DK2710375T3 - MODIFICATION DEPENDENT ACTIVITY TESTS - Google Patents
MODIFICATION DEPENDENT ACTIVITY TESTS Download PDFInfo
- Publication number
- DK2710375T3 DK2710375T3 DK12725954.7T DK12725954T DK2710375T3 DK 2710375 T3 DK2710375 T3 DK 2710375T3 DK 12725954 T DK12725954 T DK 12725954T DK 2710375 T3 DK2710375 T3 DK 2710375T3
- Authority
- DK
- Denmark
- Prior art keywords
- factor
- recombinant
- antibody
- polypeptide
- modification
- Prior art date
Links
- 230000004048 modification Effects 0.000 title claims description 180
- 238000012986 modification Methods 0.000 title claims description 180
- 230000000694 effects Effects 0.000 title claims description 154
- 238000012360 testing method Methods 0.000 title claims description 28
- 230000001419 dependent effect Effects 0.000 title description 10
- 108010054218 Factor VIII Proteins 0.000 claims description 343
- 102000001690 Factor VIII Human genes 0.000 claims description 343
- 229960000301 factor viii Drugs 0.000 claims description 343
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 327
- 229920001184 polypeptide Polymers 0.000 claims description 315
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 315
- 238000000034 method Methods 0.000 claims description 227
- 239000003795 chemical substances by application Substances 0.000 claims description 159
- 238000003556 assay Methods 0.000 claims description 158
- 239000000523 sample Substances 0.000 claims description 143
- 102100022641 Coagulation factor IX Human genes 0.000 claims description 130
- 108010076282 Factor IX Proteins 0.000 claims description 130
- 229960004222 factor ix Drugs 0.000 claims description 130
- 102100023804 Coagulation factor VII Human genes 0.000 claims description 107
- 108010023321 Factor VII Proteins 0.000 claims description 107
- 230000027455 binding Effects 0.000 claims description 107
- 229940012413 factor vii Drugs 0.000 claims description 107
- 210000002381 plasma Anatomy 0.000 claims description 90
- -1 αΐ-antiplasmin Proteins 0.000 claims description 54
- 210000000988 bone and bone Anatomy 0.000 claims description 53
- 230000000921 morphogenic effect Effects 0.000 claims description 53
- 239000007787 solid Substances 0.000 claims description 52
- 238000010790 dilution Methods 0.000 claims description 47
- 239000012895 dilution Substances 0.000 claims description 47
- 229920001223 polyethylene glycol Polymers 0.000 claims description 47
- 238000001514 detection method Methods 0.000 claims description 46
- 102000015081 Blood Coagulation Factors Human genes 0.000 claims description 35
- 108010039209 Blood Coagulation Factors Proteins 0.000 claims description 35
- 239000003114 blood coagulation factor Substances 0.000 claims description 35
- 102000004169 proteins and genes Human genes 0.000 claims description 34
- 108090000623 proteins and genes Proteins 0.000 claims description 34
- 238000002360 preparation method Methods 0.000 claims description 32
- 108010048049 Factor IXa Proteins 0.000 claims description 28
- 239000003153 chemical reaction reagent Substances 0.000 claims description 26
- 210000004027 cell Anatomy 0.000 claims description 25
- 239000002202 Polyethylene glycol Substances 0.000 claims description 21
- 108010014173 Factor X Proteins 0.000 claims description 20
- 229940012426 factor x Drugs 0.000 claims description 20
- 230000006267 polysialylation Effects 0.000 claims description 19
- 230000006320 pegylation Effects 0.000 claims description 17
- 102000005962 receptors Human genes 0.000 claims description 17
- 108020003175 receptors Proteins 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 102000004506 Blood Proteins Human genes 0.000 claims description 15
- 108010017384 Blood Proteins Proteins 0.000 claims description 15
- 210000004369 blood Anatomy 0.000 claims description 15
- 239000008280 blood Substances 0.000 claims description 15
- 108010094028 Prothrombin Proteins 0.000 claims description 14
- 229920002472 Starch Polymers 0.000 claims description 14
- 239000012472 biological sample Substances 0.000 claims description 14
- AGVAZMGAQJOSFJ-WZHZPDAFSA-M cobalt(2+);[(2r,3s,4r,5s)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2r)-1-[3-[(1r,2r,3r,4z,7s,9z,12s,13s,14z,17s,18s,19r)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2 Chemical group [Co+2].N#[C-].[N-]([C@@H]1[C@H](CC(N)=O)[C@@]2(C)CCC(=O)NC[C@@H](C)OP(O)(=O)O[C@H]3[C@H]([C@H](O[C@@H]3CO)N3C4=CC(C)=C(C)C=C4N=C3)O)\C2=C(C)/C([C@H](C\2(C)C)CCC(N)=O)=N/C/2=C\C([C@H]([C@@]/2(CC(N)=O)C)CCC(N)=O)=N\C\2=C(C)/C2=N[C@]1(C)[C@@](C)(CC(N)=O)[C@@H]2CCC(N)=O AGVAZMGAQJOSFJ-WZHZPDAFSA-M 0.000 claims description 14
- 239000008107 starch Substances 0.000 claims description 14
- 102000004127 Cytokines Human genes 0.000 claims description 13
- 108090000695 Cytokines Proteins 0.000 claims description 13
- 108010000499 Thromboplastin Proteins 0.000 claims description 13
- 102000002262 Thromboplastin Human genes 0.000 claims description 13
- 238000010494 dissociation reaction Methods 0.000 claims description 13
- 230000005593 dissociations Effects 0.000 claims description 13
- 239000011859 microparticle Substances 0.000 claims description 13
- 102000018233 Fibroblast Growth Factor Human genes 0.000 claims description 12
- 108050007372 Fibroblast Growth Factor Proteins 0.000 claims description 12
- 229940126864 fibroblast growth factor Drugs 0.000 claims description 12
- 230000012010 growth Effects 0.000 claims description 12
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 12
- OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical group [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 claims description 12
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 claims description 11
- 239000012634 fragment Substances 0.000 claims description 11
- 239000000137 peptide hydrolase inhibitor Substances 0.000 claims description 11
- 235000019698 starch Nutrition 0.000 claims description 11
- 102000035195 Peptidases Human genes 0.000 claims description 10
- 108091005804 Peptidases Proteins 0.000 claims description 10
- 239000004365 Protease Substances 0.000 claims description 10
- 108010009583 Transforming Growth Factors Proteins 0.000 claims description 10
- 102000009618 Transforming Growth Factors Human genes 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- 102000043853 ADAMTS13 Human genes 0.000 claims description 9
- 108091005670 ADAMTS13 Proteins 0.000 claims description 9
- 108010014172 Factor V Proteins 0.000 claims description 9
- 108010074864 Factor XI Proteins 0.000 claims description 9
- 108010080865 Factor XII Proteins 0.000 claims description 9
- 102000000429 Factor XII Human genes 0.000 claims description 9
- 108010046938 Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 9
- 102000007651 Macrophage Colony-Stimulating Factor Human genes 0.000 claims description 9
- 101800004937 Protein C Proteins 0.000 claims description 9
- 102000017975 Protein C Human genes 0.000 claims description 9
- 101800001700 Saposin-D Proteins 0.000 claims description 9
- 108090000190 Thrombin Proteins 0.000 claims description 9
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 claims description 9
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 claims description 9
- 229960000856 protein c Drugs 0.000 claims description 9
- 229960004072 thrombin Drugs 0.000 claims description 9
- 229960000187 tissue plasminogen activator Drugs 0.000 claims description 9
- 108010047303 von Willebrand Factor Proteins 0.000 claims description 9
- 102100036537 von Willebrand factor Human genes 0.000 claims description 9
- 229960001134 von willebrand factor Drugs 0.000 claims description 9
- 108090000394 Erythropoietin Proteins 0.000 claims description 8
- 102000003951 Erythropoietin Human genes 0.000 claims description 8
- 108010074860 Factor Xa Proteins 0.000 claims description 8
- 108010022233 Plasminogen Activator Inhibitor 1 Proteins 0.000 claims description 8
- 102100039418 Plasminogen activator inhibitor 1 Human genes 0.000 claims description 8
- 102000036693 Thrombopoietin Human genes 0.000 claims description 8
- 108010041111 Thrombopoietin Proteins 0.000 claims description 8
- 230000015271 coagulation Effects 0.000 claims description 8
- 238000005345 coagulation Methods 0.000 claims description 8
- 229940105423 erythropoietin Drugs 0.000 claims description 8
- 238000000746 purification Methods 0.000 claims description 8
- 108090001007 Interleukin-8 Proteins 0.000 claims description 7
- 102000004890 Interleukin-8 Human genes 0.000 claims description 7
- 239000003102 growth factor Substances 0.000 claims description 7
- 108090000371 Esterases Proteins 0.000 claims description 6
- 108010008165 Etanercept Proteins 0.000 claims description 6
- 102000003972 Fibroblast growth factor 7 Human genes 0.000 claims description 6
- 108090000385 Fibroblast growth factor 7 Proteins 0.000 claims description 6
- 102000003956 Fibroblast growth factor 8 Human genes 0.000 claims description 6
- 108090000368 Fibroblast growth factor 8 Proteins 0.000 claims description 6
- 108010000487 High-Molecular-Weight Kininogen Proteins 0.000 claims description 6
- 102000004877 Insulin Human genes 0.000 claims description 6
- 108090001061 Insulin Proteins 0.000 claims description 6
- 108010050904 Interferons Proteins 0.000 claims description 6
- 102000014150 Interferons Human genes 0.000 claims description 6
- 102100030703 Interleukin-22 Human genes 0.000 claims description 6
- 102100035792 Kininogen-1 Human genes 0.000 claims description 6
- 102000004179 Plasminogen Activator Inhibitor 2 Human genes 0.000 claims description 6
- 108090000614 Plasminogen Activator Inhibitor 2 Proteins 0.000 claims description 6
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 claims description 6
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 claims description 6
- 229940096437 Protein S Drugs 0.000 claims description 6
- 108010066124 Protein S Proteins 0.000 claims description 6
- 102000029301 Protein S Human genes 0.000 claims description 6
- 102100031294 Thymic stromal lymphopoietin Human genes 0.000 claims description 6
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 claims description 6
- 102000004887 Transforming Growth Factor beta Human genes 0.000 claims description 6
- 108090001012 Transforming Growth Factor beta Proteins 0.000 claims description 6
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims description 6
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims description 6
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 claims description 6
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 claims description 6
- 239000004019 antithrombin Substances 0.000 claims description 6
- 239000012530 fluid Substances 0.000 claims description 6
- 229940088597 hormone Drugs 0.000 claims description 6
- 239000005556 hormone Substances 0.000 claims description 6
- 229940125396 insulin Drugs 0.000 claims description 6
- 229940079322 interferon Drugs 0.000 claims description 6
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 claims description 6
- 108010025221 plasma protein Z Proteins 0.000 claims description 6
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 claims description 6
- 108010029307 thymic stromal lymphopoietin Proteins 0.000 claims description 6
- 229960005356 urokinase Drugs 0.000 claims description 6
- 108060003951 Immunoglobulin Proteins 0.000 claims description 5
- 108090000630 Oncostatin M Proteins 0.000 claims description 5
- 102000004140 Oncostatin M Human genes 0.000 claims description 5
- 108010082093 Placenta Growth Factor Proteins 0.000 claims description 5
- 230000029918 bioluminescence Effects 0.000 claims description 5
- 238000005415 bioluminescence Methods 0.000 claims description 5
- 210000001124 body fluid Anatomy 0.000 claims description 5
- 239000010839 body fluid Substances 0.000 claims description 5
- 238000000605 extraction Methods 0.000 claims description 5
- 102000018358 immunoglobulin Human genes 0.000 claims description 5
- 210000000440 neutrophil Anatomy 0.000 claims description 5
- 210000002966 serum Anatomy 0.000 claims description 5
- 230000001225 therapeutic effect Effects 0.000 claims description 5
- 210000001519 tissue Anatomy 0.000 claims description 5
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 claims description 4
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 claims description 4
- 102000004357 Transferases Human genes 0.000 claims description 4
- 108090000992 Transferases Proteins 0.000 claims description 4
- 210000004556 brain Anatomy 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- 210000000056 organ Anatomy 0.000 claims description 4
- 230000010287 polarization Effects 0.000 claims description 4
- 238000002165 resonance energy transfer Methods 0.000 claims description 4
- 238000000926 separation method Methods 0.000 claims description 4
- 210000000130 stem cell Anatomy 0.000 claims description 4
- 101710169336 5'-deoxyadenosine deaminase Proteins 0.000 claims description 3
- 102100033639 Acetylcholinesterase Human genes 0.000 claims description 3
- 108010022752 Acetylcholinesterase Proteins 0.000 claims description 3
- 108010059616 Activins Proteins 0.000 claims description 3
- 102000009027 Albumins Human genes 0.000 claims description 3
- 108010088751 Albumins Proteins 0.000 claims description 3
- 102100022987 Angiogenin Human genes 0.000 claims description 3
- 108090000935 Antithrombin III Proteins 0.000 claims description 3
- 102000004411 Antithrombin III Human genes 0.000 claims description 3
- 101001010152 Aplysia californica Probable glutathione transferase Proteins 0.000 claims description 3
- 102000015790 Asparaginase Human genes 0.000 claims description 3
- 108010024976 Asparaginase Proteins 0.000 claims description 3
- 238000009010 Bradford assay Methods 0.000 claims description 3
- 102000004219 Brain-derived neurotrophic factor Human genes 0.000 claims description 3
- 108090000715 Brain-derived neurotrophic factor Proteins 0.000 claims description 3
- 108010053652 Butyrylcholinesterase Proteins 0.000 claims description 3
- 102100028892 Cardiotrophin-1 Human genes 0.000 claims description 3
- 101710161573 Cardiotrophin-2 Proteins 0.000 claims description 3
- 108010008951 Chemokine CXCL12 Proteins 0.000 claims description 3
- 102000019034 Chemokines Human genes 0.000 claims description 3
- 108010012236 Chemokines Proteins 0.000 claims description 3
- 102100032404 Cholinesterase Human genes 0.000 claims description 3
- 102000011022 Chorionic Gonadotropin Human genes 0.000 claims description 3
- 108010062540 Chorionic Gonadotropin Proteins 0.000 claims description 3
- 108090000317 Chymotrypsin Proteins 0.000 claims description 3
- 102400000686 Endothelin-1 Human genes 0.000 claims description 3
- 101800004490 Endothelin-1 Proteins 0.000 claims description 3
- 101800003838 Epidermal growth factor Proteins 0.000 claims description 3
- 102100030323 Epigen Human genes 0.000 claims description 3
- 108010016906 Epigen Proteins 0.000 claims description 3
- 101800000155 Epiregulin Proteins 0.000 claims description 3
- 102100031939 Erythropoietin Human genes 0.000 claims description 3
- 108010074105 Factor Va Proteins 0.000 claims description 3
- 108010071289 Factor XIII Proteins 0.000 claims description 3
- 102000004641 Fetal Proteins Human genes 0.000 claims description 3
- 108010003471 Fetal Proteins Proteins 0.000 claims description 3
- 108010049003 Fibrinogen Proteins 0.000 claims description 3
- 102000008946 Fibrinogen Human genes 0.000 claims description 3
- 108010088842 Fibrinolysin Proteins 0.000 claims description 3
- 108050003239 Fibroblast growth factor 12 Proteins 0.000 claims description 3
- 102000012570 Fibroblast growth factor 16 Human genes 0.000 claims description 3
- 108050002072 Fibroblast growth factor 16 Proteins 0.000 claims description 3
- 102000012565 Fibroblast growth factor 17 Human genes 0.000 claims description 3
- 108050002074 Fibroblast growth factor 17 Proteins 0.000 claims description 3
- 102100031734 Fibroblast growth factor 19 Human genes 0.000 claims description 3
- 101710153349 Fibroblast growth factor 19 Proteins 0.000 claims description 3
- 102000012558 Fibroblast growth factor 20 Human genes 0.000 claims description 3
- 108050002085 Fibroblast growth factor 20 Proteins 0.000 claims description 3
- 102000003973 Fibroblast growth factor 21 Human genes 0.000 claims description 3
- 108090000376 Fibroblast growth factor 21 Proteins 0.000 claims description 3
- 102000003969 Fibroblast growth factor 4 Human genes 0.000 claims description 3
- 108090000381 Fibroblast growth factor 4 Proteins 0.000 claims description 3
- 102000003967 Fibroblast growth factor 5 Human genes 0.000 claims description 3
- 108090000380 Fibroblast growth factor 5 Proteins 0.000 claims description 3
- 102000003968 Fibroblast growth factor 6 Human genes 0.000 claims description 3
- 108090000382 Fibroblast growth factor 6 Proteins 0.000 claims description 3
- 102100037362 Fibronectin Human genes 0.000 claims description 3
- 108010067306 Fibronectins Proteins 0.000 claims description 3
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 claims description 3
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 claims description 3
- 108090000481 Heparin Cofactor II Proteins 0.000 claims description 3
- 102100030500 Heparin cofactor 2 Human genes 0.000 claims description 3
- 102000003745 Hepatocyte Growth Factor Human genes 0.000 claims description 3
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 claims description 3
- 102100031000 Hepatoma-derived growth factor Human genes 0.000 claims description 3
- 101000998139 Homo sapiens Interleukin-32 Proteins 0.000 claims description 3
- 101000871708 Homo sapiens Proheparin-binding EGF-like growth factor Proteins 0.000 claims description 3
- 102000004157 Hydrolases Human genes 0.000 claims description 3
- 108090000604 Hydrolases Proteins 0.000 claims description 3
- 101000668058 Infectious salmon anemia virus (isolate Atlantic salmon/Norway/810/9/99) RNA-directed RNA polymerase catalytic subunit Proteins 0.000 claims description 3
- 102100026818 Inhibin beta E chain Human genes 0.000 claims description 3
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 claims description 3
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 claims description 3
- 102100037852 Insulin-like growth factor I Human genes 0.000 claims description 3
- 102100025947 Insulin-like growth factor II Human genes 0.000 claims description 3
- 102100026720 Interferon beta Human genes 0.000 claims description 3
- 108090000467 Interferon-beta Proteins 0.000 claims description 3
- 102100020881 Interleukin-1 alpha Human genes 0.000 claims description 3
- 102000003777 Interleukin-1 beta Human genes 0.000 claims description 3
- 108090000193 Interleukin-1 beta Proteins 0.000 claims description 3
- 108090000174 Interleukin-10 Proteins 0.000 claims description 3
- 102000003814 Interleukin-10 Human genes 0.000 claims description 3
- 108090000177 Interleukin-11 Proteins 0.000 claims description 3
- 102000003815 Interleukin-11 Human genes 0.000 claims description 3
- 108010065805 Interleukin-12 Proteins 0.000 claims description 3
- 108090000176 Interleukin-13 Proteins 0.000 claims description 3
- 102000003812 Interleukin-15 Human genes 0.000 claims description 3
- 108090000172 Interleukin-15 Proteins 0.000 claims description 3
- 102000013691 Interleukin-17 Human genes 0.000 claims description 3
- 108050003558 Interleukin-17 Proteins 0.000 claims description 3
- 108090000171 Interleukin-18 Proteins 0.000 claims description 3
- 108050009288 Interleukin-19 Proteins 0.000 claims description 3
- 108010082786 Interleukin-1alpha Proteins 0.000 claims description 3
- 108010065637 Interleukin-23 Proteins 0.000 claims description 3
- 108010002386 Interleukin-3 Proteins 0.000 claims description 3
- 102000000646 Interleukin-3 Human genes 0.000 claims description 3
- 101710181613 Interleukin-31 Proteins 0.000 claims description 3
- 108010067003 Interleukin-33 Proteins 0.000 claims description 3
- 108010002616 Interleukin-5 Proteins 0.000 claims description 3
- 102000000743 Interleukin-5 Human genes 0.000 claims description 3
- 108090001005 Interleukin-6 Proteins 0.000 claims description 3
- 102000004889 Interleukin-6 Human genes 0.000 claims description 3
- 108010002586 Interleukin-7 Proteins 0.000 claims description 3
- 108010002335 Interleukin-9 Proteins 0.000 claims description 3
- 102000015696 Interleukins Human genes 0.000 claims description 3
- 108010063738 Interleukins Proteins 0.000 claims description 3
- 102000016267 Leptin Human genes 0.000 claims description 3
- 108010092277 Leptin Proteins 0.000 claims description 3
- 102000004058 Leukemia inhibitory factor Human genes 0.000 claims description 3
- 108090000581 Leukemia inhibitory factor Proteins 0.000 claims description 3
- 102100021747 Leukemia inhibitory factor receptor Human genes 0.000 claims description 3
- 108090001030 Lipoproteins Proteins 0.000 claims description 3
- 102000004895 Lipoproteins Human genes 0.000 claims description 3
- 101100369076 Mus musculus Tdgf1 gene Proteins 0.000 claims description 3
- 102000008934 Muscle Proteins Human genes 0.000 claims description 3
- 108010074084 Muscle Proteins Proteins 0.000 claims description 3
- 108010025020 Nerve Growth Factor Proteins 0.000 claims description 3
- 102000015336 Nerve Growth Factor Human genes 0.000 claims description 3
- 102000007339 Nerve Growth Factor Receptors Human genes 0.000 claims description 3
- 108010032605 Nerve Growth Factor Receptors Proteins 0.000 claims description 3
- 101710138657 Neurotoxin Proteins 0.000 claims description 3
- 108090000742 Neurotrophin 3 Proteins 0.000 claims description 3
- 102000004230 Neurotrophin 3 Human genes 0.000 claims description 3
- 102000003683 Neurotrophin-4 Human genes 0.000 claims description 3
- 108090000099 Neurotrophin-4 Proteins 0.000 claims description 3
- 108010064527 OSM-LIF Receptors Proteins 0.000 claims description 3
- 102000004316 Oxidoreductases Human genes 0.000 claims description 3
- 108090000854 Oxidoreductases Proteins 0.000 claims description 3
- 108010067372 Pancreatic elastase Proteins 0.000 claims description 3
- 102000016387 Pancreatic elastase Human genes 0.000 claims description 3
- 102000057297 Pepsin A Human genes 0.000 claims description 3
- 108090000284 Pepsin A Proteins 0.000 claims description 3
- 102000013566 Plasminogen Human genes 0.000 claims description 3
- 108010051456 Plasminogen Proteins 0.000 claims description 3
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 claims description 3
- 101710164680 Platelet-derived growth factor receptor beta Proteins 0.000 claims description 3
- 102100037596 Platelet-derived growth factor subunit A Human genes 0.000 claims description 3
- 101710103506 Platelet-derived growth factor subunit A Proteins 0.000 claims description 3
- 102100025498 Proepiregulin Human genes 0.000 claims description 3
- 102100033762 Proheparin-binding EGF-like growth factor Human genes 0.000 claims description 3
- 102000003946 Prolactin Human genes 0.000 claims description 3
- 108010057464 Prolactin Proteins 0.000 claims description 3
- 101710151715 Protein 7 Proteins 0.000 claims description 3
- 101710150593 Protein beta Proteins 0.000 claims description 3
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 claims description 3
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 claims description 3
- 108010039491 Ricin Proteins 0.000 claims description 3
- 102000004584 Somatomedin Receptors Human genes 0.000 claims description 3
- 108010017622 Somatomedin Receptors Proteins 0.000 claims description 3
- 102100021669 Stromal cell-derived factor 1 Human genes 0.000 claims description 3
- 102100026966 Thrombomodulin Human genes 0.000 claims description 3
- 108010079274 Thrombomodulin Proteins 0.000 claims description 3
- 102100031372 Thymidine phosphorylase Human genes 0.000 claims description 3
- 108700023160 Thymidine phosphorylases Proteins 0.000 claims description 3
- 102000011923 Thyrotropin Human genes 0.000 claims description 3
- 108010061174 Thyrotropin Proteins 0.000 claims description 3
- 102000004338 Transferrin Human genes 0.000 claims description 3
- 108090000901 Transferrin Proteins 0.000 claims description 3
- 102000011117 Transforming Growth Factor beta2 Human genes 0.000 claims description 3
- 101800000304 Transforming growth factor beta-2 Proteins 0.000 claims description 3
- 108090000631 Trypsin Proteins 0.000 claims description 3
- 102000004142 Trypsin Human genes 0.000 claims description 3
- 108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 3
- 101710187743 Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 claims description 3
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 claims description 3
- 102100035140 Vitronectin Human genes 0.000 claims description 3
- 108010031318 Vitronectin Proteins 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 3
- 229940022698 acetylcholinesterase Drugs 0.000 claims description 3
- 239000000488 activin Substances 0.000 claims description 3
- 108010023082 activin A Proteins 0.000 claims description 3
- 108010023079 activin B Proteins 0.000 claims description 3
- 229960002964 adalimumab Drugs 0.000 claims description 3
- 229940050528 albumin Drugs 0.000 claims description 3
- 108010072788 angiogenin Proteins 0.000 claims description 3
- 229960005348 antithrombin iii Drugs 0.000 claims description 3
- 229960003272 asparaginase Drugs 0.000 claims description 3
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 claims description 3
- 239000005667 attractant Substances 0.000 claims description 3
- 210000000941 bile Anatomy 0.000 claims description 3
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 claims description 3
- 229940077737 brain-derived neurotrophic factor Drugs 0.000 claims description 3
- 108090001015 cancer procoagulant Proteins 0.000 claims description 3
- 150000001720 carbohydrates Chemical class 0.000 claims description 3
- 235000014633 carbohydrates Nutrition 0.000 claims description 3
- 108010041776 cardiotrophin 1 Proteins 0.000 claims description 3
- 238000000423 cell based assay Methods 0.000 claims description 3
- 230000010261 cell growth Effects 0.000 claims description 3
- 239000013592 cell lysate Substances 0.000 claims description 3
- 230000031902 chemoattractant activity Effects 0.000 claims description 3
- 239000005482 chemotactic factor Substances 0.000 claims description 3
- 229940015047 chorionic gonadotropin Drugs 0.000 claims description 3
- 229960002376 chymotrypsin Drugs 0.000 claims description 3
- 229960001251 denosumab Drugs 0.000 claims description 3
- 238000004821 distillation Methods 0.000 claims description 3
- 229940073621 enbrel Drugs 0.000 claims description 3
- 230000002255 enzymatic effect Effects 0.000 claims description 3
- 239000002532 enzyme inhibitor Substances 0.000 claims description 3
- 229940125532 enzyme inhibitor Drugs 0.000 claims description 3
- 229940116977 epidermal growth factor Drugs 0.000 claims description 3
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 claims description 3
- 229960001123 epoprostenol Drugs 0.000 claims description 3
- 229940011871 estrogen Drugs 0.000 claims description 3
- 239000000262 estrogen Substances 0.000 claims description 3
- 229960000403 etanercept Drugs 0.000 claims description 3
- 229940012444 factor xiii Drugs 0.000 claims description 3
- 229940012952 fibrinogen Drugs 0.000 claims description 3
- 108090000047 fibroblast growth factor 13 Proteins 0.000 claims description 3
- 229940098448 fibroblast growth factor 7 Drugs 0.000 claims description 3
- 238000007478 fluorogenic assay Methods 0.000 claims description 3
- 229940028334 follicle stimulating hormone Drugs 0.000 claims description 3
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 claims description 3
- 235000019410 glycyrrhizin Nutrition 0.000 claims description 3
- 108010052188 hepatoma-derived growth factor Proteins 0.000 claims description 3
- 229940048921 humira Drugs 0.000 claims description 3
- 238000000099 in vitro assay Methods 0.000 claims description 3
- 238000005462 in vivo assay Methods 0.000 claims description 3
- 230000002779 inactivation Effects 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- 102000028416 insulin-like growth factor binding Human genes 0.000 claims description 3
- 108091022911 insulin-like growth factor binding Proteins 0.000 claims description 3
- 102000006495 integrins Human genes 0.000 claims description 3
- 108010044426 integrins Proteins 0.000 claims description 3
- 230000002452 interceptive effect Effects 0.000 claims description 3
- 102000004114 interleukin 20 Human genes 0.000 claims description 3
- 108090000681 interleukin 20 Proteins 0.000 claims description 3
- 108010074108 interleukin-21 Proteins 0.000 claims description 3
- 108010074109 interleukin-22 Proteins 0.000 claims description 3
- 108090000237 interleukin-24 Proteins 0.000 claims description 3
- 229940010675 intramuscular immunoglobulin Drugs 0.000 claims description 3
- 238000001990 intravenous administration Methods 0.000 claims description 3
- 229940039781 leptin Drugs 0.000 claims description 3
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 claims description 3
- 210000004185 liver Anatomy 0.000 claims description 3
- 210000004072 lung Anatomy 0.000 claims description 3
- 229940053128 nerve growth factor Drugs 0.000 claims description 3
- 239000002581 neurotoxin Substances 0.000 claims description 3
- 231100000618 neurotoxin Toxicity 0.000 claims description 3
- 229940032018 neurotrophin 3 Drugs 0.000 claims description 3
- 229940097998 neurotrophin 4 Drugs 0.000 claims description 3
- 230000007935 neutral effect Effects 0.000 claims description 3
- 229940111202 pepsin Drugs 0.000 claims description 3
- 229940012957 plasmin Drugs 0.000 claims description 3
- 108010000685 platelet-derived growth factor AB Proteins 0.000 claims description 3
- 230000037048 polymerization activity Effects 0.000 claims description 3
- 229940097325 prolactin Drugs 0.000 claims description 3
- 229940092597 prolia Drugs 0.000 claims description 3
- 210000003296 saliva Anatomy 0.000 claims description 3
- 210000000582 semen Anatomy 0.000 claims description 3
- 239000012581 transferrin Substances 0.000 claims description 3
- 229940072041 transforming growth factor beta 2 Drugs 0.000 claims description 3
- 239000012588 trypsin Substances 0.000 claims description 3
- 239000002753 trypsin inhibitor Substances 0.000 claims description 3
- 102000003390 tumor necrosis factor Human genes 0.000 claims description 3
- 210000002700 urine Anatomy 0.000 claims description 3
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 claims description 3
- 108010005774 beta-Galactosidase Proteins 0.000 claims description 2
- 239000000287 crude extract Substances 0.000 claims description 2
- 239000000284 extract Substances 0.000 claims description 2
- 238000012205 qualitative assay Methods 0.000 claims description 2
- 238000012207 quantitative assay Methods 0.000 claims description 2
- 108010054265 Factor VIIa Proteins 0.000 claims 7
- 229940012414 factor viia Drugs 0.000 claims 7
- 108010029144 Factor IIa Proteins 0.000 claims 6
- 108090000056 Complement factor B Proteins 0.000 claims 2
- 102000003712 Complement factor B Human genes 0.000 claims 2
- 108010047761 Interferon-alpha Proteins 0.000 claims 2
- 102000006992 Interferon-alpha Human genes 0.000 claims 2
- 102100039037 Vascular endothelial growth factor A Human genes 0.000 claims 2
- 102000003801 alpha-2-Antiplasmin Human genes 0.000 claims 2
- 108090000183 alpha-2-Antiplasmin Proteins 0.000 claims 2
- 230000010437 erythropoiesis Effects 0.000 claims 2
- 230000002519 immonomodulatory effect Effects 0.000 claims 2
- 238000007790 scraping Methods 0.000 claims 2
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 claims 1
- 102100036664 Adenosine deaminase Human genes 0.000 claims 1
- 102100022524 Alpha-1-antichymotrypsin Human genes 0.000 claims 1
- 108090000668 Annexin A2 Proteins 0.000 claims 1
- 102100034613 Annexin A2 Human genes 0.000 claims 1
- 108090000669 Annexin A4 Proteins 0.000 claims 1
- 102100034612 Annexin A4 Human genes 0.000 claims 1
- 102100034278 Annexin A6 Human genes 0.000 claims 1
- 108090000656 Annexin A6 Proteins 0.000 claims 1
- 108010005939 Ciliary Neurotrophic Factor Proteins 0.000 claims 1
- 108010000063 Ciliary Neurotrophic Factor Receptor Proteins 0.000 claims 1
- 102100031614 Ciliary neurotrophic factor Human genes 0.000 claims 1
- 102100031615 Ciliary neurotrophic factor receptor subunit alpha Human genes 0.000 claims 1
- 108700040183 Complement C1 Inhibitor Proteins 0.000 claims 1
- 102000055157 Complement C1 Inhibitor Human genes 0.000 claims 1
- 206010011224 Cough Diseases 0.000 claims 1
- 108010071241 Factor XIIa Proteins 0.000 claims 1
- 102100028417 Fibroblast growth factor 12 Human genes 0.000 claims 1
- 102100035290 Fibroblast growth factor 13 Human genes 0.000 claims 1
- 102100037850 Interferon gamma Human genes 0.000 claims 1
- 108010074328 Interferon-gamma Proteins 0.000 claims 1
- 108010064785 Phospholipases Proteins 0.000 claims 1
- 102000015439 Phospholipases Human genes 0.000 claims 1
- 102100035194 Placenta growth factor Human genes 0.000 claims 1
- 102100033237 Pro-epidermal growth factor Human genes 0.000 claims 1
- 101710179016 Protein gamma Proteins 0.000 claims 1
- 108010019674 Proto-Oncogene Proteins c-sis Proteins 0.000 claims 1
- 102100034195 Thrombopoietin Human genes 0.000 claims 1
- 108060008683 Tumor Necrosis Factor Receptor Proteins 0.000 claims 1
- 206010054094 Tumour necrosis Diseases 0.000 claims 1
- 230000003213 activating effect Effects 0.000 claims 1
- 108010091628 alpha 1-Antichymotrypsin Proteins 0.000 claims 1
- 102000005840 alpha-Galactosidase Human genes 0.000 claims 1
- 108010030291 alpha-Galactosidase Proteins 0.000 claims 1
- 102000005936 beta-Galactosidase Human genes 0.000 claims 1
- 210000001072 colon Anatomy 0.000 claims 1
- 230000009089 cytolysis Effects 0.000 claims 1
- 210000003714 granulocyte Anatomy 0.000 claims 1
- 230000002607 hemopoietic effect Effects 0.000 claims 1
- 239000003607 modifier Substances 0.000 claims 1
- 230000004936 stimulating effect Effects 0.000 claims 1
- 102000003298 tumor necrosis factor receptor Human genes 0.000 claims 1
- 238000011088 calibration curve Methods 0.000 description 60
- 241000282414 Homo sapiens Species 0.000 description 36
- 239000002953 phosphate buffered saline Substances 0.000 description 34
- 231100000673 dose–response relationship Toxicity 0.000 description 26
- 235000018102 proteins Nutrition 0.000 description 26
- 239000011534 wash buffer Substances 0.000 description 26
- 239000000872 buffer Substances 0.000 description 25
- 238000011534 incubation Methods 0.000 description 22
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 21
- 239000013024 dilution buffer Substances 0.000 description 20
- 101150041393 rsd gene Proteins 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- 102000008100 Human Serum Albumin Human genes 0.000 description 18
- 108091006905 Human Serum Albumin Proteins 0.000 description 18
- 239000007790 solid phase Substances 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 241000700159 Rattus Species 0.000 description 15
- 230000002950 deficient Effects 0.000 description 15
- 239000000463 material Substances 0.000 description 15
- 239000000758 substrate Substances 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- 238000011084 recovery Methods 0.000 description 14
- 230000000670 limiting effect Effects 0.000 description 13
- 241001465754 Metazoa Species 0.000 description 12
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 12
- 230000035602 clotting Effects 0.000 description 12
- 230000014509 gene expression Effects 0.000 description 12
- 238000000581 reactive spray deposition Methods 0.000 description 12
- 235000001014 amino acid Nutrition 0.000 description 11
- 150000001413 amino acids Chemical class 0.000 description 11
- 235000020183 skimmed milk Nutrition 0.000 description 11
- 238000005406 washing Methods 0.000 description 10
- 238000011002 quantification Methods 0.000 description 9
- 206010053567 Coagulopathies Diseases 0.000 description 8
- 229910019142 PO4 Inorganic materials 0.000 description 8
- 229920001213 Polysorbate 20 Polymers 0.000 description 8
- 239000004372 Polyvinyl alcohol Substances 0.000 description 8
- 238000005259 measurement Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000010452 phosphate Substances 0.000 description 8
- 229920000765 poly(2-oxazolines) Polymers 0.000 description 8
- 229920001515 polyalkylene glycol Polymers 0.000 description 8
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 8
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 8
- 229920001451 polypropylene glycol Polymers 0.000 description 8
- 229920002451 polyvinyl alcohol Polymers 0.000 description 8
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 8
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 8
- 241000283973 Oryctolagus cuniculus Species 0.000 description 7
- 238000013459 approach Methods 0.000 description 7
- 230000023555 blood coagulation Effects 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 230000000875 corresponding effect Effects 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 238000011067 equilibration Methods 0.000 description 7
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 230000004044 response Effects 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 6
- 241000238631 Hexapoda Species 0.000 description 6
- 241000699666 Mus <mouse, genus> Species 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 238000007820 coagulation assay Methods 0.000 description 6
- 229930004094 glycosylphosphatidylinositol Natural products 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 6
- 102000029947 transforming growth factor beta binding proteins Human genes 0.000 description 6
- 108091014793 transforming growth factor beta binding proteins Proteins 0.000 description 6
- 229920002307 Dextran Polymers 0.000 description 5
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 5
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 description 5
- 238000004113 cell culture Methods 0.000 description 5
- 230000006329 citrullination Effects 0.000 description 5
- 230000005291 magnetic effect Effects 0.000 description 5
- 238000010369 molecular cloning Methods 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 5
- OJISWRZIEWCUBN-QIRCYJPOSA-N (E,E,E)-geranylgeraniol Chemical group CC(C)=CCC\C(C)=C\CC\C(C)=C\CC\C(C)=C\CO OJISWRZIEWCUBN-QIRCYJPOSA-N 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- 229920001661 Chitosan Polymers 0.000 description 4
- 102000003666 Placenta Growth Factor Human genes 0.000 description 4
- 102000046299 Transforming Growth Factor beta1 Human genes 0.000 description 4
- 101800002279 Transforming growth factor beta-1 Proteins 0.000 description 4
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 229940031675 advate Drugs 0.000 description 4
- 230000000903 blocking effect Effects 0.000 description 4
- 239000008366 buffered solution Substances 0.000 description 4
- 125000000837 carbohydrate group Chemical group 0.000 description 4
- 230000001886 ciliary effect Effects 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- 238000001378 electrochemiluminescence detection Methods 0.000 description 4
- 239000013604 expression vector Substances 0.000 description 4
- 238000000684 flow cytometry Methods 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- QRMZSPFSDQBLIX-UHFFFAOYSA-N homovanillic acid Chemical compound COC1=CC(CC(O)=O)=CC=C1O QRMZSPFSDQBLIX-UHFFFAOYSA-N 0.000 description 4
- 239000002955 immunomodulating agent Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 210000004498 neuroglial cell Anatomy 0.000 description 4
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 4
- 229920002627 poly(phosphazenes) Polymers 0.000 description 4
- 229920005646 polycarboxylate Polymers 0.000 description 4
- 229940099456 transforming growth factor beta 1 Drugs 0.000 description 4
- 238000010200 validation analysis Methods 0.000 description 4
- 239000013598 vector Substances 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 241000283073 Equus caballus Species 0.000 description 3
- SQVRNKJHWKZAKO-PFQGKNLYSA-N N-acetyl-beta-neuraminic acid Chemical compound CC(=O)N[C@@H]1[C@@H](O)C[C@@](O)(C(O)=O)O[C@H]1[C@H](O)[C@H](O)CO SQVRNKJHWKZAKO-PFQGKNLYSA-N 0.000 description 3
- 108010069196 Neural Cell Adhesion Molecules Proteins 0.000 description 3
- 102100027347 Neural cell adhesion molecule 1 Human genes 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000000539 amino acid group Chemical group 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 239000003173 antianemic agent Substances 0.000 description 3
- SQVRNKJHWKZAKO-UHFFFAOYSA-N beta-N-Acetyl-D-neuraminic acid Natural products CC(=O)NC1C(O)CC(O)(C(O)=O)OC1C(O)C(O)CO SQVRNKJHWKZAKO-UHFFFAOYSA-N 0.000 description 3
- 238000004638 bioanalytical method Methods 0.000 description 3
- GLNDAGDHSLMOKX-UHFFFAOYSA-N coumarin 120 Chemical compound C1=C(N)C=CC2=C1OC(=O)C=C2C GLNDAGDHSLMOKX-UHFFFAOYSA-N 0.000 description 3
- 238000007865 diluting Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 229940125367 erythropoiesis stimulating agent Drugs 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 230000013595 glycosylation Effects 0.000 description 3
- IZWSFJTYBVKZNK-UHFFFAOYSA-N lauryl sulfobetaine Chemical compound CCCCCCCCCCCC[N+](C)(C)CCCS([O-])(=O)=O IZWSFJTYBVKZNK-UHFFFAOYSA-N 0.000 description 3
- 210000004962 mammalian cell Anatomy 0.000 description 3
- 239000013642 negative control Substances 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 241000894007 species Species 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- CRDAMVZIKSXKFV-YFVJMOTDSA-N (2-trans,6-trans)-farnesol Chemical group CC(C)=CCC\C(C)=C\CC\C(C)=C\CO CRDAMVZIKSXKFV-YFVJMOTDSA-N 0.000 description 2
- 239000000260 (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol Substances 0.000 description 2
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical group CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 2
- IHPYMWDTONKSCO-UHFFFAOYSA-N 2,2'-piperazine-1,4-diylbisethanesulfonic acid Chemical compound OS(=O)(=O)CCN1CCN(CCS(O)(=O)=O)CC1 IHPYMWDTONKSCO-UHFFFAOYSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- DCPFJUYTSUMUFH-UHFFFAOYSA-N 2-aminoethanol;2,3-dihydroxypropyl dihydrogen phosphate Chemical group NCCO.OCC(O)COP(O)(O)=O DCPFJUYTSUMUFH-UHFFFAOYSA-N 0.000 description 2
- ZTOBILYWTYHOJB-WBCGDKOGSA-N 3',6'-bis[[(2s,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]spiro[2-benzofuran-3,9'-xanthene]-1-one Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OC1=CC=C2C3(C4=CC=CC=C4C(=O)O3)C3=CC=C(O[C@H]4[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O4)O)C=C3OC2=C1 ZTOBILYWTYHOJB-WBCGDKOGSA-N 0.000 description 2
- DVLFYONBTKHTER-UHFFFAOYSA-N 3-(N-morpholino)propanesulfonic acid Chemical compound OS(=O)(=O)CCCN1CCOCC1 DVLFYONBTKHTER-UHFFFAOYSA-N 0.000 description 2
- INEWUCPYEUEQTN-UHFFFAOYSA-N 3-(cyclohexylamino)-2-hydroxy-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(O)CNC1CCCCC1 INEWUCPYEUEQTN-UHFFFAOYSA-N 0.000 description 2
- GUQQBLRVXOUDTN-XOHPMCGNSA-N 3-[dimethyl-[3-[[(4r)-4-[(3r,5s,7r,8r,9s,10s,12s,13r,14s,17r)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]propyl]azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCCC[N+](C)(C)CC(O)CS([O-])(=O)=O)C)[C@@]2(C)[C@@H](O)C1 GUQQBLRVXOUDTN-XOHPMCGNSA-N 0.000 description 2
- 125000001572 5'-adenylyl group Chemical group C=12N=C([H])N=C(N([H])[H])C=1N=C([H])N2[C@@]1([H])[C@@](O[H])([H])[C@@](O[H])([H])[C@](C(OP(=O)(O[H])[*])([H])[H])([H])O1 0.000 description 2
- KZZWQCKYLNIOBT-UHFFFAOYSA-N 5-amino-2-nitrobenzoic acid Chemical compound NC1=CC=C([N+]([O-])=O)C(C(O)=O)=C1 KZZWQCKYLNIOBT-UHFFFAOYSA-N 0.000 description 2
- SQDAZGGFXASXDW-UHFFFAOYSA-N 5-bromo-2-(trifluoromethoxy)pyridine Chemical group FC(F)(F)OC1=CC=C(Br)C=N1 SQDAZGGFXASXDW-UHFFFAOYSA-N 0.000 description 2
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 2
- AKASINKCIWHQEP-UHFFFAOYSA-N 7-amino-4-methoxychromen-2-one Chemical compound C1=C(N)C=CC2=C1OC(=O)C=C2OC AKASINKCIWHQEP-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 102000055025 Adenosine deaminases Human genes 0.000 description 2
- 108091023037 Aptamer Proteins 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 108010081589 Becaplermin Proteins 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 241000282693 Cercopithecidae Species 0.000 description 2
- 229920001287 Chondroitin sulfate Polymers 0.000 description 2
- 102400001368 Epidermal growth factor Human genes 0.000 description 2
- 102000004864 Fibroblast growth factor 10 Human genes 0.000 description 2
- 108090001047 Fibroblast growth factor 10 Proteins 0.000 description 2
- 102000014252 Fibroblast growth factor 11 Human genes 0.000 description 2
- 108050003237 Fibroblast growth factor 11 Proteins 0.000 description 2
- 102000014250 Fibroblast growth factor 12 Human genes 0.000 description 2
- 102000003957 Fibroblast growth factor 9 Human genes 0.000 description 2
- 108090000367 Fibroblast growth factor 9 Proteins 0.000 description 2
- 108700028146 Genetic Enhancer Elements Proteins 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 208000031220 Hemophilia Diseases 0.000 description 2
- 208000009292 Hemophilia A Diseases 0.000 description 2
- 230000006133 ISGylation Effects 0.000 description 2
- 108010021625 Immunoglobulin Fragments Proteins 0.000 description 2
- 102000008394 Immunoglobulin Fragments Human genes 0.000 description 2
- 102000017727 Immunoglobulin Variable Region Human genes 0.000 description 2
- 108010067060 Immunoglobulin Variable Region Proteins 0.000 description 2
- 101800003050 Interleukin-16 Proteins 0.000 description 2
- 108090000978 Interleukin-4 Proteins 0.000 description 2
- 102000004388 Interleukin-4 Human genes 0.000 description 2
- 241000282567 Macaca fascicularis Species 0.000 description 2
- 241000829100 Macaca mulatta polyomavirus 1 Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241001529936 Murinae Species 0.000 description 2
- 101100537555 Mus musculus Tnfrsf9 gene Proteins 0.000 description 2
- SEQKRHFRPICQDD-UHFFFAOYSA-N N-tris(hydroxymethyl)methylglycine Chemical compound OCC(CO)(CO)[NH2+]CC([O-])=O SEQKRHFRPICQDD-UHFFFAOYSA-N 0.000 description 2
- 108091008606 PDGF receptors Proteins 0.000 description 2
- 108090000113 Plasma Kallikrein Proteins 0.000 description 2
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 2
- 102100040990 Platelet-derived growth factor subunit B Human genes 0.000 description 2
- 101710103494 Platelet-derived growth factor subunit B Proteins 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 206010036790 Productive cough Diseases 0.000 description 2
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 2
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 2
- 101500026849 Rattus norvegicus C3a anaphylatoxin Proteins 0.000 description 2
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 2
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 2
- 230000006295 S-nitrosylation Effects 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 108090000097 Transforming growth factor beta-3 Proteins 0.000 description 2
- 102000056172 Transforming growth factor beta-3 Human genes 0.000 description 2
- 102100040247 Tumor necrosis factor Human genes 0.000 description 2
- 101710187830 Tumor necrosis factor receptor superfamily member 1B Proteins 0.000 description 2
- 102100033733 Tumor necrosis factor receptor superfamily member 1B Human genes 0.000 description 2
- 102000044159 Ubiquitin Human genes 0.000 description 2
- 108090000848 Ubiquitin Proteins 0.000 description 2
- 102000004504 Urokinase Plasminogen Activator Receptors Human genes 0.000 description 2
- 108010042352 Urokinase Plasminogen Activator Receptors Proteins 0.000 description 2
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Chemical compound CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 239000012445 acidic reagent Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000006154 adenylylation Effects 0.000 description 2
- 238000001042 affinity chromatography Methods 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical group OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- AVJBPWGFOQAPRH-FWMKGIEWSA-N alpha-L-IdopA-(1->3)-beta-D-GalpNAc4S Chemical group CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@H](OS(O)(=O)=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](C(O)=O)O1 AVJBPWGFOQAPRH-FWMKGIEWSA-N 0.000 description 2
- 230000004075 alteration Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000003194 amino acid receptor blocking agent Substances 0.000 description 2
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 description 2
- 230000002356 anti-selenium Effects 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 230000010516 arginylation Effects 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000006287 biotinylation Effects 0.000 description 2
- 238000007413 biotinylation Methods 0.000 description 2
- 229940019700 blood coagulation factors Drugs 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000006242 butyrylation Effects 0.000 description 2
- 238000010514 butyrylation reaction Methods 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 230000021235 carbamoylation Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 229940059329 chondroitin sulfate Drugs 0.000 description 2
- 239000003541 chymotrypsin inhibitor Substances 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 238000007398 colorimetric assay Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000002596 correlated effect Effects 0.000 description 2
- 230000006240 deamidation Effects 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- DEKPYXUDJRABNK-UHFFFAOYSA-N dimethyl 5-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(N)=CC(C(=O)OC)=C1 DEKPYXUDJRABNK-UHFFFAOYSA-N 0.000 description 2
- FOOBQHKMWYGHCE-UHFFFAOYSA-O diphthamide group Chemical group NC(CC=1N=C(NC1)CCC(C(N)=O)[N+](C)(C)C)C(=O)O FOOBQHKMWYGHCE-UHFFFAOYSA-O 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000006330 eliminylation Effects 0.000 description 2
- 239000011536 extraction buffer Substances 0.000 description 2
- 229940043259 farnesol Drugs 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 102000013361 fetuin Human genes 0.000 description 2
- 108060002885 fetuin Proteins 0.000 description 2
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 2
- 102000003684 fibroblast growth factor 13 Human genes 0.000 description 2
- 125000004072 flavinyl group Chemical group 0.000 description 2
- 230000009558 flavinylation Effects 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 230000006251 gamma-carboxylation Effects 0.000 description 2
- 238000002523 gelfiltration Methods 0.000 description 2
- 230000002068 genetic effect Effects 0.000 description 2
- XWRJRXQNOHXIOX-UHFFFAOYSA-N geranylgeraniol Natural products CC(C)=CCCC(C)=CCOCC=C(C)CCC=C(C)C XWRJRXQNOHXIOX-UHFFFAOYSA-N 0.000 description 2
- OJISWRZIEWCUBN-UHFFFAOYSA-N geranylnerol Natural products CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO OJISWRZIEWCUBN-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000006377 glucose transport Effects 0.000 description 2
- 230000035430 glutathionylation Effects 0.000 description 2
- 150000004676 glycans Polymers 0.000 description 2
- 230000036252 glycation Effects 0.000 description 2
- AWUCVROLDVIAJX-UHFFFAOYSA-N glycerol 1-phosphate Chemical compound OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 2
- 125000003147 glycosyl group Chemical group 0.000 description 2
- 238000006206 glycosylation reaction Methods 0.000 description 2
- 230000006095 glypiation Effects 0.000 description 2
- 150000003278 haem Chemical class 0.000 description 2
- 230000003394 haemopoietic effect Effects 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical group CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229920002674 hyaluronan Polymers 0.000 description 2
- 229960003160 hyaluronic acid Drugs 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000033444 hydroxylation Effects 0.000 description 2
- 238000005805 hydroxylation reaction Methods 0.000 description 2
- BZUIJMCJNWUGKQ-BDAKNGLRSA-N hypusine Chemical group NCC[C@@H](O)CNCCCC[C@H](N)C(O)=O BZUIJMCJNWUGKQ-BDAKNGLRSA-N 0.000 description 2
- 230000006164 hypusine formation Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000026045 iodination Effects 0.000 description 2
- 238000006192 iodination reaction Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 230000006122 isoprenylation Effects 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 125000003473 lipid group Chemical group 0.000 description 2
- AGBQKNBQESQNJD-UHFFFAOYSA-N lipoic acid Chemical group OC(=O)CCCCC1CCSS1 AGBQKNBQESQNJD-UHFFFAOYSA-N 0.000 description 2
- 230000006144 lipoylation Effects 0.000 description 2
- 230000002934 lysing effect Effects 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 125000000346 malonyl group Chemical group C(CC(=O)*)(=O)* 0.000 description 2
- 230000017538 malonylation Effects 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229940105132 myristate Drugs 0.000 description 2
- 230000007498 myristoylation Effects 0.000 description 2
- 229920005615 natural polymer Polymers 0.000 description 2
- 230000009527 neddylation Effects 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 108020004707 nucleic acids Proteins 0.000 description 2
- 102000039446 nucleic acids Human genes 0.000 description 2
- 150000007523 nucleic acids Chemical class 0.000 description 2
- 239000012011 nucleophilic catalyst Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 230000026792 palmitoylation Effects 0.000 description 2
- 230000005298 paramagnetic effect Effects 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 230000005261 phosphopantetheinylation Effects 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 238000005498 polishing Methods 0.000 description 2
- 230000008488 polyadenylation Effects 0.000 description 2
- 230000001884 polyglutamylation Effects 0.000 description 2
- 230000019474 polyglycylation Effects 0.000 description 2
- 108091033319 polynucleotide Proteins 0.000 description 2
- 102000040430 polynucleotide Human genes 0.000 description 2
- 239000002157 polynucleotide Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920001282 polysaccharide Polymers 0.000 description 2
- 239000005017 polysaccharide Substances 0.000 description 2
- 150000004804 polysaccharides Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- 230000004481 post-translational protein modification Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 230000013823 prenylation Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000009465 prokaryotic expression Effects 0.000 description 2
- 230000006289 propionylation Effects 0.000 description 2
- 238000010515 propionylation reaction Methods 0.000 description 2
- 230000017614 pupylation Effects 0.000 description 2
- 229940043131 pyroglutamate Drugs 0.000 description 2
- 238000011158 quantitative evaluation Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000010076 replication Effects 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000003748 selenium group Chemical group *[Se]* 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 210000003802 sputum Anatomy 0.000 description 2
- 208000024794 sputum Diseases 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000002730 succinyl group Chemical group C(CCC(=O)*)(=O)* 0.000 description 2
- 230000035322 succinylation Effects 0.000 description 2
- 238000010613 succinylation reaction Methods 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 230000019635 sulfation Effects 0.000 description 2
- 238000005670 sulfation reaction Methods 0.000 description 2
- 230000010741 sumoylation Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229920001059 synthetic polymer Polymers 0.000 description 2
- 150000003505 terpenes Chemical group 0.000 description 2
- TUNFSRHWOTWDNC-UHFFFAOYSA-N tetradecanoic acid Chemical group CCCCCCCCCCCCCC(O)=O TUNFSRHWOTWDNC-UHFFFAOYSA-N 0.000 description 2
- 230000002103 transcriptional effect Effects 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 108010033898 transforming growth factor beta1.2 Proteins 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 230000034512 ubiquitination Effects 0.000 description 2
- 238000010798 ubiquitination Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PGOHTUIFYSHAQG-LJSDBVFPSA-N (2S)-6-amino-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S,3R)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-carbamimidamidopentanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-carbamimidamidopentanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-carbamimidamidopentanoyl]amino]-5-oxopentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoyl]amino]-5-carbamimidamidopentanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-4-oxobutanoyl]amino]-5-carbamimidamidopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid Chemical compound CSCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(O)=O PGOHTUIFYSHAQG-LJSDBVFPSA-N 0.000 description 1
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 1
- UZQHHAMYEWJJOL-UHFFFAOYSA-N 1-(cyclohexylamino)-2-hydroxypropane-1-sulfonic acid Chemical compound CC(O)C(S(O)(=O)=O)NC1CCCCC1 UZQHHAMYEWJJOL-UHFFFAOYSA-N 0.000 description 1
- NHBKXEKEPDILRR-UHFFFAOYSA-N 2,3-bis(butanoylsulfanyl)propyl butanoate Chemical compound CCCC(=O)OCC(SC(=O)CCC)CSC(=O)CCC NHBKXEKEPDILRR-UHFFFAOYSA-N 0.000 description 1
- SXGZJKUKBWWHRA-UHFFFAOYSA-N 2-(N-morpholiniumyl)ethanesulfonate Chemical compound [O-]S(=O)(=O)CC[NH+]1CCOCC1 SXGZJKUKBWWHRA-UHFFFAOYSA-N 0.000 description 1
- AJTVSSFTXWNIRG-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanesulfonic acid Chemical compound OCC[NH+](CCO)CCS([O-])(=O)=O AJTVSSFTXWNIRG-UHFFFAOYSA-N 0.000 description 1
- 229940058020 2-amino-2-methyl-1-propanol Drugs 0.000 description 1
- LVQFQZZGTZFUNF-UHFFFAOYSA-N 2-hydroxy-3-[4-(2-hydroxy-3-sulfonatopropyl)piperazine-1,4-diium-1-yl]propane-1-sulfonate Chemical compound OS(=O)(=O)CC(O)CN1CCN(CC(O)CS(O)(=O)=O)CC1 LVQFQZZGTZFUNF-UHFFFAOYSA-N 0.000 description 1
- UJVBZCCNLAAMOV-UHFFFAOYSA-N 2h-1,2-benzothiazine Chemical class C1=CC=C2C=CNSC2=C1 UJVBZCCNLAAMOV-UHFFFAOYSA-N 0.000 description 1
- NUFBIAUZAMHTSP-UHFFFAOYSA-N 3-(n-morpholino)-2-hydroxypropanesulfonic acid Chemical compound OS(=O)(=O)CC(O)CN1CCOCC1 NUFBIAUZAMHTSP-UHFFFAOYSA-N 0.000 description 1
- UMCMPZBLKLEWAF-BCTGSCMUSA-N 3-[(3-cholamidopropyl)dimethylammonio]propane-1-sulfonate Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)C)[C@@]2(C)[C@@H](O)C1 UMCMPZBLKLEWAF-BCTGSCMUSA-N 0.000 description 1
- RZQXOGQSPBYUKH-UHFFFAOYSA-N 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound OCC(CO)(CO)NCC(O)CS(O)(=O)=O RZQXOGQSPBYUKH-UHFFFAOYSA-N 0.000 description 1
- XCBLFURAFHFFJF-UHFFFAOYSA-N 3-[bis(2-hydroxyethyl)azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound OCCN(CCO)CC(O)CS(O)(=O)=O XCBLFURAFHFFJF-UHFFFAOYSA-N 0.000 description 1
- PSGQCCSGKGJLRL-UHFFFAOYSA-N 4-methyl-2h-chromen-2-one Chemical group C1=CC=CC2=C1OC(=O)C=C2C PSGQCCSGKGJLRL-UHFFFAOYSA-N 0.000 description 1
- 102100029457 Adenine phosphoribosyltransferase Human genes 0.000 description 1
- 108010024223 Adenine phosphoribosyltransferase Proteins 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- 102100036826 Aldehyde oxidase Human genes 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 101100107610 Arabidopsis thaliana ABCF4 gene Proteins 0.000 description 1
- 101100437118 Arabidopsis thaliana AUG1 gene Proteins 0.000 description 1
- 102100026189 Beta-galactosidase Human genes 0.000 description 1
- 101710117542 Botulinum neurotoxin type A Proteins 0.000 description 1
- 101100454808 Caenorhabditis elegans lgg-2 gene Proteins 0.000 description 1
- 101100217502 Caenorhabditis elegans lgg-3 gene Proteins 0.000 description 1
- 102100031077 Calcineurin B homologous protein 3 Human genes 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 102000011632 Caseins Human genes 0.000 description 1
- 108010076119 Caseins Proteins 0.000 description 1
- 101100007328 Cocos nucifera COS-1 gene Proteins 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 244000303965 Cyamopsis psoralioides Species 0.000 description 1
- PJWWRFATQTVXHA-UHFFFAOYSA-N Cyclohexylaminopropanesulfonic acid Chemical compound OS(=O)(=O)CCCNC1CCCCC1 PJWWRFATQTVXHA-UHFFFAOYSA-N 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- 229920000045 Dermatan sulfate Polymers 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 241000701832 Enterobacteria phage T3 Species 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 108010061932 Factor VIIIa Proteins 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 101150094690 GAL1 gene Proteins 0.000 description 1
- 102100028501 Galanin peptides Human genes 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 239000006173 Good's buffer Substances 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- OWXMKDGYPWMGEB-UHFFFAOYSA-N HEPPS Chemical compound OCCN1CCN(CCCS(O)(=O)=O)CC1 OWXMKDGYPWMGEB-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000928314 Homo sapiens Aldehyde oxidase Proteins 0.000 description 1
- 101000777270 Homo sapiens Calcineurin B homologous protein 3 Proteins 0.000 description 1
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 1
- 101100121078 Homo sapiens GAL gene Proteins 0.000 description 1
- 102000001706 Immunoglobulin Fab Fragments Human genes 0.000 description 1
- 108010054477 Immunoglobulin Fab Fragments Proteins 0.000 description 1
- 108010091135 Immunoglobulin Fc Fragments Proteins 0.000 description 1
- 102000018071 Immunoglobulin Fc Fragments Human genes 0.000 description 1
- ZAGRKAFMISFKIO-UHFFFAOYSA-N Isolysergic acid Natural products C1=CC(C2=CC(CN(C2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-UHFFFAOYSA-N 0.000 description 1
- 239000007836 KH2PO4 Substances 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- 102000008192 Lactoglobulins Human genes 0.000 description 1
- 108010060630 Lactoglobulins Proteins 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 239000007987 MES buffer Substances 0.000 description 1
- 239000007993 MOPS buffer Substances 0.000 description 1
- 101710141347 Major envelope glycoprotein Proteins 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000255908 Manduca sexta Species 0.000 description 1
- 101000969137 Mus musculus Metallothionein-1 Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FSVCELGFZIQNCK-UHFFFAOYSA-N N,N-bis(2-hydroxyethyl)glycine Chemical compound OCCN(CCO)CC(O)=O FSVCELGFZIQNCK-UHFFFAOYSA-N 0.000 description 1
- DBXNUXBLKRLWFA-UHFFFAOYSA-N N-(2-acetamido)-2-aminoethanesulfonic acid Chemical compound NC(=O)CNCCS(O)(=O)=O DBXNUXBLKRLWFA-UHFFFAOYSA-N 0.000 description 1
- YNLCVAQJIKOXER-UHFFFAOYSA-N N-[tris(hydroxymethyl)methyl]-3-aminopropanesulfonic acid Chemical compound OCC(CO)(CO)NCCCS(O)(=O)=O YNLCVAQJIKOXER-UHFFFAOYSA-N 0.000 description 1
- MKWKNSIESPFAQN-UHFFFAOYSA-N N-cyclohexyl-2-aminoethanesulfonic acid Chemical compound OS(=O)(=O)CCNC1CCCCC1 MKWKNSIESPFAQN-UHFFFAOYSA-N 0.000 description 1
- JOCBASBOOFNAJA-UHFFFAOYSA-N N-tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid Chemical compound OCC(CO)(CO)NCCS(O)(=O)=O JOCBASBOOFNAJA-UHFFFAOYSA-N 0.000 description 1
- 229930193140 Neomycin Natural products 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 108010038807 Oligopeptides Proteins 0.000 description 1
- 102000015636 Oligopeptides Human genes 0.000 description 1
- 108700026244 Open Reading Frames Proteins 0.000 description 1
- 239000007990 PIPES buffer Substances 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000288906 Primates Species 0.000 description 1
- QVDSEJDULKLHCG-UHFFFAOYSA-N Psilocybine Natural products C1=CC(OP(O)(O)=O)=C2C(CCN(C)C)=CNC2=C1 QVDSEJDULKLHCG-UHFFFAOYSA-N 0.000 description 1
- 101100068078 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) GCN4 gene Proteins 0.000 description 1
- 241000256251 Spodoptera frugiperda Species 0.000 description 1
- UZMAPBJVXOGOFT-UHFFFAOYSA-N Syringetin Natural products COC1=C(O)C(OC)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UZMAPBJVXOGOFT-UHFFFAOYSA-N 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- 102000006601 Thymidine Kinase Human genes 0.000 description 1
- 108020004440 Thymidine kinase Proteins 0.000 description 1
- 241000255993 Trichoplusia ni Species 0.000 description 1
- 239000007997 Tricine buffer Substances 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 239000005862 Whey Substances 0.000 description 1
- 102000007544 Whey Proteins Human genes 0.000 description 1
- 108010046377 Whey Proteins Proteins 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 229940008201 allegra Drugs 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 239000012491 analyte Substances 0.000 description 1
- 238000005571 anion exchange chromatography Methods 0.000 description 1
- 239000013584 assay control Substances 0.000 description 1
- 238000013096 assay test Methods 0.000 description 1
- 238000000376 autoradiography Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- NFIKTSWJXJTUBZ-ZEQRLZLVSA-N benzyl n-[2-[(2s)-2-[[(2s)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate Chemical compound C([C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC2=CC=3OC(=O)C=C(C=3C=C2)C)CCN1C(=O)CNC(=O)OCC1=CC=CC=C1 NFIKTSWJXJTUBZ-ZEQRLZLVSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000007998 bicine buffer Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000005277 cation exchange chromatography Methods 0.000 description 1
- CZTQZXZIADLWOZ-CRAIPNDOSA-N cefaloridine Chemical compound O=C([C@@H](NC(=O)CC=1SC=CC=1)[C@H]1SC2)N1C(C(=O)[O-])=C2C[N+]1=CC=CC=C1 CZTQZXZIADLWOZ-CRAIPNDOSA-N 0.000 description 1
- 229960003866 cefaloridine Drugs 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- 238000011098 chromatofocusing Methods 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003593 chromogenic compound Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 150000004775 coumarins Chemical class 0.000 description 1
- 230000009260 cross reactivity Effects 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 229940051593 dermatan sulfate Drugs 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000011026 diafiltration Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- KCFYHBSOLOXZIF-UHFFFAOYSA-N dihydrochrysin Natural products COC1=C(O)C(OC)=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2)=C1 KCFYHBSOLOXZIF-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000013210 evaluation model Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229960003592 fexofenadine Drugs 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 102000057593 human F8 Human genes 0.000 description 1
- 210000004408 hybridoma Anatomy 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 238000004191 hydrophobic interaction chromatography Methods 0.000 description 1
- 229910052588 hydroxylapatite Inorganic materials 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 230000003100 immobilizing effect Effects 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 238000003119 immunoblot Methods 0.000 description 1
- 238000001114 immunoprecipitation Methods 0.000 description 1
- 239000003547 immunosorbent Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 229960000318 kanamycin Drugs 0.000 description 1
- 229930027917 kanamycin Natural products 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- 229930182823 kanamycin A Natural products 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000000670 ligand binding assay Methods 0.000 description 1
- 238000012005 ligant binding assay Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 description 1
- 239000006249 magnetic particle Substances 0.000 description 1
- KJLLKLRVCJAFRY-UHFFFAOYSA-N mebutizide Chemical compound ClC1=C(S(N)(=O)=O)C=C2S(=O)(=O)NC(C(C)C(C)CC)NC2=C1 KJLLKLRVCJAFRY-UHFFFAOYSA-N 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000013206 minimal dilution Methods 0.000 description 1
- 238000001823 molecular biology technique Methods 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 229960004927 neomycin Drugs 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000010627 oxidative phosphorylation Effects 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- XYJRXVWERLGGKC-UHFFFAOYSA-D pentacalcium;hydroxide;triphosphate Chemical compound [OH-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O XYJRXVWERLGGKC-UHFFFAOYSA-D 0.000 description 1
- 125000001644 phenoxazinyl group Chemical class C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 238000003322 phosphorimaging Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 230000031915 positive regulation of coagulation Effects 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- QKTAAWLCLHMUTJ-UHFFFAOYSA-N psilocybin Chemical compound C1C=CC(OP(O)(O)=O)=C2C(CCN(C)C)=CN=C21 QKTAAWLCLHMUTJ-UHFFFAOYSA-N 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- HSSLDCABUXLXKM-UHFFFAOYSA-N resorufin Chemical compound C1=CC(=O)C=C2OC3=CC(O)=CC=C3N=C21 HSSLDCABUXLXKM-UHFFFAOYSA-N 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000012898 sample dilution Substances 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 238000003118 sandwich ELISA Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000001542 size-exclusion chromatography Methods 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- YCLWMUYXEGEIGD-UHFFFAOYSA-M sodium;2-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonate Chemical compound [Na+].OCCN1CCN(CC(O)CS([O-])(=O)=O)CC1 YCLWMUYXEGEIGD-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000002798 spectrophotometry method Methods 0.000 description 1
- 238000012421 spiking Methods 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 229960002180 tetracycline Drugs 0.000 description 1
- 229930101283 tetracycline Natural products 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000010474 transient expression Effects 0.000 description 1
- 241001430294 unidentified retrovirus Species 0.000 description 1
- 239000004474 valine Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000001262 western blot Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 235000021247 β-casein Nutrition 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N33/00—Investigating or analysing materials by specific methods not covered by groups G01N1/00 - G01N31/00
- G01N33/48—Biological material, e.g. blood, urine; Haemocytometers
- G01N33/50—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing
- G01N33/68—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing involving proteins, peptides or amino acids
- G01N33/6803—General methods of protein analysis not limited to specific proteins or families of proteins
- G01N33/6842—Proteomic analysis of subsets of protein mixtures with reduced complexity, e.g. membrane proteins, phosphoproteins, organelle proteins
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N33/00—Investigating or analysing materials by specific methods not covered by groups G01N1/00 - G01N31/00
- G01N33/48—Biological material, e.g. blood, urine; Haemocytometers
- G01N33/50—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing
- G01N33/68—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing involving proteins, peptides or amino acids
- G01N33/6854—Immunoglobulins
- G01N33/6857—Antibody fragments
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N2440/00—Post-translational modifications [PTMs] in chemical analysis of biological material
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Immunology (AREA)
- Molecular Biology (AREA)
- Chemical & Material Sciences (AREA)
- Biomedical Technology (AREA)
- Hematology (AREA)
- Urology & Nephrology (AREA)
- Physics & Mathematics (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Analytical Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Pathology (AREA)
- Biochemistry (AREA)
- Food Science & Technology (AREA)
- Microbiology (AREA)
- Bioinformatics & Computational Biology (AREA)
- Biophysics (AREA)
- Cell Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Biotechnology (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Veterinary Medicine (AREA)
- Endocrinology (AREA)
- Diabetes (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicinal Preparation (AREA)
- Enzymes And Modification Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201161487612P | 2011-05-18 | 2011-05-18 | |
| PCT/US2012/038704 WO2012159084A1 (en) | 2011-05-18 | 2012-05-18 | Modification-dependent activity assays |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK2710375T3 true DK2710375T3 (en) | 2019-04-29 |
Family
ID=46208807
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK12725954.7T DK2710375T3 (en) | 2011-05-18 | 2012-05-18 | MODIFICATION DEPENDENT ACTIVITY TESTS |
| DK19161002.1T DK3517956T3 (da) | 2011-05-18 | 2012-05-18 | Modifikationsafhængige aktivitetsassayer |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK19161002.1T DK3517956T3 (da) | 2011-05-18 | 2012-05-18 | Modifikationsafhængige aktivitetsassayer |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US8785139B2 (enExample) |
| EP (3) | EP3943939A1 (enExample) |
| JP (5) | JP6175426B2 (enExample) |
| AU (2) | AU2012255066B2 (enExample) |
| CA (1) | CA2836103C (enExample) |
| DK (2) | DK2710375T3 (enExample) |
| ES (2) | ES2720138T3 (enExample) |
| PL (2) | PL3517956T3 (enExample) |
| PT (2) | PT2710375T (enExample) |
| TR (1) | TR201904997T4 (enExample) |
| WO (1) | WO2012159084A1 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN102375055A (zh) * | 2010-08-19 | 2012-03-14 | 中国人民解放军军事医学科学院微生物流行病研究所 | 一种多重检测免疫层析芯片 |
| US10745737B2 (en) * | 2012-11-09 | 2020-08-18 | Children's Medical Center Corporation | Methods and reagents for glycoproteomics |
| CN103819907B (zh) * | 2014-03-10 | 2016-04-06 | 山东理工大学 | 一种用聚丙二醇与聚乙烯醇对聚肽膜亲水性进行改进的方法 |
| WO2015169602A1 (en) * | 2014-05-05 | 2015-11-12 | Noviosmart | Method for the serological diagnosis of rheumatoid arthritis. |
| CN104559207B (zh) * | 2015-01-05 | 2017-02-22 | 山东理工大学 | 一种聚氨基甲酸酯与聚丙烯酸改进聚肽膜亲水性与柔顺性的方法 |
| CN104559206B (zh) * | 2015-01-05 | 2017-02-22 | 山东理工大学 | 一种聚三亚甲基碳酸酯与聚丙烯酰胺改进聚肽膜亲水性与柔顺性的方法 |
| CN104448841B (zh) * | 2015-01-06 | 2016-08-31 | 山东理工大学 | 一种聚乳酸乙醇酸与聚丙烯酸改进聚肽膜亲水性与柔顺性的方法 |
| CN104448843B (zh) * | 2015-01-06 | 2016-10-05 | 山东理工大学 | 一种聚己内酯与聚丙烯酸改进聚肽膜亲水性与柔顺性的方法 |
| CN104448842B (zh) * | 2015-01-06 | 2016-08-31 | 山东理工大学 | 一种聚乳酸与聚丙烯酸改进聚肽膜亲水性与柔顺性的方法 |
| CN104559224B (zh) * | 2015-01-12 | 2017-02-22 | 山东理工大学 | 一种聚丙二醇与水性聚氨酯改进聚肽膜亲水性与柔顺性的方法 |
| CN104530722B (zh) * | 2015-01-12 | 2017-05-03 | 山东理工大学 | 一种聚乳酸乙醇酸与羧甲基壳聚糖改进聚肽膜亲水性与柔顺性的方法 |
| CN104479367B (zh) * | 2015-01-12 | 2016-08-31 | 山东理工大学 | 一种聚乳酸与水性聚氨酯改进聚肽膜亲水性与柔顺性的方法 |
| US9804170B2 (en) | 2015-02-09 | 2017-10-31 | Bristol-Myers Squibb Company | Antibodies to polyethylene glycol |
| JP6552286B2 (ja) * | 2015-06-05 | 2019-07-31 | 公立大学法人奈良県立医科大学 | 凝固第viii因子の複合体形成能に関する情報の取得方法および試薬キット |
| SG11202107497XA (en) | 2019-01-23 | 2021-08-30 | Regeneron Pharma | Treatment of ophthalmic conditions with angiopoietin-like 7 (angptl7) inhibitors |
| US11845989B2 (en) | 2019-01-23 | 2023-12-19 | Regeneron Pharmaceuticals, Inc. | Treatment of ophthalmic conditions with angiopoietin-like 7 (ANGPTL7) inhibitors |
| CN110118847B (zh) * | 2019-05-17 | 2021-08-10 | 重庆派金生物科技有限公司 | 确定多位点peg修饰蛋白质修饰位点的分析方法 |
| EP4298219A1 (en) | 2021-02-26 | 2024-01-03 | Regeneron Pharmaceuticals, Inc. | Treatment of inflammation with glucocorticoids and angiopoietin-like 7 (angptl7) inhibitors |
| WO2023021311A1 (en) * | 2021-08-20 | 2023-02-23 | Takeda Pharmaceutical Company Limited | Selective measurement of human factor viii |
| CA3244889A1 (en) | 2022-03-08 | 2023-09-14 | Equashield Medical Ltd | FLUID TRANSFER STATION IN A ROBOTIC PHARMACEUTICAL PREPARATION SYSTEM |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3244030A1 (de) | 1982-11-27 | 1984-05-30 | Behringwerke Ag, 3550 Marburg | Chromogene verbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| US5208148A (en) | 1990-12-07 | 1993-05-04 | Molecular Probes, Inc. | Lipophilic fluorescent glycosidase substrates |
| EP0603266B1 (en) | 1991-08-23 | 1999-05-12 | Molecular Probes, Inc. | Use of haloalkyl derivatives of reporter molecules to analyze metabolic activity in cells |
| US5576424A (en) | 1991-08-23 | 1996-11-19 | Molecular Probes, Inc. | Haloalkyl derivatives of reporter molecules used to analyze metabolic activity in cells |
| US5242805A (en) | 1991-08-23 | 1993-09-07 | Molecular Probes, Inc. | Long wavelength lipophilic fluorogenic glycosidase substrates |
| US5830912A (en) | 1996-11-15 | 1998-11-03 | Molecular Probes, Inc. | Derivatives of 6,8-difluoro-7-hydroxycoumarin |
| US5773236A (en) | 1997-04-25 | 1998-06-30 | Molecule Probes, Inc. | Assay for glutathiane transferase using polyhaloaryl-substituted reporter molecules |
| CN1688248A (zh) * | 2002-08-22 | 2005-10-26 | 贝克顿·迪金森公司 | 痴呆相关神经疾病的诊断方法 |
| US8133865B2 (en) | 2006-12-27 | 2012-03-13 | Nektar Therapeutics | von Willebrand factor- and factor VIII-polymer conjugates having a releasable linkage |
| US9333247B2 (en) * | 2007-07-03 | 2016-05-10 | Children's Hospital & Research Center At Oakland | Oligosialic acid derivatives, methods of manufacture, and immunological uses |
| ES2587742T3 (es) * | 2007-12-27 | 2016-10-26 | Baxalta GmbH | Métodos para diferenciar en una muestra proteína derivada de plasma de proteína recombinante |
| ES2515365T3 (es) * | 2007-12-27 | 2014-10-29 | Baxter International Inc. | Procedimiento y composiciones para detectar específicamente moléculas poliméricas fisiológicamente aceptables |
| BRPI0911266A2 (pt) * | 2008-04-03 | 2015-09-29 | Hoffmann La Roche | ensaio de fator de crescimento similar à insulina peguilado |
| CA2740904C (en) * | 2008-10-21 | 2019-01-15 | Baxter International Inc. | Methods for determining active ingredients in pro-drug peg protein conjugates with releasable peg reagents (in vitro de-pegylation) |
| US8642737B2 (en) | 2010-07-26 | 2014-02-04 | Baxter International Inc. | Nucleophilic catalysts for oxime linkage |
| EP3081233B1 (en) | 2009-07-27 | 2020-12-23 | Baxalta GmbH | Glycopolysialylation of proteins other than blood coagulation proteins |
| AU2010281453C1 (en) | 2009-07-27 | 2019-08-15 | Takeda Pharmaceutical Company Limited | Blood coagulation protein conjugates |
| GB2488532B (en) * | 2011-02-18 | 2013-06-05 | Sca Ipla Holdings Inc | Communication units and methods for control change notification in broadcast communication |
-
2012
- 2012-05-18 WO PCT/US2012/038704 patent/WO2012159084A1/en not_active Ceased
- 2012-05-18 ES ES12725954T patent/ES2720138T3/es active Active
- 2012-05-18 JP JP2014511600A patent/JP6175426B2/ja active Active
- 2012-05-18 TR TR2019/04997T patent/TR201904997T4/tr unknown
- 2012-05-18 PL PL19161002T patent/PL3517956T3/pl unknown
- 2012-05-18 PL PL12725954T patent/PL2710375T3/pl unknown
- 2012-05-18 AU AU2012255066A patent/AU2012255066B2/en active Active
- 2012-05-18 PT PT12725954T patent/PT2710375T/pt unknown
- 2012-05-18 CA CA2836103A patent/CA2836103C/en active Active
- 2012-05-18 EP EP21190282.0A patent/EP3943939A1/en active Pending
- 2012-05-18 US US13/475,634 patent/US8785139B2/en active Active
- 2012-05-18 EP EP19161002.1A patent/EP3517956B1/en active Active
- 2012-05-18 DK DK12725954.7T patent/DK2710375T3/en active
- 2012-05-18 ES ES19161002T patent/ES2893605T3/es active Active
- 2012-05-18 DK DK19161002.1T patent/DK3517956T3/da active
- 2012-05-18 PT PT191610021T patent/PT3517956T/pt unknown
- 2012-05-18 EP EP12725954.7A patent/EP2710375B1/en active Active
-
2016
- 2016-05-24 AU AU2016203387A patent/AU2016203387B2/en active Active
-
2017
- 2017-04-13 JP JP2017079848A patent/JP2017161536A/ja active Pending
-
2018
- 2018-11-08 JP JP2018210141A patent/JP6863950B2/ja active Active
-
2020
- 2020-12-16 JP JP2020208021A patent/JP7242627B2/ja active Active
-
2023
- 2023-03-08 JP JP2023035124A patent/JP7618714B2/ja active Active
Also Published As
| Publication number | Publication date |
|---|---|
| CA2836103C (en) | 2020-07-14 |
| JP6863950B2 (ja) | 2021-04-21 |
| US20120329072A1 (en) | 2012-12-27 |
| PT2710375T (pt) | 2019-05-08 |
| PL2710375T3 (pl) | 2019-07-31 |
| WO2012159084A1 (en) | 2012-11-22 |
| TR201904997T4 (tr) | 2019-05-21 |
| DK3517956T3 (da) | 2021-10-11 |
| JP2023081972A (ja) | 2023-06-13 |
| PL3517956T3 (pl) | 2021-12-20 |
| ES2893605T3 (es) | 2022-02-09 |
| JP7618714B2 (ja) | 2025-01-21 |
| JP7242627B2 (ja) | 2023-03-20 |
| US8785139B2 (en) | 2014-07-22 |
| ES2720138T3 (es) | 2019-07-18 |
| EP3943939A1 (en) | 2022-01-26 |
| JP2019035765A (ja) | 2019-03-07 |
| PT3517956T (pt) | 2021-10-15 |
| EP2710375A1 (en) | 2014-03-26 |
| EP3517956A1 (en) | 2019-07-31 |
| AU2012255066A1 (en) | 2013-05-02 |
| JP2021063816A (ja) | 2021-04-22 |
| JP6175426B2 (ja) | 2017-08-02 |
| CA2836103A1 (en) | 2012-11-22 |
| AU2012255066B2 (en) | 2016-06-02 |
| JP2014524010A (ja) | 2014-09-18 |
| JP2017161536A (ja) | 2017-09-14 |
| EP3517956B1 (en) | 2021-09-08 |
| AU2016203387A1 (en) | 2016-06-16 |
| AU2016203387B2 (en) | 2018-01-25 |
| EP2710375B1 (en) | 2019-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK2710375T3 (en) | MODIFICATION DEPENDENT ACTIVITY TESTS | |
| AU2008313688A1 (en) | EDTA resistant S100A12 complexes (ERAC) | |
| WO2005081908A2 (en) | Reagents, kits and methods for immunodetection of epitopes on molecules | |
| JP2006524321A5 (enExample) | ||
| KR20100004107A (ko) | 인간 fc 감마 수용체 ⅲ | |
| HK40067577A (en) | Modification-dependent activity assays | |
| HK40010723A (en) | Modification-dependent activity assays | |
| HK40010723B (en) | Modification-dependent activity assays | |
| US20240353431A1 (en) | Selective measurement of human factor viii | |
| CA2476979A1 (en) | Assay for anti-ingap antibodies | |
| US10094833B2 (en) | Method and kit for detecting bacterial infection | |
| CN116338172B (zh) | 一种联合检测ca724和尿酸的试剂盒及应用 | |
| US20050153383A1 (en) | Synthetic and recombinant substrates for the detecion of the von willebrand factor-cleaving protease | |
| WO2025017135A1 (en) | Screening methods for antibody compositions | |
| Thougaard et al. | Tetranectin-like protein in vertebrate serum: a comparative immunochemical analysis |