAL-UHFFFAOYSA-N 1-(6-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCCCO)C(=O)C2=C1N=CN2C FQMLNCMGNMEXAL-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- CHDTUTHQHCQHPG-UHFFFAOYSA-N 1-butyl-3-methyl-7-(5-oxohexyl)purine-2,6-dione Chemical compound C(CCC)N1C(=O)N(C=2N=CN(C=2C1=O)CCCCC(C)=O)C CHDTUTHQHCQHPG-UHFFFAOYSA-N 0.000 description 1
- JRBWLQCKGJRMLW-UHFFFAOYSA-N 1-butyl-7-(5-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound O=C1N(CCCC)C(=O)N(C)C2=C1N(CCCCC(C)O)C=N2 JRBWLQCKGJRMLW-UHFFFAOYSA-N 0.000 description 1
- LSCHHQQMFOMDFQ-UHFFFAOYSA-N 1-ethyl-3-methyl-7-(5-oxohexyl)purine-2,6-dione Chemical compound O=C1N(CC)C(=O)N(C)C2=C1N(CCCCC(C)=O)C=N2 LSCHHQQMFOMDFQ-UHFFFAOYSA-N 0.000 description 1
- YOTSOUGNZSULJR-UHFFFAOYSA-N 1-hexyl-3-methyl-7-(5-oxohexyl)purine-2,6-dione Chemical compound O=C1N(CCCCCC)C(=O)N(C)C2=C1N(CCCCC(C)=O)C=N2 YOTSOUGNZSULJR-UHFFFAOYSA-N 0.000 description 1
- YVJPMXPSIMGRCD-UHFFFAOYSA-N 1-hexyl-7-(5-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound O=C1N(CCCCCC)C(=O)N(C)C2=C1N(CCCCC(C)O)C=N2 YVJPMXPSIMGRCD-UHFFFAOYSA-N 0.000 description 1
- RBQBZAPAKRDDNJ-UHFFFAOYSA-N 3,7-diethyl-1-(5-oxohexyl)purine-2,6-dione Chemical compound CCN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CC RBQBZAPAKRDDNJ-UHFFFAOYSA-N 0.000 description 1
- HXQYDMFYHHFPAD-UHFFFAOYSA-N 3,7-diethyl-1-(6-hydroxyhexyl)purine-2,6-dione Chemical compound C(C)N1C(N(C(C=2N(C=NC1=2)CC)=O)CCCCCCO)=O HXQYDMFYHHFPAD-UHFFFAOYSA-N 0.000 description 1
- PIOMNXGRLBSVFS-UHFFFAOYSA-N 3,7-dimethyl-1-(2-methyl-3-oxobutyl)purine-2,6-dione Chemical compound O=C1N(CC(C)C(C)=O)C(=O)N(C)C2=C1N(C)C=N2 PIOMNXGRLBSVFS-UHFFFAOYSA-N 0.000 description 1
- XHZWTLQBNHVZDX-UHFFFAOYSA-N 3-methyl-1-(2-methylpropyl)-7-(5-oxohexyl)purine-2,6-dione Chemical compound O=C1N(CC(C)C)C(=O)N(C)C2=C1N(CCCCC(C)=O)C=N2 XHZWTLQBNHVZDX-UHFFFAOYSA-N 0.000 description 1
- AHSKYWGYRVWJLX-UHFFFAOYSA-N 3-methyl-7-(2-methylpropyl)-1-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CC(C)C AHSKYWGYRVWJLX-UHFFFAOYSA-N 0.000 description 1
- SCWBBXYWLYSKGK-UHFFFAOYSA-N 3-methyl-7-(5-oxohexyl)-1-propylpurine-2,6-dione Chemical compound O=C1N(CCC)C(=O)N(C)C2=C1N(CCCCC(C)=O)C=N2 SCWBBXYWLYSKGK-UHFFFAOYSA-N 0.000 description 1
- MHNVSFOURBQRPK-UHFFFAOYSA-N 3-methyl-7-propylpurine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2CCC MHNVSFOURBQRPK-UHFFFAOYSA-N 0.000 description 1
- COUJDKGXLQPJNI-UHFFFAOYSA-N 6-(1,3-dimethyl-2,6-dioxopurin-7-yl)hexyl acetate Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CCCCCCOC(=O)C COUJDKGXLQPJNI-UHFFFAOYSA-N 0.000 description 1
- SIAQCIRRCCRXGV-UHFFFAOYSA-N 6-(7-ethyl-3-methyl-2,6-dioxopurin-1-yl)hexanal Chemical compound CN1C(=O)N(CCCCCC=O)C(=O)C2=C1N=CN2CC SIAQCIRRCCRXGV-UHFFFAOYSA-N 0.000 description 1
- FCMCSZXRVWDVAW-UHFFFAOYSA-N 6-bromo-1-hexanol Chemical compound OCCCCCCBr FCMCSZXRVWDVAW-UHFFFAOYSA-N 0.000 description 1
- NGCAQWOWNNVVSY-UHFFFAOYSA-N 7-(3-hydroxy-2-methylbutyl)-1,3-dimethylpurine-2,6-dione Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CC(C)C(O)C NGCAQWOWNNVVSY-UHFFFAOYSA-N 0.000 description 1
- SVHJWYLTQYXDTO-UHFFFAOYSA-N 7-(3-hydroxypentyl)-1,3-dimethylpurine-2,6-dione Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CCC(O)CC SVHJWYLTQYXDTO-UHFFFAOYSA-N 0.000 description 1
- IRZCBLPIFWYWRG-UHFFFAOYSA-N 7-(5-hydroxyhexyl)-3-methyl-1-propylpurine-2,6-dione Chemical compound O=C1N(CCC)C(=O)N(C)C2=C1N(CCCCC(C)O)C=N2 IRZCBLPIFWYWRG-UHFFFAOYSA-N 0.000 description 1
- NUNLMISVGDRQTL-UHFFFAOYSA-N 7-(6-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound O=C1NC(=O)N(C)C2=C1N(CCCCCCO)C=N2 NUNLMISVGDRQTL-UHFFFAOYSA-N 0.000 description 1
- SOCYNBJTSAFFQI-UHFFFAOYSA-N 7-butyl-3-methyl-1-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CCCC SOCYNBJTSAFFQI-UHFFFAOYSA-N 0.000 description 1
- RMGVVFDJVCGEPN-UHFFFAOYSA-N 7-decyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)O)C(=O)C2=C1N=CN2CCCCCCCCCC RMGVVFDJVCGEPN-UHFFFAOYSA-N 0.000 description 1
- RTYRGIMUXABCRT-UHFFFAOYSA-N 7-decyl-3-methyl-1-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CCCCCCCCCC RTYRGIMUXABCRT-UHFFFAOYSA-N 0.000 description 1
- BASAWTRGXKUHPR-UHFFFAOYSA-N 7-ethyl-1-(6-hydroxyhexyl)-3-methylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCCCCO)C(=O)C2=C1N=CN2CC BASAWTRGXKUHPR-UHFFFAOYSA-N 0.000 description 1
- GISWGHGEIIOKGX-UHFFFAOYSA-N 7-ethyl-3-methylpurine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2CC GISWGHGEIIOKGX-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- BYPFEZZEUUWMEJ-UHFFFAOYSA-N Pentoxifylline Chemical compound O=C1N(CCCCC(=O)C)C(=O)N(C)C2=C1N(C)C=N2 BYPFEZZEUUWMEJ-UHFFFAOYSA-N 0.000 description 1
- 235000017284 Pometia pinnata Nutrition 0.000 description 1
- 240000009305 Pometia pinnata Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- RBQOQRRFDPXAGN-UHFFFAOYSA-N Propentofylline Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CCC RBQOQRRFDPXAGN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 230000007883 bronchodilation Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/10—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 3 and 7, e.g. theobromine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2335170A DE2335170C2 (de) | 1973-07-11 | 1973-07-11 | 1,3-Dialkyl-7-(hydroxyalkyl)-xanthine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| DE2335170 | 1973-07-11 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI206574A7 FI206574A7 (enExample) | 1975-01-12 |
| FI61703B FI61703B (fi) | 1982-05-31 |
| FI61703C true FI61703C (fi) | 1982-09-10 |
Family
ID=5886518
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI2065/74A FI61703C (fi) | 1973-07-11 | 1974-07-05 | Foerfarande foer framstaellning av farmakologiskt vaerdefulla hydroxialkylxantiner |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4108995A (enExample) |
| AR (4) | AR199915A1 (enExample) |
| AT (1) | AT333300B (enExample) |
| BE (1) | BE816869R (enExample) |
| CA (1) | CA1062709A (enExample) |
| CH (4) | CH587850A5 (enExample) |
| DE (1) | DE2335170C2 (enExample) |
| DK (1) | DK147004C (enExample) |
| ES (3) | ES417828A1 (enExample) |
| FI (1) | FI61703C (enExample) |
| FR (1) | FR2236501B2 (enExample) |
| GB (1) | GB1480836A (enExample) |
| IE (1) | IE41822B1 (enExample) |
| NL (1) | NL168703C (enExample) |
| NO (2) | NO140596C (enExample) |
| SE (1) | SE415354B (enExample) |
| ZA (1) | ZA744373B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4207321A (en) * | 1977-04-02 | 1980-06-10 | Hoechst Aktiengesellschaft | Pharmaceutical compositions containing xanthines |
| DE3138397A1 (de) * | 1981-09-26 | 1983-04-07 | Hoechst Ag, 6230 Frankfurt | "arzneimittel, darin enthaltene vicinale dihydroxyalkylxanthine und herstellungsverfahren fuer diese xanthinverbindungen" |
| US4636507A (en) * | 1984-04-30 | 1987-01-13 | Hoechst-Roussel Pharmaceuticals Inc. | Host defense mechanism enhancement |
| DE3525801A1 (de) * | 1985-07-19 | 1987-01-22 | Hoechst Ag | Tertiaere hydroxyalkylxanthine, verfahren zu ihrer herstellung, die sie enthaltenden arzneimittel und ihre verwendung |
| US5338741A (en) * | 1986-10-27 | 1994-08-16 | Nestec S.A. | 1-hydroxyalkylxanthines and medicaments containing them |
| DE3725554A1 (de) * | 1987-08-01 | 1989-02-09 | Hoechst Ag | Pharmazeutisches kombinationspraeparat sowie dessen herstellung und verwendung |
| DE3942871A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | R-(-)-1-(5-hydroxyhexyl)-3-methyl-7-propylxanthin, verfahren zu dessen herstellung und diese verbindung enthaltende arzneimittel |
| EP0570831A2 (de) * | 1992-05-20 | 1993-11-24 | Hoechst Aktiengesellschaft | Verwendung von Xanthinderivaten zur Behandlung von Nervenschädigungen nach Unterbrechung der Blutzirkulation |
| US5981536A (en) * | 1996-07-31 | 1999-11-09 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the modulation of apoptosis |
| US5856330A (en) * | 1996-07-31 | 1999-01-05 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the inhibition of dephosphorylation of cofilin |
| WO1999031101A1 (en) * | 1997-12-17 | 1999-06-24 | University Of South Florida | Adenosine receptor antagonists with improved bioactivity |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2756229A (en) * | 1956-07-24 | Xanthine derivatives | ||
| DE1067025B (de) * | 1959-10-15 | Chemiewerk Homburg Aktienge Seilschaft, Frankfurt/M | Ver fahren zur Herstellung von 1 (ß-Oχγpτo pyl) theobromm | |
| US2517410A (en) * | 1947-08-15 | 1950-08-01 | Searle & Co | Hydroxy alkyl xanthines and the production thereof |
| DE926788C (de) * | 1952-11-07 | 1955-04-25 | Geigy Ag J R | Verfahren zur Herstellung von 1, 3-dialkylierten 7-Oxyalkyl-xanthinabkoemmlingen |
| FR1211333A (fr) * | 1955-10-19 | 1960-03-15 | Boehringer Sohn Ingelheim | Perfectionnements apportés aux procédés pour fabriquer des oxyalcoylxanthines |
| DE1810705C3 (de) * | 1968-11-25 | 1980-11-27 | Hoechst Ag, 6000 Frankfurt | Stabilisierung von Vitaminen |
| DE1911279A1 (de) * | 1969-03-05 | 1970-11-12 | Eckert Dr Theodor | Verfahren zur Erhoehung der Resorptionsfaehigkeit von Arzneistoffen |
-
1973
- 1973-07-11 DE DE2335170A patent/DE2335170C2/de not_active Expired
- 1973-08-02 CH CH1124073A patent/CH587850A5/xx not_active IP Right Cessation
- 1973-08-02 CH CH1602476A patent/CH587851A5/xx not_active IP Right Cessation
- 1973-08-02 CH CH1602576A patent/CH587853A5/xx not_active IP Right Cessation
- 1973-08-02 CH CH1602376A patent/CH587852A5/xx not_active IP Right Cessation
- 1973-08-03 AT AT684573A patent/AT333300B/de not_active IP Right Cessation
- 1973-08-09 DK DK438373A patent/DK147004C/da not_active IP Right Cessation
- 1973-08-10 CA CA178,591A patent/CA1062709A/en not_active Expired
- 1973-08-10 SE SE7310986A patent/SE415354B/xx unknown
- 1973-08-10 NL NLAANVRAGE7311123,A patent/NL168703C/xx not_active IP Right Cessation
- 1973-08-10 AR AR249530A patent/AR199915A1/es active
- 1973-08-11 ES ES417828A patent/ES417828A1/es not_active Expired
-
1974
- 1974-06-26 BE BE145889A patent/BE816869R/xx not_active IP Right Cessation
- 1974-06-28 GB GB28866/74A patent/GB1480836A/en not_active Expired
- 1974-07-05 FI FI2065/74A patent/FI61703C/fi active
- 1974-07-05 NO NO742464A patent/NO140596C/no unknown
- 1974-07-05 US US05/485,869 patent/US4108995A/en not_active Expired - Lifetime
- 1974-07-08 ZA ZA00744373A patent/ZA744373B/xx unknown
- 1974-07-08 FR FR7423606A patent/FR2236501B2/fr not_active Expired
- 1974-07-09 IE IE1456/74A patent/IE41822B1/en unknown
- 1974-10-01 AR AR255873A patent/AR202663A1/es active
- 1974-10-01 AR AR255872A patent/AR202662A1/es active
- 1974-10-01 AR AR255874A patent/AR200626A1/es active
-
1975
- 1975-04-29 ES ES437150A patent/ES437150A1/es not_active Expired
- 1975-04-29 ES ES437151A patent/ES437151A1/es not_active Expired
-
1979
- 1979-02-23 NO NO790627A patent/NO143064C/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4289776A (en) | Xanthine derivatives | |
| FI89921B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara tertiaera hydroxialkylxantiner | |
| FI61703C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla hydroxialkylxantiner | |
| EP0028834B1 (en) | Imidazole-5-acetic acid derivatives, their production and use | |
| EP0103497B1 (fr) | Nouveaux dérivés de la xanthine, leur procédé de préparation et les compositions pharmaceutiques les renfermant | |
| NZ272591A (en) | 1-aryl substituted pyrimidine-2,6-dione and 3-aryl substituted purine-2,6-dione derivatives and pharmaceutical uses thereof | |
| EP0051829A1 (en) | N-substituted omega-(2-oxo-4-imidazolin-1-yl) alcanoic acids, salts and esters thereof, process for producing the same and these active agents containing pharmaceutical compounds | |
| PL163884B1 (pl) | Sposób wytwarzania fluoksetyny PL PL PL | |
| JPS62116583A (ja) | プリン誘導体 | |
| US5314890A (en) | 1-7 disubstituted xanthine derivatives having antiasthmatic activity, their physiologically acceptable salts, pharmaceutical compositions containing them and process for their preparation | |
| JPH0222075B2 (enExample) | ||
| US3734911A (en) | Dialkyl-xanthine derivatives | |
| ITMI941494A1 (it) | Derivati del fenilcarbammato atti all'impiego come anticolinesterasici | |
| Montgomery et al. | Synthesis of potential anticancer agents. XXX.(1-Aziridinyl) purines | |
| CA1075237A (en) | Purine derivatives | |
| US4512990A (en) | Benzthiazine analogs as antiinflammatory agents | |
| US3905990A (en) | Basically substituted benzimidazole derivatives | |
| CA1086316A (en) | Purine acyclic nucleosides | |
| RU2159617C2 (ru) | Производные ксантина, их стереоизомеры и физиологически переносимые соли, фармацевтическая композиция, обладающая уменьшающей патологическую гиперактивность эозинофильных гранулятов активностью | |
| US3926995A (en) | Theophylline derivatives | |
| JPS6141915B2 (enExample) | ||
| KR930010559B1 (ko) | 1-히드록시알킬크산틴류, 그의 제조방법 | |
| DE2366527C2 (enExample) | ||
| GB1561380A (en) | Esters of hydroxyalkoxyalkyl purines their preparation and pharmaceutical compositions containing them | |
| CA1075692A (en) | Xanthine derivatives |