DEK0020791MA - - Google Patents
Info
- Publication number
- DEK0020791MA DEK0020791MA DEK0020791MA DE K0020791M A DEK0020791M A DE K0020791MA DE K0020791M A DEK0020791M A DE K0020791MA
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- solid
- mixed
- esters
- silicon carbide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 13
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 11
- 239000007787 solid Substances 0.000 claims description 9
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 8
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000000377 silicon dioxide Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000002699 waste material Substances 0.000 claims description 4
- 239000002706 dry binder Substances 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052593 corundum Inorganic materials 0.000 claims description 2
- 239000010431 corundum Substances 0.000 claims description 2
- 239000010438 granite Substances 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical class [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000011435 rock Substances 0.000 claims description 2
- 150000004760 silicates Chemical class 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 235000012245 magnesium oxide Nutrition 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- 238000000465 moulding Methods 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000004927 clay Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2239835A1 (de) | Verfahren zur herstellung von formkoerpern aus einem koernigen material und einem sauer-haertbaren harz | |
| DE102017107531A1 (de) | Verfahren zur Herstellung von Gießformen, Kernen und daraus regenerierten Formgrundstoffen | |
| EP2877437B1 (de) | Feuerfestes erzeugnis und verwendung des erzeugnisses | |
| EP0199941A2 (de) | Anorganische Formmasse mit Gehalten einer steinbildenden Komponente | |
| DE1769508A1 (de) | Verfahren zur Herstellung von Hydrophobiermitteln | |
| DE60218348T2 (de) | Bor-enthaltende zusammensetzung zur verwendung bei der herstellung von tonwaren | |
| DEK0020791MA (enrdf_load_stackoverflow) | ||
| CH498922A (de) | Kieselsäurehaltiges Bindemittel | |
| DE3512515A1 (de) | Anorganische formmassen mit kalziniertem bauxit als steinbildende komponente | |
| DE2809871C2 (enrdf_load_stackoverflow) | ||
| DE2021532A1 (de) | Formenbauwerkstoff zur Herstellung von Arbeitsformen fuer die keramische Industrie | |
| CH631144A5 (de) | Kalk-kieselsaeuregemisch und verfahren zur herstellung von dampfgehaerteten baustoffen. | |
| DE102007058125B4 (de) | Metallrückstände und Kohlenstoffträger enthaltender Formkörper | |
| DE898267C (de) | Verfahren zur Herstellung von geformten Koerpern aus Siliziumkarbid | |
| DE2134232A1 (de) | Verfahren zur herstellung von putz in pulverform | |
| AT130224B (de) | Verfahren zur Herstellung von hochfeuerfesten Produkten aus natürlichen Magnesiumsilikaten. | |
| EP0381662B1 (de) | Verfahren zur Herstellung von Schleifkörpern | |
| AT205403B (de) | Verfahren zur Herstellung feuerfester Steine, keramischer Körper, Steingut und Porzellan aus gebranntem Ton | |
| DE186280C (enrdf_load_stackoverflow) | ||
| DE1646719C3 (de) | Bindemittel zur Herstellung feuerfester Gegenstände | |
| DE862726C (de) | Verfahren zur Herstellung keramisch gebundener Schleifkoerper | |
| AT200801B (de) | Verfahren zur Herstellung von Formkörpern aus feinkörnigen Stoffen, insbesondere Feinerzen, Feinkohlen sowie Schlacke oder/und sonstigen feinkörnigen Stoffen, die zur Steinherstellung dienen | |
| AT156293B (de) | Verfahren zur Herstellung von gesintertem Portlandzement. | |
| DE2248205A1 (de) | Bindemittel und feuerfeste betone | |
| AT248943B (de) | Verfahren zur Herstellung von Sinterprodukten aus feuer- bzw. hochfeuerfesten Oxyden |