DEM0023224MA - - Google Patents
Info
- Publication number
- DEM0023224MA DEM0023224MA DEM0023224MA DE M0023224M A DEM0023224M A DE M0023224MA DE M0023224M A DEM0023224M A DE M0023224MA
- Authority
- DE
- Germany
- Prior art keywords
- alloys
- nickel
- palladium
- manganese
- soldering
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910045601 alloy Inorganic materials 0.000 claims description 31
- 239000000956 alloy Substances 0.000 claims description 31
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 18
- 229910052759 nickel Inorganic materials 0.000 claims description 11
- 238000005476 soldering Methods 0.000 claims description 11
- 229910052763 palladium Inorganic materials 0.000 claims description 9
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052748 manganese Inorganic materials 0.000 claims description 7
- 239000011572 manganese Substances 0.000 claims description 7
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229910000669 Chrome steel Inorganic materials 0.000 claims description 2
- 239000012535 impurity Substances 0.000 claims description 2
- 229910000679 solder Inorganic materials 0.000 description 8
- 230000008901 benefit Effects 0.000 description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 229910000914 Mn alloy Inorganic materials 0.000 description 3
- 229910000990 Ni alloy Inorganic materials 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- 229910000599 Cr alloy Inorganic materials 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000005219 brazing Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910001252 Pd alloy Inorganic materials 0.000 description 1
- 150000001450 anions Chemical group 0.000 description 1
- 229910002056 binary alloy Inorganic materials 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001768 cations Chemical group 0.000 description 1
- 239000000788 chromium alloy Substances 0.000 description 1
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- ZAUUZASCMSWKGX-UHFFFAOYSA-N manganese nickel Chemical compound [Mn].[Ni] ZAUUZASCMSWKGX-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910021652 non-ferrous alloy Inorganic materials 0.000 description 1
- SWELZOZIOHGSPA-UHFFFAOYSA-N palladium silver Chemical compound [Pd].[Ag] SWELZOZIOHGSPA-UHFFFAOYSA-N 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69421281T2 (de) | Ferritisch-austenitischer rostfreier stahl und seine verwendung | |
| DE68911266T2 (de) | Korrosionsbeständige Nickelbasislegierung. | |
| DE69709308T2 (de) | Schweissmaterial für nichtrostenden stahl | |
| DE102007028275A1 (de) | Hartlotfolie auf Eisen-Basis sowie Verfahren zum Hartlöten | |
| DE19501673A1 (de) | Metalllötmittel | |
| DE2037648B2 (de) | Verwendung einer Eisenlegierung mit guter Kriechfestigkeit und Korrossionsfestigkeit bei hoher Temperatur und hohem Widerstand gegen Rückkohlung im Kontakt mit Aufkohlungsmittein als Werkstoff für die Herstellung von Teilen in Öfen für Temperaturen bis 1200 Grad C | |
| DE2447137B2 (de) | Gegen gruebchenkorrosion bestaendige stahllegierung | |
| DE69505603T2 (de) | Bauteil aus hitzebeständigem austenitischem Stahl mit ausgezeichneter Festigkeit bei hohen Temperaturen | |
| EP0827438B1 (de) | Amorphe legierung und lötmittel aus amorpher legierung | |
| DE2248130A1 (de) | Haftpulver auf nickelbasis | |
| DE3510949A1 (de) | Aluminiumlotlegierung | |
| DE3027730A1 (de) | Verfahren zum behandeln einer legierung | |
| DE2234111C2 (de) | Verwendung eines Aluminium-Schweißzusatzwerkstoffes | |
| DE102016124588A1 (de) | Verwendung einer nickel-chrom-molybdän-legierung | |
| DE1289395C2 (de) | Hartlot zum Loeten von Wolfram, Molybdaen und deren Legierungen sowie Verfahren zum Loeten | |
| DE3304736C2 (de) | Gold-Lötmittel | |
| DE2124687C3 (de) | Verwendung ferritischer Eisen-Chrom-Molybdan-Legierungen für die Herstellung von Apparateteilen fur den Chemiebau, Wärmeaustauschern und anderen Behaltern | |
| DE69432780T2 (de) | Inertgaslichtbogenschweissdraht für temperaturbeständigen hochchromhaltigen ferritischen stahl | |
| DE957270C (de) | Lot | |
| DEM0023224MA (OSRAM) | ||
| DE1508326B2 (de) | Lötlegierung | |
| DE69833630T2 (de) | Nickelbasislegierung und Schweisselektrode aus einer Nickelbasislegierung | |
| DE1283546B (de) | Verwendung einer Stahllegierung als Bindemetallplatte fuer mehrschichtige Metallplatten mit mindestens einer Titanschicht | |
| DE1508306B1 (de) | Hartlot | |
| DE19629376C2 (de) | Hartlot zum Löten von unter Verformungsspannungen stehenden Stahlrohren (II) |