DEF0010974MA - - Google Patents
Info
- Publication number
- DEF0010974MA DEF0010974MA DEF0010974MA DE F0010974M A DEF0010974M A DE F0010974MA DE F0010974M A DEF0010974M A DE F0010974MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- phosgene
- nitrobenzene
- isocyanates
- hours
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 25
- 239000012948 isocyanate Substances 0.000 claims description 12
- -1 aromatic aminosulfonic acids Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical group OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 30
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 14
- 150000002513 isocyanates Chemical class 0.000 description 8
- 229910002092 carbon dioxide Inorganic materials 0.000 description 7
- 239000001569 carbon dioxide Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical class ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000007664 blowing Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- PDWSXDQLCPYSFZ-UHFFFAOYSA-N 2-isocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1N=C=O PDWSXDQLCPYSFZ-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- VPXCXBHLKDPWQV-UHFFFAOYSA-N 5-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C(S(O)(=O)=O)=C1 VPXCXBHLKDPWQV-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IKQUSHJVVKPVFG-UHFFFAOYSA-N N=C=O.OS(Cl)(=O)=O Chemical compound N=C=O.OS(Cl)(=O)=O IKQUSHJVVKPVFG-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0126351B1 (de) | Verfahren zur Isolierung und Reinigung von Antibiotika | |
| DE947159C (de) | Verfahren zur Herstellung von Sulfochloridgruppen tragenden Isocyanaten | |
| EP0464582B1 (de) | Verfahren zur Reinigung von fermentativ hergestelltem Riboflavin | |
| DE943771C (de) | Verfahren zur Herstellung von neuen, in 1-Stellung substituierten 4-Aminopiperazinderivaten | |
| EP0183115B1 (de) | Gegebenenfalls in 3-Stellung Methyl-substituierte Bis-(4-isocyanatophenoxy)-alkane, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
| DEF0010974MA (OSRAM) | ||
| DE2524747C3 (de) | Verfahren zur Isolierung von 1,5-/1,8-Dinitroanthrachinon mit einem hohen Gehalt an a , a '-Duutroverbindungen | |
| EP0126999B1 (de) | Verfahren zur Herstellung von sphärisch-kristallinem 5-(Hydroxy)-tetracyclinhydrochlorid (Oxytetracyclinhydrochlorid) | |
| DE2250579C3 (de) | Verwendung von Isocyanurat- und Metallisocyanuratreste enthaltenden Verbindungen ab Emulgatoren | |
| EP0468303A1 (de) | Verfahren zur Gewinnung von Carbonsäuren aus ihren wässrigen Lösungen | |
| DE69004244T2 (de) | Verfahren zur Herstellung von hohen Anteilen des trans,trans-Isomeren enthaltenden 4,4'-Diisocyanatodicyclohexylmethan. | |
| DE859156C (de) | Verfahren zur Herstellung von Additionsprodukten aus Isocyanaten und sauren Salzen der schwefligen Saeure | |
| DE2246920A1 (de) | Verfahren zur reinigung von hochschmelzenden isocyanaten | |
| DE950910C (de) | Verfahren zur Herstellung von Sulfochloridgruppen tragenden Isocyanaten | |
| EP0463466A2 (de) | Verfahren zur Herstellung sehr reiner 5-Aminosalicylsäure | |
| DE870563C (de) | Verfahren zur Herstellung von Cholinabkoemmlingen | |
| EP0095569A2 (de) | Verfahren zur Herstellung von Phenylpyridazinverbindungen | |
| EP0099985A2 (de) | Verfahren zur Herstellung von grobkristallinem, rieselfähigem Natriumdichlorisocyanuratdihydrat | |
| DD288151A5 (de) | Verfahren zur herstellung von stabilem azlocillin-na-trockensalz | |
| AT345816B (de) | Verfahren zur herstellung von neuen thiadiazolylimidazolinonen | |
| DE863803C (de) | Verfahren zur Herstellung von p-Nitrobenzolsulfonsaeurechlorid | |
| DE3642475C2 (OSRAM) | ||
| DE848808C (de) | Verfahren zur Herstellung von Verbindungen, die neben einer Carbon-saeurechloridgruppe einen Carbaminsaeurechlorid- oder Isocyanatrest bzw. die Reste der entsprechenden Thioverbindungen enthalten | |
| DE965904C (de) | Verfahren zur Herstellung von 2-Semicarbazidoessigsaeure | |
| DE1013556B (de) | Verfahren zur Herstellung von schwefelsaeurefreiem Nitroguanidin mit grosser spezifischer Oberflaeche |