FI57770C - Gjutbara polybutylentereftalat-kompositioner som innehaoller naolaktigt kalsiummetasilikat - Google Patents
Gjutbara polybutylentereftalat-kompositioner som innehaoller naolaktigt kalsiummetasilikat Download PDFInfo
- Publication number
- FI57770C FI57770C FI3468/72A FI346872A FI57770C FI 57770 C FI57770 C FI 57770C FI 3468/72 A FI3468/72 A FI 3468/72A FI 346872 A FI346872 A FI 346872A FI 57770 C FI57770 C FI 57770C
- Authority
- FI
- Finland
- Prior art keywords
- pbt
- calcium metasilicate
- calcium
- polybutylene terephthalate
- needle
- Prior art date
Links
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 title description 3
- 229910052791 calcium Inorganic materials 0.000 title description 3
- 239000011575 calcium Substances 0.000 title description 3
- 229920001707 polybutylene terephthalate Polymers 0.000 description 52
- 235000012241 calcium silicate Nutrition 0.000 description 35
- 229910052918 calcium silicate Inorganic materials 0.000 description 34
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 34
- -1 polybutylene terephthalate Polymers 0.000 description 34
- 239000011347 resin Substances 0.000 description 25
- 229920005989 resin Polymers 0.000 description 25
- 238000005266 casting Methods 0.000 description 21
- 239000000203 mixture Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 239000010425 asbestos Substances 0.000 description 14
- 239000000835 fiber Substances 0.000 description 14
- 239000012744 reinforcing agent Substances 0.000 description 14
- 229910052895 riebeckite Inorganic materials 0.000 description 14
- 239000003365 glass fiber Substances 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 10
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 8
- 238000012360 testing method Methods 0.000 description 7
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 6
- 229920000139 polyethylene terephthalate Polymers 0.000 description 6
- 239000005020 polyethylene terephthalate Substances 0.000 description 6
- 239000012779 reinforcing material Substances 0.000 description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Inorganic materials O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 5
- 238000005260 corrosion Methods 0.000 description 5
- 230000007797 corrosion Effects 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 230000032683 aging Effects 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000011152 fibreglass Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229920001748 polybutylene Polymers 0.000 description 3
- 230000003014 reinforcing effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- MBRNKMIFWVMHPZ-UHFFFAOYSA-N bis(hydroxymethyl) benzene-1,4-dicarboxylate Chemical compound OCOC(=O)C1=CC=C(C(=O)OCO)C=C1 MBRNKMIFWVMHPZ-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 235000012431 wafers Nutrition 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- 229910004762 CaSiO Inorganic materials 0.000 description 1
- 239000000899 Gutta-Percha Substances 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 240000000342 Palaquium gutta Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- BTZJQYVYGCCNHY-UHFFFAOYSA-N calcium;urea Chemical compound [Ca].NC(N)=O BTZJQYVYGCCNHY-UHFFFAOYSA-N 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- 238000010891 electric arc Methods 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229920000588 gutta-percha Polymers 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 230000009974 thixotropic effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- MBWVCEZZJUXUHB-UHFFFAOYSA-I zinc antimony(3+) pentaacetate Chemical compound [Sb+3].C(C)(=O)[O-].[Zn+2].C(C)(=O)[O-].C(C)(=O)[O-].C(C)(=O)[O-].C(C)(=O)[O-] MBWVCEZZJUXUHB-UHFFFAOYSA-I 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/34—Silicon-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21019071A | 1971-12-15 | 1971-12-15 | |
| US21019071 | 1971-12-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI57770B FI57770B (fi) | 1980-06-30 |
| FI57770C true FI57770C (fi) | 1980-10-10 |
Family
ID=22781926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3468/72A FI57770C (fi) | 1971-12-15 | 1972-12-07 | Gjutbara polybutylentereftalat-kompositioner som innehaoller naolaktigt kalsiummetasilikat |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3764576A (index.php) |
| JP (1) | JPS513500B2 (index.php) |
| AT (1) | AT333039B (index.php) |
| AU (1) | AU454512B2 (index.php) |
| BE (1) | BE792712A (index.php) |
| BR (1) | BR7208791D0 (index.php) |
| CA (1) | CA1008582A (index.php) |
| CH (1) | CH563422A5 (index.php) |
| CS (1) | CS185207B2 (index.php) |
| DD (1) | DD101173A5 (index.php) |
| DE (1) | DE2256699B2 (index.php) |
| DK (1) | DK139527B (index.php) |
| ES (1) | ES409609A1 (index.php) |
| FI (1) | FI57770C (index.php) |
| FR (1) | FR2163635B1 (index.php) |
| GB (1) | GB1367710A (index.php) |
| IL (1) | IL41080A (index.php) |
| IT (1) | IT971806B (index.php) |
| NL (1) | NL150489B (index.php) |
| NO (1) | NO136756C (index.php) |
| PL (1) | PL87757B1 (index.php) |
| RO (1) | RO69128A (index.php) |
| SU (1) | SU475785A3 (index.php) |
| ZA (1) | ZA727675B (index.php) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5090649A (index.php) * | 1973-12-14 | 1975-07-19 | ||
| JPS5319335B2 (index.php) * | 1974-11-22 | 1978-06-20 | ||
| DE2512504A1 (de) * | 1975-03-21 | 1976-10-07 | Basf Ag | Polyesterformmassen mit verminderter brennbarkeit |
| CH595416A5 (index.php) * | 1975-04-18 | 1978-02-15 | Ciba Geigy Ag | |
| CA1088235A (en) * | 1975-09-24 | 1980-10-21 | Frank M.. Berardinelli | Reinforced polyester composition having improved impact strength |
| US4203887A (en) * | 1978-01-19 | 1980-05-20 | General Electric Company | Modified polyester composition |
| JPS555958A (en) * | 1978-06-30 | 1980-01-17 | Dainippon Ink & Chem Inc | Flame-retardant resin composition |
| FR2486085B1 (fr) * | 1979-05-23 | 1986-09-26 | Gen Electric | Compositions modifiees de polyesters, en particulier de poly(terephtalate de butylene) |
| US4429004A (en) * | 1980-06-26 | 1984-01-31 | Ciba-Geigy Corporation | Light-reflecting body |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4478964A (en) * | 1981-06-05 | 1984-10-23 | Mobay Chemical Corporation | Polycarbonate-silicate compositions |
| JPS5842639A (ja) * | 1981-09-07 | 1983-03-12 | Toa Nenryo Kogyo Kk | ポリオレフイン組成物 |
| US4487877A (en) * | 1981-12-07 | 1984-12-11 | Matsushita Electric Industrial Co., Ltd. | Diaphragm for loudspeaker |
| EP0089314B1 (de) * | 1982-03-16 | 1986-02-19 | Ciba-Geigy Ag | Flammwidrige verstärkte thermoplastische Polyesterformmasse und deren Verwendung |
| US4458039A (en) * | 1983-02-07 | 1984-07-03 | Celanese Corporation | Thermotropic liquid crystalline polymer blend with reduced surface abrasion |
| US4874809A (en) * | 1988-01-25 | 1989-10-17 | Eastman Kodak Company | Reinforced polyesters, article thereof and method of making low warpage articles |
| US5149734A (en) * | 1989-10-20 | 1992-09-22 | General Electric Company | Highly filled thermoplastic polyester molding compositions |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5399608A (en) * | 1989-10-20 | 1995-03-21 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5132353A (en) * | 1989-10-20 | 1992-07-21 | General Electric Company | Molding composition |
| JP3156863B2 (ja) * | 1991-12-26 | 2001-04-16 | 日本ジーイープラスチックス株式会社 | 強化難燃ポリエステル系樹脂組成物 |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| DE69433719T2 (de) * | 1993-08-19 | 2005-03-24 | General Electric Co. | Mineralgefüllte thermoplastische Formmasse |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US6221279B1 (en) | 1999-06-24 | 2001-04-24 | Isotag Technology, Inc. | Pigment particles for invisible marking applications |
| US20060036012A1 (en) * | 2004-08-10 | 2006-02-16 | Hayes Richard A | Process for producing a wollastonite containing polyester and products and articles produced therefrom |
| US20070232170A1 (en) * | 2005-12-22 | 2007-10-04 | Atwood Kenneth B | Polyester and modified fluoropolymer blends |
| TWI424931B (zh) * | 2011-08-26 | 2014-02-01 | Wistron Neweb Corp | 車用雷達裝置及其天線罩 |
| CN102956969A (zh) * | 2011-08-30 | 2013-03-06 | 启碁科技股份有限公司 | 车用雷达装置及其天线罩 |
| US9130426B2 (en) * | 2011-10-31 | 2015-09-08 | Regal Beloit America, Inc. | Permanent magnet rotors and methods of assembling the same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA879151A (en) * | 1971-08-24 | Celanese Corporation | Polyalkylene terephthalate molding resin | |
| US2888377A (en) * | 1954-03-25 | 1959-05-26 | Columbia Southern Chem Corp | Calcium silicate and method of producing same |
| BE574476A (index.php) * | 1958-01-08 | |||
| FR84238E (fr) * | 1963-04-08 | 1964-12-24 | Organico | Matières thermoplastiques améliorées et leur procédé de fabrication |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
-
0
- BE BE792712D patent/BE792712A/xx unknown
-
1971
- 1971-12-15 US US00210190A patent/US3764576A/en not_active Expired - Lifetime
-
1972
- 1972-10-30 ZA ZA727675A patent/ZA727675B/xx unknown
- 1972-10-31 CA CA155,293A patent/CA1008582A/en not_active Expired
- 1972-11-18 DE DE2256699A patent/DE2256699B2/de not_active Ceased
- 1972-11-27 AT AT1008972A patent/AT333039B/de not_active IP Right Cessation
- 1972-11-30 AU AU49496/72A patent/AU454512B2/en not_active Expired
- 1972-12-07 FI FI3468/72A patent/FI57770C/fi active
- 1972-12-08 RO RO7273082A patent/RO69128A/ro unknown
- 1972-12-12 CH CH1806972A patent/CH563422A5/xx not_active IP Right Cessation
- 1972-12-12 JP JP47124009A patent/JPS513500B2/ja not_active Expired
- 1972-12-13 DD DD167616A patent/DD101173A5/xx unknown
- 1972-12-13 NL NL727216897A patent/NL150489B/xx unknown
- 1972-12-13 IT IT32837/72A patent/IT971806B/it active
- 1972-12-13 BR BR008791/72A patent/BR7208791D0/pt unknown
- 1972-12-13 GB GB5742972A patent/GB1367710A/en not_active Expired
- 1972-12-13 IL IL41080A patent/IL41080A/xx unknown
- 1972-12-14 FR FR7244593A patent/FR2163635B1/fr not_active Expired
- 1972-12-14 DK DK622172AA patent/DK139527B/da unknown
- 1972-12-14 NO NO4615/72A patent/NO136756C/no unknown
- 1972-12-14 PL PL1972159519A patent/PL87757B1/pl unknown
- 1972-12-14 ES ES409609A patent/ES409609A1/es not_active Expired
- 1972-12-15 SU SU1857818A patent/SU475785A3/ru active
- 1972-12-15 CS CS7200008651A patent/CS185207B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL41080A (en) | 1975-12-31 |
| DK139527B (da) | 1979-03-05 |
| ZA727675B (en) | 1973-07-25 |
| US3764576A (en) | 1973-10-09 |
| FI57770B (fi) | 1980-06-30 |
| NL7216897A (index.php) | 1973-06-19 |
| DE2256699A1 (de) | 1973-06-28 |
| ATA1008972A (de) | 1976-02-15 |
| RO69128A (ro) | 1981-08-30 |
| IL41080A0 (en) | 1973-02-28 |
| JPS4866652A (index.php) | 1973-09-12 |
| AU454512B2 (en) | 1974-10-31 |
| FR2163635B1 (index.php) | 1978-09-08 |
| DE2256699B2 (de) | 1976-01-02 |
| AU4949672A (en) | 1974-05-30 |
| JPS513500B2 (index.php) | 1976-02-03 |
| NO136756C (no) | 1977-11-02 |
| BR7208791D0 (pt) | 1973-12-11 |
| DK139527C (index.php) | 1979-08-27 |
| CA1008582A (en) | 1977-04-12 |
| ES409609A1 (es) | 1976-01-01 |
| GB1367710A (en) | 1974-09-18 |
| CH563422A5 (index.php) | 1975-06-30 |
| NO136756B (index.php) | 1977-07-25 |
| CS185207B2 (en) | 1978-09-15 |
| NL150489B (nl) | 1976-08-16 |
| PL87757B1 (index.php) | 1976-07-31 |
| AT333039B (de) | 1976-10-25 |
| BE792712A (fr) | 1973-06-14 |
| FR2163635A1 (index.php) | 1973-07-27 |
| DD101173A5 (index.php) | 1973-10-20 |
| SU475785A3 (ru) | 1975-06-30 |
| IT971806B (it) | 1974-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI57770C (fi) | Gjutbara polybutylentereftalat-kompositioner som innehaoller naolaktigt kalsiummetasilikat | |
| DE2856270C2 (de) | Formmasse und Verfahren zu ihrer Herstellung | |
| DE2545568C3 (de) | Flamm- und lichtbogenfeste Polyesterpreßmassen | |
| DE68927469T2 (de) | Polyamidharz-Zusammensetzungen | |
| DE69114304T2 (de) | Copolyamide aus terephthalsäure. | |
| DE2852750C2 (de) | Formmasse | |
| DE69408833T3 (de) | Mineralgefüllte copolyamdidzusammensetzungen | |
| DE69029552T2 (de) | Flammhemmende Harzzusammensetzung und Formkörper für elektrische Teile | |
| DE69623858T2 (de) | Verwendung anorganischer Oxide oder Hydroxide in flüssigkristallinen Polyesterharzen | |
| DE69222685T2 (de) | Flammhemmende Polybutylenterephthalatharzzusammensetzung | |
| DE2616754C2 (de) | Formmasse auf der Basis von Polybutylenterephthalat | |
| DE2646965A1 (de) | Anorganischer fuellstoff und damit gefuellte kunstharzmasse | |
| DE2459062B2 (de) | Glasfaserverstärkte, flammwidrige, thermoplastische Polyesterformmassen | |
| DE69031236T2 (de) | Zusammensetzung aromatischer Polycarbonate | |
| DE2524121A1 (de) | Thermoplastische polybutylenterephthalat-formmassen mit verbesserter kriechstromfestigkeit | |
| EP0327978A1 (de) | Füllstoffhaltige Polyamid-Formmassen mit verbesserter Oberfläche und Lackierbarkeit | |
| DE2855521A1 (de) | Verbesserte thermoplastische formmassen | |
| DE3874359T2 (de) | Flammwidrige polyamidharzzubereitung. | |
| DE3706356A1 (de) | Polyamidgranulat mit aeusserer huelle | |
| DE2534762A1 (de) | Thermoplastische polyestermasse | |
| DE2042447A1 (de) | Formmassen und ihre Herstellung | |
| DE2361773A1 (de) | Verstaerkte thermoplastische massen | |
| EP0194523B1 (de) | Hydrophobierte, leichtfliessende thermoplastische Polyamide | |
| EP0591731B1 (de) | Fliessfähige Polyamidformmassen | |
| DE68911122T2 (de) | Polyacetal-harzzusammensetzung. |