DEU0003313MA - - Google Patents
Info
- Publication number
- DEU0003313MA DEU0003313MA DEU0003313MA DE U0003313M A DEU0003313M A DE U0003313MA DE U0003313M A DEU0003313M A DE U0003313MA
- Authority
- DE
- Germany
- Prior art keywords
- cyclic
- potassium
- tetramer
- trimer
- cyclic trimer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 21
- 239000003054 catalyst Substances 0.000 claims description 13
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 11
- 229910052700 potassium Inorganic materials 0.000 claims description 11
- 239000011591 potassium Substances 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 description 42
- 239000013638 trimer Substances 0.000 description 28
- -1 diethylsiloxane Chemical class 0.000 description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 10
- BYLOHCRAPOSXLY-UHFFFAOYSA-N dichloro(diethyl)silane Chemical compound CC[Si](Cl)(Cl)CC BYLOHCRAPOSXLY-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 150000004819 silanols Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- IALUUOKJPBOFJL-UHFFFAOYSA-N potassium oxidosilane Chemical class [K+].[SiH3][O-] IALUUOKJPBOFJL-UHFFFAOYSA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- XOCOMEGNVMCRMP-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octaethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane Chemical compound CC[Si]1(CC)O[Si](CC)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O1 XOCOMEGNVMCRMP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68919530T2 (de) | Verfahren und Zwischenprodukte für die Herstellung von Bis(aminoalkyl)polydiorganosiloxanen. | |
| DE69617518T2 (de) | Verfahren zur Herstellung von zyklischen Polysiloxanen | |
| DE69822023T2 (de) | Erhitztes-Öl-Verfahren zur Herstellung von Isocyanatosilanen | |
| DE2500930C2 (de) | Verfahren zum Herstellen linearer Diorganopolysiloxan-Öle | |
| DE2363539B2 (de) | Verfahren zum Herstellen von cyclischen Polydiorganosiloxanen | |
| DE2148669A1 (de) | Verfahren zur herstellung von organosiloxanen | |
| DE2908249C2 (de) | Verfahren zur Herstellung von Octamethylcyclotetrasiloxan | |
| DE3041296A1 (de) | Verfahren zur synthese fluessiger fluorsiloxane mit als silanol endender kette | |
| DE966957C (de) | Verfahren zur Herstellung von Hexaaethylcyclotrisiloxan | |
| DE957662C (de) | Verfahren zur Herstellung von stabilen Alkyl- und/oder Arylpolysiloxanölen | |
| DE3742069A1 (de) | Verfahren zur herstellung von diorganopolysiloxanen mit triorganosiloxygruppen als endstaendigen einheiten | |
| DE69127344T2 (de) | Katalysierte Äquilibrierung von Polyorganosiloxanen und Verfahren zur Herstellung von Cyclosiloxanen | |
| DE69314897T2 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE2455502C2 (de) | Verfahren zum Herstellen von symmetrischen Tetramethyltetravinylcyclotetrasiloxan | |
| DE1495868C3 (de) | Verfahren zur Herstellung von Acyloxyalkylgruppen enthaltenden Organo polysiloxanen | |
| EP0269886A2 (de) | Verfahren zur Herstellung von Organopolysiloxanen mit basischen Stickstoff aufweisenden, SiC-gebundenen organischen Resten | |
| DE2263819A1 (de) | Alpha-alkoxy-omega-siloxanole und verfahren zu irer herstellung | |
| DEU0003313MA (cg-RX-API-DMAC7.html) | ||
| DE69828796T2 (de) | Hochreine verzweigte alkylsilsesquioxanflüssigkeiten | |
| EP0126792A1 (de) | Verfahren zur Herstellung von Hexamethylcyclotrisiloxan und eine Verwendung des so hergestellten Cyclotrisiloxans | |
| DE1083820B (de) | Verfahren zur Herstellung reiner cyclischer Dimethylsiloxane | |
| DE1060862B (de) | Verfahren zur Herstellung neuer cyclischer trimerer und tetramerer Organopolysiloxane | |
| DE1745556B2 (de) | Verfahren zur Herstellung von alpha-Triorganosiloxy-omega-hydroxydlorganopolysiloxanen | |
| DE1618802C (de) | Verfahren zur Herstellung von 1,3,5,7-Tetramethyl-l^SJ-tetraphenylcyclotetrasiloxan | |
| DE1545051C (de) | Verfahren zur Herstellung von hydroxylendblockiertenDiorganosiloxanen |