DEW0013622MA - - Google Patents
Info
- Publication number
- DEW0013622MA DEW0013622MA DEW0013622MA DE W0013622M A DEW0013622M A DE W0013622MA DE W0013622M A DEW0013622M A DE W0013622MA
- Authority
- DE
- Germany
- Prior art keywords
- glass
- layer
- thermal expansion
- base
- suspension
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000011521 glass Substances 0.000 claims description 37
- 239000006121 base glass Substances 0.000 claims description 16
- 239000005385 borate glass Substances 0.000 claims description 14
- KIRWCRPCYCPJPE-UHFFFAOYSA-N aluminum barium(2+) borate Chemical group B([O-])([O-])[O-].[Al+3].[Ba+2] KIRWCRPCYCPJPE-UHFFFAOYSA-N 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 8
- 239000000725 suspension Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 229910052792 caesium Inorganic materials 0.000 claims description 6
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 6
- 239000005337 ground glass Substances 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000005388 borosilicate glass Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 239000010410 layer Substances 0.000 claims 17
- 238000002844 melting Methods 0.000 claims 1
- 230000008018 melting Effects 0.000 claims 1
- 239000002344 surface layer Substances 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 8
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 230000002925 chemical effect Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- FRWYFWZENXDZMU-UHFFFAOYSA-N 2-iodoquinoline Chemical compound C1=CC=CC2=NC(I)=CC=C21 FRWYFWZENXDZMU-UHFFFAOYSA-N 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- LTPBRCUWZOMYOC-UHFFFAOYSA-N beryllium oxide Inorganic materials O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 229910052743 krypton Inorganic materials 0.000 description 1
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2655085C2 (enExample) | ||
| DE69408609T2 (de) | Leitfähige Überzüge mit Silber | |
| DE2336581C2 (de) | Verfahren zur Herstellung einer transparenten Heizscheibe | |
| DE2801720A1 (de) | Dickschicht-widerstandsthermometer und verfahren zu seiner herstellung | |
| EP0202501A2 (de) | Ozonerzeuger | |
| DE2752559C3 (de) | Dickschichtvaristor | |
| DE10345248A1 (de) | Dichtungsmaterial | |
| DE2257497A1 (de) | Kathodenstrahlroehre | |
| DE3447581C2 (enExample) | ||
| DE2538342C3 (de) | Verfahren zum Aufbringen eines hitzebeständigen Überzugs auf eine Metalloberfläche | |
| DE2723380A1 (de) | Glasierter gegenstand | |
| DE1640524A1 (de) | Elektrischer Widerstand | |
| DE1011348B (de) | Verglasbares Flussmittel sowie keramischer Gegenstand | |
| DE2147603A1 (de) | Kathodenstrahlröhre mit reflexverminderndem Bildschirmbelag und Verfahren zur Herstellung eines solchen Bildschirmbelages | |
| DE720713C (de) | Verfahren zur Herstellung von Leuchtschirmen fuer elektrische Entladungsgefaesse | |
| DE1807862A1 (de) | Elektrisch heizbares Glaserzeugnis und Verfahren zu seiner Herstellung | |
| DE1596934A1 (de) | Den elektrischen Strom leitende Loetglasmischungen und Verfahren zum Aufbringen derselben auf Glasoberflaechen | |
| DEW0013622MA (enExample) | ||
| DE1496544A1 (de) | Glasmassen fuer elektrische Widerstandsschichten | |
| CH355201A (de) | Verfahren zur Herstellung eines elektrischen Widerstandes | |
| CH465918A (de) | Verfahren zur Herstellung eines gaschromatographischen Trägermaterials | |
| DE2557938C2 (de) | Verfahren zum Mahlen von Alkalimetallboratgläsern | |
| DE1007689B (de) | Verglasbares Flussmittel sowie keramischer Gegenstand | |
| DE1771233B2 (de) | Verfahren zum Verfestigen einer Schicht aus einem glasartigen oder vitrokristallinen Material | |
| DE19841009A1 (de) | Farbbild-Kathodenstrahlröhre und wasserbeständige Glasfritte |