ES2710487T3 - Derivados de piperazina como moduladores de ror-gamma - Google Patents
Derivados de piperazina como moduladores de ror-gamma Download PDFInfo
- Publication number
- ES2710487T3 ES2710487T3 ES15800398T ES15800398T ES2710487T3 ES 2710487 T3 ES2710487 T3 ES 2710487T3 ES 15800398 T ES15800398 T ES 15800398T ES 15800398 T ES15800398 T ES 15800398T ES 2710487 T3 ES2710487 T3 ES 2710487T3
- Authority
- ES
- Spain
- Prior art keywords
- methyl
- methylpiperazin
- methylphenyl
- chloro
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000004885 piperazines Chemical class 0.000 title description 2
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 416
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 287
- 150000003839 salts Chemical class 0.000 claims abstract description 125
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims abstract description 63
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 60
- 125000001424 substituent group Chemical group 0.000 claims abstract description 49
- 125000005843 halogen group Chemical group 0.000 claims abstract description 46
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims abstract description 44
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 42
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract description 40
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 35
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 34
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 31
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 19
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 13
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims abstract description 12
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims abstract description 12
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims abstract description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000002971 oxazolyl group Chemical group 0.000 claims abstract description 8
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 8
- 239000001301 oxygen Substances 0.000 claims abstract description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 7
- 125000006582 (C5-C6) heterocycloalkyl group Chemical group 0.000 claims abstract description 6
- 125000006006 difluoroethoxy group Chemical group 0.000 claims abstract description 6
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims abstract description 6
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 238000011282 treatment Methods 0.000 claims description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims description 12
- 230000001404 mediated effect Effects 0.000 claims description 10
- 208000023275 Autoimmune disease Diseases 0.000 claims description 9
- 239000003937 drug carrier Substances 0.000 claims description 9
- 125000004076 pyridyl group Chemical group 0.000 claims description 9
- HGEZOHPCAWRILZ-HNNXBMFYSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5-fluoro-6-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)F)C)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C HGEZOHPCAWRILZ-HNNXBMFYSA-N 0.000 claims description 7
- 208000027866 inflammatory disease Diseases 0.000 claims description 7
- 201000006417 multiple sclerosis Diseases 0.000 claims description 6
- 150000003457 sulfones Chemical class 0.000 claims description 5
- 206010002556 Ankylosing Spondylitis Diseases 0.000 claims description 4
- VKCPQGYMMSAKAQ-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5-cyano-6-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)C#N)C)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C VKCPQGYMMSAKAQ-INIZCTEOSA-N 0.000 claims description 4
- 201000004681 Psoriasis Diseases 0.000 claims description 4
- RTDYDXFJLKEJIZ-HNNXBMFYSA-N N-[3-[[(3S)-4-butanoyl-3-methylpiperazin-1-yl]methyl]-5-chloro-2-methylphenyl]-5-fluoro-6-methylpyridine-3-carboxamide Chemical compound C(CCC)(=O)N1[C@H](CN(CC1)CC=1C(=C(C=C(C1)Cl)NC(C1=CN=C(C(=C1)F)C)=O)C)C RTDYDXFJLKEJIZ-HNNXBMFYSA-N 0.000 claims description 3
- UDUDCWQNJWSRNE-AWEZNQCLSA-N N-[5-chloro-3-[[(3S)-4-(2,2-difluorobutanoyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5-fluoro-6-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C=1)NC(C1=CN=C(C(=C1)F)C)=O)C)CN1C[C@@H](N(CC1)C(C(CC)(F)F)=O)C UDUDCWQNJWSRNE-AWEZNQCLSA-N 0.000 claims description 3
- QXPUCNBFKYBNCI-INIZCTEOSA-N N-[5-cyano-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5-fluoro-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)F)C)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C QXPUCNBFKYBNCI-INIZCTEOSA-N 0.000 claims description 3
- 230000002757 inflammatory effect Effects 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- BUGOPWGPQGYYGR-UHFFFAOYSA-N thiane 1,1-dioxide Chemical compound O=S1(=O)CCCCC1 BUGOPWGPQGYYGR-UHFFFAOYSA-N 0.000 claims description 3
- SQZKZGLNOUAVHJ-AWEZNQCLSA-N 5-chloro-N-[3-[[(3S)-4-(2,2-difluorobutanoyl)-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)F)CN2C[C@@H](N(CC2)C(C(CC)(F)F)=O)C)C)C=1)C SQZKZGLNOUAVHJ-AWEZNQCLSA-N 0.000 claims description 2
- ZULKJUFZKBRHSB-HNNXBMFYSA-N 5-chloro-N-[3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)F)CN2C[C@@H](N(CC2)C(CC2CC2)=O)C)C)C1)C ZULKJUFZKBRHSB-HNNXBMFYSA-N 0.000 claims description 2
- PQQSXRKARRBHAQ-HNNXBMFYSA-N 5-chloro-N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)Cl)CN2C[C@@H](N(CC2)C(CC2CC2)=O)C)C)C1)C PQQSXRKARRBHAQ-HNNXBMFYSA-N 0.000 claims description 2
- VIXHYTFENNJPFA-AWEZNQCLSA-N 5-chloro-N-[5-chloro-3-[[(3S)-4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)Cl)CN2C[C@@H](N(CC2)C(=O)C2CC2)C)C)C1)C VIXHYTFENNJPFA-AWEZNQCLSA-N 0.000 claims description 2
- ZYQGFSDMGQAULE-INIZCTEOSA-N 5-chloro-N-[5-cyano-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)C#N)CN2C[C@@H](N(CC2)C(CC2CC2)=O)C)C)C1)C ZYQGFSDMGQAULE-INIZCTEOSA-N 0.000 claims description 2
- ZBSJAIQLGXOESH-HNNXBMFYSA-N 5-chloro-N-[5-fluoro-2-methyl-3-[[(3S)-3-methyl-4-(2-methylpropanoyl)piperazin-1-yl]methyl]phenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)F)CN2C[C@@H](N(CC2)C(C(C)C)=O)C)C)C1)C ZBSJAIQLGXOESH-HNNXBMFYSA-N 0.000 claims description 2
- OJDMEOSJDNLOGJ-HNNXBMFYSA-N N-[3-[[(3S)-4-butanoyl-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]-5-chloro-6-methylpyridine-3-carboxamide Chemical compound C(CCC)(=O)N1[C@H](CN(CC1)CC=1C(=C(C=C(C1)F)NC(C1=CN=C(C(=C1)Cl)C)=O)C)C OJDMEOSJDNLOGJ-HNNXBMFYSA-N 0.000 claims description 2
- DSTQEIOPHFONIA-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-cyano-5-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)C)C#N)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C DSTQEIOPHFONIA-KRWDZBQOSA-N 0.000 claims description 2
- FCRIJMWHPMMORC-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5-cyano-6-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)C#N)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C FCRIJMWHPMMORC-KRWDZBQOSA-N 0.000 claims description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- 238000002560 therapeutic procedure Methods 0.000 claims 1
- -1 monocyclic sulfone Chemical class 0.000 abstract description 304
- 125000006578 monocyclic heterocycloalkyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 373
- 239000000203 mixture Substances 0.000 description 317
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 232
- 239000000243 solution Substances 0.000 description 190
- 235000019439 ethyl acetate Nutrition 0.000 description 184
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 168
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 155
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 133
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 127
- 239000011541 reaction mixture Substances 0.000 description 117
- 239000012044 organic layer Substances 0.000 description 115
- 239000007787 solid Substances 0.000 description 115
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 102
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 97
- 239000002253 acid Substances 0.000 description 94
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 83
- 239000003921 oil Substances 0.000 description 78
- 235000019198 oils Nutrition 0.000 description 78
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 75
- 238000005481 NMR spectroscopy Methods 0.000 description 75
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 72
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 66
- 239000000706 filtrate Substances 0.000 description 64
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 61
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 61
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 54
- 239000003208 petroleum Substances 0.000 description 53
- 238000000034 method Methods 0.000 description 52
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- 238000004440 column chromatography Methods 0.000 description 51
- 239000012267 brine Substances 0.000 description 50
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 50
- 239000002904 solvent Substances 0.000 description 48
- 238000006243 chemical reaction Methods 0.000 description 47
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 46
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 46
- 239000000741 silica gel Substances 0.000 description 45
- 229910002027 silica gel Inorganic materials 0.000 description 45
- 229910052938 sodium sulfate Inorganic materials 0.000 description 42
- 235000011152 sodium sulphate Nutrition 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 39
- 239000007832 Na2SO4 Substances 0.000 description 38
- 239000012043 crude product Substances 0.000 description 37
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 35
- 239000007821 HATU Substances 0.000 description 32
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 32
- 239000011734 sodium Substances 0.000 description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 29
- 125000001153 fluoro group Chemical group F* 0.000 description 28
- 239000000460 chlorine Substances 0.000 description 27
- UXRDAJMOOGEIAQ-CKOZHMEPSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] acetate Chemical compound C1=CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@](OC(=O)C)(C(C)=O)[C@@]1(C)CC2 UXRDAJMOOGEIAQ-CKOZHMEPSA-N 0.000 description 26
- 125000004429 atom Chemical group 0.000 description 25
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 25
- 239000010410 layer Substances 0.000 description 25
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 23
- 239000011737 fluorine Substances 0.000 description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 21
- 210000004027 cell Anatomy 0.000 description 20
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 20
- 238000005160 1H NMR spectroscopy Methods 0.000 description 19
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 239000002585 base Substances 0.000 description 18
- 239000012230 colorless oil Substances 0.000 description 18
- 239000012074 organic phase Substances 0.000 description 18
- 230000002829 reductive effect Effects 0.000 description 18
- 125000004093 cyano group Chemical group *C#N 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- 238000001914 filtration Methods 0.000 description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 15
- SOOHVEZAXYVGEZ-ZDUSSCGKSA-N [(2s)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone Chemical compound C([C@@H](N(CC1)C(=O)C2CCCC2)C)N1CC1=CC(Cl)=CC(N)=C1C SOOHVEZAXYVGEZ-ZDUSSCGKSA-N 0.000 description 15
- 238000003556 assay Methods 0.000 description 15
- 229910052799 carbon Inorganic materials 0.000 description 13
- 201000010099 disease Diseases 0.000 description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 13
- 150000002828 nitro derivatives Chemical class 0.000 description 13
- 101100322888 Escherichia coli (strain K12) metL gene Proteins 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000012298 atmosphere Substances 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 11
- 239000007864 aqueous solution Substances 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000003085 diluting agent Substances 0.000 description 10
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 201000002491 encephalomyelitis Diseases 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 9
- 210000004698 lymphocyte Anatomy 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- 108020004414 DNA Proteins 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- 150000001263 acyl chlorides Chemical class 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 8
- 239000000872 buffer Substances 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 8
- 239000012458 free base Substances 0.000 description 8
- 239000000499 gel Substances 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 8
- 239000003446 ligand Substances 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 8
- 239000012279 sodium borohydride Substances 0.000 description 8
- 229910000033 sodium borohydride Inorganic materials 0.000 description 8
- NNKLICLIBKMDOY-UHFFFAOYSA-N 3-methylidenecyclobutane-1-carboxylic acid Chemical compound OC(=O)C1CC(=C)C1 NNKLICLIBKMDOY-UHFFFAOYSA-N 0.000 description 7
- 108010004469 allophycocyanin Proteins 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 229910052693 Europium Inorganic materials 0.000 description 6
- RZKSECIXORKHQS-UHFFFAOYSA-N Heptan-3-ol Chemical compound CCCCC(O)CC RZKSECIXORKHQS-UHFFFAOYSA-N 0.000 description 6
- 108060001084 Luciferase Proteins 0.000 description 6
- 239000005089 Luciferase Substances 0.000 description 6
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 229910000085 borane Inorganic materials 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 125000000524 functional group Chemical group 0.000 description 6
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 6
- 239000012299 nitrogen atmosphere Substances 0.000 description 6
- 239000013612 plasmid Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 description 6
- 230000002441 reversible effect Effects 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- QMCQBAJOOAMKBX-UHFFFAOYSA-N 1-(hydroxymethyl)cyclopropane-1-carbonitrile Chemical compound OCC1(C#N)CC1 QMCQBAJOOAMKBX-UHFFFAOYSA-N 0.000 description 5
- WLOWIPYSYJEWHB-UHFFFAOYSA-N 2-(3,3-difluorocyclobutyl)acetic acid Chemical compound OC(=O)CC1CC(F)(F)C1 WLOWIPYSYJEWHB-UHFFFAOYSA-N 0.000 description 5
- KVVDRQDTODKIJD-UHFFFAOYSA-N 2-cyclopropylacetic acid Chemical compound OC(=O)CC1CC1 KVVDRQDTODKIJD-UHFFFAOYSA-N 0.000 description 5
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 5
- 108010090804 Streptavidin Proteins 0.000 description 5
- 150000001559 benzoic acids Chemical class 0.000 description 5
- 230000003081 coactivator Effects 0.000 description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 5
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002953 phosphate buffered saline Substances 0.000 description 5
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 108090000765 processed proteins & peptides Proteins 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 239000012453 solvate Substances 0.000 description 5
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 5
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 5
- 229910052721 tungsten Inorganic materials 0.000 description 5
- NQIAQBVYGDADLH-UHFFFAOYSA-N (5-methyloxolan-3-yl)methanol Chemical compound CC1CC(CO)CO1 NQIAQBVYGDADLH-UHFFFAOYSA-N 0.000 description 4
- NLMGIWPPOHBGLL-UHFFFAOYSA-N 1-ethyl-5-oxopyrrolidine-3-carbonyl chloride Chemical compound CCN1CC(C(Cl)=O)CC1=O NLMGIWPPOHBGLL-UHFFFAOYSA-N 0.000 description 4
- BNPUQHZYYWBHSW-UHFFFAOYSA-N 1-ethyl-5-oxopyrrolidine-3-carboxylic acid Chemical compound CCN1CC(C(O)=O)CC1=O BNPUQHZYYWBHSW-UHFFFAOYSA-N 0.000 description 4
- ZVJZAKIRDRMLDW-UHFFFAOYSA-N 1-formylcyclopropane-1-carbonitrile Chemical compound O=CC1(C#N)CC1 ZVJZAKIRDRMLDW-UHFFFAOYSA-N 0.000 description 4
- MUEDKXBKWLEGLB-UHFFFAOYSA-N 2-(4-methyloxolan-3-yl)acetonitrile Chemical compound CC1C(COC1)CC#N MUEDKXBKWLEGLB-UHFFFAOYSA-N 0.000 description 4
- BLZAAHUROYYGMN-UHFFFAOYSA-N 2-(5-methyloxolan-3-yl)acetonitrile Chemical compound CC1CC(CO1)CC#N BLZAAHUROYYGMN-UHFFFAOYSA-N 0.000 description 4
- DWLLOVQLBKONMB-UHFFFAOYSA-N 2-(oxolan-2-yl)propanenitrile Chemical compound N#CC(C)C1CCCO1 DWLLOVQLBKONMB-UHFFFAOYSA-N 0.000 description 4
- CQNGUSHCIYIMRK-UHFFFAOYSA-N 2-(thiolan-3-yl)acetic acid Chemical compound OC(=O)CC1CCSC1 CQNGUSHCIYIMRK-UHFFFAOYSA-N 0.000 description 4
- ZHPKAPJNEIKPGV-UHFFFAOYSA-N 2-methyloxan-4-ol Chemical compound CC1CC(O)CCO1 ZHPKAPJNEIKPGV-UHFFFAOYSA-N 0.000 description 4
- MQOPUXINXNVMKJ-UHFFFAOYSA-N 2-methyloxan-4-one Chemical compound CC1CC(=O)CCO1 MQOPUXINXNVMKJ-UHFFFAOYSA-N 0.000 description 4
- KMOYMQUNADPLGJ-UHFFFAOYSA-N 3-(chloromethyl)-4-methyloxolane Chemical compound CC1COCC1CCl KMOYMQUNADPLGJ-UHFFFAOYSA-N 0.000 description 4
- QICIMADZMWGDTQ-UHFFFAOYSA-N 3-Heptyl acetate Chemical compound CCCCC(CC)OC(C)=O QICIMADZMWGDTQ-UHFFFAOYSA-N 0.000 description 4
- ODUCCTTZGHSNKX-UHFFFAOYSA-N 3-methylsulfonylpropanoic acid Chemical compound CS(=O)(=O)CCC(O)=O ODUCCTTZGHSNKX-UHFFFAOYSA-N 0.000 description 4
- MLSTZXHMLRSZBD-UHFFFAOYSA-N 4-methylsulfonylbutanoic acid Chemical compound CS(=O)(=O)CCCC(O)=O MLSTZXHMLRSZBD-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 101100396718 Homo sapiens IL17A gene Proteins 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- HQDLZISNHUMXEA-UHFFFAOYSA-N Methyl 4-(methylthio)butyrate Chemical compound COC(=O)CCCSC HQDLZISNHUMXEA-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- GRQJEVKIBDYWST-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-cyanopyridine-4-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CC(=NC=C1)C#N)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C GRQJEVKIBDYWST-KRWDZBQOSA-N 0.000 description 4
- CRSSYSPUEKGIND-UHFFFAOYSA-N [N+](=[N-])=CC(=O)C1CC(C1)=O Chemical compound [N+](=[N-])=CC(=O)C1CC(C1)=O CRSSYSPUEKGIND-UHFFFAOYSA-N 0.000 description 4
- CGSRTWUQNOTULJ-UHFFFAOYSA-N [N+](=[N-])=CC(=O)C1CC(N(C1)C)=O Chemical compound [N+](=[N-])=CC(=O)C1CC(N(C1)C)=O CGSRTWUQNOTULJ-UHFFFAOYSA-N 0.000 description 4
- RRBVMPRSXURGPR-UHFFFAOYSA-N [N+](=[N-])=CC(=O)C1CC(N(C1)CC)=O Chemical compound [N+](=[N-])=CC(=O)C1CC(N(C1)CC)=O RRBVMPRSXURGPR-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- ZCAPBIBWGPZTKW-UHFFFAOYSA-N benzyl 3-(difluoromethoxy)propanoate Chemical compound FC(F)OCCC(=O)OCC1=CC=CC=C1 ZCAPBIBWGPZTKW-UHFFFAOYSA-N 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- 230000006287 biotinylation Effects 0.000 description 4
- 238000007413 biotinylation Methods 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- ALTAAUJNHYWOGS-UHFFFAOYSA-N cis-4-Hydroxycyclohexylacetic acid Chemical compound OC1CCC(CC(O)=O)CC1 ALTAAUJNHYWOGS-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 150000004683 dihydrates Chemical class 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- FDZLCIITHLSEQK-UHFFFAOYSA-N ethyl 1-cyanocyclopropane-1-carboxylate Chemical compound CCOC(=O)C1(C#N)CC1 FDZLCIITHLSEQK-UHFFFAOYSA-N 0.000 description 4
- BJHPJWAVNYIWGA-UHFFFAOYSA-N ethyl 3-(1-cyanocyclopropyl)propanoate Chemical compound CCOC(=O)CCC1(CC1)C#N BJHPJWAVNYIWGA-UHFFFAOYSA-N 0.000 description 4
- UUBYKQPQLBLTKH-UHFFFAOYSA-N ethyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate Chemical compound C1C(C(=O)OCC)CC1OS(=O)(=O)C1=CC=C(C)C=C1 UUBYKQPQLBLTKH-UHFFFAOYSA-N 0.000 description 4
- 239000012634 fragment Substances 0.000 description 4
- NGAZZOYFWWSOGK-UHFFFAOYSA-N heptan-3-one Chemical compound CCCCC(=O)CC NGAZZOYFWWSOGK-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 230000003993 interaction Effects 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 108020001756 ligand binding domains Proteins 0.000 description 4
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 4
- YZHDDDSHRIMVEG-UHFFFAOYSA-N methyl 4-cyano-4-methylpentanoate Chemical compound COC(=O)CCC(C)(C)C#N YZHDDDSHRIMVEG-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 238000002953 preparative HPLC Methods 0.000 description 4
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 125000003003 spiro group Chemical group 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- IHPWWVPOLYUYMG-UHFFFAOYSA-N (5-chloro-2-methyl-3-nitrophenyl)methanol Chemical compound CC1=C(CO)C=C(Cl)C=C1[N+]([O-])=O IHPWWVPOLYUYMG-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 3
- ARDJZBUWZOQXCO-UHFFFAOYSA-N 2-(2-oxocyclohexyl)ethyl acetate Chemical compound CC(=O)OCCC1CCCCC1=O ARDJZBUWZOQXCO-UHFFFAOYSA-N 0.000 description 3
- ASGCFEYFDZRGCS-UHFFFAOYSA-N 2-(5-methyloxolan-3-yl)acetic acid Chemical compound CC1CC(CO1)CC(=O)O ASGCFEYFDZRGCS-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- IKNQWMBVSFOLRL-UHFFFAOYSA-N 4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound NC=1C(=C(CN2CC(N(CC2)C(=O)O)C)C=C(C=1)Cl)C IKNQWMBVSFOLRL-UHFFFAOYSA-N 0.000 description 3
- FEZBYWZJSLPSAO-JTQLQIEISA-N 4-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]-5-nitrobenzonitrile Chemical compound CC1=C(C=C(C#N)C=C1[N+](=O)[O-])CN1C[C@@H](NCC1)C FEZBYWZJSLPSAO-JTQLQIEISA-N 0.000 description 3
- DXUUJILVHXQDCV-UHFFFAOYSA-N 5-bromo-2-methyl-3-nitrobenzoic acid Chemical compound CC1=C(C(O)=O)C=C(Br)C=C1[N+]([O-])=O DXUUJILVHXQDCV-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 3
- 102000004127 Cytokines Human genes 0.000 description 3
- 108090000695 Cytokines Proteins 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 238000002965 ELISA Methods 0.000 description 3
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 3
- 102000013691 Interleukin-17 Human genes 0.000 description 3
- 108050003558 Interleukin-17 Proteins 0.000 description 3
- QPXPWCFEYAVNKD-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-cyanopyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C#N)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C QPXPWCFEYAVNKD-INIZCTEOSA-N 0.000 description 3
- UBJPZBDUCADZEU-HNNXBMFYSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-hydroxy-2-methylpropanamide Chemical compound ClC=1C=C(C(=C(C1)NC(C(C)(C)O)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C UBJPZBDUCADZEU-HNNXBMFYSA-N 0.000 description 3
- GHVCHPYLJFTJFF-SFHVURJKSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyano-4-methylpentanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCC(C)(C)C#N)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C GHVCHPYLJFTJFF-SFHVURJKSA-N 0.000 description 3
- NGKHAJANRHPUJR-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyanobutanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCCC#N)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C NGKHAJANRHPUJR-KRWDZBQOSA-N 0.000 description 3
- NYPBIYBEGBLZBW-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-methoxybutanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCCOC)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C NYPBIYBEGBLZBW-KRWDZBQOSA-N 0.000 description 3
- DTZVGKPLTWOKMO-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-cyanopyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C#N)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C DTZVGKPLTWOKMO-KRWDZBQOSA-N 0.000 description 3
- CYIRIAAIMGBCKV-INIZCTEOSA-N N-[5-cyano-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-methylpyrimidine-5-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(=O)C=1C=NC(=NC1)C)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C CYIRIAAIMGBCKV-INIZCTEOSA-N 0.000 description 3
- CGYJZOKRFCPROA-KRWDZBQOSA-N N-[5-cyano-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methoxypyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)OC)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C CGYJZOKRFCPROA-KRWDZBQOSA-N 0.000 description 3
- CQXDTAGTWNQNDA-IBGZPJMESA-N N-[5-cyano-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C CQXDTAGTWNQNDA-IBGZPJMESA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 3
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 3
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 206010033799 Paralysis Diseases 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 102000001708 Protein Isoforms Human genes 0.000 description 3
- 108010029485 Protein Isoforms Proteins 0.000 description 3
- 101100485158 Salmonella typhimurium (strain LT2 / SGSC1412 / ATCC 700720) wzzE gene Proteins 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 229940022663 acetate Drugs 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000001363 autoimmune Effects 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 229960002685 biotin Drugs 0.000 description 3
- 235000020958 biotin Nutrition 0.000 description 3
- 239000011616 biotin Substances 0.000 description 3
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- CXUKMALSQXRODE-UHFFFAOYSA-N cyclobutene-1-carboxylic acid Chemical compound OC(=O)C1=CCC1 CXUKMALSQXRODE-UHFFFAOYSA-N 0.000 description 3
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 210000003141 lower extremity Anatomy 0.000 description 3
- 238000003670 luciferase enzyme activity assay Methods 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 101150089110 metN gene Proteins 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 3
- 235000005152 nicotinamide Nutrition 0.000 description 3
- 239000011570 nicotinamide Substances 0.000 description 3
- 229960003966 nicotinamide Drugs 0.000 description 3
- 108020004017 nuclear receptors Proteins 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 230000008506 pathogenesis Effects 0.000 description 3
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 3
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 3
- 238000002390 rotary evaporation Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- CVBIZOAMGIAMEP-UHFFFAOYSA-N spiro[2.3]hexane-5-carboxylic acid Chemical compound C1C(C(=O)O)CC11CC1 CVBIZOAMGIAMEP-UHFFFAOYSA-N 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- NMHGIRMTPWDQOC-UHFFFAOYSA-N tert-butyl 3-(2-ethoxy-2-oxoethyl)-2-oxopyrrolidine-1-carboxylate Chemical compound CCOC(=O)CC1CCN(C(=O)OC(C)(C)C)C1=O NMHGIRMTPWDQOC-UHFFFAOYSA-N 0.000 description 3
- VMKIXWAFFVLJCK-UHFFFAOYSA-N tert-butyl 3-oxoazetidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(=O)C1 VMKIXWAFFVLJCK-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- KQDSOLMWMXZWJW-DFBJGRDBSA-N (2S)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-1-(2-methylpropanoyl)pyrrolidine-2-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(=O)[C@H]1N(CCC1)C(C(C)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C KQDSOLMWMXZWJW-DFBJGRDBSA-N 0.000 description 2
- DHEFLJRXYCQVMS-UUOWRZLLSA-N (2S)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-1-propanoylpyrrolidine-2-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(=O)[C@H]1N(CCC1)C(CC)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C DHEFLJRXYCQVMS-UUOWRZLLSA-N 0.000 description 2
- MDZKTVVUZBIKGI-UHFFFAOYSA-N (3,3-difluorocyclobutyl)methanol Chemical compound OCC1CC(F)(F)C1 MDZKTVVUZBIKGI-UHFFFAOYSA-N 0.000 description 2
- KIFWPSWOZXXLMM-VIFPVBQESA-N (3S)-1-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-3-methylpiperazine Chemical compound ClC=1C=C(C(=C(CN2C[C@@H](NCC2)C)C1)C)[N+](=O)[O-] KIFWPSWOZXXLMM-VIFPVBQESA-N 0.000 description 2
- BAMYGGQXKJSJMT-CQSZACIVSA-N (3r)-1-benzyl-3-propylpiperazine Chemical compound C1CN[C@H](CCC)CN1CC1=CC=CC=C1 BAMYGGQXKJSJMT-CQSZACIVSA-N 0.000 description 2
- OVEMFXRHESVQEF-UHFFFAOYSA-N (5-fluoro-2-methyl-3-nitrophenyl)methanol Chemical compound CC1=C(CO)C=C(F)C=C1[N+]([O-])=O OVEMFXRHESVQEF-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 2
- WWXQMMYUIBSVDN-LBPRGKRZSA-N 1-[(2S)-4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]butan-1-one Chemical compound ClC=1C=C(C(=C(CN2C[C@@H](N(CC2)C(CCC)=O)C)C1)C)[N+](=O)[O-] WWXQMMYUIBSVDN-LBPRGKRZSA-N 0.000 description 2
- VYDQUABHDFWIIX-UHFFFAOYSA-N 2,2-difluoro-2-fluorosulfonylacetic acid Chemical compound OC(=O)C(F)(F)S(F)(=O)=O VYDQUABHDFWIIX-UHFFFAOYSA-N 0.000 description 2
- ZNKGPJTYNUEAKE-UHFFFAOYSA-N 2-(1,1-dioxothian-4-yl)acetic acid Chemical compound OC(=O)CC1CCS(=O)(=O)CC1 ZNKGPJTYNUEAKE-UHFFFAOYSA-N 0.000 description 2
- YJKULDDALYVTTQ-UHFFFAOYSA-N 2-(1-ethyl-5-oxopyrrolidin-3-yl)acetic acid Chemical compound CCN1CC(CC(O)=O)CC1=O YJKULDDALYVTTQ-UHFFFAOYSA-N 0.000 description 2
- GIFZQJHZLDAKOK-UHFFFAOYSA-N 2-(1-methyl-5-oxopyrrolidin-3-yl)acetic acid Chemical compound CN1CC(CC(O)=O)CC1=O GIFZQJHZLDAKOK-UHFFFAOYSA-N 0.000 description 2
- CWDNEZJMSMLJIJ-UHFFFAOYSA-N 2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)acetic acid Chemical compound O1CCC2C(CC(=O)O)COC21 CWDNEZJMSMLJIJ-UHFFFAOYSA-N 0.000 description 2
- FEEZUVLPIFGXOT-UHFFFAOYSA-N 2-(2-methyloxan-4-yl)acetic acid Chemical compound CC1CC(CC(O)=O)CCO1 FEEZUVLPIFGXOT-UHFFFAOYSA-N 0.000 description 2
- OLLLIBGOZUPLOK-UHFFFAOYSA-N 2-(2-oxocyclopentyl)acetic acid Chemical compound OC(=O)CC1CCCC1=O OLLLIBGOZUPLOK-UHFFFAOYSA-N 0.000 description 2
- GCUBKZXHAKEOKP-UHFFFAOYSA-N 2-(3,3-difluorocyclobutyl)acetonitrile Chemical compound FC1(F)CC(CC#N)C1 GCUBKZXHAKEOKP-UHFFFAOYSA-N 0.000 description 2
- KEPYKFNXJFNSDL-UHFFFAOYSA-N 2-(3-hydroxycyclohexyl)acetic acid Chemical compound OC1CCCC(CC(O)=O)C1 KEPYKFNXJFNSDL-UHFFFAOYSA-N 0.000 description 2
- KFBADNJELGIOTE-UHFFFAOYSA-N 2-(3-oxocyclobutyl)acetic acid Chemical compound OC(=O)CC1CC(=O)C1 KFBADNJELGIOTE-UHFFFAOYSA-N 0.000 description 2
- PMVQOELIHBEEAD-UHFFFAOYSA-N 2-(4-methyloxolan-3-yl)acetic acid Chemical compound CC1C(COC1)CC(=O)O PMVQOELIHBEEAD-UHFFFAOYSA-N 0.000 description 2
- DFUYDBNOCSKWJZ-UHFFFAOYSA-N 2-(difluoromethoxy)acetic acid Chemical compound OC(=O)COC(F)F DFUYDBNOCSKWJZ-UHFFFAOYSA-N 0.000 description 2
- PAUJCMUQMZXIJQ-UHFFFAOYSA-N 2-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)C(C)C1CCCO1 PAUJCMUQMZXIJQ-UHFFFAOYSA-N 0.000 description 2
- JSWKBJIKVSXWDJ-UHFFFAOYSA-N 2-(oxolan-3-yl)acetic acid Chemical compound OC(=O)CC1CCOC1 JSWKBJIKVSXWDJ-UHFFFAOYSA-N 0.000 description 2
- MILXYGVGBFRIEW-UHFFFAOYSA-N 2-(oxolan-3-yl)propanoic acid Chemical compound OC(=O)C(C)C1CCOC1 MILXYGVGBFRIEW-UHFFFAOYSA-N 0.000 description 2
- AQLJZLIQLBJTBE-UHFFFAOYSA-N 2-(thian-3-yl)acetic acid Chemical compound OC(=O)CC1CCCSC1 AQLJZLIQLBJTBE-UHFFFAOYSA-N 0.000 description 2
- QNNZZKGJSIDKRB-UHFFFAOYSA-N 2-acetylsulfanylcyclobutane-1-carboxylic acid Chemical compound C(C)(=O)SC1C(CC1)C(=O)O QNNZZKGJSIDKRB-UHFFFAOYSA-N 0.000 description 2
- KUHAYJJXXGBYBW-UHFFFAOYSA-N 2-amino-3-fluorobenzoic acid Chemical compound NC1=C(F)C=CC=C1C(O)=O KUHAYJJXXGBYBW-UHFFFAOYSA-N 0.000 description 2
- UEHLZRCCIWVHBH-UHFFFAOYSA-N 2-cyclopropyl-2-methylcyclopropane-1-carboxylic acid Chemical compound C1CC1C1(C)CC1C(O)=O UEHLZRCCIWVHBH-UHFFFAOYSA-N 0.000 description 2
- IRRAJLZEAOBJIV-UHFFFAOYSA-N 2-methoxycarbonylcyclopropane-1-carboxylic acid Chemical compound COC(=O)C1CC1C(O)=O IRRAJLZEAOBJIV-UHFFFAOYSA-N 0.000 description 2
- MMIWDPMBWOTICQ-UHFFFAOYSA-M 2-methylpiperazine-1-carboxylate Chemical compound CC1CNCCN1C([O-])=O MMIWDPMBWOTICQ-UHFFFAOYSA-M 0.000 description 2
- JSTPSYXDTATHNX-UHFFFAOYSA-N 3-(1-cyanocyclopropyl)propanoic acid Chemical compound C(#N)C1(CC1)CCC(=O)O JSTPSYXDTATHNX-UHFFFAOYSA-N 0.000 description 2
- XDNDSAQVXNZKGP-UHFFFAOYSA-N 3-(1h-pyrrol-2-yl)propanoic acid Chemical compound OC(=O)CCC1=CC=CN1 XDNDSAQVXNZKGP-UHFFFAOYSA-N 0.000 description 2
- CZNFEVPGYZAYLH-UHFFFAOYSA-N 3-(difluoromethoxy)propanoic acid Chemical compound OC(=O)CCOC(F)F CZNFEVPGYZAYLH-UHFFFAOYSA-N 0.000 description 2
- XSESIOQBUSCVEA-AWEZNQCLSA-N 3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile Chemical compound C1(CCCC1)C(=O)N1[C@H](CN(CC1)CC=1C=C(C#N)C=C(C1C)[N+](=O)[O-])C XSESIOQBUSCVEA-AWEZNQCLSA-N 0.000 description 2
- WWXFHHXOVMQARV-UHFFFAOYSA-N 3-hydroxy-2,2-dimethylpropanenitrile Chemical compound OCC(C)(C)C#N WWXFHHXOVMQARV-UHFFFAOYSA-N 0.000 description 2
- SSEJSSNDPMMWBQ-UHFFFAOYSA-N 3-methylpiperazine-1-carboxylic acid Chemical compound CC1CN(C(O)=O)CCN1 SSEJSSNDPMMWBQ-UHFFFAOYSA-N 0.000 description 2
- JGSIAOZAXBWRFO-UHFFFAOYSA-N 3-methylsulfanyl-1-phenyl-4,5-dihydrobenzo[g]indazole Chemical compound C1CC2=CC=CC=C2C2=C1C(SC)=NN2C1=CC=CC=C1 JGSIAOZAXBWRFO-UHFFFAOYSA-N 0.000 description 2
- OYGDHKULJCLKJS-UHFFFAOYSA-N 4-(5-bromo-2-methyl-3-nitrobenzoyl)-2-methylpiperazine-1-carboxylic acid Chemical compound BrC=1C=C(C(=C(C(=O)N2CC(N(CC2)C(=O)O)C)C1)C)[N+](=O)[O-] OYGDHKULJCLKJS-UHFFFAOYSA-N 0.000 description 2
- CIEGRVNWTABSBJ-UHFFFAOYSA-N 4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound ClC=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C=1)C)[N+](=O)[O-] CIEGRVNWTABSBJ-UHFFFAOYSA-N 0.000 description 2
- WYZSURZJAGQZFY-HNNXBMFYSA-N 4-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylanilino]-4-oxobutanoic acid Chemical compound ClC=1C=C(C(=C(C1)NC(CCC(=O)O)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C WYZSURZJAGQZFY-HNNXBMFYSA-N 0.000 description 2
- MNMLGZMORMDPJI-UHFFFAOYSA-N 4-bromo-2-(difluoromethyl)pyridine Chemical compound FC(F)C1=CC(Br)=CC=N1 MNMLGZMORMDPJI-UHFFFAOYSA-N 0.000 description 2
- WNXQJKRHMHUFDQ-UHFFFAOYSA-N 4-cyano-4-methylpentanoic acid Chemical compound N#CC(C)(C)CCC(O)=O WNXQJKRHMHUFDQ-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- RMQJECWPWQIIPW-UHFFFAOYSA-N 4-hydroxycrotonic acid Chemical compound OCC=CC(O)=O RMQJECWPWQIIPW-UHFFFAOYSA-N 0.000 description 2
- VRRCYIFZBSJBAT-UHFFFAOYSA-N 4-methoxybutanoic acid Chemical compound COCCCC(O)=O VRRCYIFZBSJBAT-UHFFFAOYSA-N 0.000 description 2
- 229940124125 5 Lipoxygenase inhibitor Drugs 0.000 description 2
- CNIMBOUIGPLLKL-KRWDZBQOSA-N 5-N-[3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]-2-N-methylpyridine-2,5-dicarboxamide Chemical compound C1(CCCC1)C(=O)N1[C@H](CN(CC1)CC=1C(=C(C=C(C=1)F)NC(=O)C=1C=CC(=NC=1)C(=O)NC)C)C CNIMBOUIGPLLKL-KRWDZBQOSA-N 0.000 description 2
- ZUIRCFMXBOARHP-HNNXBMFYSA-N 5-N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]pyridine-2,5-dicarboxamide Chemical compound ClC=1C=C(C(=C(C=1)NC(=O)C=1C=CC(=NC=1)C(=O)N)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C ZUIRCFMXBOARHP-HNNXBMFYSA-N 0.000 description 2
- QZQHEPUZEQZTTJ-INIZCTEOSA-N 5-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]pyridine-2,5-dicarboxamide Chemical compound ClC=1C=C(C(=C(C=1)NC(=O)C=1C=CC(=NC=1)C(=O)N)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C QZQHEPUZEQZTTJ-INIZCTEOSA-N 0.000 description 2
- YPCLLVYLWXIIBW-UHFFFAOYSA-N 5-bromo-3-methylpyridine-2-carbonitrile Chemical compound CC1=CC(Br)=CN=C1C#N YPCLLVYLWXIIBW-UHFFFAOYSA-N 0.000 description 2
- UORDMUKGFFTCOC-UHFFFAOYSA-N 5-chloro-1-(chloromethyl)-2-methyl-3-nitrobenzene Chemical compound ClC=1C=C(CCl)C(=C(C1)[N+](=O)[O-])C UORDMUKGFFTCOC-UHFFFAOYSA-N 0.000 description 2
- KSLZRIXXMKXDEO-UHFFFAOYSA-N 5-chloro-2-methyl-3-nitrobenzoic acid Chemical compound CC1=C(C(O)=O)C=C(Cl)C=C1[N+]([O-])=O KSLZRIXXMKXDEO-UHFFFAOYSA-N 0.000 description 2
- CMZCBPLTJBYJHZ-UHFFFAOYSA-N 5-fluoro-2-methyl-3-nitrobenzoic acid Chemical compound CC1=C(C(O)=O)C=C(F)C=C1[N+]([O-])=O CMZCBPLTJBYJHZ-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 208000032116 Autoimmune Experimental Encephalomyelitis Diseases 0.000 description 2
- 241000219495 Betulaceae Species 0.000 description 2
- YDULBSLKFDGNEI-UHFFFAOYSA-N CC(CN(CC1=C(C)C(NC(C2=CC(C#N)=CC=C2)=O)=CC(C#N)=C1)CC1)N1C(O)=O Chemical compound CC(CN(CC1=C(C)C(NC(C2=CC(C#N)=CC=C2)=O)=CC(C#N)=C1)CC1)N1C(O)=O YDULBSLKFDGNEI-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000001712 DNA sequencing Methods 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 2
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 2
- 108700028146 Genetic Enhancer Elements Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000004233 Indanthrene blue RS Substances 0.000 description 2
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 2
- 102000004218 Insulin-Like Growth Factor I Human genes 0.000 description 2
- 102000042838 JAK family Human genes 0.000 description 2
- 108091082332 JAK family Proteins 0.000 description 2
- 229910010084 LiAlH4 Inorganic materials 0.000 description 2
- 239000000867 Lipoxygenase Inhibitor Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N Methyl nicotinate Natural products COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- QYPPHZANBONZPG-PJNRRBRMSA-N N-[3-[[(3S)-4-(bicyclo[3.1.0]hexane-3-carbonyl)-3-methylpiperazin-1-yl]methyl]-5-cyano-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound C12CC(CC2C1)C(=O)N1[C@H](CN(CC1)CC=1C(=C(C=C(C1)C#N)NC(C1=CN=C(C=C1)C)=O)C)C QYPPHZANBONZPG-PJNRRBRMSA-N 0.000 description 2
- GODFAIGETUQPFG-HNNXBMFYSA-N N-[3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]azetidine-3-carboxamide Chemical compound N1CC(C1)C(=O)NC1=C(C(=CC(=C1)F)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C GODFAIGETUQPFG-HNNXBMFYSA-N 0.000 description 2
- JHLBCRRBLWDJLP-LBPRGKRZSA-N N-[5-chloro-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-5-fluoro-6-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)F)C)=O)C)CN1C[C@@H](NCC1)C JHLBCRRBLWDJLP-LBPRGKRZSA-N 0.000 description 2
- VHHJVQPSXHWBQN-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-cyanopyridine-4-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CC(=NC=C1)C#N)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C VHHJVQPSXHWBQN-INIZCTEOSA-N 0.000 description 2
- PMYHANVSSQXTOS-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-methoxybutanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCCOC)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C PMYHANVSSQXTOS-INIZCTEOSA-N 0.000 description 2
- OKEDCGHPAHMHOJ-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-3-hydroxy-3-methylbutanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CC(C)(C)O)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C OKEDCGHPAHMHOJ-INIZCTEOSA-N 0.000 description 2
- HWRJLUDFSRAVFV-HNNXBMFYSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4,4,4-trifluorobutanamide Chemical compound ClC=1C=C(C(=C(C=1)NC(CCC(F)(F)F)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C HWRJLUDFSRAVFV-HNNXBMFYSA-N 0.000 description 2
- COMOCCLYEVOSTB-IBGZPJMESA-N N-[5-cyano-2-methyl-3-[[(3S)-3-methyl-4-(spiro[2.3]hexane-5-carbonyl)piperazin-1-yl]methyl]phenyl]-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CC2(CC2)C1)C COMOCCLYEVOSTB-IBGZPJMESA-N 0.000 description 2
- SPQKRLVAUFANCX-SFHVURJKSA-N N-[5-cyano-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C SPQKRLVAUFANCX-SFHVURJKSA-N 0.000 description 2
- VCUSZEKMJZUZKA-IBGZPJMESA-N N-[5-cyano-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-methylpyridine-4-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CC(=NC=C1)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C VCUSZEKMJZUZKA-IBGZPJMESA-N 0.000 description 2
- XXTWTFUAGRPJTM-KRWDZBQOSA-N N-[5-cyano-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-methylpyrimidine-5-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(=O)C=1C=NC(=NC1)C)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C XXTWTFUAGRPJTM-KRWDZBQOSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 206010033892 Paraplegia Diseases 0.000 description 2
- 108010081690 Pertussis Toxin Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Chemical compound OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 2
- 229910006124 SOCl2 Inorganic materials 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- YNFYCBDMMKUYKX-UHFFFAOYSA-N THTA Chemical compound OC(=O)CC1CCCS1 YNFYCBDMMKUYKX-UHFFFAOYSA-N 0.000 description 2
- 210000000068 Th17 cell Anatomy 0.000 description 2
- 108091023040 Transcription factor Proteins 0.000 description 2
- 102000040945 Transcription factor Human genes 0.000 description 2
- LPZSBFXHHFVGPX-LJQANCHMSA-N [(2R)-4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-propylpiperazin-1-yl]-cyclopentylmethanone Chemical compound ClC=1C=C(C(=C(CN2C[C@H](N(CC2)C(=O)C2CCCC2)CCC)C1)C)[N+](=O)[O-] LPZSBFXHHFVGPX-LJQANCHMSA-N 0.000 description 2
- ALNBJIYUOZCNPZ-LJQANCHMSA-N [(2R)-4-benzyl-2-propylpiperazin-1-yl]-cyclopentylmethanone Chemical compound C(C1=CC=CC=C1)N1C[C@H](N(CC1)C(=O)C1CCCC1)CCC ALNBJIYUOZCNPZ-LJQANCHMSA-N 0.000 description 2
- FKLUCSKSUYDDHM-AWEZNQCLSA-N [(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclohexylmethanone Chemical compound NC=1C(=C(CN2C[C@@H](N(CC2)C(=O)C2CCCCC2)C)C=C(C1)Cl)C FKLUCSKSUYDDHM-AWEZNQCLSA-N 0.000 description 2
- HRKKWEQYTCVNJO-ZDUSSCGKSA-N [(2s)-4-[(3-amino-5-fluoro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone Chemical compound C([C@@H](N(CC1)C(=O)C2CCCC2)C)N1CC1=CC(F)=CC(N)=C1C HRKKWEQYTCVNJO-ZDUSSCGKSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 125000004567 azetidin-3-yl group Chemical group N1CC(C1)* 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- IEEUSWYDXDXBNK-UHFFFAOYSA-N bicyclo[3.1.0]hexane-3-carboxylic acid Chemical compound C1C(C(=O)O)CC2CC21 IEEUSWYDXDXBNK-UHFFFAOYSA-N 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 239000004109 brown FK Substances 0.000 description 2
- 235000012713 brown FK Nutrition 0.000 description 2
- 239000001678 brown HT Substances 0.000 description 2
- 235000012670 brown HT Nutrition 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 238000004296 chiral HPLC Methods 0.000 description 2
- 239000001752 chlorophylls and chlorophyllins Substances 0.000 description 2
- 235000012698 chlorophylls and chlorophyllins Nutrition 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 229940111134 coxibs Drugs 0.000 description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-M crotonate Chemical compound C\C=C\C([O-])=O LDHQCZJRKDOVOX-NSCUHMNNSA-M 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- MFNYBOWJWGPXFM-UHFFFAOYSA-N cyclobutanecarboxamide Chemical class NC(=O)C1CCC1 MFNYBOWJWGPXFM-UHFFFAOYSA-N 0.000 description 2
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 2
- VELDYOPRLMJFIK-UHFFFAOYSA-N cyclopentanecarbaldehyde Chemical compound O=CC1CCCC1 VELDYOPRLMJFIK-UHFFFAOYSA-N 0.000 description 2
- SGNKSUCZCOLWLN-GFCCVEGCSA-N cyclopentyl-[(2R)-2-propylpiperazin-1-yl]methanone Chemical compound C1(CCCC1)C(=O)N1[C@@H](CNCC1)CCC SGNKSUCZCOLWLN-GFCCVEGCSA-N 0.000 description 2
- OHLUXTBCZHRNAG-LBPRGKRZSA-N cyclopentyl-[(2S)-4-[(2,5-dichloro-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]methanone Chemical compound C1(CCCC1)C(=O)N1[C@H](CN(CC1)CC1=C(C(=CC(=C1)Cl)[N+](=O)[O-])Cl)C OHLUXTBCZHRNAG-LBPRGKRZSA-N 0.000 description 2
- VMLNPGXNZHBOPX-VIFPVBQESA-N cyclopentyl-[(2s)-2-methylpiperazin-1-yl]methanone Chemical compound C[C@H]1CNCCN1C(=O)C1CCCC1 VMLNPGXNZHBOPX-VIFPVBQESA-N 0.000 description 2
- IGEFCHXRRMUFDE-ZDUSSCGKSA-N cyclopentyl-[(2s)-4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]methanone Chemical compound C([C@@H](N(CC1)C(=O)C2CCCC2)C)N1CC1=CC(F)=CC([N+]([O-])=O)=C1C IGEFCHXRRMUFDE-ZDUSSCGKSA-N 0.000 description 2
- AIMMVWOEOZMVMS-UHFFFAOYSA-N cyclopropanecarboxamide Chemical compound NC(=O)C1CC1 AIMMVWOEOZMVMS-UHFFFAOYSA-N 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- JBVOSZYUSFDYIN-UHFFFAOYSA-N dimethyl cyclopropane-1,2-dicarboxylate Chemical compound COC(=O)C1CC1C(=O)OC JBVOSZYUSFDYIN-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- VDAPYXHAXWXNDK-UHFFFAOYSA-N ethyl 2-chloro-5-cyano-6-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CC(C#N)=C(C)N=C1Cl VDAPYXHAXWXNDK-UHFFFAOYSA-N 0.000 description 2
- IOFDGVXYARBFOQ-UHFFFAOYSA-N ethyl 5-cyano-6-methyl-2-oxo-1h-pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CC(C#N)=C(C)NC1=O IOFDGVXYARBFOQ-UHFFFAOYSA-N 0.000 description 2
- QUAMCESTXLYSGN-UHFFFAOYSA-N ethyl 5-cyano-6-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=C(C)C(C#N)=C1 QUAMCESTXLYSGN-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 208000012997 experimental autoimmune encephalomyelitis Diseases 0.000 description 2
- 125000003838 furazanyl group Chemical group 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- BRZYSWJRSDMWLG-CAXSIQPQSA-N geneticin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(C)O)O2)N)[C@@H](N)C[C@H]1N BRZYSWJRSDMWLG-CAXSIQPQSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 235000019239 indanthrene blue RS Nutrition 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000010212 intracellular staining Methods 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 238000004811 liquid chromatography Methods 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- WADLLLSMEPLCNO-UHFFFAOYSA-N methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate Chemical compound COC(=O)C1=CC(F)=C(Cl)N=C1Cl WADLLLSMEPLCNO-UHFFFAOYSA-N 0.000 description 2
- AARWZYFWYNJHOQ-UHFFFAOYSA-N methyl 2-chloro-5-fluoro-6-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CC(F)=C(C)N=C1Cl AARWZYFWYNJHOQ-UHFFFAOYSA-N 0.000 description 2
- ABELEDYNIKPYTP-UHFFFAOYSA-N methyl 3-amino-4-fluorobenzoate Chemical compound COC(=O)C1=CC=C(F)C(N)=C1 ABELEDYNIKPYTP-UHFFFAOYSA-N 0.000 description 2
- HWZINXYBRIQTEJ-UHFFFAOYSA-N methyl 5,6-dichloropyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)C(Cl)=C1 HWZINXYBRIQTEJ-UHFFFAOYSA-N 0.000 description 2
- SFHNAZRNPCBTEJ-UHFFFAOYSA-N methyl 5-chloro-6-methylpyridine-3-carboxylate Chemical compound ClC=1C(=NC=C(C(=O)OC)C1)C SFHNAZRNPCBTEJ-UHFFFAOYSA-N 0.000 description 2
- ZFIHBTMALUQXAL-UHFFFAOYSA-N methyl 5-fluoro-6-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(C)C(F)=C1 ZFIHBTMALUQXAL-UHFFFAOYSA-N 0.000 description 2
- ASEMVDGUOASAMH-UHFFFAOYSA-N methyl 6-cyano-5-methylpyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(C#N)C(C)=C1 ASEMVDGUOASAMH-UHFFFAOYSA-N 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 2
- 229960001238 methylnicotinate Drugs 0.000 description 2
- 230000003278 mimic effect Effects 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000004177 patent blue V Substances 0.000 description 2
- 235000012736 patent blue V Nutrition 0.000 description 2
- 230000007170 pathology Effects 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920002704 polyhistidine Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000004929 pyrrolidonyl group Chemical group N1(C(CCC1)=O)* 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 239000004172 quinoline yellow Substances 0.000 description 2
- 235000012752 quinoline yellow Nutrition 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000004180 red 2G Substances 0.000 description 2
- 235000012739 red 2G Nutrition 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 229910052702 rhenium Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- FLCVZHVWCUDPTD-ZDUSSCGKSA-N tert-butyl (2S)-4-[(3-amino-5-cyano-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylate Chemical compound NC=1C(=C(CN2C[C@@H](N(CC2)C(=O)OC(C)(C)C)C)C=C(C1)C#N)C FLCVZHVWCUDPTD-ZDUSSCGKSA-N 0.000 description 2
- UZGYQUPHIKXKNW-ZDUSSCGKSA-N tert-butyl (2S)-4-[(5-cyano-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazine-1-carboxylate Chemical compound C(#N)C=1C=C(C(=C(CN2C[C@@H](N(CC2)C(=O)OC(C)(C)C)C)C1)C)[N+](=O)[O-] UZGYQUPHIKXKNW-ZDUSSCGKSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 125000004306 triazinyl group Chemical group 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000013598 vector Substances 0.000 description 2
- UVGHPGOONBRLCX-NJSLBKSFSA-N (2,5-dioxopyrrolidin-1-yl) 6-[5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoate Chemical compound C([C@H]1[C@H]2NC(=O)N[C@H]2CS1)CCCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O UVGHPGOONBRLCX-NJSLBKSFSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- YLKFINACTQICFV-HRAATJIYSA-N (2R)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]pyrrolidine-2-carboxamide Chemical compound N1[C@H](CCC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C YLKFINACTQICFV-HRAATJIYSA-N 0.000 description 1
- YLKFINACTQICFV-KKSFZXQISA-N (2S)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]pyrrolidine-2-carboxamide Chemical compound N1[C@@H](CCC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C YLKFINACTQICFV-KKSFZXQISA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VUAFHZCUKUDDBC-SCSAIBSYSA-N (2s)-2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid Chemical compound CC(C)(S)C(=O)N[C@H](CS)C(O)=O VUAFHZCUKUDDBC-SCSAIBSYSA-N 0.000 description 1
- JOMNTHCQHJPVAZ-YFKPBYRVSA-N (2s)-2-methylpiperazine Chemical compound C[C@H]1CNCCN1 JOMNTHCQHJPVAZ-YFKPBYRVSA-N 0.000 description 1
- LJRDOKAZOAKLDU-UDXJMMFXSA-N (2s,3s,4r,5r,6r)-5-amino-2-(aminomethyl)-6-[(2r,3s,4r,5s)-5-[(1r,2r,3s,5r,6s)-3,5-diamino-2-[(2s,3r,4r,5s,6r)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxycyclohexyl]oxy-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyoxane-3,4-diol;sulfuric ac Chemical compound OS(O)(=O)=O.N[C@@H]1[C@@H](O)[C@H](O)[C@H](CN)O[C@@H]1O[C@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](N)C[C@@H](N)[C@@H]2O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)O[C@@H]1CO LJRDOKAZOAKLDU-UDXJMMFXSA-N 0.000 description 1
- MJZBTWYPBBTXJK-FXAWDEMLSA-N (3R)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]piperidine-3-carboxamide Chemical compound N1C[C@@H](CCC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C MJZBTWYPBBTXJK-FXAWDEMLSA-N 0.000 description 1
- XGDDSMQIDXIQFW-QFBILLFUSA-N (3R)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]pyrrolidine-3-carboxamide Chemical compound N1C[C@@H](CC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C XGDDSMQIDXIQFW-QFBILLFUSA-N 0.000 description 1
- MJZBTWYPBBTXJK-PXNSSMCTSA-N (3S)-N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]piperidine-3-carboxamide Chemical compound N1C[C@H](CCC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C MJZBTWYPBBTXJK-PXNSSMCTSA-N 0.000 description 1
- NRVVVSMDLOPXJD-GFCCVEGCSA-N (3r)-1-benzyl-3-propylpiperazine-2,5-dione Chemical compound O=C1[C@@H](CCC)NC(=O)CN1CC1=CC=CC=C1 NRVVVSMDLOPXJD-GFCCVEGCSA-N 0.000 description 1
- HRMRQBJUFWFQLX-ZETCQYMHSA-N (3s)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CC[C@H](C(O)=O)C1 HRMRQBJUFWFQLX-ZETCQYMHSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- XLYMOEINVGRTEX-ONEGZZNKSA-N (e)-4-ethoxy-4-oxobut-2-enoic acid Chemical compound CCOC(=O)\C=C\C(O)=O XLYMOEINVGRTEX-ONEGZZNKSA-N 0.000 description 1
- VTIODUHBZHNXFP-IHWYPQMZSA-N (e)-4-hexen-1-ol Chemical compound C\C=C/CCCO VTIODUHBZHNXFP-IHWYPQMZSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- ITDQUAQMICQLER-UHFFFAOYSA-N 1,2,4,5,6,7-hexahydrotricyclo[2.2.1.0^{2,6}]heptan-3-one Chemical compound C12CC3C(=O)C1C2C3 ITDQUAQMICQLER-UHFFFAOYSA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- ILWJAOPQHOZXAN-UHFFFAOYSA-N 1,3-dithianyl Chemical group [CH]1SCCCS1 ILWJAOPQHOZXAN-UHFFFAOYSA-N 0.000 description 1
- KFHQOZXAFUKFNB-UHFFFAOYSA-N 1,3-oxathiolanyl Chemical group [CH]1OCCS1 KFHQOZXAFUKFNB-UHFFFAOYSA-N 0.000 description 1
- PRLNKBJVTMKIGO-UHFFFAOYSA-N 1-(azetidin-1-yl)propan-1-one Chemical group CCC(=O)N1CCC1 PRLNKBJVTMKIGO-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- IZFHYCBIJRCFOW-LBPRGKRZSA-N 1-[(2S)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazin-1-yl]butan-1-one Chemical compound NC=1C(=C(CN2C[C@@H](N(CC2)C(CCC)=O)C)C=C(C1)Cl)C IZFHYCBIJRCFOW-LBPRGKRZSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- XLUXAKJPHJEFKL-UHFFFAOYSA-N 1-ethylcyclobutane-1-carboxylic acid Chemical compound CCC1(C(O)=O)CCC1 XLUXAKJPHJEFKL-UHFFFAOYSA-N 0.000 description 1
- YHDZDIPQCVCIJS-UHFFFAOYSA-N 1-methyl-5-oxopyrrolidine-3-carboxylic acid Chemical compound CN1CC(C(O)=O)CC1=O YHDZDIPQCVCIJS-UHFFFAOYSA-N 0.000 description 1
- DNMTXRJELGPOGW-UHFFFAOYSA-N 1-methylindazole-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2N(C)N=CC2=C1 DNMTXRJELGPOGW-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DGHHQBMTXTWTJV-BQAIUKQQSA-N 119413-54-6 Chemical compound Cl.C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 DGHHQBMTXTWTJV-BQAIUKQQSA-N 0.000 description 1
- YPQAFWHSMWWPLX-UHFFFAOYSA-N 1975-50-4 Chemical compound CC1=C(C(O)=O)C=CC=C1[N+]([O-])=O YPQAFWHSMWWPLX-UHFFFAOYSA-N 0.000 description 1
- SBSKRVZFWQPJID-UHFFFAOYSA-N 2,2-difluorobutanoic acid Chemical compound CCC(F)(F)C(O)=O SBSKRVZFWQPJID-UHFFFAOYSA-N 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- LIMXEVCFAUTBCK-UHFFFAOYSA-N 2,5-dibromo-3-methylpyridine Chemical compound CC1=CC(Br)=CN=C1Br LIMXEVCFAUTBCK-UHFFFAOYSA-N 0.000 description 1
- NBDADTJKLNTSHS-UHFFFAOYSA-N 2,5-dichloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C=O)=C1Cl NBDADTJKLNTSHS-UHFFFAOYSA-N 0.000 description 1
- AUAXYMOBWXOEQD-UHFFFAOYSA-N 2,5-dichloro-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl AUAXYMOBWXOEQD-UHFFFAOYSA-N 0.000 description 1
- RRRQMFWCOUSIEB-UHFFFAOYSA-N 2-(1-iodoethyl)oxolane Chemical compound CC(I)C1CCCO1 RRRQMFWCOUSIEB-UHFFFAOYSA-N 0.000 description 1
- VKSAXGLYIZSGTF-UHFFFAOYSA-N 2-(2-methyloxolan-3-yl)acetic acid Chemical compound CC1OCCC1CC(O)=O VKSAXGLYIZSGTF-UHFFFAOYSA-N 0.000 description 1
- POEFJFLAFQWOTL-UHFFFAOYSA-N 2-(3-methyl-1,2-oxazol-5-yl)acetic acid Chemical compound CC=1C=C(CC(O)=O)ON=1 POEFJFLAFQWOTL-UHFFFAOYSA-N 0.000 description 1
- BDLRLCCAOPDRHZ-UHFFFAOYSA-N 2-(3-methyloxan-4-yl)acetic acid Chemical compound CC1COCCC1CC(O)=O BDLRLCCAOPDRHZ-UHFFFAOYSA-N 0.000 description 1
- MBNGJUKRPGINST-UHFFFAOYSA-N 2-(hydroxymethyl)pentane-1,4-diol Chemical compound CC(O)CC(CO)CO MBNGJUKRPGINST-UHFFFAOYSA-N 0.000 description 1
- FSJPCGQVHNWRGI-UHFFFAOYSA-N 2-(oxetan-3-yl)acetic acid Chemical compound OC(=O)CC1COC1 FSJPCGQVHNWRGI-UHFFFAOYSA-N 0.000 description 1
- AAAQFGUYHFJNHI-SFHVURJKSA-N 2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide Chemical compound N([C@H](C1=NN=C(C)N1C1=CC=C(OC)C=C11)CC(=O)NCC)=C1C1=CC=C(Cl)C=C1 AAAQFGUYHFJNHI-SFHVURJKSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- MMIWDPMBWOTICQ-UHFFFAOYSA-N 2-methylpiperazine-1-carboxylic acid Chemical compound CC1CNCCN1C(O)=O MMIWDPMBWOTICQ-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 1
- LGCYVLDNGBSOOW-UHFFFAOYSA-N 2H-benzotriazol-4-ol 1-hydroxybenzotriazole Chemical compound OC1=CC=CC2=C1N=NN2.C1=CC=C2N(O)N=NC2=C1 LGCYVLDNGBSOOW-UHFFFAOYSA-N 0.000 description 1
- PLRCVBKYFLWAAT-UHFFFAOYSA-N 3,3-difluorocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1CC(F)(F)C1 PLRCVBKYFLWAAT-UHFFFAOYSA-N 0.000 description 1
- FICAQKBMCKEFDI-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole Chemical compound CC=1C=C(C)ON=1 FICAQKBMCKEFDI-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- FIUFLISGGHNPSM-UHFFFAOYSA-N 3-(4-methoxyphenyl)propanoic acid Chemical compound COC1=CC=C(CCC(O)=O)C=C1 FIUFLISGGHNPSM-UHFFFAOYSA-N 0.000 description 1
- DVLFYONBTKHTER-UHFFFAOYSA-N 3-(N-morpholino)propanesulfonic acid Chemical compound OS(=O)(=O)CCCN1CCOCC1 DVLFYONBTKHTER-UHFFFAOYSA-N 0.000 description 1
- LIACRDFNWIGRCX-UHFFFAOYSA-N 3-(difluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC(C(F)F)=C1 LIACRDFNWIGRCX-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- BJWLFUHDWUSOCG-ZDUSSCGKSA-N 3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-4-methyl-5-nitrobenzonitrile Chemical compound C1(CC1)CC(=O)N1[C@H](CN(CC1)CC=1C=C(C#N)C=C(C1C)[N+](=O)[O-])C BJWLFUHDWUSOCG-ZDUSSCGKSA-N 0.000 description 1
- ZQRKHTKPOBJYSZ-ZDUSSCGKSA-N 3-amino-5-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-4-methylbenzonitrile Chemical compound NC=1C=C(C#N)C=C(C1C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C ZQRKHTKPOBJYSZ-ZDUSSCGKSA-N 0.000 description 1
- HPLLFHRENOCNLD-AWEZNQCLSA-N 3-amino-5-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-4-methylbenzonitrile Chemical compound NC=1C=C(C#N)C=C(C1C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C HPLLFHRENOCNLD-AWEZNQCLSA-N 0.000 description 1
- DELJOESCKJGFML-UHFFFAOYSA-N 3-aminobut-2-enenitrile Chemical compound CC(N)=CC#N DELJOESCKJGFML-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- JAHSNQRETVXCRC-UHFFFAOYSA-N 3-ethylsulfonylpropanoic acid Chemical compound CCS(=O)(=O)CCC(O)=O JAHSNQRETVXCRC-UHFFFAOYSA-N 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- ZRWMAMOBIQQJSA-UHFFFAOYSA-N 3-methylidenecyclobutane-1-carbonitrile Chemical compound C=C1CC(C#N)C1 ZRWMAMOBIQQJSA-UHFFFAOYSA-N 0.000 description 1
- IENOFRJPUPTEMI-UHFFFAOYSA-N 3-oxocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1CC(=O)C1 IENOFRJPUPTEMI-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- IYTJRMRETHPZAC-UHFFFAOYSA-N 4,4-dibenzylpiperidine Chemical compound C1CNCCC1(CC=1C=CC=CC=1)CC1=CC=CC=C1 IYTJRMRETHPZAC-UHFFFAOYSA-N 0.000 description 1
- IIQFBBQJYPGOHJ-UHFFFAOYSA-N 4-(cyclohexen-1-yl)morpholine Chemical compound C1CCCC(N2CCOCC2)=C1 IIQFBBQJYPGOHJ-UHFFFAOYSA-N 0.000 description 1
- GUUBCSOLYHUVEX-UHFFFAOYSA-N 4-(cyclopentanecarbonyl)-3-methylpiperazine-1-carboxylic acid Chemical compound CC1CN(CCN1C(=O)C2CCCC2)C(=O)O GUUBCSOLYHUVEX-UHFFFAOYSA-N 0.000 description 1
- FYLKAPKRJRXEHH-UHFFFAOYSA-N 4-[(3-amino-5-cyano-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound CC1CN(CCN1C(=O)O)CC2=C(C(=CC(=C2)C#N)N)C FYLKAPKRJRXEHH-UHFFFAOYSA-N 0.000 description 1
- ADQWXIIGQIRUKC-UHFFFAOYSA-N 4-[(5-bromo-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound BrC=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C1)C)[N+](=O)[O-] ADQWXIIGQIRUKC-UHFFFAOYSA-N 0.000 description 1
- UWVZEEMYEDTFNE-UHFFFAOYSA-N 4-[(5-cyano-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound C(#N)C=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C1)C)[N+](=O)[O-] UWVZEEMYEDTFNE-UHFFFAOYSA-N 0.000 description 1
- LKCOLTQZYNDNFD-UHFFFAOYSA-N 4-[(5-fluoro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazine-1-carboxylic acid Chemical compound FC=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C1)C)[N+](=O)[O-] LKCOLTQZYNDNFD-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- YXBVMSQDRLXPQV-UHFFFAOYSA-N 4-cyanobutanoic acid Chemical compound OC(=O)CCCC#N YXBVMSQDRLXPQV-UHFFFAOYSA-N 0.000 description 1
- JCYLVLDCMAUAKJ-UHFFFAOYSA-N 4-oxabicyclo[3.2.1]octan-3-one Chemical compound O1C(=O)CC2CCC1C2 JCYLVLDCMAUAKJ-UHFFFAOYSA-N 0.000 description 1
- 108090000411 5-Lipoxygenase-Activating Proteins Proteins 0.000 description 1
- 102000004023 5-Lipoxygenase-Activating Proteins Human genes 0.000 description 1
- HPLIPOAWDLPCSU-INIZCTEOSA-N 5-N-[3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-5-fluoro-2-methylphenyl]pyridine-2,5-dicarboxamide Chemical compound N1=C(C=CC(=C1)C(=O)NC1=C(C(=CC(=C1)F)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C)C(=O)N HPLIPOAWDLPCSU-INIZCTEOSA-N 0.000 description 1
- CSAPESWNZDOAFU-UHFFFAOYSA-N 5-chloro-2-methylbenzoic acid Chemical compound CC1=CC=C(Cl)C=C1C(O)=O CSAPESWNZDOAFU-UHFFFAOYSA-N 0.000 description 1
- GCHOHARBDOJOJR-LBPRGKRZSA-N 5-chloro-N-[5-chloro-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)Cl)CN2C[C@@H](NCC2)C)C)C1)C GCHOHARBDOJOJR-LBPRGKRZSA-N 0.000 description 1
- DDFFSTAWBADKNF-LBPRGKRZSA-N 5-chloro-N-[5-fluoro-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-6-methylpyridine-3-carboxamide Chemical compound ClC=1C(=NC=C(C(=O)NC2=C(C(=CC(=C2)F)CN2C[C@@H](NCC2)C)C)C1)C DDFFSTAWBADKNF-LBPRGKRZSA-N 0.000 description 1
- RUFNWXXFCIKZBX-UHFFFAOYSA-N 5-fluoro-2-methyl-3-nitrobenzaldehyde Chemical compound CC1=C(C=O)C=C(F)C=C1[N+]([O-])=O RUFNWXXFCIKZBX-UHFFFAOYSA-N 0.000 description 1
- JVBLXLBINTYFPR-UHFFFAOYSA-N 5-fluoro-2-methylbenzoic acid Chemical compound CC1=CC=C(F)C=C1C(O)=O JVBLXLBINTYFPR-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- MJZJYWCQPMNPRM-UHFFFAOYSA-N 6,6-dimethyl-1-[3-(2,4,5-trichlorophenoxy)propoxy]-1,6-dihydro-1,3,5-triazine-2,4-diamine Chemical compound CC1(C)N=C(N)N=C(N)N1OCCCOC1=CC(Cl)=C(Cl)C=C1Cl MJZJYWCQPMNPRM-UHFFFAOYSA-N 0.000 description 1
- JFCICVDKSOXXCF-UHFFFAOYSA-N 6-carbamoylpyridine-3-carboxylic acid Chemical compound NC(=O)C1=CC=C(C(O)=O)C=N1 JFCICVDKSOXXCF-UHFFFAOYSA-N 0.000 description 1
- FAMBJGGXXNEVAR-UHFFFAOYSA-N 6-cyano-5-methylpyridine-3-carboxylic acid Chemical compound C(#N)C1=NC=C(C(=O)O)C=C1C FAMBJGGXXNEVAR-UHFFFAOYSA-N 0.000 description 1
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- MROJXXOCABQVEF-UHFFFAOYSA-N Actarit Chemical compound CC(=O)NC1=CC=C(CC(O)=O)C=C1 MROJXXOCABQVEF-UHFFFAOYSA-N 0.000 description 1
- 108060003345 Adrenergic Receptor Proteins 0.000 description 1
- 102000017910 Adrenergic receptor Human genes 0.000 description 1
- 239000004229 Alkannin Substances 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JXKNGFRGPPDYJR-UHFFFAOYSA-N C(#N)C=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C1)C)NC(=O)C=1C=NC(=NC1)C Chemical compound C(#N)C=1C=C(C(=C(CN2CC(N(CC2)C(=O)O)C)C1)C)NC(=O)C=1C=NC(=NC1)C JXKNGFRGPPDYJR-UHFFFAOYSA-N 0.000 description 1
- DLEUXLJMIZVCEQ-LBPRGKRZSA-N C[C@H]1CN(Cc2cc(Cl)cc(c2C)[N+]([O-])=O)CCN1C(=O)OC(C)(C)C Chemical compound C[C@H]1CN(Cc2cc(Cl)cc(c2C)[N+]([O-])=O)CCN1C(=O)OC(C)(C)C DLEUXLJMIZVCEQ-LBPRGKRZSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- LUKZNWIVRBCLON-GXOBDPJESA-N Ciclesonide Chemical compound C1([C@H]2O[C@@]3([C@H](O2)C[C@@H]2[C@@]3(C[C@H](O)[C@@H]3[C@@]4(C)C=CC(=O)C=C4CC[C@H]32)C)C(=O)COC(=O)C(C)C)CCCCC1 LUKZNWIVRBCLON-GXOBDPJESA-N 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- PTHSHZAUZPSHOD-UHFFFAOYSA-N ClC1=C(C=C(C=C1[N+](=O)[O-])Cl)CO Chemical compound ClC1=C(C=C(C=C1[N+](=O)[O-])Cl)CO PTHSHZAUZPSHOD-UHFFFAOYSA-N 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 description 1
- 108010036949 Cyclosporine Proteins 0.000 description 1
- 102000010918 Cysteinyl leukotriene receptors Human genes 0.000 description 1
- 108050001116 Cysteinyl leukotriene receptors Proteins 0.000 description 1
- SNDPXSYFESPGGJ-SCSAIBSYSA-N D-2-aminopentanoic acid Chemical compound CCC[C@@H](N)C(O)=O SNDPXSYFESPGGJ-SCSAIBSYSA-N 0.000 description 1
- 230000004568 DNA-binding Effects 0.000 description 1
- 101100441092 Danio rerio crlf3 gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- MWWSFMDVAYGXBV-RUELKSSGSA-N Doxorubicin hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 MWWSFMDVAYGXBV-RUELKSSGSA-N 0.000 description 1
- WSWCOQWTEOXDQX-MQQKCMAXSA-N E-Sorbic acid Chemical compound C\C=C\C=C\C(O)=O WSWCOQWTEOXDQX-MQQKCMAXSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- HKVAMNSJSFKALM-GKUWKFKPSA-N Everolimus Chemical compound C1C[C@@H](OCCO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 HKVAMNSJSFKALM-GKUWKFKPSA-N 0.000 description 1
- 208000009386 Experimental Arthritis Diseases 0.000 description 1
- 239000004214 Fast Green FCF Substances 0.000 description 1
- 239000004230 Fast Yellow AB Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 102000003834 Histamine H1 Receptors Human genes 0.000 description 1
- 108090000110 Histamine H1 Receptors Proteins 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000998146 Homo sapiens Interleukin-17A Proteins 0.000 description 1
- 101000844245 Homo sapiens Non-receptor tyrosine-protein kinase TYK2 Proteins 0.000 description 1
- 101001103036 Homo sapiens Nuclear receptor ROR-alpha Proteins 0.000 description 1
- 101001103034 Homo sapiens Nuclear receptor ROR-beta Proteins 0.000 description 1
- 101000686034 Homo sapiens Nuclear receptor ROR-gamma Proteins 0.000 description 1
- 101000997832 Homo sapiens Tyrosine-protein kinase JAK2 Proteins 0.000 description 1
- 102100021854 Inhibitor of nuclear factor kappa-B kinase subunit beta Human genes 0.000 description 1
- 101710205525 Inhibitor of nuclear factor kappa-B kinase subunit beta Proteins 0.000 description 1
- 102100026018 Interleukin-1 receptor antagonist protein Human genes 0.000 description 1
- 101710144554 Interleukin-1 receptor antagonist protein Proteins 0.000 description 1
- 102100033461 Interleukin-17A Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- UETNIIAIRMUTSM-UHFFFAOYSA-N Jacareubin Natural products CC1(C)OC2=CC3Oc4c(O)c(O)ccc4C(=O)C3C(=C2C=C1)O UETNIIAIRMUTSM-UHFFFAOYSA-N 0.000 description 1
- 108010024121 Janus Kinases Proteins 0.000 description 1
- 102000015617 Janus Kinases Human genes 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 239000002138 L01XE21 - Regorafenib Substances 0.000 description 1
- 239000002177 L01XE27 - Ibrutinib Substances 0.000 description 1
- XNRVGTHNYCNCFF-UHFFFAOYSA-N Lapatinib ditosylate monohydrate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 XNRVGTHNYCNCFF-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- UAGJVSRUFNSIHR-UHFFFAOYSA-N Methyl levulinate Chemical compound COC(=O)CCC(C)=O UAGJVSRUFNSIHR-UHFFFAOYSA-N 0.000 description 1
- HZQDCMWJEBCWBR-UUOKFMHZSA-N Mizoribine Chemical compound OC1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 HZQDCMWJEBCWBR-UUOKFMHZSA-N 0.000 description 1
- 241001049988 Mycobacterium tuberculosis H37Ra Species 0.000 description 1
- XICJSXIGIGNXIK-AWEZNQCLSA-N N-[5-chloro-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-4-cyano-4-methylpentanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCC(C)(C)C#N)=O)C)CN1C[C@@H](NCC1)C XICJSXIGIGNXIK-AWEZNQCLSA-N 0.000 description 1
- QCZVRRAJBVHBNZ-AWEZNQCLSA-N N-[5-chloro-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-6-cyano-5-methylpyridine-3-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(C1=CN=C(C(=C1)C)C#N)=O)C)CN1C[C@@H](NCC1)C QCZVRRAJBVHBNZ-AWEZNQCLSA-N 0.000 description 1
- VADHBVWFSZPLQE-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(2-cyclopropylacetyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-cyano-4-methylpentanamide Chemical compound ClC=1C=C(C(=C(C1)NC(CCC(C)(C)C#N)=O)C)CN1C[C@@H](N(CC1)C(CC1CC1)=O)C VADHBVWFSZPLQE-KRWDZBQOSA-N 0.000 description 1
- KERWIUKYVLCBIK-SFHVURJKSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-2-morpholin-4-ylacetamide Chemical compound ClC=1C=C(C(=C(C1)NC(CN1CCOCC1)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C KERWIUKYVLCBIK-SFHVURJKSA-N 0.000 description 1
- PYLIXVLFOWPAIZ-OYMFQORVSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-4-hydroxycyclohexane-1-carboxamide Chemical compound ClC=1C=C(C(=C(C1)NC(=O)C1CCC(CC1)O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C PYLIXVLFOWPAIZ-OYMFQORVSA-N 0.000 description 1
- BRJJCQFHJWENCT-INIZCTEOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-5,5,5-trifluoropentanamide Chemical compound ClC=1C=C(C(=C(C=1)NC(CCCC(F)(F)F)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C BRJJCQFHJWENCT-INIZCTEOSA-N 0.000 description 1
- DYCLXKLGWXYCDD-CISYCMJJSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]morpholine-2-carboxamide Chemical compound N1CC(OCC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C DYCLXKLGWXYCDD-CISYCMJJSA-N 0.000 description 1
- IAOGIHIJHJDSMN-KRWDZBQOSA-N N-[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]piperidine-4-carboxamide Chemical compound N1CCC(CC1)C(=O)NC1=C(C(=CC(=C1)Cl)CN1C[C@@H](N(CC1)C(=O)C1CCCC1)C)C IAOGIHIJHJDSMN-KRWDZBQOSA-N 0.000 description 1
- SCOKFZLHOGMUGC-ZDUSSCGKSA-N N-[5-cyano-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-2-methylpyrimidine-5-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(=O)C=1C=NC(=NC1)C)C)CN1C[C@@H](NCC1)C SCOKFZLHOGMUGC-ZDUSSCGKSA-N 0.000 description 1
- RXUQUGWCBOHPDX-AWEZNQCLSA-N N-[5-cyano-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-6-methoxypyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)OC)=O)C)CN1C[C@@H](NCC1)C RXUQUGWCBOHPDX-AWEZNQCLSA-N 0.000 description 1
- LLIIGZLZKJHWFT-HNNXBMFYSA-N N-[5-cyano-2-methyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C)=O)C)CN1C[C@@H](NCC1)C LLIIGZLZKJHWFT-HNNXBMFYSA-N 0.000 description 1
- WMQWAKIBQUGBGW-SFHVURJKSA-N N-[5-cyano-3-[[(3S)-4-(cyclobutanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]-6-methylpyridine-3-carboxamide Chemical compound C(#N)C=1C=C(C(=C(C1)NC(C1=CN=C(C=C1)C)=O)C)CN1C[C@@H](N(CC1)C(=O)C1CCC1)C WMQWAKIBQUGBGW-SFHVURJKSA-N 0.000 description 1
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- HPLIPOAWDLPCSU-UHFFFAOYSA-N N1=C(C=CC(=C1)C(=O)NC1=C(C(=CC(=C1)F)CN1CC(N(CC1)C(=O)C1CCCC1)C)C)C(=O)N Chemical compound N1=C(C=CC(=C1)C(=O)NC1=C(C(=CC(=C1)F)CN1CC(N(CC1)C(=O)C1CCCC1)C)C)C(=O)N HPLIPOAWDLPCSU-UHFFFAOYSA-N 0.000 description 1
- UCWBHKNOTLILHK-UHFFFAOYSA-N NC=1C(=C(CN2CC(N(CC2)C(=O)O)C)C=C(C1)C(=O)OC)C Chemical compound NC=1C(=C(CN2CC(N(CC2)C(=O)O)C)C=C(C1)C(=O)OC)C UCWBHKNOTLILHK-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102100032028 Non-receptor tyrosine-protein kinase TYK2 Human genes 0.000 description 1
- 102100039614 Nuclear receptor ROR-alpha Human genes 0.000 description 1
- 102100039617 Nuclear receptor ROR-beta Human genes 0.000 description 1
- 102100023421 Nuclear receptor ROR-gamma Human genes 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical class COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- 239000004235 Orange GGN Substances 0.000 description 1
- 102000016978 Orphan receptors Human genes 0.000 description 1
- 108070000031 Orphan receptors Proteins 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 206010033885 Paraparesis Diseases 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- IGVPBCZDHMIOJH-UHFFFAOYSA-N Phenyl butyrate Chemical class CCCC(=O)OC1=CC=CC=C1 IGVPBCZDHMIOJH-UHFFFAOYSA-N 0.000 description 1
- 229940123932 Phosphodiesterase 4 inhibitor Drugs 0.000 description 1
- 102100022364 Polyunsaturated fatty acid 5-lipoxygenase Human genes 0.000 description 1
- 239000004237 Ponceau 6R Substances 0.000 description 1
- 239000004236 Ponceau SX Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038277 Prostaglandin G/H synthase 1 Human genes 0.000 description 1
- 108050003243 Prostaglandin G/H synthase 1 Proteins 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 108091008680 RAR-related orphan receptors Proteins 0.000 description 1
- 102000042839 ROR family Human genes 0.000 description 1
- 108091082331 ROR family Proteins 0.000 description 1
- 101150042659 RORC gene Proteins 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 239000004231 Riboflavin-5-Sodium Phosphate Substances 0.000 description 1
- 101150102369 Ror gene Proteins 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 108010085012 Steroid Receptors Proteins 0.000 description 1
- 102000007451 Steroid Receptors Human genes 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 239000012505 Superdex™ Substances 0.000 description 1
- QJJXYPPXXYFBGM-LFZNUXCKSA-N Tacrolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1\C=C(/C)[C@@H]1[C@H](C)[C@@H](O)CC(=O)[C@H](CC=C)/C=C(C)/C[C@H](C)C[C@H](OC)[C@H]([C@H](C[C@H]2C)OC)O[C@@]2(O)C(=O)C(=O)N2CCCC[C@H]2C(=O)O1 QJJXYPPXXYFBGM-LFZNUXCKSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 102100033444 Tyrosine-protein kinase JAK2 Human genes 0.000 description 1
- 239000004234 Yellow 2G Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- KSDLVUPSYXSXQA-LJQANCHMSA-N [(2R)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-propylpiperazin-1-yl]-cyclopentylmethanone Chemical compound NC=1C(=C(CN2C[C@H](N(CC2)C(=O)C2CCCC2)CCC)C=C(C1)Cl)C KSDLVUPSYXSXQA-LJQANCHMSA-N 0.000 description 1
- OSOWLXATABTFKD-LBPRGKRZSA-N [(2S)-4-[(3-amino-2,5-dichlorophenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone Chemical compound NC=1C(=C(CN2C[C@@H](N(CC2)C(=O)C2CCCC2)C)C=C(C=1)Cl)Cl OSOWLXATABTFKD-LBPRGKRZSA-N 0.000 description 1
- UMNHHKZCCRIPHT-AWEZNQCLSA-N [(2S)-4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-cyclohexylmethanone Chemical compound C[C@H]1CN(CC2=C(C)C(=CC(Cl)=C2)[N+]([O-])=O)CCN1C(=O)C1CCCCC1 UMNHHKZCCRIPHT-AWEZNQCLSA-N 0.000 description 1
- WAQUHBYQRLBXAP-ZDUSSCGKSA-N [(2s)-4-[(5-chloro-2-methyl-3-nitrophenyl)methyl]-2-methylpiperazin-1-yl]-cyclopentylmethanone Chemical compound C([C@@H](N(CC1)C(=O)C2CCCC2)C)N1CC1=CC(Cl)=CC([N+]([O-])=O)=C1C WAQUHBYQRLBXAP-ZDUSSCGKSA-N 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- 229960003697 abatacept Drugs 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 229950003218 actarit Drugs 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- 229940126157 adrenergic receptor agonist Drugs 0.000 description 1
- 108010081667 aflibercept Proteins 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- IAJILQKETJEXLJ-QTBDOELSSA-N aldehydo-D-glucuronic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-QTBDOELSSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 235000019232 alkannin Nutrition 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000004191 allura red AC Substances 0.000 description 1
- 235000012741 allura red AC Nutrition 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 239000012911 assay medium Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- AUJRCFUBUPVWSZ-XTZHGVARSA-M auranofin Chemical compound CCP(CC)(CC)=[Au]S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O AUJRCFUBUPVWSZ-XTZHGVARSA-M 0.000 description 1
- 229960005207 auranofin Drugs 0.000 description 1
- 229940009100 aurothiomalate Drugs 0.000 description 1
- XJHSMFDIQHVMCY-UHFFFAOYSA-M aurothiomalic acid Chemical compound OC(=O)CC(S[Au])C(O)=O XJHSMFDIQHVMCY-UHFFFAOYSA-M 0.000 description 1
- 230000005784 autoimmunity Effects 0.000 description 1
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 1
- 229960002170 azathioprine Drugs 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- GMWFCJXSQQHBPI-UHFFFAOYSA-N azetidin-3-ol Chemical compound OC1CNC1 GMWFCJXSQQHBPI-UHFFFAOYSA-N 0.000 description 1
- KVVMXWRFYAGASO-UHFFFAOYSA-N azetidine-1-carboxylic acid Chemical compound OC(=O)N1CCC1 KVVMXWRFYAGASO-UHFFFAOYSA-N 0.000 description 1
- 239000004176 azorubin Substances 0.000 description 1
- 235000012733 azorubine Nutrition 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 229960003270 belimumab Drugs 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- RYKKJPDBCIAJIB-UHFFFAOYSA-N benzyl 2-(difluoromethoxy)acetate Chemical compound FC(F)OCC(=O)OCC1=CC=CC=C1 RYKKJPDBCIAJIB-UHFFFAOYSA-N 0.000 description 1
- VPYJBEIOKFRWQZ-UHFFFAOYSA-N benzyl 2-hydroxyacetate Chemical compound OCC(=O)OCC1=CC=CC=C1 VPYJBEIOKFRWQZ-UHFFFAOYSA-N 0.000 description 1
- RDRDBYYUPACJJT-UHFFFAOYSA-N benzyl 3-hydroxypropanoate Chemical compound OCCC(=O)OCC1=CC=CC=C1 RDRDBYYUPACJJT-UHFFFAOYSA-N 0.000 description 1
- 229940007550 benzyl acetate Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyloxyacetoaldehyde Natural products CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical compound O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 1
- 229960000397 bevacizumab Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 239000004126 brilliant black BN Substances 0.000 description 1
- 235000012709 brilliant black BN Nutrition 0.000 description 1
- 239000004161 brilliant blue FCF Substances 0.000 description 1
- 235000012745 brilliant blue FCF Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229960004272 bucillamine Drugs 0.000 description 1
- GRERYAZQWYKFMG-UHFFFAOYSA-N but-3-en-1-ol Chemical compound [CH2]C=CCO GRERYAZQWYKFMG-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229960004117 capecitabine Drugs 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000019241 carbon black Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000004106 carminic acid Substances 0.000 description 1
- 235000012730 carminic acid Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- ATHXVJUXBKZXBL-UHFFFAOYSA-N chembl1446173 Chemical compound CC1(C)CC(O)=C(C=N)C(=O)C1 ATHXVJUXBKZXBL-UHFFFAOYSA-N 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229960003728 ciclesonide Drugs 0.000 description 1
- 229960001265 ciclosporin Drugs 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000001679 citrus red 2 Substances 0.000 description 1
- 235000013986 citrus red 2 Nutrition 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000004121 copper complexes of chlorophylls and chlorophyllins Substances 0.000 description 1
- 235000012700 copper complexes of chlorophylls and chlorophyllins Nutrition 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000004148 curcumin Substances 0.000 description 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 1
- 239000003260 cyclooxygenase 1 inhibitor Substances 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 1
- 229930182912 cyclosporin Natural products 0.000 description 1
- BFSMGDJOXZAERB-UHFFFAOYSA-N dabrafenib Chemical compound S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 BFSMGDJOXZAERB-UHFFFAOYSA-N 0.000 description 1
- 229960002465 dabrafenib Drugs 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000005534 decanoate group Chemical class 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 1
- 150000001975 deuterium Chemical group 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical compound CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- TUGSJNQAIMFEDY-UHFFFAOYSA-N dimethyl pyridine-2,5-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)N=C1 TUGSJNQAIMFEDY-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- DSYGKYCYNVHCNQ-UHFFFAOYSA-N diphenyl(pyren-1-yl)phosphane Chemical compound C1=CC=CC=C1P(C=1C2=CC=C3C=CC=C4C=CC(C2=C43)=CC=1)C1=CC=CC=C1 DSYGKYCYNVHCNQ-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229960002918 doxorubicin hydrochloride Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 210000003162 effector t lymphocyte Anatomy 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 229960005073 erlotinib hydrochloride Drugs 0.000 description 1
- GTTBEUCJPZQMDZ-UHFFFAOYSA-N erlotinib hydrochloride Chemical compound [H+].[Cl-].C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 GTTBEUCJPZQMDZ-UHFFFAOYSA-N 0.000 description 1
- 239000004174 erythrosine Substances 0.000 description 1
- 235000012732 erythrosine Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- SLYGAZAJIHMCNT-SNAWJCMRSA-N ethyl (e)-3-(3-methyloxiran-2-yl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1OC1C SLYGAZAJIHMCNT-SNAWJCMRSA-N 0.000 description 1
- UTVNSHXHFRIXMM-UHFFFAOYSA-N ethyl 1-bromocyclobutane-1-carboxylate Chemical compound CCOC(=O)C1(Br)CCC1 UTVNSHXHFRIXMM-UHFFFAOYSA-N 0.000 description 1
- RIRMMVCSEDMEFW-UHFFFAOYSA-N ethyl 2-(1-methyl-2-oxopyrrolidin-3-yl)acetate Chemical compound CCOC(=O)CC1CCN(C)C1=O RIRMMVCSEDMEFW-UHFFFAOYSA-N 0.000 description 1
- ZZWSNYNCRUZSPR-UHFFFAOYSA-N ethyl 2-(2-oxocyclohexyl)acetate Chemical compound CCOC(=O)CC1CCCCC1=O ZZWSNYNCRUZSPR-UHFFFAOYSA-N 0.000 description 1
- PJMKFKUFBDXYEC-UHFFFAOYSA-N ethyl 2-(2-oxocyclopentyl)acetate Chemical compound CCOC(=O)CC1CCCC1=O PJMKFKUFBDXYEC-UHFFFAOYSA-N 0.000 description 1
- HGQPJJRZHCNBNY-UHFFFAOYSA-N ethyl 2-(2-oxopyrrolidin-3-yl)acetate Chemical compound CCOC(=O)CC1CCNC1=O HGQPJJRZHCNBNY-UHFFFAOYSA-N 0.000 description 1
- ULOLIZHBYWAICY-UHFFFAOYSA-N ethyl 2-(benzylamino)acetate Chemical compound CCOC(=O)CNCC1=CC=CC=C1 ULOLIZHBYWAICY-UHFFFAOYSA-N 0.000 description 1
- JAPAOTYLWINGNL-UHFFFAOYSA-N ethyl 2-(thiolan-3-yl)acetate Chemical compound CCOC(=O)CC1CCSC1 JAPAOTYLWINGNL-UHFFFAOYSA-N 0.000 description 1
- FYGRPGOHQCPZCV-UHFFFAOYSA-N ethyl 2-cyano-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)C#N FYGRPGOHQCPZCV-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- BVSRWCMAJISCTD-UHFFFAOYSA-N ethyl 2-diethoxyphosphorylpropanoate Chemical compound CCOC(=O)C(C)P(=O)(OCC)OCC BVSRWCMAJISCTD-UHFFFAOYSA-N 0.000 description 1
- KTVUZBJHOAPDGC-UHFFFAOYSA-N ethyl 3-hydroxycyclobutane-1-carboxylate Chemical compound CCOC(=O)C1CC(O)C1 KTVUZBJHOAPDGC-UHFFFAOYSA-N 0.000 description 1
- OHLRLMWUFVDREV-UHFFFAOYSA-N ethyl 4-chloro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CCl OHLRLMWUFVDREV-UHFFFAOYSA-N 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 229960005167 everolimus Drugs 0.000 description 1
- 239000013613 expression plasmid Substances 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 235000019240 fast green FCF Nutrition 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 description 1
- 235000008191 folinic acid Nutrition 0.000 description 1
- 239000011672 folinic acid Substances 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- XLYMOEINVGRTEX-UHFFFAOYSA-N fumaric acid monoethyl ester Natural products CCOC(=O)C=CC(O)=O XLYMOEINVGRTEX-UHFFFAOYSA-N 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000004612 furopyridinyl group Chemical group O1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 229960005144 gemcitabine hydrochloride Drugs 0.000 description 1
- OKKDEIYWILRZIA-OSZBKLCCSA-N gemcitabine hydrochloride Chemical compound [H+].[Cl-].O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 OKKDEIYWILRZIA-OSZBKLCCSA-N 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000004120 green S Substances 0.000 description 1
- 235000012701 green S Nutrition 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 229950010864 guselkumab Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 210000002443 helper t lymphocyte Anatomy 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical class CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- XXSMGPRMXLTPCZ-UHFFFAOYSA-N hydroxychloroquine Chemical compound ClC1=CC=C2C(NC(C)CCCN(CCO)CC)=CC=NC2=C1 XXSMGPRMXLTPCZ-UHFFFAOYSA-N 0.000 description 1
- 229960004171 hydroxychloroquine Drugs 0.000 description 1
- XYFPWWZEPKGCCK-GOSISDBHSA-N ibrutinib Chemical compound C1=2C(N)=NC=NC=2N([C@H]2CN(CCC2)C(=O)C=C)N=C1C(C=C1)=CC=C1OC1=CC=CC=C1 XYFPWWZEPKGCCK-GOSISDBHSA-N 0.000 description 1
- 229960001507 ibrutinib Drugs 0.000 description 1
- 229960003685 imatinib mesylate Drugs 0.000 description 1
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 230000036039 immunity Effects 0.000 description 1
- 238000002649 immunization Methods 0.000 description 1
- 230000003053 immunization Effects 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 239000004179 indigotine Substances 0.000 description 1
- 235000012738 indigotine Nutrition 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229940046732 interleukin inhibitors Drugs 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229960005386 ipilimumab Drugs 0.000 description 1
- 229960000779 irinotecan hydrochloride Drugs 0.000 description 1
- GURKHSYORGJETM-WAQYZQTGSA-N irinotecan hydrochloride (anhydrous) Chemical compound Cl.C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 GURKHSYORGJETM-WAQYZQTGSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- VHOGYURTWQBHIL-UHFFFAOYSA-N leflunomide Chemical compound O1N=CC(C(=O)NC=2C=CC(=CC=2)C(F)(F)F)=C1C VHOGYURTWQBHIL-UHFFFAOYSA-N 0.000 description 1
- 229960000681 leflunomide Drugs 0.000 description 1
- 229960001691 leucovorin Drugs 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical class [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- UGDPYGKWIHHBMB-UHFFFAOYSA-N lobenzarit Chemical compound OC(=O)C1=CC=CC=C1NC1=CC(Cl)=CC=C1C(O)=O UGDPYGKWIHHBMB-UHFFFAOYSA-N 0.000 description 1
- 229950005662 lobenzarit Drugs 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- KCKWOJWPEXHLOQ-SCSAIBSYSA-N methyl (3r)-3,4-dihydroxybutanoate Chemical compound COC(=O)C[C@@H](O)CO KCKWOJWPEXHLOQ-SCSAIBSYSA-N 0.000 description 1
- FUDUBAPFCNGJJM-UHFFFAOYSA-N methyl 2-(4-hydroxycyclohexyl)acetate Chemical compound COC(=O)CC1CCC(O)CC1 FUDUBAPFCNGJJM-UHFFFAOYSA-N 0.000 description 1
- XGDZEDRBLVIUMX-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C=C1 XGDZEDRBLVIUMX-UHFFFAOYSA-N 0.000 description 1
- FDVNQZVPNUJODO-UHFFFAOYSA-N methyl 2-(difluoromethyl)pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C(F)F)=C1 FDVNQZVPNUJODO-UHFFFAOYSA-N 0.000 description 1
- HCQUYIDTEHMXQS-UHFFFAOYSA-N methyl 2-methyl-1,3-oxazole-5-carboxylate Chemical compound COC(=O)C1=CN=C(C)O1 HCQUYIDTEHMXQS-UHFFFAOYSA-N 0.000 description 1
- SMCVPMKCDDNUCQ-UHFFFAOYSA-N methyl 3,3-dimethoxypropanoate Chemical compound COC(OC)CC(=O)OC SMCVPMKCDDNUCQ-UHFFFAOYSA-N 0.000 description 1
- OSWTXCSCDKIANQ-UHFFFAOYSA-N methyl 3-methylidenecyclobutane-1-carboxylate Chemical compound COC(=O)C1CC(=C)C1 OSWTXCSCDKIANQ-UHFFFAOYSA-N 0.000 description 1
- QAWFLJGZSZIZHO-UHFFFAOYSA-N methyl 4-bromobutanoate Chemical compound COC(=O)CCCBr QAWFLJGZSZIZHO-UHFFFAOYSA-N 0.000 description 1
- VHDGWXQBVWAMJA-UHFFFAOYSA-N methyl 4-methoxybutanoate Chemical compound COCCCC(=O)OC VHDGWXQBVWAMJA-UHFFFAOYSA-N 0.000 description 1
- QVLONHSXRWCCAE-UHFFFAOYSA-N methyl 6-(hydroxymethyl)pyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(CO)N=C1 QVLONHSXRWCCAE-UHFFFAOYSA-N 0.000 description 1
- XIWOJXMQJJGUDQ-UHFFFAOYSA-N methyl 6-carbamoylpyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(C(N)=O)N=C1 XIWOJXMQJJGUDQ-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- TWIIRMSFZNYMQE-UHFFFAOYSA-N methyl pyrazine-2-carboxylate Chemical compound COC(=O)C1=CN=CC=N1 TWIIRMSFZNYMQE-UHFFFAOYSA-N 0.000 description 1
- KTMKRRPZPWUYKK-UHFFFAOYSA-N methylboronic acid Chemical compound CB(O)O KTMKRRPZPWUYKK-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N methylsulphonylmethane Natural products CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 239000011325 microbead Substances 0.000 description 1
- 229960004857 mitomycin Drugs 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 229950000844 mizoribine Drugs 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 102000035118 modified proteins Human genes 0.000 description 1
- 108091005573 modified proteins Proteins 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000010413 mother solution Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- LLYKPZOWCPVRPD-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine;n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=CC=N1 LLYKPZOWCPVRPD-UHFFFAOYSA-N 0.000 description 1
- LBWFXVZLPYTWQI-IPOVEDGCSA-N n-[2-(diethylamino)ethyl]-5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-1h-pyrrole-3-carboxamide;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C LBWFXVZLPYTWQI-IPOVEDGCSA-N 0.000 description 1
- CJJZCWJJAZMVCJ-UHFFFAOYSA-N n-benzyl-2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(NCC=2C=CC=CC=2)=C1 CJJZCWJJAZMVCJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical class C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 210000000440 neutrophil Anatomy 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229960003301 nivolumab Drugs 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- 108091008569 nuclear steroid hormone receptors Proteins 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960002450 ofatumumab Drugs 0.000 description 1
- 230000000771 oncological effect Effects 0.000 description 1
- 235000019236 orange GGN Nutrition 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229960001756 oxaliplatin Drugs 0.000 description 1
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- JLPJFSCQKHRSQR-UHFFFAOYSA-N oxolan-3-one Chemical compound O=C1CCOC1 JLPJFSCQKHRSQR-UHFFFAOYSA-N 0.000 description 1
- 102000002574 p38 Mitogen-Activated Protein Kinases Human genes 0.000 description 1
- 108010068338 p38 Mitogen-Activated Protein Kinases Proteins 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 229960001972 panitumumab Drugs 0.000 description 1
- SQYNKIJPMDEDEG-UHFFFAOYSA-N paraldehyde Chemical compound CC1OC(C)OC(C)O1 SQYNKIJPMDEDEG-UHFFFAOYSA-N 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229960002621 pembrolizumab Drugs 0.000 description 1
- 229960001639 penicillamine Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical class CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002587 phosphodiesterase IV inhibitor Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000004175 ponceau 4R Substances 0.000 description 1
- 235000012731 ponceau 4R Nutrition 0.000 description 1
- 235000019238 ponceau 6R Nutrition 0.000 description 1
- 235000019237 ponceau SX Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000000770 proinflammatory effect Effects 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical class CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- FKRCODPIKNYEAC-UHFFFAOYSA-N propionic acid ethyl ester Natural products CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical class OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- RYVMUASDIZQXAA-UHFFFAOYSA-N pyranoside Natural products O1C2(OCC(C)C(OC3C(C(O)C(O)C(CO)O3)O)C2)C(C)C(C2(CCC3C4(C)CC5O)C)C1CC2C3CC=C4CC5OC(C(C1O)O)OC(CO)C1OC(C1OC2C(C(OC3C(C(O)C(O)C(CO)O3)O)C(O)C(CO)O2)O)OC(CO)C(O)C1OC1OCC(O)C(O)C1O RYVMUASDIZQXAA-UHFFFAOYSA-N 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- 229960002633 ramucirumab Drugs 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960004836 regorafenib Drugs 0.000 description 1
- FNHKPVJBJVTLMP-UHFFFAOYSA-N regorafenib Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(F)C(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 FNHKPVJBJVTLMP-UHFFFAOYSA-N 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000004492 retinoid derivatives Chemical class 0.000 description 1
- 239000002151 riboflavin Substances 0.000 description 1
- 235000019192 riboflavin Nutrition 0.000 description 1
- 235000019234 riboflavin-5-sodium phosphate Nutrition 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004641 rituximab Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical class OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical class OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229950006094 sirukumab Drugs 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 229960000487 sorafenib tosylate Drugs 0.000 description 1
- IVDHYUQIDRJSTI-UHFFFAOYSA-N sorafenib tosylate Chemical compound [H+].CC1=CC=C(S([O-])(=O)=O)C=C1.C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 IVDHYUQIDRJSTI-UHFFFAOYSA-N 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical class OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- NCEXYHBECQHGNR-QZQOTICOSA-N sulfasalazine Chemical compound C1=C(O)C(C(=O)O)=CC(\N=N\C=2C=CC(=CC=2)S(=O)(=O)NC=2N=CC=CC=2)=C1 NCEXYHBECQHGNR-QZQOTICOSA-N 0.000 description 1
- 229960001940 sulfasalazine Drugs 0.000 description 1
- NCEXYHBECQHGNR-UHFFFAOYSA-N sulfasalazine Natural products C1=C(O)C(C(=O)O)=CC(N=NC=2C=CC(=CC=2)S(=O)(=O)NC=2N=CC=CC=2)=C1 NCEXYHBECQHGNR-UHFFFAOYSA-N 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229960002812 sunitinib malate Drugs 0.000 description 1
- 239000004173 sunset yellow FCF Substances 0.000 description 1
- 235000012751 sunset yellow FCF Nutrition 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940037128 systemic glucocorticoids Drugs 0.000 description 1
- 229960001967 tacrolimus Drugs 0.000 description 1
- QJJXYPPXXYFBGM-SHYZHZOCSA-N tacrolimus Natural products CO[C@H]1C[C@H](CC[C@@H]1O)C=C(C)[C@H]2OC(=O)[C@H]3CCCCN3C(=O)C(=O)[C@@]4(O)O[C@@H]([C@H](C[C@H]4C)OC)[C@@H](C[C@H](C)CC(=C[C@@H](CC=C)C(=O)C[C@H](O)[C@H]2C)C)OC QJJXYPPXXYFBGM-SHYZHZOCSA-N 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- BBDGVXDOJKNMFL-INIZCTEOSA-N tert-butyl (2S)-4-[[3-[(5-chloro-6-methylpyridine-3-carbonyl)amino]-5-methoxycarbonyl-2-methylphenyl]methyl]-2-methylpiperazine-1-carboxylate Chemical compound ClC=1C(=NC=C(C(=O)NC=2C(=C(CN3C[C@@H](N(CC3)C(=O)OC(C)(C)C)C)C=C(C2)C(=O)OC)C)C1)C BBDGVXDOJKNMFL-INIZCTEOSA-N 0.000 description 1
- MMOOINFTWCNOGK-ATNAJCNCSA-N tert-butyl (2S)-4-[[5-chloro-2-methyl-3-[[2-(thiolan-3-yl)acetyl]amino]phenyl]methyl]-2-methylpiperazine-1-carboxylate Chemical compound ClC=1C=C(C(=C(CN2C[C@@H](N(CC2)C(=O)OC(C)(C)C)C)C1)C)NC(CC1CSCC1)=O MMOOINFTWCNOGK-ATNAJCNCSA-N 0.000 description 1
- AENHXWRQTVUROC-INIZCTEOSA-N tert-butyl (2S)-4-[[5-cyano-2-methyl-3-[(2-methylpyrimidine-5-carbonyl)amino]phenyl]methyl]-2-methylpiperazine-1-carboxylate Chemical compound C(#N)C=1C=C(C(=C(CN2C[C@@H](N(CC2)C(=O)OC(C)(C)C)C)C1)C)NC(=O)C=1C=NC(=NC1)C AENHXWRQTVUROC-INIZCTEOSA-N 0.000 description 1
- VTGVWPZFNLKFPP-SFHVURJKSA-N tert-butyl (2S)-4-[[5-cyano-2-methyl-3-[(6-methylpyridine-3-carbonyl)amino]phenyl]methyl]-2-methylpiperazine-1-carboxylate Chemical compound C(#N)C=1C=C(C(=C(CN2C[C@@H](N(CC2)C(=O)OC(C)(C)C)C)C1)C)NC(C1=CN=C(C=C1)C)=O VTGVWPZFNLKFPP-SFHVURJKSA-N 0.000 description 1
- BVWJUKIAFKMHFI-LBPRGKRZSA-N tert-butyl (2s)-4-[(3-amino-5-chloro-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1CC1=CC(Cl)=CC(N)=C1C BVWJUKIAFKMHFI-LBPRGKRZSA-N 0.000 description 1
- HYJPGYWSAJCVSK-LBPRGKRZSA-N tert-butyl (3s)-4-(cyclopentanecarbonyl)-3-methylpiperazine-1-carboxylate Chemical compound C[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)C1CCCC1 HYJPGYWSAJCVSK-LBPRGKRZSA-N 0.000 description 1
- WCJHPYKMVPJMPN-UBDBMELISA-N tert-butyl 2-[[5-chloro-3-[[(3S)-4-(cyclopentanecarbonyl)-3-methylpiperazin-1-yl]methyl]-2-methylphenyl]carbamoyl]morpholine-4-carboxylate Chemical compound C[C@H]1CN(CC2=CC(Cl)=CC(NC(=O)C3CN(CCO3)C(=O)OC(C)(C)C)=C2C)CCN1C(=O)C1CCCC1 WCJHPYKMVPJMPN-UBDBMELISA-N 0.000 description 1
- GJJYYMXBCYYXPQ-UHFFFAOYSA-N tert-butyl 2-oxopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC1=O GJJYYMXBCYYXPQ-UHFFFAOYSA-N 0.000 description 1
- JSOMVCDXPUXKIC-UHFFFAOYSA-N tert-butyl 3-oxopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)C1 JSOMVCDXPUXKIC-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- ATAMXDLUUTYFKT-UHFFFAOYSA-N thian-3-one Chemical compound O=C1CCCSC1 ATAMXDLUUTYFKT-UHFFFAOYSA-N 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
- DSXFPRKPFJRPIB-UHFFFAOYSA-N thiolan-3-one Chemical compound O=C1CCSC1 DSXFPRKPFJRPIB-UHFFFAOYSA-N 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 210000001541 thymus gland Anatomy 0.000 description 1
- 229960003989 tocilizumab Drugs 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 229960004066 trametinib Drugs 0.000 description 1
- LIRYPHYGHXZJBZ-UHFFFAOYSA-N trametinib Chemical compound CC(=O)NC1=CC=CC(N2C(N(C3CC3)C(=O)C3=C(NC=4C(=CC(I)=CC=4)F)N(C)C(=O)C(C)=C32)=O)=C1 LIRYPHYGHXZJBZ-UHFFFAOYSA-N 0.000 description 1
- VTIODUHBZHNXFP-UHFFFAOYSA-N trans-hex-4-en-1-ol Natural products CC=CCCCO VTIODUHBZHNXFP-UHFFFAOYSA-N 0.000 description 1
- 229960000575 trastuzumab Drugs 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- IIHPVYJPDKJYOU-UHFFFAOYSA-N triphenylcarbethoxymethylenephosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OCC)C1=CC=CC=C1 IIHPVYJPDKJYOU-UHFFFAOYSA-N 0.000 description 1
- 229940046728 tumor necrosis factor alpha inhibitor Drugs 0.000 description 1
- 239000002452 tumor necrosis factor alpha inhibitor Substances 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 229960003824 ustekinumab Drugs 0.000 description 1
- 239000004108 vegetable carbon Substances 0.000 description 1
- 235000012712 vegetable carbon Nutrition 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- GDJZZWYLFXAGFH-UHFFFAOYSA-M xylenesulfonate group Chemical group C1(C(C=CC=C1)C)(C)S(=O)(=O)[O-] GDJZZWYLFXAGFH-UHFFFAOYSA-M 0.000 description 1
- 235000019235 yellow 2G Nutrition 0.000 description 1
- 229960002760 ziv-aflibercept Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/496—Non-condensed piperazines containing further heterocyclic rings, e.g. rifampin, thiothixene or sparfloxacin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/04—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Epidemiology (AREA)
- Neurology (AREA)
- Dermatology (AREA)
- Rheumatology (AREA)
- Biomedical Technology (AREA)
- Transplantation (AREA)
- Neurosurgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN2014000540 | 2014-05-28 | ||
| PCT/CN2015/079753 WO2015180612A1 (en) | 2014-05-28 | 2015-05-26 | Novel compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2710487T3 true ES2710487T3 (es) | 2019-04-25 |
Family
ID=54698093
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES15800398T Active ES2710487T3 (es) | 2014-05-28 | 2015-05-26 | Derivados de piperazina como moduladores de ror-gamma |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US9902735B2 (show.php) |
| EP (1) | EP3148975B1 (show.php) |
| JP (1) | JP6759110B2 (show.php) |
| KR (1) | KR20170012389A (show.php) |
| CN (1) | CN106536489B (show.php) |
| AU (1) | AU2015267909B2 (show.php) |
| BR (1) | BR112016027732B1 (show.php) |
| CA (1) | CA2950211C (show.php) |
| ES (1) | ES2710487T3 (show.php) |
| MX (1) | MX378098B (show.php) |
| RU (1) | RU2016150535A (show.php) |
| WO (1) | WO2015180612A1 (show.php) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN105121430B (zh) | 2012-12-06 | 2017-06-16 | 葛兰素集团有限公司 | 用于治疗自身免疫性和炎性疾病的类维生素A相关的孤儿受体γ(RORγ)的调节剂 |
| US9868724B2 (en) | 2014-05-28 | 2018-01-16 | Glaxosmithkline Intellectual Property Development Limited | Compounds |
| KR20170012388A (ko) | 2014-05-28 | 2017-02-02 | 글락소스미스클라인 인털렉츄얼 프로퍼티 디벨로프먼트 리미티드 | 신규 화합물 |
| EP3474942B1 (en) * | 2016-06-23 | 2023-07-19 | Kessler Foundation Inc. | Testosterone replacement therapy in combination with neuromuscular stimulation |
| MY196990A (en) | 2016-07-13 | 2023-05-17 | Leo Pharma As | Heteroaromatic modulators of the retinoid-related orphan receptor gamma |
| MX2019007213A (es) | 2016-12-21 | 2019-08-16 | Jiangsu Hengrui Medicine Co | Derivado de azaciclobutil triazol del grupo anular condensado, metodo de preparacion del mismo y uso del mismo en medicina. |
| CA3047641A1 (en) | 2016-12-28 | 2018-07-05 | Jiangsu Hengrui Medicine Co., Ltd. | Azabicyclo-substituted triazole derivative, preparation method thereof, and application of same in medicine |
| CN109134476B (zh) * | 2017-06-15 | 2021-03-19 | 复旦大学 | 桥环哌嗪类衍生物或其盐及其制备方法和用途 |
| JPWO2019022223A1 (ja) * | 2017-07-28 | 2020-06-11 | 東レ株式会社 | 環状アミン誘導体及びその医薬用途 |
| CN107698462A (zh) * | 2017-10-10 | 2018-02-16 | 重庆科脉生物化工有限公司 | 一种1‑氨基‑1‑环丙腈盐酸盐的制备方法 |
| CN109438423A (zh) * | 2018-09-12 | 2019-03-08 | 通化师范学院 | 一种肺癌靶向化合物azd-3759的合成工艺的新方法 |
| JPWO2021177431A1 (show.php) * | 2020-03-06 | 2021-09-10 | ||
| CN116234548A (zh) * | 2020-06-09 | 2023-06-06 | 再生治疗有限公司 | 作为pd-1/pd-l1阻断剂的包含三环母核的化合物 |
| CN116239445B (zh) * | 2023-01-05 | 2024-10-18 | 万华化学集团股份有限公司 | 一种丙内酯开环加氢合成1,3-丙二醇的方法 |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU714931B2 (en) * | 1995-12-18 | 2000-01-13 | Fujisawa Pharmaceutical Co., Ltd. | Piperazine derivatives as tachykinin antagonists |
| US7790726B2 (en) | 2005-08-16 | 2010-09-07 | Chemocentryx, Inc. | Monocyclic and bicyclic compounds and methods of use |
| US7825120B2 (en) | 2005-12-15 | 2010-11-02 | Cytokinetics, Inc. | Certain substituted ((piperazin-1-ylmethyl)benzyl)ureas |
| US20070208000A1 (en) | 2005-12-15 | 2007-09-06 | Morgan Bradley P | Certain chemical entities, compositions and methods |
| JP5178526B2 (ja) * | 2005-12-19 | 2013-04-10 | サイトキネティクス・インコーポレーテッド | 化合物、組成物および方法 |
| WO2012028100A1 (en) | 2010-09-01 | 2012-03-08 | Glaxo Group Limited | Novel compounds |
| WO2012027965A1 (en) | 2010-09-01 | 2012-03-08 | Glaxo Group Limited | Novel compounds |
| WO2012100734A1 (en) | 2011-01-24 | 2012-08-02 | Glaxo Group Limited | Compounds useful as retinoid-related orphan receptor gamma modulators |
| WO2012100732A1 (en) | 2011-01-24 | 2012-08-02 | Glaxo Group Limited | Retinoid-related orphan receptor gamma modulators, composition containing them and uses thereof |
| EP2511263A1 (en) * | 2011-04-14 | 2012-10-17 | Phenex Pharmaceuticals AG | Pyrrolo sulfonamide compounds for modulation of orphan nuclear receptor RAR-related orphan receptor-gamma (RORgamma, NR1F3) activity and for the treatment of chronic inflammatory and autoimmune diseases |
| WO2012145254A2 (en) | 2011-04-16 | 2012-10-26 | Board Of Regents, The University Of Texas System | Methods of using inhibitors of rorϒt to treat disease |
| CA2833493C (en) | 2011-04-28 | 2020-06-02 | Japan Tobacco Inc. | Amide compound and pharmaceutical application therefor |
| US9586928B2 (en) * | 2011-05-16 | 2017-03-07 | The Scripps Research Institute | Modulators of the nuclear hormone receptor ROR |
| KR20140072090A (ko) | 2011-09-09 | 2014-06-12 | 뉴욕 유니버시티 | RORγt 조정제로서의 아미도 화합물 및 이의 용도 |
| GB201116641D0 (en) | 2011-09-27 | 2011-11-09 | Glaxo Group Ltd | Novel compounds |
| MX2014012989A (es) | 2012-04-27 | 2015-01-22 | Glaxo Group Ltd | Compuestos novedosos. |
| GB201207406D0 (en) | 2012-04-27 | 2012-06-13 | Glaxo Group Ltd | Novel compounds |
| CN105121430B (zh) * | 2012-12-06 | 2017-06-16 | 葛兰素集团有限公司 | 用于治疗自身免疫性和炎性疾病的类维生素A相关的孤儿受体γ(RORγ)的调节剂 |
| WO2013171729A2 (en) | 2013-01-08 | 2013-11-21 | Glenmark Pharmaceuticals S.A. | Aryl and heteroaryl amide compounds as rorgamat modulator |
| US10286000B2 (en) | 2013-10-25 | 2019-05-14 | St. Jude Children's Research Hospital, Inc. | Retinoid X receptor-gamma agonists and retinoid X receptor-alpha antagonists for treatment of cancer |
| WO2015061515A1 (en) | 2013-10-25 | 2015-04-30 | Glaxosmithkline Llc | Novel compounds |
| KR20170012388A (ko) | 2014-05-28 | 2017-02-02 | 글락소스미스클라인 인털렉츄얼 프로퍼티 디벨로프먼트 리미티드 | 신규 화합물 |
| US9868724B2 (en) | 2014-05-28 | 2018-01-16 | Glaxosmithkline Intellectual Property Development Limited | Compounds |
-
2015
- 2015-05-26 MX MX2016015630A patent/MX378098B/es unknown
- 2015-05-26 CA CA2950211A patent/CA2950211C/en active Active
- 2015-05-26 JP JP2016569766A patent/JP6759110B2/ja active Active
- 2015-05-26 EP EP15800398.8A patent/EP3148975B1/en active Active
- 2015-05-26 BR BR112016027732-5A patent/BR112016027732B1/pt active IP Right Grant
- 2015-05-26 CN CN201580039564.9A patent/CN106536489B/zh active Active
- 2015-05-26 KR KR1020167036017A patent/KR20170012389A/ko not_active Withdrawn
- 2015-05-26 AU AU2015267909A patent/AU2015267909B2/en not_active Ceased
- 2015-05-26 WO PCT/CN2015/079753 patent/WO2015180612A1/en not_active Ceased
- 2015-05-26 ES ES15800398T patent/ES2710487T3/es active Active
- 2015-05-26 RU RU2016150535A patent/RU2016150535A/ru not_active Application Discontinuation
- 2015-05-26 US US15/314,111 patent/US9902735B2/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| MX378098B (es) | 2025-03-10 |
| EP3148975A4 (en) | 2018-01-03 |
| RU2016150535A (ru) | 2018-07-03 |
| CA2950211A1 (en) | 2015-12-03 |
| CN106536489A (zh) | 2017-03-22 |
| KR20170012389A (ko) | 2017-02-02 |
| BR112016027732A2 (show.php) | 2017-08-15 |
| BR112016027732B1 (pt) | 2023-11-07 |
| WO2015180612A1 (en) | 2015-12-03 |
| EP3148975A1 (en) | 2017-04-05 |
| EP3148975B1 (en) | 2018-11-28 |
| US9902735B2 (en) | 2018-02-27 |
| CN106536489B (zh) | 2020-02-07 |
| JP6759110B2 (ja) | 2020-09-23 |
| US20170197978A1 (en) | 2017-07-13 |
| AU2015267909A1 (en) | 2016-12-01 |
| AU2015267909B2 (en) | 2018-03-22 |
| MX2016015630A (es) | 2017-04-25 |
| CA2950211C (en) | 2023-02-07 |
| RU2016150535A3 (show.php) | 2018-12-26 |
| JP2017516796A (ja) | 2017-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2710487T3 (es) | Derivados de piperazina como moduladores de ror-gamma | |
| US11547704B2 (en) | Chemical compounds | |
| WO2019121691A1 (en) | Sulphonyl urea derivatives as nlrp3 inflammasome modulators | |
| WO2019025467A1 (en) | SELECTIVE INHIBITORS OF INFLAMMASOME NLRP3 | |
| KR102824799B1 (ko) | 알파-d-갈락토피라노시드 유도체 | |
| WO2018225093A1 (en) | Chemical compounds as atf4 pathway inhibitors | |
| CA2735730A1 (en) | 2,4-diaminopyrimidine compound | |
| EP3126349A1 (en) | 5,6-disubstituted pyridine-2-carboxamides as cannabinoid receptor agonists | |
| EP3634952A1 (en) | Chemical compounds as atf4 pathway inhibitors | |
| AU2015267910A1 (en) | Novel compounds | |
| WO2018205948A1 (en) | Compounds | |
| KR20170008852A (ko) | 신규 화합물 | |
| KR20180050408A (ko) | 국부 약물 전달용의 비스테로이드성 글루코코르티코이드 수용체 조절제 | |
| JP2023527792A (ja) | Tlr2調節剤化合物、医薬組成物、及びそれらの使用 | |
| BR112016027749B1 (pt) | Composto modulador do receptor órfão relacionado à retinóide gama (rory), composição farmacêutica compreendendo dito composto e uso do mesmo para o tratamento de esclerose múltipla e espondilite anquilosante |