DEE0006313MA - - Google Patents
Info
- Publication number
- DEE0006313MA DEE0006313MA DEE0006313MA DE E0006313M A DEE0006313M A DE E0006313MA DE E0006313M A DEE0006313M A DE E0006313MA
- Authority
- DE
- Germany
- Prior art keywords
- polychlorocyclohexane
- hydrogen chloride
- benzene hexachloride
- parts
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 21
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 15
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 claims description 13
- 230000008030 elimination Effects 0.000 claims description 5
- 238000003379 elimination reaction Methods 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 239000003957 anion exchange resin Substances 0.000 claims 1
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 229920001429 chelating resin Polymers 0.000 description 3
- 229940018564 m-phenylenediamine Drugs 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 2
- -1 hydroxide ions Chemical class 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- 229960002809 lindane Drugs 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- HWHNEHLXBIWKHC-UHFFFAOYSA-N ClC(C=CC=C1)=C1Cl.Cl.Cl.Cl.Cl.Cl.Cl Chemical compound ClC(C=CC=C1)=C1Cl.Cl.Cl.Cl.Cl.Cl.Cl HWHNEHLXBIWKHC-UHFFFAOYSA-N 0.000 description 1
- SGOWAUYYANZZHE-UHFFFAOYSA-N ClC1=CC=CC=C1.Cl.Cl.Cl.Cl.Cl.Cl Chemical compound ClC1=CC=CC=C1.Cl.Cl.Cl.Cl.Cl.Cl SGOWAUYYANZZHE-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001944 continuous distillation Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2631034A1 (de) | Verfahren zur herstellung eines gemisches aus di(aminophenyl)methan und oligomeren polymethylenpolyphenylpolyaminen | |
| DE1001980B (de) | Verfahren zur Herstellung von 2, 2-Bis-(p-carboxyphenyl)-propan sowie dessen Dimethylester | |
| DE2947531A1 (de) | Verfahren zur herstellung von polyphenylpolymethylenpolyaminen | |
| EP0345579B1 (de) | Verfahren zur Herstellung von oligomerem 2,2,4-Trimethyl-1,2-dihydrochinolin | |
| EP0026291B1 (de) | Verfahren zur Herstellung von Terephthalaldehyd bzw. Isophthalaldehyd | |
| DE10063937A1 (de) | Verfahren zur Herstellung von Trimethylolverbindungen und Ameisensäure | |
| DEE0006313MA (Direct) | ||
| DE944428C (de) | Verfahren zur Chlorwasserstoffabspaltung aus einem Polychlorcyclohexan | |
| DE2416584C2 (de) | Verfahren zur Herstellung von Squalan | |
| DE2405283C2 (de) | Verfahren zur Herstellung von Phenylacetaldehyd | |
| EP0077537B1 (de) | Verfahren zur Herstellung von 6-Chlor-3-toluidin-4-sulfonsäure | |
| DE1011411B (de) | Verfahren zur Gewinnung reiner tert. Butylbenzoesaeuren | |
| DE2111723C3 (de) | Verfahren zur Herstellung von Methylvinylketon | |
| DE2019261C3 (de) | Verfahren zur Herstellung von Alkanon- oder Cycloalkanon-oximen durch partielle Reduktion von Nitroalkanen oder Nitrocycloalkanen | |
| EP0090277A1 (de) | Verfahren zur Herstellung von 2,2-Dicyclohexenylpropan | |
| AT225691B (de) | Verfahren und Vorrichtung zur Herstellung reiner Kondensationsprodukte des Acetons | |
| DE2426863A1 (de) | Verfahren zur spaltung von cycloaliphatischen hdroperoxiden | |
| DE4203792A1 (de) | Verbessertes verfahren zur herstellung von gegebenenfalls substituierten benzaldehyden | |
| DE1543894C (de) | 2,3-Dimethy 1-5-tert-butylphenol, seine Verwendung und Verfahren zu seiner Herstellung | |
| DE750057C (de) | Verfahren zur Herstellung von Butandiol-1, 4-on-2 | |
| DE3225135A1 (de) | Verfahren zur kontinuierlichen herstellung von methylenbruecken aufweisenden polyarylaminen | |
| DE69129341T2 (de) | Verfahren zur Herstellung von 5-oxohexannitrilen und die Verbindung 2,4-dimethyl-5-oxo-hexannitrile | |
| DE2261616A1 (de) | Verfahren zur herstellung von organischen aldehyden | |
| DE2003600A1 (de) | Verfahren zur Herstellung von Aldolisierungsprodukten aus Isobutyraldehyd und Glyoxal | |
| CH635321A5 (de) | Verfahren zur herstellung von 2,3,3-trimethylindolenin. |