FI56475C - D-cis transkrysantemat innehaollande insekticidkomposition - Google Patents
D-cis transkrysantemat innehaollande insekticidkomposition Download PDFInfo
- Publication number
- FI56475C FI56475C FI3018/73A FI301873A FI56475C FI 56475 C FI56475 C FI 56475C FI 3018/73 A FI3018/73 A FI 3018/73A FI 301873 A FI301873 A FI 301873A FI 56475 C FI56475 C FI 56475C
- Authority
- FI
- Finland
- Prior art keywords
- trans
- cis
- chrysanthemate
- preparation
- chrysanthemic acid
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 58
- 230000000749 insecticidal effect Effects 0.000 claims description 29
- XLOPRKKSAJMMEW-SFYZADRCSA-M (R,R)-chrysanthemate Chemical compound CC(C)=C[C@@H]1[C@@H](C([O-])=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-M 0.000 claims description 24
- 239000004480 active ingredient Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 101000870345 Vasconcellea cundinamarcensis Cysteine proteinase 1 Proteins 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- 150000001875 compounds Chemical class 0.000 description 50
- 238000002360 preparation method Methods 0.000 description 41
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 34
- -1 (+) - cis Chemical compound 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 241000255925 Diptera Species 0.000 description 20
- 239000000443 aerosol Substances 0.000 description 18
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 15
- 239000002917 insecticide Substances 0.000 description 15
- 230000000694 effects Effects 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 230000002195 synergetic effect Effects 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 10
- 239000007921 spray Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000003350 kerosene Substances 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 6
- 241000257226 Muscidae Species 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- XLOPRKKSAJMMEW-YUMQZZPRSA-N (+)-cis-chrysanthemic acid Chemical compound CC(C)=C[C@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-YUMQZZPRSA-N 0.000 description 5
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 229960005235 piperonyl butoxide Drugs 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- 241000256054 Culex <genus> Species 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 description 3
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 3
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 241000723353 Chrysanthemum Species 0.000 description 3
- 235000007516 Chrysanthemum Nutrition 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 235000019766 L-Lysine Nutrition 0.000 description 3
- 239000004472 Lysine Substances 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241000396377 Tranes Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940024113 allethrin Drugs 0.000 description 3
- 239000010425 asbestos Substances 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 3
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000000638 solvent extraction Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WLDMPODMCFGWAA-UHFFFAOYSA-N 3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione Chemical compound C1CCCC2C(=O)NC(=O)C21 WLDMPODMCFGWAA-UHFFFAOYSA-N 0.000 description 2
- 241001674044 Blattodea Species 0.000 description 2
- 241000256113 Culicidae Species 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000014121 butter Nutrition 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 2
- 239000002316 fumigant Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000012747 synergistic agent Substances 0.000 description 2
- XLOPRKKSAJMMEW-HTQZYQBOSA-N (-)-cis-chrysanthemic acid Chemical compound CC(C)=C[C@@H]1[C@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-HTQZYQBOSA-N 0.000 description 1
- SBLJHJFELRVSEP-UHFFFAOYSA-N (4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl) thiocyanate Chemical compound C1CC2(C)C(SC#N)CC1C2(C)C SBLJHJFELRVSEP-UHFFFAOYSA-N 0.000 description 1
- AFEOKIGLYCQHAZ-UHFFFAOYSA-N (5-benzylfuran-3-yl)methanol Chemical compound OCC1=COC(CC=2C=CC=CC=2)=C1 AFEOKIGLYCQHAZ-UHFFFAOYSA-N 0.000 description 1
- LNJXZKBHJZAIKQ-UHFFFAOYSA-N 1,1,1,2-tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane Chemical compound ClC(Cl)(Cl)C(Cl)COCC(Cl)C(Cl)(Cl)Cl LNJXZKBHJZAIKQ-UHFFFAOYSA-N 0.000 description 1
- IAKOZHOLGAGEJT-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-Ethane Chemical compound C1=CC(OC)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(OC)C=C1 IAKOZHOLGAGEJT-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- AFJWMGOTLUUGHF-UHFFFAOYSA-N 4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1CCCC2=C1C(=O)NC2=O AFJWMGOTLUUGHF-UHFFFAOYSA-N 0.000 description 1
- PLNSRMGERSJCDQ-UHFFFAOYSA-N 4-(2-octylsulfinylpropyl)-1,3-benzodioxole Chemical compound C1OC2=CC=CC(=C2O1)CC(C)S(=O)CCCCCCCC PLNSRMGERSJCDQ-UHFFFAOYSA-N 0.000 description 1
- IMPPGHMHELILKG-UHFFFAOYSA-N 4-ethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1 IMPPGHMHELILKG-UHFFFAOYSA-N 0.000 description 1
- ISFGTDAAYLSOFY-UHFFFAOYSA-N 4-hydroxy-3-methyl-2-prop-2-ynylcyclopent-2-en-1-one Chemical compound CC1=C(CC#C)C(=O)CC1O ISFGTDAAYLSOFY-UHFFFAOYSA-N 0.000 description 1
- CSXOGACWYJFTLV-UHFFFAOYSA-N 4-methyl-5-propyl-1,3-benzodioxole Chemical compound CCCC1=CC=C2OCOC2=C1C CSXOGACWYJFTLV-UHFFFAOYSA-N 0.000 description 1
- VSBPRBXTUAKKSY-UHFFFAOYSA-N 5-(5-methyl-1,3-dioxan-4-yl)-1,3-benzodioxole Chemical compound CC1COCOC1C1=CC=C(OCO2)C2=C1 VSBPRBXTUAKKSY-UHFFFAOYSA-N 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000256059 Culex pipiens Species 0.000 description 1
- 241001137307 Cyprinodon variegatus Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 150000008545 L-lysines Chemical class 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 241000218922 Magnoliophyta Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical class C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical class C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- 101150098207 NAAA gene Proteins 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Natural products NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 240000004460 Tanacetum coccineum Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009363 floriculture Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 230000009474 immediate action Effects 0.000 description 1
- 239000000201 insect hormone Substances 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000003915 liquefied petroleum gas Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- BRBAEHHXGZRCBK-UHFFFAOYSA-N pentrinitrol Chemical compound [O-][N+](=O)OCC(CO)(CO[N+]([O-])=O)CO[N+]([O-])=O BRBAEHHXGZRCBK-UHFFFAOYSA-N 0.000 description 1
- 229950006286 pentrinitrol Drugs 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000012794 pre-harvesting Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- 229940015367 pyrethrum Drugs 0.000 description 1
- VEMKTZHHVJILDY-UHFFFAOYSA-N resmethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
- C07D209/49—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide and having in the molecule an acyl radical containing a saturated three-membered ring, e.g. chrysanthemumic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9845872A JPS5516402B2 (enExample) | 1972-09-29 | 1972-09-29 | |
| JP9845872 | 1972-09-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56475B FI56475B (fi) | 1979-10-31 |
| FI56475C true FI56475C (fi) | 1980-02-11 |
Family
ID=14220246
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3018/73A FI56475C (fi) | 1972-09-29 | 1973-09-27 | D-cis transkrysantemat innehaollande insekticidkomposition |
Country Status (33)
| Country | Link |
|---|---|
| US (1) | US3934023A (enExample) |
| JP (1) | JPS5516402B2 (enExample) |
| AT (1) | AT332679B (enExample) |
| BE (1) | BE805442A (enExample) |
| BR (1) | BR7307536D0 (enExample) |
| CA (1) | CA1007564A (enExample) |
| CH (2) | CH595062A5 (enExample) |
| CS (1) | CS203967B2 (enExample) |
| DD (1) | DD106775A5 (enExample) |
| DE (1) | DE2348930C3 (enExample) |
| DK (1) | DK139702B (enExample) |
| EG (1) | EG11400A (enExample) |
| FI (1) | FI56475C (enExample) |
| FR (1) | FR2201036B1 (enExample) |
| GB (1) | GB1443533A (enExample) |
| HK (1) | HK9277A (enExample) |
| HU (1) | HU177749B (enExample) |
| IN (1) | IN138685B (enExample) |
| IT (1) | IT1053522B (enExample) |
| KE (1) | KE2701A (enExample) |
| MX (1) | MX3300E (enExample) |
| MY (1) | MY7700179A (enExample) |
| NL (1) | NL150308B (enExample) |
| NO (1) | NO138318C (enExample) |
| OA (1) | OA04557A (enExample) |
| PH (1) | PH10808A (enExample) |
| PL (2) | PL99484B1 (enExample) |
| RO (1) | RO71392A (enExample) |
| SE (2) | SE417267B (enExample) |
| SU (2) | SU664529A3 (enExample) |
| TR (1) | TR19267A (enExample) |
| YU (1) | YU257173A (enExample) |
| ZA (1) | ZA737516B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS537499B2 (enExample) * | 1974-12-05 | 1978-03-18 | ||
| AU1973076A (en) * | 1975-11-19 | 1978-05-25 | Wellcome Australasia Limited | Pyrethroid and organophosphorus composition |
| JPS5462323A (en) * | 1977-10-11 | 1979-05-19 | Wellcome Found | Nematocide composition |
| DE2967512D1 (en) * | 1978-05-30 | 1985-10-17 | Wellcome Found | Synergistic pyrethroid formulations and their preparation |
| JPS5527104A (en) * | 1978-07-19 | 1980-02-27 | Sumitomo Chem Co Ltd | Pesticidal composition |
| FR2451161A1 (fr) * | 1979-03-16 | 1980-10-10 | Roussel Uclaf | Melanges synergiques a base d'esters de (s) allethrolone et de (r) allethrolone, doues d'activite contre les arthropodes |
| JPS562929A (en) * | 1979-06-21 | 1981-01-13 | Sumitomo Chem Co Ltd | Preparation of optically active cyclopentenolone |
| JPS5620546A (en) * | 1979-07-27 | 1981-02-26 | Sumitomo Chem Co Ltd | Carboxylic acid ester |
| DE3061543D1 (en) * | 1979-09-06 | 1983-02-10 | Sumitomo Chemical Co | Cis-(1r,2s)-3,3-dimethyl-2-((4s)-3-methyl-2-(2-propynyl)cyclopent-2-en-1-on-4-yloxyhydroxymethyl)-cyclopropanecarboxylic lactone and method of producing (s)-4-hydroxy-3-methyl-2-(2-propynyl)-cyclopent-2-en-1-on |
| EG18025A (en) * | 1986-07-18 | 1993-06-30 | Sumitomo Chemical Co | A method for killing insects by heating fumigation |
| EG18369A (en) * | 1986-08-15 | 1992-10-30 | Sumitomo Chemical Co | An insecticidal composition for electric fumigator |
| JP2570388B2 (ja) * | 1988-06-10 | 1997-01-08 | 住友化学工業株式会社 | カルボン酸エステルおよびその殺虫剤としての用途 |
| JP3052142B2 (ja) * | 1989-09-14 | 2000-06-12 | 住友化学工業株式会社 | 殺虫、殺ダニ組成物 |
| TW254842B (enExample) * | 1991-12-27 | 1995-08-21 | Sumitomo Chemical Co | |
| US5468497A (en) * | 1993-09-03 | 1995-11-21 | Dainihon Jochugiku Co., Ltd. | Fuming, hot-vaporizing insecticide for killing flies, and method for killing flies with the same |
| RU2176448C2 (ru) * | 1999-11-19 | 2001-12-10 | Открытое акционерное общество "Арнест" | Инсектицидный препарат |
| AU2011265562A1 (en) | 2011-01-12 | 2012-07-26 | Sumitomo Chemical Company, Limited | Method of controlling harmful arthropod, composition, and electrostatic spray device |
| JP2012153608A (ja) * | 2011-01-21 | 2012-08-16 | Sumitomo Chemical Co Ltd | 有害節足動物の防除方法、組成物、静電噴霧装置 |
| JO3626B1 (ar) | 2012-02-23 | 2020-08-27 | Merial Inc | تركيبات موضعية تحتوي على فيبرونيل و بيرميثرين و طرق استخدامها |
| WO2018050213A1 (en) | 2016-09-14 | 2018-03-22 | Endura S.P.A. | Improved process for the preparation of pyrethroids |
| KR20210061336A (ko) | 2018-07-27 | 2021-05-27 | 아페르타 바이오사이언시스 엘엘씨 | 모낭충으로 유발된 안구 및 안면 증상의 치료를 위한 스피노신 제제 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE635902A (enExample) * | 1962-08-06 | |||
| US3702333A (en) * | 1967-08-11 | 1972-11-07 | Yoshitomi Pharmaceutical | Cyclopropanecarboxylic acid esters possessing pesticidal properties |
| ZA708448B (en) * | 1969-12-24 | 1971-09-29 | Sumitomo Chemical Co | Novel insecticidal compositions |
| FR2077677B1 (enExample) * | 1970-02-04 | 1973-05-25 | Roussel Uclaf | |
| AU432259B1 (en) * | 1970-02-26 | 1972-08-24 | Sumitomo Chemical Company, Limited | Novel substituted chrysanthemates |
| US3714153A (en) * | 1970-06-22 | 1973-01-30 | Roussel Uclaf | Novel cyclopropanecarboxylic acids |
-
1972
- 1972-09-29 JP JP9845872A patent/JPS5516402B2/ja not_active Expired
-
1973
- 1973-09-19 NO NO3674/73A patent/NO138318C/no unknown
- 1973-09-24 IN IN2165/CAL/73A patent/IN138685B/en unknown
- 1973-09-24 ZA ZA737516*A patent/ZA737516B/xx unknown
- 1973-09-26 OA OA55018A patent/OA04557A/xx unknown
- 1973-09-26 US US05/401,034 patent/US3934023A/en not_active Expired - Lifetime
- 1973-09-26 GB GB4514173A patent/GB1443533A/en not_active Expired
- 1973-09-27 TR TR19267A patent/TR19267A/xx unknown
- 1973-09-27 CH CH1386473A patent/CH595062A5/xx not_active IP Right Cessation
- 1973-09-27 SE SE7313185A patent/SE417267B/xx unknown
- 1973-09-27 CH CH231077A patent/CH595063A5/xx not_active IP Right Cessation
- 1973-09-27 FI FI3018/73A patent/FI56475C/fi active
- 1973-09-27 DK DK530273AA patent/DK139702B/da not_active IP Right Cessation
- 1973-09-27 SU SU731961454A patent/SU664529A3/ru active
- 1973-09-27 FR FR7334658A patent/FR2201036B1/fr not_active Expired
- 1973-09-27 BR BR7536/73A patent/BR7307536D0/pt unknown
- 1973-09-28 CA CA182,160A patent/CA1007564A/en not_active Expired
- 1973-09-28 IT IT52830/73A patent/IT1053522B/it active
- 1973-09-28 CS CS736689A patent/CS203967B2/cs unknown
- 1973-09-28 HU HU73SU840A patent/HU177749B/hu unknown
- 1973-09-28 BE BE136149A patent/BE805442A/xx not_active IP Right Cessation
- 1973-09-28 DD DD173765A patent/DD106775A5/xx unknown
- 1973-09-28 NL NL737313373A patent/NL150308B/xx not_active IP Right Cessation
- 1973-09-28 MX MX005222U patent/MX3300E/es unknown
- 1973-09-28 DE DE2348930A patent/DE2348930C3/de not_active Expired
- 1973-09-28 YU YU02571/73A patent/YU257173A/xx unknown
- 1973-09-28 AT AT836073A patent/AT332679B/de not_active IP Right Cessation
- 1973-09-28 PH PH15066A patent/PH10808A/en unknown
- 1973-09-29 PL PL1973189104A patent/PL99484B1/pl unknown
- 1973-09-29 PL PL1973165532A patent/PL98702B1/xx unknown
- 1973-09-29 RO RO7376202A patent/RO71392A/ro unknown
- 1973-09-29 EG EG378/73A patent/EG11400A/xx active
-
1975
- 1975-08-20 SU SU7502167199A patent/SU572171A3/ru active
-
1976
- 1976-09-30 SE SE7610860A patent/SE430298B/sv not_active IP Right Cessation
-
1977
- 1977-02-03 KE KE2701A patent/KE2701A/xx unknown
- 1977-02-17 HK HK92/77A patent/HK9277A/xx unknown
- 1977-12-30 MY MY179/77A patent/MY7700179A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI56475C (fi) | D-cis transkrysantemat innehaollande insekticidkomposition | |
| US3973036A (en) | Cyclopropanecarboxylic acid esters | |
| DE2365555C2 (enExample) | ||
| DE2826864C2 (enExample) | ||
| US4212879A (en) | Benzyl pyrrolyl methyl carboxylate insecticides and acaricides | |
| US3899586A (en) | Synergistic chrysanthemate insecticides | |
| DE2231312B2 (enExample) | ||
| US3981903A (en) | Cyclopropane carboxylic acid esters | |
| US3766218A (en) | Novel substituted chrysanthemates | |
| DE2418950A1 (de) | Cyclopropancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide | |
| NO169479B (no) | Skrukapsel. | |
| US4496586A (en) | Cyclopropanecarboxylates, their production and insecticide containing them as an active ingredient | |
| US3966963A (en) | Insecticidal composition containing cyclopropane-carboxylate | |
| US3970703A (en) | Phenylacetic acid derivatives | |
| US3835220A (en) | Insecticidal composition comprising vinylcyclopropanecarboxylates | |
| US4309439A (en) | Substituted-acetic acid ester | |
| US3932459A (en) | Novel cyclopropanecarboxylic acid esters | |
| FR2462419A1 (fr) | Nouveaux cyclopropanecarboxylates de cyclopentenone, leur production et leur utilisation comme insecticides | |
| US4053625A (en) | Insecticides | |
| DE2113124A1 (de) | Vinylcyclopropancarbonsaeureester,Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2432951A1 (de) | (+)-cis-chrysanthemumsaeureester und insektizide und akarizide mittel | |
| EP0037851A2 (en) | Carboxylates, a process for their production, an insecticidal and/or acaricidal composition and the use of the compounds as insecticides and/or acaricides | |
| US3857858A (en) | Cyclopropane carboxylic acid esters | |
| JPS6021153B2 (ja) | シクロプロパンカルボン酸エステル、その製造法およびそのエステルからなる殺虫、殺ダニ剤 | |
| JPS6141903B2 (enExample) |