DK174280B1 - Fremgangsmåde til fremstilling af allyl-2-thioxopenam-3-carboxylat-forbindelser og mellemprodukter ved fremgangsmåden - Google Patents
Fremgangsmåde til fremstilling af allyl-2-thioxopenam-3-carboxylat-forbindelser og mellemprodukter ved fremgangsmåden Download PDFInfo
- Publication number
- DK174280B1 DK174280B1 DK198702798A DK279887A DK174280B1 DK 174280 B1 DK174280 B1 DK 174280B1 DK 198702798 A DK198702798 A DK 198702798A DK 279887 A DK279887 A DK 279887A DK 174280 B1 DK174280 B1 DK 174280B1
- Authority
- DK
- Denmark
- Prior art keywords
- product
- mmol
- preparation
- compound
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 49
- 238000002360 preparation method Methods 0.000 title claims description 31
- 239000000543 intermediate Substances 0.000 title abstract description 6
- -1 allyl 2-thioxopenam3-carboxylates Chemical class 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims description 31
- 239000000460 chlorine Chemical group 0.000 claims description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 15
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 239000012442 inert solvent Substances 0.000 claims description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 7
- 229910052801 chlorine Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 235000009518 sodium iodide Nutrition 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000006239 protecting group Chemical group 0.000 claims 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 claims 2
- OEYMQQDJCUHKQS-UHFFFAOYSA-N (4-oxoazetidin-2-yl) acetate Chemical class CC(=O)OC1CC(=O)N1 OEYMQQDJCUHKQS-UHFFFAOYSA-N 0.000 abstract description 4
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- 238000003786 synthesis reaction Methods 0.000 abstract description 3
- 239000003242 anti bacterial agent Substances 0.000 abstract description 2
- 229940088710 antibiotic agent Drugs 0.000 abstract description 2
- HHXMXAQDOUCLDN-RXMQYKEDSA-N penem Chemical compound S1C=CN2C(=O)C[C@H]21 HHXMXAQDOUCLDN-RXMQYKEDSA-N 0.000 abstract description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 97
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 96
- 239000000047 product Substances 0.000 description 58
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- 239000000243 solution Substances 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000003480 eluent Substances 0.000 description 13
- 238000005481 NMR spectroscopy Methods 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000007787 solid Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 238000005160 1H NMR spectroscopy Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- IPTRYMUFUDMIPE-UHFFFAOYSA-M sodium;tert-butylsulfanylmethanedithioate Chemical compound [Na+].CC(C)(C)SC([S-])=S IPTRYMUFUDMIPE-UHFFFAOYSA-M 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- LZWQNOHZMQIFBX-UHFFFAOYSA-N lithium;2-methylpropan-2-olate Chemical compound [Li+].CC(C)(C)[O-] LZWQNOHZMQIFBX-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- LDVDKTLZRGWFID-GLDDHUGJSA-N (5r,6s)-3-ethylsulfanyl-6-[(1r)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(SCC)=C(C(O)=O)N2C(=O)[C@H]([C@@H](C)O)[C@@H]12 LDVDKTLZRGWFID-GLDDHUGJSA-N 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 2
- LXZRIAWYBGTJFH-UHFFFAOYSA-N 4-tert-butylsulfanylcarbothioylsulfanylazetidin-2-one Chemical compound CC(C)(C)SC(=S)SC1CC(=O)N1 LXZRIAWYBGTJFH-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000013589 supplement Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- VYNGFCUGSYEOOZ-UHFFFAOYSA-N triphenylphosphine sulfide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=S)C1=CC=CC=C1 VYNGFCUGSYEOOZ-UHFFFAOYSA-N 0.000 description 2
- 150000003952 β-lactams Chemical class 0.000 description 2
- VCQFATPBKSVBKL-UHFFFAOYSA-N 2-methyl-7-oxoheptanoic acid Chemical compound OC(=O)C(C)CCCCC=O VCQFATPBKSVBKL-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 101000687905 Homo sapiens Transcription factor SOX-2 Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 229910006121 SOBr2 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 102100024270 Transcription factor SOX-2 Human genes 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000003781 beta lactamase inhibitor Substances 0.000 description 1
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 1
- VPPSHXIFIAJKMX-UHFFFAOYSA-N bis(prop-2-enyl) 2,3-dihydroxybutanedioate Chemical compound C=CCOC(=O)C(O)C(O)C(=O)OCC=C VPPSHXIFIAJKMX-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002961 penems Chemical class 0.000 description 1
- 210000003899 penis Anatomy 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Steroid Compounds (AREA)
- Electroluminescent Light Sources (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86976086 | 1986-06-02 | ||
| US06/869,760 US4782145A (en) | 1986-06-02 | 1986-06-02 | Process for penem derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK279887D0 DK279887D0 (da) | 1987-06-01 |
| DK279887A DK279887A (da) | 1987-12-03 |
| DK174280B1 true DK174280B1 (da) | 2002-11-04 |
Family
ID=25354215
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK198702798A DK174280B1 (da) | 1986-06-02 | 1987-06-01 | Fremgangsmåde til fremstilling af allyl-2-thioxopenam-3-carboxylat-forbindelser og mellemprodukter ved fremgangsmåden |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4782145A (enExample) |
| EP (1) | EP0249358B1 (enExample) |
| JP (1) | JPS62294685A (enExample) |
| KR (1) | KR890004560B1 (enExample) |
| AT (1) | ATE56452T1 (enExample) |
| AU (1) | AU574610B2 (enExample) |
| CA (1) | CA1279312C (enExample) |
| DE (1) | DE3764875D1 (enExample) |
| DK (1) | DK174280B1 (enExample) |
| ES (1) | ES2018022B3 (enExample) |
| FI (1) | FI87649C (enExample) |
| GR (1) | GR3000862T3 (enExample) |
| HU (1) | HU196601B (enExample) |
| IE (1) | IE59871B1 (enExample) |
| IL (1) | IL82695A0 (enExample) |
| NZ (1) | NZ220498A (enExample) |
| PT (1) | PT84983B (enExample) |
| YU (1) | YU46208B (enExample) |
| ZA (1) | ZA873876B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5191075A (en) * | 1988-10-19 | 1993-03-02 | Pfizer Inc | Process for the preparation of penems |
| US4895940A (en) * | 1988-10-19 | 1990-01-23 | Pfizer Inc. | Process for the preparation of penems |
| US4992543A (en) * | 1988-10-19 | 1991-02-12 | Pfizer Inc. | Penem derivatives |
| JP2569455B2 (ja) * | 1992-03-06 | 1997-01-08 | 田辺製薬株式会社 | β−ラクタム誘導体の製法 |
| US5399679A (en) * | 1992-06-16 | 1995-03-21 | Farmitalia Carlo Erba S.R.L. | (1'R,3S,4R)4-acylthio azetidinones |
| US5698547A (en) * | 1994-04-01 | 1997-12-16 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| US5593986A (en) * | 1994-04-01 | 1997-01-14 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| US5688786A (en) * | 1994-04-01 | 1997-11-18 | Microcide Pharmaceuticals, Inc. | β-lactam antibiotics |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0176064A1 (en) * | 1980-11-06 | 1986-04-02 | Hoechst Uk Limited | Intermediates for the production of 7-oxo-4-thia-1-aza[3,2,0]heptane and 7-oxo-4-thia-1-aza[3,2,0]hept-2-ene derivatives |
| EP0091576B1 (en) * | 1982-03-26 | 1987-07-29 | Hoechst Uk Limited | 7-oxo-4-thia-1-azabicyclo(3,2,0)heptane derivatives |
| ATE112778T1 (de) * | 1982-11-29 | 1994-10-15 | Schering Corp | Verfahren zur herstellung von penem-verbindungen. |
| US4530793A (en) * | 1982-11-29 | 1985-07-23 | Schering Corporation | Processes for the production of penems |
| CA1221358A (en) * | 1982-12-08 | 1987-05-05 | Erba Farmitalia | 2-thiacephems and (5r) penems derivatives |
| US4695626A (en) * | 1986-07-29 | 1987-09-22 | Pfizer Inc. | 1-aza-4,5-dithiabicyclo [4.2.0] oct-2-en-8-one-2 carboxylate esters |
-
1986
- 1986-06-02 US US06/869,760 patent/US4782145A/en not_active Expired - Lifetime
-
1987
- 1987-05-19 FI FI872195A patent/FI87649C/fi not_active IP Right Cessation
- 1987-05-27 EP EP87304669A patent/EP0249358B1/en not_active Expired - Lifetime
- 1987-05-27 AT AT87304669T patent/ATE56452T1/de not_active IP Right Cessation
- 1987-05-27 DE DE8787304669T patent/DE3764875D1/de not_active Expired - Lifetime
- 1987-05-27 ES ES87304669T patent/ES2018022B3/es not_active Expired - Lifetime
- 1987-05-29 ZA ZA873876A patent/ZA873876B/xx unknown
- 1987-05-29 IE IE143087A patent/IE59871B1/en not_active IP Right Cessation
- 1987-05-29 CA CA000538429A patent/CA1279312C/en not_active Expired - Lifetime
- 1987-05-29 NZ NZ220498A patent/NZ220498A/xx unknown
- 1987-05-29 IL IL82695A patent/IL82695A0/xx not_active IP Right Cessation
- 1987-06-01 YU YU100087A patent/YU46208B/sh unknown
- 1987-06-01 DK DK198702798A patent/DK174280B1/da not_active IP Right Cessation
- 1987-06-01 PT PT84983A patent/PT84983B/pt not_active IP Right Cessation
- 1987-06-01 JP JP62135002A patent/JPS62294685A/ja active Granted
- 1987-06-01 HU HU872511A patent/HU196601B/hu not_active IP Right Cessation
- 1987-06-01 AU AU73695/87A patent/AU574610B2/en not_active Ceased
- 1987-06-01 KR KR1019870005506A patent/KR890004560B1/ko not_active Expired
-
1990
- 1990-09-24 GR GR90400693T patent/GR3000862T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU196601B (en) | 1988-12-28 |
| YU46208B (sh) | 1993-05-28 |
| FI872195A0 (fi) | 1987-05-19 |
| EP0249358A1 (en) | 1987-12-16 |
| NZ220498A (en) | 1989-08-29 |
| KR890004560B1 (ko) | 1989-11-15 |
| FI87649B (fi) | 1992-10-30 |
| JPH0544950B2 (enExample) | 1993-07-07 |
| US4782145A (en) | 1988-11-01 |
| AU574610B2 (en) | 1988-07-07 |
| PT84983B (pt) | 1990-02-08 |
| KR880000442A (ko) | 1988-03-25 |
| ATE56452T1 (de) | 1990-09-15 |
| DE3764875D1 (de) | 1990-10-18 |
| YU100087A (en) | 1988-12-31 |
| IL82695A0 (en) | 1987-11-30 |
| FI87649C (fi) | 1993-02-10 |
| DK279887D0 (da) | 1987-06-01 |
| ZA873876B (en) | 1987-11-30 |
| AU7369587A (en) | 1987-12-10 |
| IE871430L (en) | 1987-12-02 |
| GR3000862T3 (en) | 1991-11-15 |
| IE59871B1 (en) | 1994-04-20 |
| DK279887A (da) | 1987-12-03 |
| FI872195A7 (fi) | 1987-12-03 |
| PT84983A (en) | 1987-07-01 |
| HUT45066A (en) | 1988-05-30 |
| JPS62294685A (ja) | 1987-12-22 |
| ES2018022B3 (es) | 1991-03-16 |
| EP0249358B1 (en) | 1990-09-12 |
| CA1279312C (en) | 1991-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4876365A (en) | Intermediate compounds for preparing penems and carbapenems | |
| JPH0329789B2 (enExample) | ||
| NO158540B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 2-penem-forbindelser. | |
| DK174280B1 (da) | Fremgangsmåde til fremstilling af allyl-2-thioxopenam-3-carboxylat-forbindelser og mellemprodukter ved fremgangsmåden | |
| EP0294934B1 (en) | Diastereomeric 5R,6S-6-(1R-hydroxyethyl)-2-(cis-1-oxo-3-thiolanylthio)-2-penem-3-carboxylic acids | |
| DK166152B (da) | Fremgangsmaade til fremstilling af penemforbindelser | |
| NO166132B (no) | Kjemisk forbindelse og fremgangsmaate til fremstilling derav. | |
| US4782146A (en) | Process for the synthesis of penems | |
| JPH02131487A (ja) | 2―チアセフエム誘導体の製造方法 | |
| US4772683A (en) | High percentage beta-yield synthesis of carbapenem intermediates | |
| FR2518098A1 (fr) | Procede pour la preparation de derives penem optiquement actifs | |
| US4769451A (en) | Synthesis of carbapenems using n-substituted azetidinones | |
| IE49656B1 (en) | Method for the production of 2-substituted penems and penams | |
| US4751297A (en) | Method for preparation of azetidinone-1-oxoacetate by oxidation of the corresponding 2-hydroxyacetate | |
| US4895939A (en) | High percentage β-yield synthesis of carbapenem intermediates | |
| PT92022B (pt) | Processo para a preparacao antibioticos penems | |
| US4564473A (en) | 6-Unsubstituted-7-oxo-4-oxa-diazabicyclo(3.2.0)hept-2-ene derivatives | |
| US4973687A (en) | Synthesis of carbapenems using N-substituted azetidinones | |
| US5075439A (en) | Processes for (3S,4R)-3-[1(R)-t-butyl-dimethylsilyloxy)-ethyl]-4-[1-oxo-3-thiolanylthio(thiocarbonyl)thio]azetidin-2-ones and intermediates therefor | |
| EP0122002B1 (en) | Process for preparing azetidinone derivatives | |
| US4895940A (en) | Process for the preparation of penems | |
| KR0128513B1 (ko) | 신규한 항균성 페넴 유도체와 그의 제조방법 | |
| US4391975A (en) | Process for 1-oxacephem derivatives | |
| EP0574784B1 (en) | Process for preparing (1'R,3S,4R)4-acylthio azetidinones | |
| JPS62153289A (ja) | 2,6−エポキシ−3,4,5,6−テトラヒドロ−2H−ナフタレノ〔1,2−b〕オキソシン−9,12−ジオン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |
Country of ref document: DK |