EA016781B1 - Триазолиламинопиримидиновые соединения - Google Patents
Триазолиламинопиримидиновые соединения Download PDFInfo
- Publication number
- EA016781B1 EA016781B1 EA200971068A EA200971068A EA016781B1 EA 016781 B1 EA016781 B1 EA 016781B1 EA 200971068 A EA200971068 A EA 200971068A EA 200971068 A EA200971068 A EA 200971068A EA 016781 B1 EA016781 B1 EA 016781B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- ethyl
- amino
- mmol
- benzo
- methyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 162
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 14
- 201000011510 cancer Diseases 0.000 claims abstract description 12
- -1 methoxy, hydroxy, amino, chloro, amino Chemical group 0.000 claims description 227
- 125000000217 alkyl group Chemical group 0.000 claims description 40
- 229910052739 hydrogen Inorganic materials 0.000 claims description 36
- 239000001257 hydrogen Substances 0.000 claims description 35
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 35
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 24
- 229910052731 fluorine Inorganic materials 0.000 claims description 21
- 239000011737 fluorine Substances 0.000 claims description 21
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 11
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 8
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000004267 aziridin-2-yl group Chemical group [H]N1C([H])([H])C1([H])* 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 180
- 239000000203 mixture Substances 0.000 description 131
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 125
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 120
- 239000000243 solution Substances 0.000 description 97
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 76
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 60
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 55
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 48
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 47
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 44
- 229920006395 saturated elastomer Polymers 0.000 description 42
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 40
- 229910052938 sodium sulfate Inorganic materials 0.000 description 40
- 235000011152 sodium sulphate Nutrition 0.000 description 40
- 239000011780 sodium chloride Substances 0.000 description 38
- 239000007787 solid Substances 0.000 description 38
- 238000000034 method Methods 0.000 description 37
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 36
- 210000004027 cell Anatomy 0.000 description 36
- 238000004440 column chromatography Methods 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 239000000543 intermediate Substances 0.000 description 29
- 239000007864 aqueous solution Substances 0.000 description 28
- 239000012044 organic layer Substances 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- 125000005605 benzo group Chemical group 0.000 description 24
- 239000003921 oil Substances 0.000 description 24
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- 238000000746 purification Methods 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000012043 crude product Substances 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 13
- 239000012074 organic phase Substances 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000012298 atmosphere Substances 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 235000011114 ammonium hydroxide Nutrition 0.000 description 10
- 239000003480 eluent Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 9
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 9
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 9
- 108020004414 DNA Proteins 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 239000003550 marker Substances 0.000 description 8
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 8
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 7
- 230000014509 gene expression Effects 0.000 description 7
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 7
- 230000000394 mitotic effect Effects 0.000 description 7
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- OPZDXMCOWFPQPE-UHFFFAOYSA-N 2-bromo-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C(Br)=C1 OPZDXMCOWFPQPE-UHFFFAOYSA-N 0.000 description 6
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 239000008363 phosphate buffer Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 206010009944 Colon cancer Diseases 0.000 description 5
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 5
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 5
- 206010057444 Oropharyngeal neoplasm Diseases 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 208000029742 colonic neoplasm Diseases 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 125000001207 fluorophenyl group Chemical group 0.000 description 5
- 108020001507 fusion proteins Proteins 0.000 description 5
- 102000037865 fusion proteins Human genes 0.000 description 5
- 208000006359 hepatoblastoma Diseases 0.000 description 5
- 201000001441 melanoma Diseases 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 5
- 201000006958 oropharynx cancer Diseases 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000012047 saturated solution Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 5
- 125000001607 1,2,3-triazol-1-yl group Chemical group [*]N1N=NC([H])=C1[H] 0.000 description 4
- CASYPDKXSSJANQ-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)ethanamine Chemical compound CC(N)C1=CC=C(F)C=C1Br CASYPDKXSSJANQ-UHFFFAOYSA-N 0.000 description 4
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 206010006187 Breast cancer Diseases 0.000 description 4
- 208000026310 Breast neoplasm Diseases 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 206010014733 Endometrial cancer Diseases 0.000 description 4
- 206010014759 Endometrial neoplasm Diseases 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 4
- 206010031096 Oropharyngeal cancer Diseases 0.000 description 4
- 206010033128 Ovarian cancer Diseases 0.000 description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 description 4
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 4
- 206010060862 Prostate cancer Diseases 0.000 description 4
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 4
- 208000005718 Stomach Neoplasms Diseases 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- WGXZDYPGLJYBJW-UHFFFAOYSA-N chloroform;propan-2-ol Chemical compound CC(C)O.ClC(Cl)Cl WGXZDYPGLJYBJW-UHFFFAOYSA-N 0.000 description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 4
- 201000004101 esophageal cancer Diseases 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000012634 fragment Substances 0.000 description 4
- 206010017758 gastric cancer Diseases 0.000 description 4
- 208000005017 glioblastoma Diseases 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 4
- 201000002528 pancreatic cancer Diseases 0.000 description 4
- 208000008443 pancreatic carcinoma Diseases 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 201000011549 stomach cancer Diseases 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- QUNRYKLHPBGAPI-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethanol Chemical compound FC(F)(F)C(O)C1=CC=C(F)C=C1Br QUNRYKLHPBGAPI-UHFFFAOYSA-N 0.000 description 3
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 3
- NUKGECOKHDKZAW-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)C1=CC=C(F)C=C1Br NUKGECOKHDKZAW-UHFFFAOYSA-N 0.000 description 3
- CHEYEJGXQSHSFE-UHFFFAOYSA-N 2-(triazol-1-yl)ethanamine Chemical compound NCCN1C=CN=N1 CHEYEJGXQSHSFE-UHFFFAOYSA-N 0.000 description 3
- YZRNCGJQASHIJE-UHFFFAOYSA-N 2-chloro-5-fluoro-4-[7-[2-[2-(oxan-2-yloxy)ethoxy]phenyl]-1-benzothiophen-2-yl]pyrimidine Chemical compound FC1=CN=C(Cl)N=C1C1=CC2=CC=CC(C=3C(=CC=CC=3)OCCOC3OCCCC3)=C2S1 YZRNCGJQASHIJE-UHFFFAOYSA-N 0.000 description 3
- PXLATSFXGKTGKG-UHFFFAOYSA-N 5-fluoro-4-[7-(5-fluoro-1H-indol-7-yl)-1-benzothiophen-2-yl]-6-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine Chemical compound N1(N=NC=C1)CCC1=C(C(=NC(=N1)N)C1=CC2=C(S1)C(=CC=C2)C=1C=C(C=C2C=CNC=12)F)F PXLATSFXGKTGKG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- 206010008342 Cervix carcinoma Diseases 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 208000000453 Skin Neoplasms Diseases 0.000 description 3
- 208000024770 Thyroid neoplasm Diseases 0.000 description 3
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000002246 antineoplastic agent Substances 0.000 description 3
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 3
- 230000004663 cell proliferation Effects 0.000 description 3
- 201000010881 cervical cancer Diseases 0.000 description 3
- 239000002299 complementary DNA Substances 0.000 description 3
- 229940125898 compound 5 Drugs 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000003821 enantio-separation Methods 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 230000011278 mitosis Effects 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 201000000849 skin cancer Diseases 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- CCLKBQZVNSHZLO-UHFFFAOYSA-N tert-butyl n-[2-(2-bromophenyl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCC1=CC=CC=C1Br CCLKBQZVNSHZLO-UHFFFAOYSA-N 0.000 description 3
- 201000002510 thyroid cancer Diseases 0.000 description 3
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 3
- MWKJTNBSKNUMFN-UHFFFAOYSA-N trifluoromethyltrimethylsilane Chemical compound C[Si](C)(C)C(F)(F)F MWKJTNBSKNUMFN-UHFFFAOYSA-N 0.000 description 3
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 3
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- DZOMROPNNIVDLB-UHFFFAOYSA-N 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene Chemical compound FC1=CC=C(C(N=[N+]=[N-])C(F)(F)F)C(Br)=C1 DZOMROPNNIVDLB-UHFFFAOYSA-N 0.000 description 2
- LVYFZHXFVDRMGQ-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenoxy)propan-2-one Chemical compound CC(=O)COC1=CC=C(F)C=C1Br LVYFZHXFVDRMGQ-UHFFFAOYSA-N 0.000 description 2
- CHNZHUPLXVBXFW-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-ol Chemical compound C=1C=C(F)C=C(Br)C=1C(O)CCC1OCCCO1 CHNZHUPLXVBXFW-UHFFFAOYSA-N 0.000 description 2
- YKVGLFMJUNNZKC-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)butane-1,4-diol Chemical compound OCCCC(O)C1=CC=C(F)C=C1Br YKVGLFMJUNNZKC-UHFFFAOYSA-N 0.000 description 2
- IZMRFAAQUGIPAE-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)cyclobutane-1-carboxylic acid Chemical compound C=1C=C(F)C=C(Br)C=1C1(C(=O)O)CCC1 IZMRFAAQUGIPAE-UHFFFAOYSA-N 0.000 description 2
- OWPCLVBUXBKHEO-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)cyclopropan-1-amine Chemical compound C=1C=C(F)C=C(Br)C=1C1(N)CC1 OWPCLVBUXBKHEO-UHFFFAOYSA-N 0.000 description 2
- RCXFSBRMWBFWMH-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C=C1Br RCXFSBRMWBFWMH-UHFFFAOYSA-N 0.000 description 2
- VHPMLJCNKYCAMW-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)propan-1-ol Chemical compound CCC(O)C1=CC=C(F)C=C1Br VHPMLJCNKYCAMW-UHFFFAOYSA-N 0.000 description 2
- LLAPDLPYIYKTGQ-UHFFFAOYSA-N 1-aminoethyl Chemical group C[CH]N LLAPDLPYIYKTGQ-UHFFFAOYSA-N 0.000 description 2
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 2
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 2
- YATZVCSTXYPBDM-UHFFFAOYSA-N 2-(1-benzothiophen-7-yl)-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1C1=CC=CC2=C1SC=C2 YATZVCSTXYPBDM-UHFFFAOYSA-N 0.000 description 2
- YMVQSWRCILGXBN-UHFFFAOYSA-N 2-(1-benzothiophen-7-yl)phenol Chemical compound OC1=CC=CC=C1C1=CC=CC2=C1SC=C2 YMVQSWRCILGXBN-UHFFFAOYSA-N 0.000 description 2
- QXMXICYZJDYKKG-UHFFFAOYSA-N 2-(2-bromo-4-chlorophenyl)-2-fluoroacetonitrile Chemical compound N#CC(F)C1=CC=C(Cl)C=C1Br QXMXICYZJDYKKG-UHFFFAOYSA-N 0.000 description 2
- OITVZXQQQFKXIP-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C(Br)=C1 OITVZXQQQFKXIP-UHFFFAOYSA-N 0.000 description 2
- LXUOROQLNQMWLL-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)propan-2-ol Chemical compound CC(C)(O)C1=CC=C(F)C=C1Br LXUOROQLNQMWLL-UHFFFAOYSA-N 0.000 description 2
- DSTFTYAYSLZREG-UHFFFAOYSA-N 2-(triazol-2-yl)ethanamine Chemical compound NCCN1N=CC=N1 DSTFTYAYSLZREG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- NKQYHZABKBYUMX-UHFFFAOYSA-N 2-[2-(4-methyltriazol-1-yl)ethyl]isoindole-1,3-dione Chemical compound N1=NC(C)=CN1CCN1C(=O)C2=CC=CC=C2C1=O NKQYHZABKBYUMX-UHFFFAOYSA-N 0.000 description 2
- XTUGIXLQMVRQFE-UHFFFAOYSA-N 2-[2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenoxy]ethanol Chemical compound OCCOC1=CC=CC=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 XTUGIXLQMVRQFE-UHFFFAOYSA-N 0.000 description 2
- ZCTVSLGEPJNFMK-UHFFFAOYSA-N 2-[2-[4-(iodomethyl)triazol-1-yl]ethyl]isoindole-1,3-dione Chemical compound N1=NC(CI)=CN1CCN1C(=O)C2=CC=CC=C2C1=O ZCTVSLGEPJNFMK-UHFFFAOYSA-N 0.000 description 2
- CLGFNXWGVCAIQH-UHFFFAOYSA-N 2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]benzaldehyde Chemical compound N1=C(C=2SC3=C(C=4C(=CC=CC=4)C=O)C=CC=C3C=2)C(F)=CN=C1NCCN1C=CN=N1 CLGFNXWGVCAIQH-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- QPLUIZXBWYUFMY-UHFFFAOYSA-N 2-bromo-1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C(Br)=C1 QPLUIZXBWYUFMY-UHFFFAOYSA-N 0.000 description 2
- GKGPZAZTXZCUMU-UHFFFAOYSA-N 2-bromo-4-fluoro-1-iodobenzene Chemical compound FC1=CC=C(I)C(Br)=C1 GKGPZAZTXZCUMU-UHFFFAOYSA-N 0.000 description 2
- JHIJCBDIUWTBLU-UHFFFAOYSA-N 5-(2-bromo-4-fluorophenyl)-3,4-dihydro-2h-pyrrole Chemical compound BrC1=CC(F)=CC=C1C1=NCCC1 JHIJCBDIUWTBLU-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 102100030817 Liver carboxylesterase 1 Human genes 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 108091000080 Phosphotransferase Proteins 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 101710169844 Sesquipedalian-1 Proteins 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000022131 cell cycle Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 210000004907 gland Anatomy 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- DPLPRQURUMMJQY-UHFFFAOYSA-N n-[1-(2-bromophenyl)ethylidene]hydroxylamine Chemical compound ON=C(C)C1=CC=CC=C1Br DPLPRQURUMMJQY-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000005416 organic matter Substances 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 102000020233 phosphotransferase Human genes 0.000 description 2
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 2
- 108091033319 polynucleotide Proteins 0.000 description 2
- 102000040430 polynucleotide Human genes 0.000 description 2
- 239000002157 polynucleotide Substances 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- XJMOSONTPMZWPB-UHFFFAOYSA-M propidium iodide Chemical compound [I-].[I-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CCC[N+](C)(CC)CC)=C1C1=CC=CC=C1 XJMOSONTPMZWPB-UHFFFAOYSA-M 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- 241000701447 unidentified baculovirus Species 0.000 description 2
- 239000013598 vector Substances 0.000 description 2
- 238000001851 vibrational circular dichroism spectroscopy Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- TWDQSJDFXUMAOI-UHFFFAOYSA-N (5-fluoro-2-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC(F)=CC=C1O TWDQSJDFXUMAOI-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- VSMZRZUTLAHOGD-UHFFFAOYSA-N 1-(2-bromo-4-chlorophenyl)ethanamine Chemical compound CC(N)C1=CC=C(Cl)C=C1Br VSMZRZUTLAHOGD-UHFFFAOYSA-N 0.000 description 1
- QRSFRTISGKDJTM-UHFFFAOYSA-N 1-(2-bromo-4-chlorophenyl)ethanol Chemical compound CC(O)C1=CC=C(Cl)C=C1Br QRSFRTISGKDJTM-UHFFFAOYSA-N 0.000 description 1
- JCZVJTHRNYEVIX-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenoxy)-2-methylpropan-2-ol Chemical compound CC(C)(O)COC1=CC=C(F)C=C1Br JCZVJTHRNYEVIX-UHFFFAOYSA-N 0.000 description 1
- GQQLAXSHKHMOAZ-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethanamine Chemical compound FC(F)(F)C(N)C1=CC=C(F)C=C1Br GQQLAXSHKHMOAZ-UHFFFAOYSA-N 0.000 description 1
- HLZWBMSWTKZOSA-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-2,2,2-trifluoroethanone Chemical compound FC1=CC=C(C(=O)C(F)(F)F)C(Br)=C1 HLZWBMSWTKZOSA-UHFFFAOYSA-N 0.000 description 1
- NBNNBTUYZBZZQH-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-2,2-difluoroethanone Chemical compound FC(F)C(=O)C1=CC=C(F)C=C1Br NBNNBTUYZBZZQH-UHFFFAOYSA-N 0.000 description 1
- FEXQKTDEVKVDPY-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-2-methylpropan-1-ol Chemical compound BrC1=C(C=CC(=C1)F)C(C(C)C)O FEXQKTDEVKVDPY-UHFFFAOYSA-N 0.000 description 1
- QZNXVMZWDWYTQB-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)-n,n-dimethylmethanamine Chemical compound CN(C)CC1=CC=C(F)C=C1Br QZNXVMZWDWYTQB-UHFFFAOYSA-N 0.000 description 1
- VFCZFIWTFIAWAI-UHFFFAOYSA-N 1-(2-bromo-4-fluorophenyl)propan-1-amine Chemical compound CCC(N)C1=CC=C(F)C=C1Br VFCZFIWTFIAWAI-UHFFFAOYSA-N 0.000 description 1
- PIMNFNXBTGPCIL-UHFFFAOYSA-N 1-(2-bromophenyl)ethanone Chemical compound CC(=O)C1=CC=CC=C1Br PIMNFNXBTGPCIL-UHFFFAOYSA-N 0.000 description 1
- RXUZKSCIEPFATE-UHFFFAOYSA-N 1-[(2-bromo-4-fluorophenyl)methyl]piperidin-4-ol Chemical compound C1CC(O)CCN1CC1=CC=C(F)C=C1Br RXUZKSCIEPFATE-UHFFFAOYSA-N 0.000 description 1
- VZHHQGVQMZVCMD-UHFFFAOYSA-N 1-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenoxy]-2-methylpropan-2-ol Chemical compound CC(C)(O)COC1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 VZHHQGVQMZVCMD-UHFFFAOYSA-N 0.000 description 1
- RVFILKCRCVFHPV-UHFFFAOYSA-N 1-benzothiophen-7-ylboronic acid Chemical compound OB(O)C1=CC=CC2=C1SC=C2 RVFILKCRCVFHPV-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- WHPFEQUEHBULBW-UHFFFAOYSA-N 2,4-dichloro-5-fluoropyrimidine Chemical compound FC1=CN=C(Cl)N=C1Cl WHPFEQUEHBULBW-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- PNPHOIZEFCAWEB-UHFFFAOYSA-N 2-(1-benzothiophen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CC2=C1SC=C2 PNPHOIZEFCAWEB-UHFFFAOYSA-N 0.000 description 1
- WHYPSHDXYZFTHJ-UHFFFAOYSA-N 2-(2-azidoethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCN=[N+]=[N-])C(=O)C2=C1 WHYPSHDXYZFTHJ-UHFFFAOYSA-N 0.000 description 1
- NUWLEGVCTULNPJ-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)-2-methylpropan-1-amine Chemical compound NCC(C)(C)C1=CC=C(F)C=C1Br NUWLEGVCTULNPJ-UHFFFAOYSA-N 0.000 description 1
- ZDCURNMUAQSMBY-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)C1=CC=C(F)C=C1Br ZDCURNMUAQSMBY-UHFFFAOYSA-N 0.000 description 1
- GEUWZXPDLYZIIR-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)acetamide Chemical compound NC(=O)CC1=CC=C(F)C=C1Br GEUWZXPDLYZIIR-UHFFFAOYSA-N 0.000 description 1
- MJSGXOXCPKTZTK-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(F)C=C1Br MJSGXOXCPKTZTK-UHFFFAOYSA-N 0.000 description 1
- PYLJWYYGGYIAPI-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)acetyl chloride Chemical compound FC1=CC=C(CC(Cl)=O)C(Br)=C1 PYLJWYYGGYIAPI-UHFFFAOYSA-N 0.000 description 1
- GZUGKKBTJOORDG-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)cyclopentan-1-one Chemical compound BrC1=CC(F)=CC=C1C1C(=O)CCC1 GZUGKKBTJOORDG-UHFFFAOYSA-N 0.000 description 1
- KHRCAOSWXINJTK-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)oxolane Chemical compound BrC1=CC(F)=CC=C1C1OCCC1 KHRCAOSWXINJTK-UHFFFAOYSA-N 0.000 description 1
- WLIMULATNBCXCQ-UHFFFAOYSA-N 2-(2-bromo-4-fluorophenyl)pyrrolidine Chemical compound BrC1=CC(F)=CC=C1C1NCCC1 WLIMULATNBCXCQ-UHFFFAOYSA-N 0.000 description 1
- GCUOLJOTJRUDIZ-UHFFFAOYSA-N 2-(2-bromoethoxy)oxane Chemical compound BrCCOC1CCCCO1 GCUOLJOTJRUDIZ-UHFFFAOYSA-N 0.000 description 1
- ITRNQMJXZUWZQL-UHFFFAOYSA-N 2-(2-bromophenyl)ethanamine Chemical compound NCCC1=CC=CC=C1Br ITRNQMJXZUWZQL-UHFFFAOYSA-N 0.000 description 1
- SJWJIKMZQXUVSC-UHFFFAOYSA-N 2-(4-methyltriazol-1-yl)ethanamine Chemical compound CC1=CN(CCN)N=N1 SJWJIKMZQXUVSC-UHFFFAOYSA-N 0.000 description 1
- HNMHQUMEFNYLQV-UHFFFAOYSA-N 2-(5-methyltriazol-1-yl)ethanamine Chemical compound CC1=CN=NN1CCN HNMHQUMEFNYLQV-UHFFFAOYSA-N 0.000 description 1
- KRQUFUKTQHISJB-YYADALCUSA-N 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one Chemical compound CCC\C(=N/OCC(C)OC1=CC=C(Cl)C=C1)C1=C(O)CC(CC1=O)C1CCCSC1 KRQUFUKTQHISJB-YYADALCUSA-N 0.000 description 1
- CGLHINIEWADZDE-UHFFFAOYSA-N 2-[1-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenyl]ethyl-methylamino]ethanol Chemical compound OCCN(C)C(C)C1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 CGLHINIEWADZDE-UHFFFAOYSA-N 0.000 description 1
- NDHKPERQHLHPHR-UHFFFAOYSA-N 2-[2-(2-bromophenoxy)ethoxy]oxane Chemical compound BrC1=CC=CC=C1OCCOC1OCCCC1 NDHKPERQHLHPHR-UHFFFAOYSA-N 0.000 description 1
- ORAYONCWRSSRTN-UHFFFAOYSA-N 2-[2-(triazol-1-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCN1C=CN=N1 ORAYONCWRSSRTN-UHFFFAOYSA-N 0.000 description 1
- DICDXJGLKXVZAA-UHFFFAOYSA-N 2-[2-[2-(1-benzothiophen-7-yl)-4-fluorophenoxy]ethoxy]oxane Chemical compound S1C2=C(C=C1)C=CC=C2C1=C(OCCOC2OCCCC2)C=CC(=C1)F DICDXJGLKXVZAA-UHFFFAOYSA-N 0.000 description 1
- UGFCKDSMZNQUBT-UHFFFAOYSA-N 2-[2-[2-(1-benzothiophen-7-yl)phenoxy]ethoxy]oxane Chemical compound C=1C=CC=C(C=2C=3SC=CC=3C=CC=2)C=1OCCOC1CCCCO1 UGFCKDSMZNQUBT-UHFFFAOYSA-N 0.000 description 1
- SJYREHRSKURNBY-UHFFFAOYSA-N 2-[2-[4-(hydroxymethyl)triazol-1-yl]ethyl]isoindole-1,3-dione Chemical compound N1=NC(CO)=CN1CCN1C(=O)C2=CC=CC=C2C1=O SJYREHRSKURNBY-UHFFFAOYSA-N 0.000 description 1
- SGYVUTCXHZCZMU-UHFFFAOYSA-N 2-[2-[5-(hydroxymethyl)triazol-1-yl]ethyl]isoindole-1,3-dione Chemical compound OCC1=CN=NN1CCN1C(=O)C2=CC=CC=C2C1=O SGYVUTCXHZCZMU-UHFFFAOYSA-N 0.000 description 1
- DIYHSLITZQCUNM-UHFFFAOYSA-N 2-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenoxy]ethanol Chemical compound OCCOC1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 DIYHSLITZQCUNM-UHFFFAOYSA-N 0.000 description 1
- DWYYBJVCTIIMLK-UHFFFAOYSA-N 2-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenyl]-2-methylpropanamide Chemical compound NC(=O)C(C)(C)C1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 DWYYBJVCTIIMLK-UHFFFAOYSA-N 0.000 description 1
- AJETWNCZUWQDKA-UHFFFAOYSA-N 2-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenyl]-2-methylpropanenitrile Chemical compound N#CC(C)(C)C1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 AJETWNCZUWQDKA-UHFFFAOYSA-N 0.000 description 1
- OOYXYCPMBGDRAZ-UHFFFAOYSA-N 2-amino-1-(2-bromo-4-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=C(F)C=C1Br OOYXYCPMBGDRAZ-UHFFFAOYSA-N 0.000 description 1
- AJOAHIKYBSZIEV-UHFFFAOYSA-N 2-bromo-4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C(Br)=C1 AJOAHIKYBSZIEV-UHFFFAOYSA-N 0.000 description 1
- SFGFOJPGCOYQJK-UHFFFAOYSA-N 2-bromo-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1Br SFGFOJPGCOYQJK-UHFFFAOYSA-N 0.000 description 1
- MNNDREXLRLDWEY-UHFFFAOYSA-N 2-bromo-4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C(Br)=C1 MNNDREXLRLDWEY-UHFFFAOYSA-N 0.000 description 1
- MEYRABVEYCFHHB-UHFFFAOYSA-N 2-bromo-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Br MEYRABVEYCFHHB-UHFFFAOYSA-N 0.000 description 1
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical compound OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- SPOWJNXAKKKRIF-UHFFFAOYSA-N 2-chloro-4-[7-(5-fluoro-2-methylphenyl)-1-benzothiophen-2-yl]pyrimidine Chemical compound Cc1ccc(F)cc1-c1cccc2cc(sc12)-c1ccnc(Cl)n1 SPOWJNXAKKKRIF-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- WEVWMDXKENHVCZ-UHFFFAOYSA-N 3,4-dihydro-1h-pteridin-2-one Chemical class C1=CN=C2NC(=O)NCC2=N1 WEVWMDXKENHVCZ-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- PUDPWGWYGGDDML-UHFFFAOYSA-N 4-(7-bromo-1-benzothiophen-2-yl)-2-chloro-5-fluoropyrimidine Chemical compound FC1=CN=C(Cl)N=C1C1=CC2=CC=CC(Br)=C2S1 PUDPWGWYGGDDML-UHFFFAOYSA-N 0.000 description 1
- SLHZWVCCPGOZBS-UHFFFAOYSA-N 4-(7-bromo-1-benzothiophen-2-yl)-2-chloropyrimidine Chemical compound ClC1=NC=CC(C=2SC3=C(Br)C=CC=C3C=2)=N1 SLHZWVCCPGOZBS-UHFFFAOYSA-N 0.000 description 1
- ZAQZCXGPXLFFQP-UHFFFAOYSA-N 4-(7-bromo-1-benzothiophen-2-yl)-5-fluoro-n-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine Chemical compound N1=C(C=2SC3=C(Br)C=CC=C3C=2)C(F)=CN=C1NCCN1C=CN=N1 ZAQZCXGPXLFFQP-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- JRIHSKPSHQDJMT-UHFFFAOYSA-N 4-[(2-bromo-4-fluorophenyl)methyl]morpholine Chemical compound BrC1=CC(F)=CC=C1CN1CCOCC1 JRIHSKPSHQDJMT-UHFFFAOYSA-N 0.000 description 1
- KMZSCMXUGNQJLP-UHFFFAOYSA-N 4-[[2-(1-benzothiophen-7-yl)-4-fluorophenyl]methyl]morpholine Chemical compound S1C2=C(C=C1)C=CC=C2C1=C(CN2CCOCC2)C=CC(=C1)F KMZSCMXUGNQJLP-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- IXOUSLAWDHODKH-UHFFFAOYSA-N 4-thiophen-2-ylpyrimidin-2-amine Chemical compound NC1=NC=CC(C=2SC=CC=2)=N1 IXOUSLAWDHODKH-UHFFFAOYSA-N 0.000 description 1
- RFDIFTWXZOLHAF-UHFFFAOYSA-N 7-(2-chloro-5-fluorophenyl)-1-benzothiophene Chemical compound ClC1=C(C=C(C=C1)F)C1=CC=CC2=C1SC=C2 RFDIFTWXZOLHAF-UHFFFAOYSA-N 0.000 description 1
- NOICDPBEDNMHQK-UHFFFAOYSA-N 7-bromo-1-benzothiophene Chemical compound BrC1=CC=CC2=C1SC=C2 NOICDPBEDNMHQK-UHFFFAOYSA-N 0.000 description 1
- XOMFQRPHXMTJSG-UHFFFAOYSA-N 7-bromo-5-fluoro-1h-indole Chemical compound FC1=CC(Br)=C2NC=CC2=C1 XOMFQRPHXMTJSG-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 101100162203 Aspergillus parasiticus (strain ATCC 56775 / NRRL 5862 / SRRC 143 / SU-1) aflG gene Proteins 0.000 description 1
- FEHCEYWTMDYJJG-UHFFFAOYSA-N B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(S3)C4=NC(=NC(=C4F)CCN5C=CN=N5)N Chemical compound B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(S3)C4=NC(=NC(=C4F)CCN5C=CN=N5)N FEHCEYWTMDYJJG-UHFFFAOYSA-N 0.000 description 1
- 206010065553 Bone marrow failure Diseases 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 208000017897 Carcinoma of esophagus Diseases 0.000 description 1
- 108091060290 Chromatid Proteins 0.000 description 1
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 description 1
- 101100353161 Drosophila melanogaster prel gene Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000152447 Hades Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- BZQFBWGGLXLEPQ-UHFFFAOYSA-N O-phosphoryl-L-serine Natural products OC(=O)C(N)COP(O)(O)=O BZQFBWGGLXLEPQ-UHFFFAOYSA-N 0.000 description 1
- DNBNSMFLILEKAK-UHFFFAOYSA-N O.O.O.O.O.O.O.O.Cl.[Ba] Chemical compound O.O.O.O.O.O.O.O.Cl.[Ba] DNBNSMFLILEKAK-UHFFFAOYSA-N 0.000 description 1
- UXRZLDREKITWRO-UHFFFAOYSA-N P(c1ccccc1)c1ccccc1.CC1(C)c2ccccc2Oc2ccccc12 Chemical compound P(c1ccccc1)c1ccccc1.CC1(C)c2ccccc2Oc2ccccc12 UXRZLDREKITWRO-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102000014434 POLO box domains Human genes 0.000 description 1
- 108050003399 POLO box domains Proteins 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 208000008938 Rhabdoid tumor Diseases 0.000 description 1
- 102000006382 Ribonucleases Human genes 0.000 description 1
- 108010083644 Ribonucleases Proteins 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 102000007562 Serum Albumin Human genes 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- AVRWEULSKHQETA-UHFFFAOYSA-N Thiophene-2 Chemical compound S1C=2CCCCCC=2C(C(=O)OC)=C1NC(=O)C1=C(F)C(F)=C(F)C(F)=C1F AVRWEULSKHQETA-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 description 1
- 229940122803 Vinca alkaloid Drugs 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- QBRSPHHAFDKHBS-UHFFFAOYSA-N [1-(2-aminoethyl)triazol-4-yl]methanol Chemical compound NCCN1C=C(CO)N=N1 QBRSPHHAFDKHBS-UHFFFAOYSA-N 0.000 description 1
- JYNXRXBIEHSSLR-UHFFFAOYSA-M [Br-].[Mg+]CCC1OCCCO1 Chemical compound [Br-].[Mg+]CCC1OCCCO1 JYNXRXBIEHSSLR-UHFFFAOYSA-M 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 230000031016 anaphase Effects 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Substances [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- ZPKOKIDOEZWTDT-UHFFFAOYSA-N azido(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(N=[N+]=[N-])C1=CC=CC=C1 ZPKOKIDOEZWTDT-UHFFFAOYSA-N 0.000 description 1
- YNCYPMUJDDXIRH-UHFFFAOYSA-N benzo[b]thiophene-2-boronic acid Chemical compound C1=CC=C2SC(B(O)O)=CC2=C1 YNCYPMUJDDXIRH-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000023359 cell cycle switching, meiotic to mitotic cell cycle Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 210000003793 centrosome Anatomy 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 210000004756 chromatid Anatomy 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- GFBLFDSCAKHHGX-UHFFFAOYSA-N cyclobutanecarbonitrile Chemical compound N#CC1CCC1 GFBLFDSCAKHHGX-UHFFFAOYSA-N 0.000 description 1
- LWABFMLTBBNLTA-UHFFFAOYSA-N cyclobutyl carbamate Chemical compound NC(=O)OC1CCC1 LWABFMLTBBNLTA-UHFFFAOYSA-N 0.000 description 1
- 230000021953 cytokinesis Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229950006137 dexfosfoserine Drugs 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- CJVAUVKDCYPHQX-UHFFFAOYSA-N difluoro(dihydroxy)silane Chemical compound O[Si](O)(F)F CJVAUVKDCYPHQX-UHFFFAOYSA-N 0.000 description 1
- PBWZKZYHONABLN-UHFFFAOYSA-N difluoroacetic acid Chemical compound OC(=O)C(F)F PBWZKZYHONABLN-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GZKHDVAKKLTJPO-UHFFFAOYSA-N ethyl 2,2-difluoroacetate Chemical compound CCOC(=O)C(F)F GZKHDVAKKLTJPO-UHFFFAOYSA-N 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 239000012894 fetal calf serum Substances 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- PUPFATUGTIQBQA-UZQPLGKSSA-N fluorophen Chemical compound C([C@@]1(C)C2=CC(O)=CC=C2C[C@H]2[C@@H]1C)CN2CCC1=CC=C(F)C=C1 PUPFATUGTIQBQA-UZQPLGKSSA-N 0.000 description 1
- VYKKDKFTDMVOBU-UHFFFAOYSA-N flusalan Chemical compound OC1=C(Br)C=C(Br)C=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 VYKKDKFTDMVOBU-UHFFFAOYSA-N 0.000 description 1
- 229950004696 flusalan Drugs 0.000 description 1
- 150000004674 formic acids Chemical class 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 238000010191 image analysis Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000001698 laser desorption ionisation Methods 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- JENBPOJAZCPSEW-UHFFFAOYSA-N methyl 2-bromo-4-fluorobenzoate Chemical compound COC(=O)C1=CC=C(F)C=C1Br JENBPOJAZCPSEW-UHFFFAOYSA-N 0.000 description 1
- SURZCVYFPAXNGN-UHFFFAOYSA-N methyl-carbamic acid ethyl ester Chemical compound CCOC(=O)NC SURZCVYFPAXNGN-UHFFFAOYSA-N 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000008600 mitotic progression Effects 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 1
- YNTOKMNHRPSGFU-UHFFFAOYSA-N n-Propyl carbamate Chemical compound CCCOC(N)=O YNTOKMNHRPSGFU-UHFFFAOYSA-N 0.000 description 1
- HVYRLQCAYQKQDB-UHFFFAOYSA-N n-[2-[4-fluoro-2-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]phenyl]propan-2-yl]formamide Chemical compound O=CNC(C)(C)C1=CC=C(F)C=C1C1=CC=CC2=C1SC(C=1C(=CN=C(NCCN3N=NC=C3)N=1)F)=C2 HVYRLQCAYQKQDB-UHFFFAOYSA-N 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- QNDVLZJODHBUFM-WFXQOWMNSA-N okadaic acid Chemical compound C([C@H](O1)[C@H](C)/C=C/[C@H]2CC[C@@]3(CC[C@H]4O[C@@H](C([C@@H](O)[C@@H]4O3)=C)[C@@H](O)C[C@H](C)[C@@H]3[C@@H](CC[C@@]4(OCCCC4)O3)C)O2)C(C)=C[C@]21O[C@H](C[C@@](C)(O)C(O)=O)CC[C@H]2O QNDVLZJODHBUFM-WFXQOWMNSA-N 0.000 description 1
- VEFJHAYOIAAXEU-UHFFFAOYSA-N okadaic acid Natural products CC(CC(O)C1OC2CCC3(CCC(O3)C=CC(C)C4CC(=CC5(OC(CC(C)(O)C(=O)O)CCC5O)O4)C)OC2C(O)C1C)C6OC7(CCCCO7)CCC6C VEFJHAYOIAAXEU-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229940080469 phosphocellulose Drugs 0.000 description 1
- BZQFBWGGLXLEPQ-REOHCLBHSA-N phosphoserine Chemical compound OC(=O)[C@@H](N)COP(O)(O)=O BZQFBWGGLXLEPQ-REOHCLBHSA-N 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- 239000005373 porous glass Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 230000020347 spindle assembly Effects 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000012799 strong cation exchange Methods 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- HHOPPKOLHCBNJI-UHFFFAOYSA-N tert-butyl 2-(2-bromo-4-fluorophenyl)aziridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC1C1=CC=C(F)C=C1Br HHOPPKOLHCBNJI-UHFFFAOYSA-N 0.000 description 1
- TZRQZPMQUXEZMC-UHFFFAOYSA-N tert-butyl n-(2-bromoethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCBr TZRQZPMQUXEZMC-UHFFFAOYSA-N 0.000 description 1
- MNZCBGMOGKPXCU-UHFFFAOYSA-N tert-butyl n-[1-(2-bromo-4-fluorophenyl)cyclopropyl]carbamate Chemical compound C=1C=C(F)C=C(Br)C=1C1(NC(=O)OC(C)(C)C)CC1 MNZCBGMOGKPXCU-UHFFFAOYSA-N 0.000 description 1
- KHVYXBFMEJBYTM-UHFFFAOYSA-N tert-butyl n-[1-(2-bromo-4-fluorophenyl)ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)C(C)C1=CC=C(F)C=C1Br KHVYXBFMEJBYTM-UHFFFAOYSA-N 0.000 description 1
- FZJZVHFDACTDDT-UHFFFAOYSA-N tert-butyl n-[1-(2-bromo-4-fluorophenyl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(F)C=C1Br FZJZVHFDACTDDT-UHFFFAOYSA-N 0.000 description 1
- RMNWPYMNQJCFTE-UHFFFAOYSA-N tert-butyl n-[1-(2-bromophenyl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=CC=C1Br RMNWPYMNQJCFTE-UHFFFAOYSA-N 0.000 description 1
- YWIKIZRQWUMSOX-UHFFFAOYSA-N tert-butyl n-[2-(2-bromo-4-fluorophenyl)-2-hydroxyethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC(O)C1=CC=C(F)C=C1Br YWIKIZRQWUMSOX-UHFFFAOYSA-N 0.000 description 1
- SINBAJJBBVBXLB-UHFFFAOYSA-N tert-butyl n-[2-[2-(1-benzothiophen-7-yl)-4-fluorophenoxy]ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCOC1=CC=C(F)C=C1C1=CC=CC2=C1SC=C2 SINBAJJBBVBXLB-UHFFFAOYSA-N 0.000 description 1
- MDGMYIZXXAVMSU-UHFFFAOYSA-N tert-butyl n-[2-[2-(1-benzothiophen-7-yl)phenoxy]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCOC1=CC=CC=C1C1=CC=CC2=C1SC=C2 MDGMYIZXXAVMSU-UHFFFAOYSA-N 0.000 description 1
- WADCCZWZIKUZGB-UHFFFAOYSA-N tert-butyl n-[2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCC1=CC=CC=C1B1OC(C)(C)C(C)(C)O1 WADCCZWZIKUZGB-UHFFFAOYSA-N 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- GMRIOAVKKGNMMV-UHFFFAOYSA-N tetrabutylazanium;azide Chemical compound [N-]=[N+]=[N-].CCCC[N+](CCCC)(CCCC)CCCC GMRIOAVKKGNMMV-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US93834707P | 2007-05-16 | 2007-05-16 | |
| PCT/US2008/062808 WO2008144223A2 (en) | 2007-05-16 | 2008-05-07 | Triazolyl aminopyrimidine compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA200971068A1 EA200971068A1 (ru) | 2010-04-30 |
| EA016781B1 true EA016781B1 (ru) | 2012-07-30 |
Family
ID=39951591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA200971068A EA016781B1 (ru) | 2007-05-16 | 2008-05-07 | Триазолиламинопиримидиновые соединения |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US8063035B2 (enExample) |
| EP (1) | EP2155734A2 (enExample) |
| JP (1) | JP5248600B2 (enExample) |
| KR (1) | KR101131261B1 (enExample) |
| CN (1) | CN101679395B (enExample) |
| AR (1) | AR066473A1 (enExample) |
| AU (1) | AU2008254319B2 (enExample) |
| BR (1) | BRPI0811433A2 (enExample) |
| CA (1) | CA2691997A1 (enExample) |
| CL (1) | CL2008001323A1 (enExample) |
| EA (1) | EA016781B1 (enExample) |
| MX (1) | MX2009012228A (enExample) |
| PE (1) | PE20090216A1 (enExample) |
| TW (1) | TW200908981A (enExample) |
| WO (1) | WO2008144223A2 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7964729B2 (en) | 2006-08-28 | 2011-06-21 | Massachusetts Institute Of Technology | Sox-based kinase sensor |
| JP2010513553A (ja) | 2006-12-21 | 2010-04-30 | イーライ リリー アンド カンパニー | 癌治療用イミダゾリジノニルアミノピリミジン化合物 |
| CN101563342B (zh) | 2006-12-21 | 2012-09-05 | 伊莱利利公司 | 用于治疗癌症的咪唑啉酮基氨基嘧啶化合物 |
| US8440835B2 (en) | 2007-02-26 | 2013-05-14 | Massachusetts Institute Of Technology | Environmentally sensitive fluorophores |
| MX2009012228A (es) | 2007-05-16 | 2009-12-01 | Lilly Co Eli | Compuesto de triazolil aminopirimidina. |
| EA015574B1 (ru) | 2007-05-16 | 2011-10-31 | Эли Лилли Энд Компани | Триазолиламинопиримидиновые соединения |
| KR101123178B1 (ko) * | 2009-04-09 | 2012-06-13 | (주)에스메디 | 2-아릴벤조싸이오펜 유도체 또는 이의 약학적으로 허용가능한 염, 이의 제조방법 및 이를 유효성분으로 함유하는 퇴행성 뇌질환의 진단 또는 치료용 약학적 조성물 |
| WO2011024441A1 (en) * | 2009-08-25 | 2011-03-03 | Oncotherapy Science, Inc. | Ercc6l as target genes for cancer therapy and diagnosis |
| WO2011025546A1 (en) * | 2009-08-31 | 2011-03-03 | Massachusetts Institute Of Technology | 1, 2, 3-triazole containing protein kinase sensors |
| UA119247C2 (uk) | 2013-09-06 | 2019-05-27 | РОЙВЕНТ САЙЕНСИЗ ҐмбГ | Спіроциклічні сполуки як інгібітори триптофангідроксилази |
| US9611201B2 (en) | 2015-03-05 | 2017-04-04 | Karos Pharmaceuticals, Inc. | Processes for preparing (R)-1-(5-chloro-[1,1′-biphenyl]-2-yl)-2,2,2-trifluoroethanol and 1-(5-chloro-[1,1′-biphenyl]-2-yl)-2,2,2-trifluoroethanone |
| WO2017220516A1 (en) * | 2016-06-23 | 2017-12-28 | F. Hoffmann-La Roche Ag | Novel [1,2,3]triazolo[4,5-d]pyrimidine derivatives |
| WO2020068600A1 (en) * | 2018-09-24 | 2020-04-02 | Rapt Therapeutics, Inc. | Ubiquitin-specific-processing protease 7 (usp7) modulators and uses thereof |
| MY205268A (en) * | 2019-09-05 | 2024-10-10 | Univ Melbourne | Nitrification inhibitors |
| CN112341428A (zh) * | 2020-11-04 | 2021-02-09 | 菏泽鸿特药业有限公司 | 一种噻吩-2-乙胺的生产方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1989007599A2 (en) * | 1988-02-09 | 1989-08-24 | Georgia State University Foundation, Inc. | Novel diazines and their method of preparation |
| WO2006066172A1 (en) * | 2004-12-17 | 2006-06-22 | Amgen, Inc. | Aminopyrimidine compounds and methods of use |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004063192A1 (en) | 2003-01-10 | 2004-07-29 | Pharmacopeia Drug Discovery, Inc. | Imidazolyl pyrimidine derivatives useful as il-8 receptor modulators |
| GB0308466D0 (en) | 2003-04-11 | 2003-05-21 | Novartis Ag | Organic compounds |
| CA2534127A1 (en) * | 2003-07-31 | 2005-02-10 | Boehringer Ingelheim Pharmaceuticals, Inc. | Substituted benzothiophene compounds and uses thereof |
| TW200800201A (en) | 2005-11-18 | 2008-01-01 | Lilly Co Eli | Pyrimidinyl benzothiophene compounds |
| US8008481B2 (en) | 2006-03-31 | 2011-08-30 | Ericsson Anna M | Indazole compounds |
| JP2010513553A (ja) * | 2006-12-21 | 2010-04-30 | イーライ リリー アンド カンパニー | 癌治療用イミダゾリジノニルアミノピリミジン化合物 |
| CN101563342B (zh) * | 2006-12-21 | 2012-09-05 | 伊莱利利公司 | 用于治疗癌症的咪唑啉酮基氨基嘧啶化合物 |
| MX2009012228A (es) | 2007-05-16 | 2009-12-01 | Lilly Co Eli | Compuesto de triazolil aminopirimidina. |
| EA015574B1 (ru) * | 2007-05-16 | 2011-10-31 | Эли Лилли Энд Компани | Триазолиламинопиримидиновые соединения |
-
2008
- 2008-05-07 MX MX2009012228A patent/MX2009012228A/es active IP Right Grant
- 2008-05-07 CA CA002691997A patent/CA2691997A1/en not_active Abandoned
- 2008-05-07 PE PE2008000798A patent/PE20090216A1/es not_active Application Discontinuation
- 2008-05-07 WO PCT/US2008/062808 patent/WO2008144223A2/en not_active Ceased
- 2008-05-07 TW TW097116886A patent/TW200908981A/zh unknown
- 2008-05-07 US US12/598,926 patent/US8063035B2/en not_active Expired - Fee Related
- 2008-05-07 JP JP2010508500A patent/JP5248600B2/ja not_active Expired - Fee Related
- 2008-05-07 BR BRPI0811433A patent/BRPI0811433A2/pt not_active IP Right Cessation
- 2008-05-07 KR KR1020097023340A patent/KR101131261B1/ko not_active Expired - Fee Related
- 2008-05-07 EP EP08747731A patent/EP2155734A2/en not_active Withdrawn
- 2008-05-07 AU AU2008254319A patent/AU2008254319B2/en not_active Ceased
- 2008-05-07 AR ARP080101932A patent/AR066473A1/es unknown
- 2008-05-07 EA EA200971068A patent/EA016781B1/ru not_active IP Right Cessation
- 2008-05-07 CL CL2008001323A patent/CL2008001323A1/es unknown
- 2008-05-07 CN CN2008800157689A patent/CN101679395B/zh not_active Expired - Fee Related
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1989007599A2 (en) * | 1988-02-09 | 1989-08-24 | Georgia State University Foundation, Inc. | Novel diazines and their method of preparation |
| WO2006066172A1 (en) * | 2004-12-17 | 2006-06-22 | Amgen, Inc. | Aminopyrimidine compounds and methods of use |
Also Published As
| Publication number | Publication date |
|---|---|
| PE20090216A1 (es) | 2009-02-28 |
| AU2008254319B2 (en) | 2012-04-19 |
| CA2691997A1 (en) | 2008-11-27 |
| US8063035B2 (en) | 2011-11-22 |
| WO2008144223A3 (en) | 2009-02-05 |
| AU2008254319A1 (en) | 2008-11-27 |
| KR20090130242A (ko) | 2009-12-21 |
| TW200908981A (en) | 2009-03-01 |
| AR066473A1 (es) | 2009-08-19 |
| BRPI0811433A2 (pt) | 2016-03-22 |
| CN101679395B (zh) | 2012-06-13 |
| CN101679395A (zh) | 2010-03-24 |
| WO2008144223A2 (en) | 2008-11-27 |
| EA200971068A1 (ru) | 2010-04-30 |
| MX2009012228A (es) | 2009-12-01 |
| JP5248600B2 (ja) | 2013-07-31 |
| EP2155734A2 (en) | 2010-02-24 |
| US20100087431A1 (en) | 2010-04-08 |
| JP2010527365A (ja) | 2010-08-12 |
| CL2008001323A1 (es) | 2009-05-29 |
| KR101131261B1 (ko) | 2012-04-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA016781B1 (ru) | Триазолиламинопиримидиновые соединения | |
| KR102620905B1 (ko) | 신규한 아미노산 유도체, 이의 제조방법, 및 이를 함유한 약제 조성물 | |
| CA2355234A1 (en) | Quinoline derivatives | |
| CA2990088A1 (en) | Hydroxyester derivatives, a process for their preparation and pharmaceutical compositions containing them | |
| EA029497B1 (ru) | Производные бензимидазолона в качестве ингибиторов бромодомена | |
| Narsimha et al. | Design, synthesis and biological evaluation of novel 1, 2, 3-triazole-based xanthine derivatives as DPP-4 inhibitors | |
| TW200528447A (en) | Novel imidazole derivatives and their use as pharmaceutical agents | |
| JP2013537201A (ja) | Ｊａｋ１インヒビターとしてのフタラジン誘導体 | |
| AU2016319597B2 (en) | Novel benzimidazole compound and medical use thereof | |
| US11773101B2 (en) | GPR35 modulators | |
| EP2687518B1 (en) | Nitrogen-containing saturated heterocyclic compound | |
| JP2025525947A (ja) | Ｃｂｌ－ｂ阻害剤としての置換ピリジノン化合物 | |
| US8114872B2 (en) | Triazolyl aminopyrimidine compounds | |
| EA016178B1 (ru) | Соединения имидазолидинониламинопиримидина | |
| CN114751899A (zh) | 一种二芳基脲类mTOR激酶抑制剂及其药物组合物和应用 | |
| TW200524608A (en) | Therapeutic agents | |
| US20250353831A1 (en) | Novel heterobicyclic compound for inhibiting yap-tead interaction and pharmaceutical composition comprising same | |
| WO2024126777A1 (en) | Heteroaromatic compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG MD TJ TM RU |