FI59097C - Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrimido(4,5-b)kinolin-4(3h)-oni-2-karboxylsyraderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrimido(4,5-b)kinolin-4(3h)-oni-2-karboxylsyraderivat Download PDFInfo
- Publication number
- FI59097C FI59097C FI751628A FI751628A FI59097C FI 59097 C FI59097 C FI 59097C FI 751628 A FI751628 A FI 751628A FI 751628 A FI751628 A FI 751628A FI 59097 C FI59097 C FI 59097C
- Authority
- FI
- Finland
- Prior art keywords
- quinolin
- pyrimido
- compounds
- preparation
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 23
- 238000002360 preparation method Methods 0.000 title description 8
- 241001465754 Metazoa Species 0.000 title description 7
- 230000001225 therapeutic effect Effects 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- -1 cationic salts Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- PUBYDOJONNWFJJ-UHFFFAOYSA-N 2-aminoquinoline-3-carboxylic acid Chemical class C1=CC=C2C=C(C(O)=O)C(N)=NC2=C1 PUBYDOJONNWFJJ-UHFFFAOYSA-N 0.000 description 4
- 108010058846 Ovalbumin Proteins 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 230000003266 anti-allergic effect Effects 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 206010070835 Skin sensitisation Diseases 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical class OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 3
- 229960003699 evans blue Drugs 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000012038 nucleophile Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 231100000370 skin sensitisation Toxicity 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- GXZOXGRLLFZVGF-UHFFFAOYSA-N 2-aminoquinoline-3-carboxamide Chemical compound C1=CC=C2N=C(N)C(C(=O)N)=CC2=C1 GXZOXGRLLFZVGF-UHFFFAOYSA-N 0.000 description 2
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 230000000521 hyperimmunizing effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 150000002912 oxalic acid derivatives Chemical class 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- AAZKQXRGMFBMCF-UHFFFAOYSA-N 2-amino-6,7-dimethoxyquinoline-3-carboxamide Chemical compound NC(=O)C1=C(N)N=C2C=C(OC)C(OC)=CC2=C1 AAZKQXRGMFBMCF-UHFFFAOYSA-N 0.000 description 1
- FXWFZIRWWNPPOV-UHFFFAOYSA-N 2-aminobenzaldehyde Chemical compound NC1=CC=CC=C1C=O FXWFZIRWWNPPOV-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- KKORZNPFZXORNH-UHFFFAOYSA-N 4-oxo-3h-quinoline-2-carboxylic acid Chemical compound C1=CC=C2C(=O)CC(C(=O)O)=NC2=C1 KKORZNPFZXORNH-UHFFFAOYSA-N 0.000 description 1
- HCQHHOPQKUCGAL-UHFFFAOYSA-N 7-hydroxy-4-oxo-1h-pyrimido[4,5-b]quinoline-2-carboxylic acid Chemical compound C1=C(O)C=C2C=C(C(=O)NC(C(=O)O)=N3)C3=NC2=C1 HCQHHOPQKUCGAL-UHFFFAOYSA-N 0.000 description 1
- CKZYHVPSVYPYJR-UHFFFAOYSA-N 7-hydroxy-8-methoxy-4-oxo-1h-pyrimido[4,5-b]quinoline-2-carboxylic acid Chemical compound N1=C(C(O)=O)NC(=O)C2=C1N=C1C=C(OC)C(O)=CC1=C2 CKZYHVPSVYPYJR-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 241000588832 Bordetella pertussis Species 0.000 description 1
- DYLTXFKQRPDOIM-UHFFFAOYSA-N C(C)C=1NC(C=2C(=NC3=CC=C(C=C3C2)O)N1)=O Chemical compound C(C)C=1NC(C=2C(=NC3=CC=C(C=C3C2)O)N1)=O DYLTXFKQRPDOIM-UHFFFAOYSA-N 0.000 description 1
- XZUTUMXCZCEJNY-UHFFFAOYSA-N C(C1=CC=CC=C1)OC=1CC(C=O)(C(=CC1)[N+](=O)[O-])OC Chemical compound C(C1=CC=CC=C1)OC=1CC(C=O)(C(=CC1)[N+](=O)[O-])OC XZUTUMXCZCEJNY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241001239379 Calophysus macropterus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N Monoamide-Oxalic acid Natural products NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000004856 capillary permeability Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- IPOKKXQKOUMPPQ-UHFFFAOYSA-N ethyl 7-acetyloxy-8-methoxy-4-oxo-1h-pyrimido[4,5-b]quinoline-2-carboxylate Chemical compound C1=C(OC(C)=O)C(OC)=CC2=NC3=NC(C(=O)OCC)=NC(O)=C3C=C21 IPOKKXQKOUMPPQ-UHFFFAOYSA-N 0.000 description 1
- DPUYKOOWTKFVIR-UHFFFAOYSA-N ethyl 7-hydroxy-4-oxo-1h-pyrimido[4,5-b]quinoline-2-carboxylate Chemical compound C1=C(O)C=C2C=C(C(=O)NC(C(=O)OCC)=N3)C3=NC2=C1 DPUYKOOWTKFVIR-UHFFFAOYSA-N 0.000 description 1
- RLGPISBVXLTLFT-UHFFFAOYSA-N ethyl 7-hydroxy-8-methoxy-4-oxo-1h-pyrimido[4,5-b]quinoline-2-carboxylate Chemical compound COC1=C(O)C=C2C=C(C(=O)NC(C(=O)OCC)=N3)C3=NC2=C1 RLGPISBVXLTLFT-UHFFFAOYSA-N 0.000 description 1
- QECQDIAWRNBGLO-UHFFFAOYSA-N ethyl 7-methoxy-4-oxo-8-phenylmethoxy-1h-pyrimido[4,5-b]quinoline-2-carboxylate Chemical compound COC=1C=C2C=C3C(=O)NC(C(=O)OCC)=NC3=NC2=CC=1OCC1=CC=CC=C1 QECQDIAWRNBGLO-UHFFFAOYSA-N 0.000 description 1
- MSMGXWFHBSCQFB-UHFFFAOYSA-N ethyl cyanoformate Chemical compound CCOC(=O)C#N MSMGXWFHBSCQFB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- UJTMLNARSPORHR-UHFFFAOYSA-N oc2h5 Chemical compound C=C=[O+] UJTMLNARSPORHR-UHFFFAOYSA-N 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003230 pyrimidines Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- ZJVTYKZWDWVIFD-UHFFFAOYSA-N zinc;hydrochloride Chemical compound Cl.[Zn] ZJVTYKZWDWVIFD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/24—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in positions 2 and 4
- C07D265/26—Two oxygen atoms, e.g. isatoic anhydride
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/485,945 US3974161A (en) | 1974-02-20 | 1974-07-05 | Fused pyrimidin-4(3H)-ones as antiallergy agents |
| US48594574 | 1974-07-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI751628A7 FI751628A7 (enEXAMPLES) | 1976-01-06 |
| FI59097B FI59097B (fi) | 1981-02-27 |
| FI59097C true FI59097C (fi) | 1981-06-10 |
Family
ID=23930024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI751628A FI59097C (fi) | 1974-07-05 | 1975-06-03 | Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrimido(4,5-b)kinolin-4(3h)-oni-2-karboxylsyraderivat |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS518280A (enEXAMPLES) |
| AR (1) | AR214389A1 (enEXAMPLES) |
| AT (1) | AT351546B (enEXAMPLES) |
| BE (1) | BE829987R (enEXAMPLES) |
| BG (1) | BG25226A3 (enEXAMPLES) |
| CA (1) | CA1053674A (enEXAMPLES) |
| CH (1) | CH619951A5 (enEXAMPLES) |
| DD (1) | DD118093A6 (enEXAMPLES) |
| DE (1) | DE2525050A1 (enEXAMPLES) |
| DK (1) | DK250275A (enEXAMPLES) |
| ES (1) | ES437966A2 (enEXAMPLES) |
| FI (1) | FI59097C (enEXAMPLES) |
| GB (1) | GB1501438A (enEXAMPLES) |
| IE (1) | IE42746B1 (enEXAMPLES) |
| LU (1) | LU72672A1 (enEXAMPLES) |
| NO (1) | NO751594L (enEXAMPLES) |
| RO (1) | RO69550A (enEXAMPLES) |
| SE (1) | SE420610B (enEXAMPLES) |
| YU (1) | YU145675A (enEXAMPLES) |
| ZA (1) | ZA752908B (enEXAMPLES) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5510896U (enEXAMPLES) * | 1979-08-03 | 1980-01-24 | ||
| JPS5510891U (enEXAMPLES) * | 1979-08-03 | 1980-01-24 | ||
| JPS5510892U (enEXAMPLES) * | 1979-08-03 | 1980-01-24 | ||
| JPS5510894U (enEXAMPLES) * | 1979-08-03 | 1980-01-24 | ||
| JPS59210071A (ja) * | 1982-12-30 | 1984-11-28 | バイオメジヤ−・インコ−ポレ−テツド | 抗ウイルス作用を有する化合物 |
| WO2004034985A2 (en) * | 2002-10-16 | 2004-04-29 | Smithkline Beecham Corporation | Chemical compounds |
-
1975
- 1975-04-30 CA CA225,936A patent/CA1053674A/en not_active Expired
- 1975-05-01 IE IE980/75A patent/IE42746B1/en unknown
- 1975-05-02 GB GB18583/75A patent/GB1501438A/en not_active Expired
- 1975-05-05 NO NO751594A patent/NO751594L/no unknown
- 1975-05-06 ZA ZA00752908A patent/ZA752908B/xx unknown
- 1975-05-27 ES ES437966A patent/ES437966A2/es not_active Expired
- 1975-06-03 DE DE19752525050 patent/DE2525050A1/de not_active Ceased
- 1975-06-03 FI FI751628A patent/FI59097C/fi not_active IP Right Cessation
- 1975-06-04 RO RO7582428A patent/RO69550A/ro unknown
- 1975-06-04 DK DK250275A patent/DK250275A/da unknown
- 1975-06-04 BG BG030186A patent/BG25226A3/xx unknown
- 1975-06-05 YU YU01456/75A patent/YU145675A/xx unknown
- 1975-06-06 LU LU72672A patent/LU72672A1/xx unknown
- 1975-06-06 AR AR259117A patent/AR214389A1/es active
- 1975-06-06 DD DD186490A patent/DD118093A6/xx unknown
- 1975-06-06 CH CH730075A patent/CH619951A5/fr not_active IP Right Cessation
- 1975-06-06 JP JP50068456A patent/JPS518280A/ja active Pending
- 1975-06-06 AT AT432675A patent/AT351546B/de not_active IP Right Cessation
- 1975-06-06 BE BE1006719A patent/BE829987R/xx active
- 1975-06-21 SE SE7504599A patent/SE420610B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE7504599L (sv) | 1976-01-07 |
| ATA432675A (de) | 1979-01-15 |
| RO69550A (ro) | 1981-08-30 |
| LU72672A1 (enEXAMPLES) | 1976-03-17 |
| CA1053674A (en) | 1979-05-01 |
| IE42746L (en) | 1976-01-05 |
| DK250275A (da) | 1976-01-06 |
| CH619951A5 (en) | 1980-10-31 |
| BG25226A3 (bg) | 1978-08-10 |
| YU145675A (en) | 1982-08-31 |
| DD118093A6 (enEXAMPLES) | 1976-02-12 |
| ES437966A2 (es) | 1977-02-16 |
| GB1501438A (en) | 1978-02-15 |
| AU8095575A (en) | 1976-11-11 |
| SE420610B (sv) | 1981-10-19 |
| ZA752908B (en) | 1976-04-28 |
| DE2525050A1 (de) | 1976-01-22 |
| IE42746B1 (en) | 1980-10-08 |
| BE829987R (fr) | 1975-12-08 |
| AT351546B (de) | 1979-07-25 |
| FI59097B (fi) | 1981-02-27 |
| NO751594L (enEXAMPLES) | 1976-01-06 |
| FI751628A7 (enEXAMPLES) | 1976-01-06 |
| AR214389A1 (es) | 1979-06-15 |
| JPS518280A (enEXAMPLES) | 1976-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3447292B2 (ja) | イミダゾピリジン及び胃腸の疾病の治療のためのその使用 | |
| EP0310950B1 (en) | Quinoline intermediates for the synthesis of 1H-imidazo[4,5-c]quinolines and 1H-imidazo[4,5-c]quinolin-4-amimes | |
| US4689338A (en) | 1H-Imidazo[4,5-c]quinolin-4-amines and antiviral use | |
| RU2126007C1 (ru) | Производные индолокарбазолимида, смесь их изомеров и их соли, фармацевтическая композиция с активностью, ингибирующей протеинкиназу c или киназу легкой миозиновой цепи или подавляющей иммунные реакции | |
| JPH0327380A (ja) | 1h―イミダゾ〔4,5―c〕キノリン―4―アミン類 | |
| KR20070062609A (ko) | 5-ht2c 아고니스트로서의 피롤로인돌, 피리도인돌 및아제피노인돌 | |
| NO791150L (no) | Substituerte 5,6-dimetylpyrrolo/2,3-d/pyrimidiner, fremgangsmaate til deres fremstilling og deres anvendelse som legemiddel | |
| JPH09301958A (ja) | 新規ピリミジン化合物及び抗ロタウイルス剤 | |
| KR100523422B1 (ko) | 테트라히드로피리도 화합물 | |
| CZ105596A3 (en) | ALKOXYALKYL CARBAMATES OF IMIDAZO(1,2-a)PYRIDINES | |
| JPS6225670B2 (enEXAMPLES) | ||
| AU685881B2 (en) | 5-heteroarylindole derivatives as benzodiazepine receptor site agonists and antagonists | |
| FI59097C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrimido(4,5-b)kinolin-4(3h)-oni-2-karboxylsyraderivat | |
| US4088647A (en) | Pyrazino (1,2,3-ab)-β-carboline derivatives and salts thereof and method of preparing same | |
| SK197A3 (en) | Imidazopyridine-azolidinones, preparation method thereof, pharmaceutical composition containing same and their use | |
| FI86426B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 4-oh-kinolinkarboxylsyraderivat. | |
| JPH04128288A (ja) | キノロンカルボン酸誘導体及びその製造方法 | |
| PL100184B1 (pl) | Sposob wytwarzania nowych pochodnych naftyrydynylo-piroliny | |
| US4044134A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| JPH06211841A (ja) | β−カルボリン由来化合物、逆アゴニスト及びアンタゴニスト作用を有するベンゾジアゼピンレセプターリガンド及びそれを含有する薬剤 | |
| CS242858B2 (en) | Method of octahydro-1h-pyrrolo(2,3-g)-isoquinolines production | |
| RU2068415C1 (ru) | 5,7-диокси-2-метил-8-/4-(3-окси-1-(1-пропил)пиперидинил/-4н-1-бензопиран-4-он или его стереоизомеры или фармакологически приемлемые кислотно-аддитивные соли и способ их получения | |
| US3989689A (en) | 4-Carbamoyl-1-benzazepines | |
| NZ228286A (en) | Quinolin-2,5-diones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: PFIZER INC. |