DEN0008330MA - - Google Patents
Info
- Publication number
- DEN0008330MA DEN0008330MA DEN0008330MA DE N0008330M A DEN0008330M A DE N0008330MA DE N0008330M A DEN0008330M A DE N0008330MA
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- column
- liquid
- heat treatment
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 268
- 239000007788 liquid Substances 0.000 claims description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 44
- 239000012535 impurity Substances 0.000 claims description 40
- 238000010438 heat treatment Methods 0.000 claims description 34
- 239000000243 solution Substances 0.000 claims description 33
- 239000000047 product Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 28
- 239000001301 oxygen Substances 0.000 claims description 28
- 229910052760 oxygen Inorganic materials 0.000 claims description 28
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 20
- 150000002894 organic compounds Chemical class 0.000 claims description 20
- 239000000126 substance Substances 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 239000006227 byproduct Substances 0.000 claims description 10
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 7
- 230000015556 catabolic process Effects 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 230000000875 corresponding Effects 0.000 claims description 4
- 239000007789 gas Substances 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 238000005755 formation reaction Methods 0.000 claims 1
- 230000001590 oxidative Effects 0.000 claims 1
- 239000011347 resin Substances 0.000 claims 1
- 229920005989 resin Polymers 0.000 claims 1
- 238000011049 filling Methods 0.000 description 28
- 230000003647 oxidation Effects 0.000 description 17
- 238000007254 oxidation reaction Methods 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000004821 distillation Methods 0.000 description 10
- 150000002576 ketones Chemical class 0.000 description 10
- 238000005194 fractionation Methods 0.000 description 9
- 238000000926 separation method Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 150000001451 organic peroxides Chemical class 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 239000000356 contaminant Substances 0.000 description 4
- 230000004059 degradation Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- -1 aliphatic alcohols Chemical class 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 229940098424 POTASSIUM PYROPHOSPHATE Drugs 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000001174 ascending Effects 0.000 description 2
- 125000004432 carbon atoms Chemical group C* 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N n-butanol Chemical group CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003303 reheating Methods 0.000 description 2
- 230000000630 rising Effects 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 2
- 239000006200 vaporizer Substances 0.000 description 2
- MCJGNVYPOGVAJF-UHFFFAOYSA-N 8-Hydroxyquinoline Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 229940048084 Pyrophosphate Drugs 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J Pyrophosphate Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- KBTJYNAFUYTSNN-UHFFFAOYSA-N [Na].OO Chemical compound [Na].OO KBTJYNAFUYTSNN-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 201000002574 conversion disease Diseases 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N oxygen atom Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229940085991 phosphate ion Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000000717 retained Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 229940071182 stannate Drugs 0.000 description 1
- 125000005402 stannate group Chemical group 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2223541C3 (de) | Verfahren zur Reinigung eines Essigsäure enthaltenden Produktstroms | |
| EP0868398B1 (de) | Verfahren zur abtrennung von mittelsiedern aus einem gemisch aus leicht-, mittel- und hochsiedern | |
| DE3102948C2 (ko) | ||
| DE2906698B2 (de) | Verfahren zur Gewinnung von Ethylenoxid, das von Aldehydverunreinigungen und Wasser praktisch frei ist | |
| DE2643000A1 (de) | Reinigung von alkansulfonsaeuren durch destillation | |
| DE3222370A1 (de) | Kontinuierliches verfahren fuer die gleichzeitige extraktion von 2,2-bis(4-hydroxyphenyl)-propan und phenol aus waesserigen abwasserstroemen | |
| DE3322535A1 (de) | Verbessertes verfahren zur schonenden destillation von fettsaeuren | |
| DE2926693A1 (de) | Verfahren zur abtrennung von jod aus einem jod, jodwasserstoff und wasser enthaltenden, fluessigen gemisch | |
| EP0304770A1 (de) | Verfahren zur destillativen Reinigung von rohem sec-Butylalkohol | |
| DE69118391T2 (de) | Verfahren zur reinigung von hydroxypivalyl-hydroxypivalat | |
| DE68916123T2 (de) | Reinigung von Alkylglyoxylate. | |
| DE962068C (de) | Verfahren zum Reinigen oder Gewinnen von Wasserstoffperoxyd | |
| EP0989952B1 (de) | Verfahren zur herstellung hochreiner, wässriger hydroxylaminlösungen | |
| DEN0008330MA (ko) | ||
| DE68911949T2 (de) | Reinigung von Alkylglyyoxalat in einer kontinuierlichen Säule mittels azeotropischer Destillation. | |
| DE3009946C2 (de) | Verfahren zur Gewinnung von Methacrylsäure | |
| EP0036406B1 (de) | Verfahren zur Extraktion von Essigsäure, Ameisensäure, gegebenenfalls Furfurol | |
| CH326522A (de) | Verfahren zur Gewinnung von Wasserstoffperoxyd | |
| DE1618249B1 (de) | Verfahren zur Abtrennung bromhaltigen Cokatalysators aus rohem Phthalsäureanhydrid | |
| CH395050A (de) | Verfahren zur Gewinnung von Katalysatoren und Essigsäure aus einem Essigsäuresynthesegemisch | |
| DE2724191A1 (de) | Verfahren zur herstellung von aethylenglykol | |
| DE1768412B2 (de) | Verfahren zur Gewinnung von Vinylacetat | |
| DE1643604B1 (de) | Verfahren zum Gewinnen von Adipinsaeuredinitril | |
| DE940349C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE961436C (de) | Verfahren zur Reinigung von Wasserstoffperoxyd |