DEST005119MA - - Google Patents
Info
- Publication number
- DEST005119MA DEST005119MA DEST005119MA DE ST005119M A DEST005119M A DE ST005119MA DE ST005119M A DEST005119M A DE ST005119MA
- Authority
- DE
- Germany
- Prior art keywords
- copper
- components
- nickel
- manganese
- cobalt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 18
- 229910045601 alloy Inorganic materials 0.000 claims description 12
- 239000000956 alloy Substances 0.000 claims description 12
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 10
- 229910052802 copper Inorganic materials 0.000 claims description 10
- 239000010949 copper Substances 0.000 claims description 10
- 239000010941 cobalt Substances 0.000 claims description 9
- 229910017052 cobalt Inorganic materials 0.000 claims description 9
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 9
- 229910052759 nickel Inorganic materials 0.000 claims description 9
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 8
- 239000000463 material Substances 0.000 claims 1
- 239000012535 impurity Substances 0.000 description 7
- 230000007797 corrosion Effects 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052790 beryllium Inorganic materials 0.000 description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 229910000881 Cu alloy Inorganic materials 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910000914 Mn alloy Inorganic materials 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- DMFGNRRURHSENX-UHFFFAOYSA-N beryllium copper Chemical compound [Be].[Cu] DMFGNRRURHSENX-UHFFFAOYSA-N 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- UTICYDQJEHVLJZ-UHFFFAOYSA-N copper manganese nickel Chemical compound [Mn].[Ni].[Cu] UTICYDQJEHVLJZ-UHFFFAOYSA-N 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005021 gait Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69903202T2 (de) | Eisen-Kobalt Legierung | |
| DE69517173T2 (de) | Silber-palladium-legierung | |
| EP0267318A2 (de) | Legierung für Schmuckzwecke | |
| EP2420583B1 (de) | Schmuckstück aus einer ideal-weiße, anlaufbeständigen Edelmetall-Legierung | |
| DEST005119MA (https=) | ||
| EP2976441A1 (de) | Eisenbasierte formgedächtnislegierung | |
| DE102009044651B4 (de) | Uhr mit magnetischer Abschirmung | |
| DE960768C (de) | Bestandteile fuer Uhren und Apparate | |
| DE102022104609B3 (de) | Bronze-Legierung | |
| DE585545C (de) | Rhodiumhaltige Palladiumlegierungen | |
| DE202007006994U1 (de) | Platinlegierung sowie ein aus der Platinlegierung hergestelltes Schmuckstück, insbesondere einen Trauring | |
| AT501806A1 (de) | Gleitlager | |
| DE202008017584U1 (de) | Platin-Schmucklegierung | |
| DE202007001963U1 (de) | Platinlegierung sowie ein aus der Platinlegierung hergestelltes Schmuckstück, insbesondere einen Trauring | |
| DE1913279C2 (de) | Kupfer-Eisen-Legierung | |
| CH294767A (de) | Uhrenbestandteil. | |
| DE1955449C (de) | Kupfer Eisen Aluminium Legierungen | |
| DE202008002753U1 (de) | Platinlegierung sowie ein aus der Platinlegierung hergestelltes Schmuckstück, insbesondere einen Trauring | |
| DE674933C (de) | Beryllium-Gold-Legierungen | |
| DE102008011355A1 (de) | Platinlegierung sowie ein Verfahren zu deren Herstellung und ein aus der Platinlegierung hergestelltes Schmuckstück, insbesondere einen Trauring | |
| DE202022002098U1 (de) | Platinlegierung, insbesondere Platin-Schmucklegierung | |
| DE971686C (de) | Verwendung von Sinterhartmetallen fuer Gegenstaende, die gegen Salpetersaeure bestaendig sein sollen | |
| DE743001C (de) | Katalysator fuer die Durchfuehrung von katalytischen Reaktionen in der Gasphase | |
| EP4474505A2 (de) | Bronzelegierung | |
| DE102007022992A1 (de) | Platinlegierung sowie ein Verfahren zu deren Herstellung und ein aus der Platinlegierung hergestelltes Schmuckstück, insbesondere einen Trauring |